File: | alld2/home/sdobbs/Software/jana/jana_0.8.2/Linux_CentOS7.7-x86_64-gcc4.8.5/include/JANA/JEventLoop.h |
Warning: | line 398, column 7 Null pointer passed to 2nd parameter expecting 'nonnull' |
Press '?' to see keyboard shortcuts
Keyboard shortcuts:
1 | // $Id$ | |||
2 | // | |||
3 | // File: DTrackCandidate_factory_CDC.cc | |||
4 | // Created: Thu Sep 6 14:47:48 EDT 2007 | |||
5 | // Creator: davidl (on Darwin Amelia.local 8.10.1 i386) | |||
6 | // | |||
7 | ||||
8 | #include "DTrackCandidate_factory_CDC.h" | |||
9 | #include <cmath> | |||
10 | #include <JANA/JCalibration.h> | |||
11 | ||||
12 | #define BeamRMS0.5 0.5 | |||
13 | #define EPS1e-3 1e-3 | |||
14 | ||||
15 | #define TWO(c)(0x1u << (c)) (0x1u << (c)) | |||
16 | #define MASK(c)((unsigned int)(-1)) / ((0x1u << ((0x1u << (c)))) + 1u) ((unsigned int)(-1)) / (TWO(TWO(c))(0x1u << ((0x1u << (c)))) + 1u) | |||
17 | #define COUNT(x,c)((x) & ((unsigned int)(-1)) / ((0x1u << ((0x1u << (c)))) + 1u)) + (((x) >> ((0x1u << (c)))) & ( (unsigned int)(-1)) / ((0x1u << ((0x1u << (c)))) + 1u)) ((x) & MASK(c)((unsigned int)(-1)) / ((0x1u << ((0x1u << (c)))) + 1u)) + (((x) >> (TWO(c)(0x1u << (c)))) & MASK(c)((unsigned int)(-1)) / ((0x1u << ((0x1u << (c)))) + 1u)) | |||
18 | ||||
19 | #ifndef M_TWO_PI6.28318530717958647692 | |||
20 | #define M_TWO_PI6.28318530717958647692 6.28318530717958647692 | |||
21 | #endif | |||
22 | ||||
23 | using namespace std; | |||
24 | ||||
25 | inline int bitcount(unsigned int n) | |||
26 | { | |||
27 | n = COUNT(n, 0)((n) & ((unsigned int)(-1)) / ((0x1u << ((0x1u << (0)))) + 1u)) + (((n) >> ((0x1u << (0)))) & ( (unsigned int)(-1)) / ((0x1u << ((0x1u << (0)))) + 1u)); | |||
28 | n = COUNT(n, 1)((n) & ((unsigned int)(-1)) / ((0x1u << ((0x1u << (1)))) + 1u)) + (((n) >> ((0x1u << (1)))) & ( (unsigned int)(-1)) / ((0x1u << ((0x1u << (1)))) + 1u)); | |||
29 | n = COUNT(n, 2)((n) & ((unsigned int)(-1)) / ((0x1u << ((0x1u << (2)))) + 1u)) + (((n) >> ((0x1u << (2)))) & ( (unsigned int)(-1)) / ((0x1u << ((0x1u << (2)))) + 1u)); | |||
30 | n = COUNT(n, 3)((n) & ((unsigned int)(-1)) / ((0x1u << ((0x1u << (3)))) + 1u)) + (((n) >> ((0x1u << (3)))) & ( (unsigned int)(-1)) / ((0x1u << ((0x1u << (3)))) + 1u)); | |||
31 | n = COUNT(n, 4)((n) & ((unsigned int)(-1)) / ((0x1u << ((0x1u << (4)))) + 1u)) + (((n) >> ((0x1u << (4)))) & ( (unsigned int)(-1)) / ((0x1u << ((0x1u << (4)))) + 1u)); | |||
32 | //n = COUNT(n, 5); for 64-bit integers | |||
33 | return n; | |||
34 | } | |||
35 | ||||
36 | inline bool CDCSortByRdecreasing(const DTrackCandidate_factory_CDC::DCDCTrkHit* hit1, const DTrackCandidate_factory_CDC::DCDCTrkHit* hit2) | |||
37 | { | |||
38 | // use the ring number to sort by R(decreasing) and then straw(increasing) | |||
39 | if(hit1->hit->wire->ring == hit2->hit->wire->ring) | |||
40 | return hit1->hit->wire->straw < hit2->hit->wire->straw; | |||
41 | return hit1->hit->wire->ring > hit2->hit->wire->ring; | |||
42 | } | |||
43 | ||||
44 | inline bool CDCSortByChiSqPerNDFDecreasing(const DTrackCandidate_factory_CDC::DCDCTrackCircle* locTrackCircle1, const DTrackCandidate_factory_CDC::DCDCTrackCircle* locTrackCircle2) | |||
45 | { | |||
46 | // largest weighted fit chisq/ndf is first | |||
47 | return (locTrackCircle1->dWeightedChiSqPerDF > locTrackCircle2->dWeightedChiSqPerDF); | |||
48 | } | |||
49 | ||||
50 | inline bool CDCSortByStereoChiSqPerNDFIncreasing(const DTrackCandidate_factory_CDC::DCDCTrackCircle* locTrackCircle1, const DTrackCandidate_factory_CDC::DCDCTrackCircle* locTrackCircle2) | |||
51 | { | |||
52 | // smallest weighted theta/z chisq/ndf is first | |||
53 | return (locTrackCircle1->dWeightedChiSqPerDF_Stereo < locTrackCircle2->dWeightedChiSqPerDF_Stereo); | |||
54 | } | |||
55 | ||||
56 | inline bool CDCSort_Intersections(const DTrackCandidate_factory_CDC::intersection_t& locIntersection1, const DTrackCandidate_factory_CDC::intersection_t& locIntersection2) | |||
57 | { | |||
58 | return (locIntersection1.perp2 < locIntersection2.perp2); | |||
59 | } | |||
60 | ||||
61 | inline bool CDCSort_DeltaPhis(const pair<DTrackCandidate_factory_CDC::DCDCTrkHit*, double>& locDeltaPhiPair1, const pair<DTrackCandidate_factory_CDC::DCDCTrkHit*, double>& locDeltaPhiPair2) | |||
62 | { | |||
63 | //smallest delta-phi is first | |||
64 | return (locDeltaPhiPair1.second < locDeltaPhiPair2.second); | |||
65 | } | |||
66 | ||||
67 | DTrackCandidate_factory_CDC::~DTrackCandidate_factory_CDC(){ | |||
68 | ||||
69 | } | |||
70 | ||||
71 | ||||
72 | //------------------ | |||
73 | // init | |||
74 | //------------------ | |||
75 | jerror_t DTrackCandidate_factory_CDC::init(void) | |||
76 | { | |||
77 | DEBUG_LEVEL = 0; | |||
78 | MAX_DCDCTrkHitPoolSize = 200; | |||
79 | MAX_DCDCSuperLayerSeedPoolSize = 50; | |||
80 | MAX_HelicalFitPoolSize = 100; | |||
81 | MAX_DCDCTrackCirclePoolSize = 100; | |||
82 | ||||
83 | MAX_ALLOWED_CDC_HITS = 10000; | |||
84 | MAX_ALLOWED_TRACK_CIRCLES = 5000; | |||
85 | MAX_HIT_DIST = 4.0; // cm //each straw is 5/8in (1.5875 cm) in diameter | |||
86 | MAX_HIT_DIST2 = MAX_HIT_DIST*MAX_HIT_DIST; | |||
87 | ||||
88 | //when linking DCDCRingSeed's together to form DCDCSuperLayerSeed's, allow skipping of rings | |||
89 | //for example, say there are hits in ring 1 and ring 3, but none in ring 2 because the particle didn't deposit enough energy. | |||
90 | //setting MAX_NUM_RINGSEED_RINGS_SKIPABLE >= 1 will recover these cases | |||
91 | MAX_NUM_RINGSEED_RINGS_SKIPABLE = 1; | |||
92 | ||||
93 | MIN_SEED_HITS = 2; | |||
94 | ||||
95 | // to be labeled as a potential/definite spiral turn (in/out-wards), the following conditions need to be met (where appropriate): | |||
96 | MIN_STRAWS_POTENTIAL_SPIRAL_TURN = 4; //minimum number of straws in a DCDCRingSeed necessary to be labeled as a potential spiral turn (in/out-wards) | |||
97 | MIN_STRAWS_DEFINITE_SPIRAL_TURN = 6; //minimum number of straws in a DCDCRingSeed necessary to be labeled as a definite spiral turn (in/out-wards) | |||
98 | MIN_STRAWS_ADJACENT_TO_SPIRAL_TURN = 3; // in some cases, this is the minimum number of straws in a DCDCRingSeed that is adjacent to the spiral turn (in/out-wards) | |||
99 | // if a spiral turn occurs between rings or outside the CDC, the below is the max # of straws that can be between two DCDCRingSeed's in the adjacent ring | |||
100 | // the two DCDCRingSeed's would be in different super layer seeds | |||
101 | MAX_STRAWS_BETWEEN_LINK_SPIRAL_TURN = 6; | |||
102 | ||||
103 | //within a super layer, if the number of seeds in a region of width SEED_DENSITY_BIN_STRAW_WIDTH is greater than MAX_SEEDS_IN_STRAW_BIN, reject all seeds passing through this region | |||
104 | //note that since the # of straws increases with ring #, the region width is technically computed as a phi region: | |||
105 | //from phi of straw 'N' in the first ring of a given super layer, to the phi of straw 'N + DENSITY_BIN_STRAW_WIDTH - 1' | |||
106 | SEED_DENSITY_BIN_STRAW_WIDTH = 8; | |||
107 | MAX_SEEDS_IN_STRAW_BIN = 15; | |||
108 | ||||
109 | //when true, will allow linking of super layer seeds to skip a super layer (in case there is a dead HV board there) | |||
110 | //note that this feature is not fully tested!! | |||
111 | ENABLE_DEAD_HV_BOARD_LINKING = false; | |||
112 | ||||
113 | //don't allow new track seeds to start after this super layer | |||
114 | //track seeds could start late if track is a decay product, or HV board is dead | |||
115 | //this is to prevent tracks forming that are complete garbage (e.g. a spiral craziness, knockout electrons re-entering the CDC from the BCAL, etc.) | |||
116 | MAX_SUPERLAYER_NEW_TRACK = 4; | |||
117 | ||||
118 | // the maximum # of hits allowed to be shared between the axial super layer seeds of DCDCTrackCircle's | |||
119 | // if > than this amount, the track with the larger circle-fit weighted-chisq/ndf will be rejected | |||
120 | MAX_COMMON_HIT_FRACTION = 0.49; //reject if exactly half | |||
121 | ||||
122 | MAX_DRIFT_TIME = 1000.0; // ns | |||
123 | MAX_SEED_TIME_DIFF = 1000.0; // ns | |||
124 | ||||
125 | // used for identifying arms of a spiral: can be true if the centers of the fit circles are close together (relative to their difference from the origin) | |||
126 | MIN_CIRCLE_ASYMMETRY = 0.10; | |||
127 | ||||
128 | // when calculating the final theta/z, include at least this many stereo hits for the calculation | |||
129 | // don't want to include stereo hits whose projections onto the track circle are too far away | |||
130 | MIN_PRUNED_STEREO_HITS = 4; | |||
131 | ||||
132 | // when searching for unused axial hits to add to the track, require that the hit be within this #-degrees in phi to the circle fit | |||
133 | MAX_UNUSED_HIT_LINK_ANGLE = 10.0; //degrees | |||
134 | ||||
135 | TARGET_Z = 65.0; | |||
136 | VERTEX_Z_MIN = -100.0; | |||
137 | VERTEX_Z_MAX = 200.0; | |||
138 | ||||
139 | cdchits_by_superlayer.resize(7); | |||
140 | dSuperLayerSeeds.resize(7); | |||
141 | for(unsigned int loc_i = 0; loc_i < 7; ++loc_i) | |||
142 | superlayer_boundaries.push_back(4*(1 + loc_i)); | |||
143 | ||||
144 | dNumStrawsPerRing.resize(28); | |||
145 | ||||
146 | dNumSeedDensityPhiBins = 360; | |||
147 | ||||
148 | return NOERROR; | |||
149 | } | |||
150 | ||||
151 | //------------------ | |||
152 | // brun | |||
153 | //------------------ | |||
154 | jerror_t DTrackCandidate_factory_CDC::brun(JEventLoop *locEventLoop, int32_t runnumber) | |||
155 | { | |||
156 | gPARMS->SetDefaultParameter("TRKFIND:DEBUG_LEVEL", DEBUG_LEVEL); | |||
157 | gPARMS->SetDefaultParameter("TRKFIND:MAX_ALLOWED_CDC_HITS", MAX_ALLOWED_CDC_HITS); | |||
158 | gPARMS->SetDefaultParameter("TRKFIND:MAX_ALLOWED_TRACK_CIRCLES", MAX_ALLOWED_TRACK_CIRCLES); | |||
159 | gPARMS->SetDefaultParameter("TRKFIND:MAX_HIT_DIST", MAX_HIT_DIST); | |||
160 | gPARMS->SetDefaultParameter("TRKFIND:MAX_NUM_RINGSEED_RINGS_SKIPABLE", MAX_NUM_RINGSEED_RINGS_SKIPABLE); | |||
161 | gPARMS->SetDefaultParameter("TRKFIND:MIN_SEED_HITS", MIN_SEED_HITS); | |||
162 | gPARMS->SetDefaultParameter("TRKFIND:MIN_STRAWS_POTENTIAL_SPIRAL_TURN", MIN_STRAWS_POTENTIAL_SPIRAL_TURN); | |||
163 | gPARMS->SetDefaultParameter("TRKFIND:MIN_STRAWS_DEFINITE_SPIRAL_TURN", MIN_STRAWS_DEFINITE_SPIRAL_TURN); | |||
164 | gPARMS->SetDefaultParameter("TRKFIND:MIN_STRAWS_ADJACENT_TO_SPIRAL_TURN", MIN_STRAWS_ADJACENT_TO_SPIRAL_TURN); | |||
165 | gPARMS->SetDefaultParameter("TRKFIND:MAX_STRAWS_BETWEEN_LINK_SPIRAL_TURN", MAX_STRAWS_BETWEEN_LINK_SPIRAL_TURN); | |||
166 | gPARMS->SetDefaultParameter("TRKFIND:SEED_DENSITY_BIN_STRAW_WIDTH", SEED_DENSITY_BIN_STRAW_WIDTH); | |||
167 | gPARMS->SetDefaultParameter("TRKFIND:MAX_SEEDS_IN_STRAW_BIN", MAX_SEEDS_IN_STRAW_BIN); | |||
168 | gPARMS->SetDefaultParameter("TRKFIND:ENABLE_DEAD_HV_BOARD_LINKING", ENABLE_DEAD_HV_BOARD_LINKING); | |||
169 | gPARMS->SetDefaultParameter("TRKFIND:MAX_SUPERLAYER_NEW_TRACK", MAX_SUPERLAYER_NEW_TRACK); | |||
170 | gPARMS->SetDefaultParameter("TRKFIND:MAX_COMMON_HIT_FRACTION", MAX_COMMON_HIT_FRACTION); | |||
171 | gPARMS->SetDefaultParameter("TRKFIND:MIN_CIRCLE_ASYMMETRY", MIN_CIRCLE_ASYMMETRY); | |||
172 | gPARMS->SetDefaultParameter("TRKFIND:MAX_DRIFT_TIME", MAX_DRIFT_TIME); | |||
173 | gPARMS->SetDefaultParameter("TRKFIND:MAX_SEED_TIME_DIFF", MAX_SEED_TIME_DIFF); | |||
174 | gPARMS->SetDefaultParameter("TRKFIND:MIN_PRUNED_STEREO_HITS", MIN_PRUNED_STEREO_HITS); | |||
175 | gPARMS->SetDefaultParameter("TRKFIND:MAX_UNUSED_HIT_LINK_ANGLE", MAX_UNUSED_HIT_LINK_ANGLE); | |||
176 | gPARMS->SetDefaultParameter("TRKFIND:VERTEX_Z_MIN", VERTEX_Z_MIN); | |||
177 | gPARMS->SetDefaultParameter("TRKFIND:VERTEX_Z_MAX", VERTEX_Z_MAX); | |||
178 | ||||
179 | MAX_HIT_DIST2 = MAX_HIT_DIST*MAX_HIT_DIST; | |||
180 | ||||
181 | DApplication* locApplication = dynamic_cast<DApplication*>(locEventLoop->GetJApplication()); | |||
182 | dMagneticField = locApplication->GetBfield(runnumber); | |||
183 | dFactorForSenseOfRotation=(dMagneticField->GetBz(0.,0.,65.)>0.)?-1.:1.; | |||
184 | ||||
185 | const DGeometry *locGeometry = locApplication->GetDGeometry(runnumber); | |||
186 | JCalibration *jcalib = locApplication->GetJCalibration(runnumber); | |||
187 | map<string, double> targetparms; | |||
188 | if (jcalib->Get("TARGET/target_parms",targetparms)==false){ | |||
189 | TARGET_Z = targetparms["TARGET_Z_POSITION"]; | |||
190 | } | |||
191 | else{ | |||
192 | locGeometry->GetTargetZ(TARGET_Z); | |||
193 | } | |||
194 | ||||
195 | // Get the CDC wire table from the XML | |||
196 | vector<vector<DCDCWire*> > locCDCWires; | |||
197 | locGeometry->GetCDCWires(locCDCWires); | |||
198 | for(size_t loc_i = 0; loc_i < locCDCWires.size(); ++loc_i) | |||
199 | dNumStrawsPerRing[loc_i] = locCDCWires[loc_i].size(); | |||
200 | ||||
201 | // Clean up after using wire map | |||
202 | for (size_t i=0;i<locCDCWires.size();i++){ | |||
203 | for (size_t j=0;j<locCDCWires[i].size();j++){ | |||
204 | delete locCDCWires[i][j]; | |||
205 | } | |||
206 | } | |||
207 | ||||
208 | return NOERROR; | |||
209 | } | |||
210 | ||||
211 | //------------------ | |||
212 | // evnt | |||
213 | //------------------ | |||
214 | jerror_t DTrackCandidate_factory_CDC::evnt(JEventLoop *locEventLoop, uint64_t eventnumber) | |||
215 | { | |||
216 | // Reset | |||
217 | dRejectedPhiRegions.clear(); | |||
218 | dStereoHitNumUsedMap.clear(); | |||
219 | for(unsigned int loc_i = 0; loc_i < 7; ++loc_i) | |||
220 | dSuperLayerSeeds[loc_i].clear(); | |||
221 | ||||
222 | // Reset in case didn't clear before exiting event evaluation on last event. | |||
223 | Reset_Pools(); | |||
224 | ||||
225 | // Get CDC hits | |||
226 | if(Get_CDCHits(locEventLoop) != NOERROR) | |||
227 | { | |||
228 | Reset_Pools(); | |||
229 | return RESOURCE_UNAVAILABLE; | |||
230 | } | |||
231 | ||||
232 | // Build Super Layer Seeds | |||
233 | for(unsigned int loc_i = 0; loc_i < 7; ++loc_i) | |||
234 | { | |||
235 | if(DEBUG_LEVEL > 3) | |||
236 | cout << "Find Seeds, Super Layer = " << loc_i + 1 << endl; | |||
237 | Find_SuperLayerSeeds(cdchits_by_superlayer[loc_i], loc_i + 1); | |||
238 | Reject_SuperLayerSeeds_HighSeedDensity(loc_i + 1); | |||
239 | } | |||
240 | // Search for Spiral Links in and between super layer seeds | |||
241 | Set_SpiralLinkParams(); | |||
242 | if(DEBUG_LEVEL > 5) | |||
243 | { | |||
244 | cout << "init super layers" << endl; | |||
245 | Print_SuperLayerSeeds(); | |||
246 | } | |||
247 | ||||
248 | // Build DCDCTrackCircle objects (each corresponds to (at most) one track): | |||
249 | vector<DCDCTrackCircle*> locCDCTrackCircles; | |||
250 | bool locStatusFlag = Build_TrackCircles(locCDCTrackCircles); | |||
251 | if(!locStatusFlag) | |||
252 | { | |||
253 | //SHOULD SET JEVENT STATUS BIT HERE!!! | |||
254 | Reset_Pools(); | |||
255 | return OBJECT_NOT_AVAILABLE; | |||
256 | } | |||
257 | if(locCDCTrackCircles.empty()) | |||
258 | { | |||
259 | Reset_Pools(); | |||
260 | return NOERROR; | |||
261 | } | |||
262 | Handle_StereoAndFilter(locCDCTrackCircles, false); //false: not final pass: filter seeds, don't reject seeds with no stereo hits (will add unused below), etc. | |||
263 | ||||
264 | // If the last super layer of a track is not 7, search for lone, unused hits on the next super layer and add them to the track | |||
265 | // Only add them if they are close enough to the track circle fit | |||
266 | Add_UnusedHits(locCDCTrackCircles); | |||
267 | ||||
268 | // using axial on the track, redo the circle fit and re-calc theta-z | |||
269 | // This is for when extra hits are picked up by Add_UnusedHits, and for including midpoints between SL2/SL3 & SL5/SL6 | |||
270 | //fit circles will reject fits if they aren't very good //false: fit all circles //true: add intersections between stereo layers | |||
271 | Fit_Circles(locCDCTrackCircles, false, true); //will reject fits if they aren't very good | |||
272 | if(DEBUG_LEVEL > 5) | |||
273 | { | |||
274 | cout << "final fit track circles" << endl; | |||
275 | Print_TrackCircles(locCDCTrackCircles); | |||
276 | } | |||
277 | stable_sort(locCDCTrackCircles.begin(), locCDCTrackCircles.end(), CDCSortByChiSqPerNDFDecreasing); //sort by circle-fit weighted chisq/ndf (largest first) | |||
278 | ||||
279 | Handle_StereoAndFilter(locCDCTrackCircles, true); //true: final pass: don't need to filter any more, get improved theta-z (although will reject if bad/no theta/z) | |||
280 | if(DEBUG_LEVEL > 5) | |||
281 | { | |||
282 | cout << "final track circles" << endl; | |||
283 | Print_TrackCircles(locCDCTrackCircles); | |||
284 | } | |||
285 | ||||
286 | // Create track candidates (as long as p > 0!!) | |||
287 | for(size_t loc_i = 0; loc_i < locCDCTrackCircles.size(); ++loc_i) | |||
288 | Create_TrackCandidiate(locCDCTrackCircles[loc_i]); | |||
289 | ||||
290 | // Reset memory before exiting event evaluation. | |||
291 | Reset_Pools(); | |||
292 | ||||
293 | return NOERROR; | |||
294 | } | |||
295 | ||||
296 | //------------------ | |||
297 | // Reset_Pools | |||
298 | //------------------ | |||
299 | void DTrackCandidate_factory_CDC::Reset_Pools(void) | |||
300 | { | |||
301 | // delete pool contents if too large, preventing memory-leakage-like behavor. | |||
302 | if(dCDCTrkHitPool_All.size() > MAX_DCDCTrkHitPoolSize) | |||
303 | { | |||
304 | for(size_t loc_i = MAX_DCDCTrkHitPoolSize; loc_i < dCDCTrkHitPool_All.size(); ++loc_i) | |||
305 | delete dCDCTrkHitPool_All[loc_i]; | |||
306 | dCDCTrkHitPool_All.resize(MAX_DCDCTrkHitPoolSize); | |||
307 | } | |||
308 | dCDCTrkHitPool_Available = dCDCTrkHitPool_All; | |||
309 | ||||
310 | if(dCDCSuperLayerSeedPool_All.size() > MAX_DCDCSuperLayerSeedPoolSize) | |||
311 | { | |||
312 | for(size_t loc_i = MAX_DCDCSuperLayerSeedPoolSize; loc_i < dCDCSuperLayerSeedPool_All.size(); ++loc_i) | |||
313 | delete dCDCSuperLayerSeedPool_All[loc_i]; | |||
314 | dCDCSuperLayerSeedPool_All.resize(MAX_DCDCSuperLayerSeedPoolSize); | |||
315 | } | |||
316 | dCDCSuperLayerSeedPool_Available = dCDCSuperLayerSeedPool_All; | |||
317 | ||||
318 | if(dHelicalFitPool_All.size() > MAX_HelicalFitPoolSize) | |||
319 | { | |||
320 | for(unsigned int loc_i = MAX_HelicalFitPoolSize; loc_i < dHelicalFitPool_All.size(); ++loc_i) | |||
321 | delete dHelicalFitPool_All[loc_i]; | |||
322 | dHelicalFitPool_All.resize(MAX_HelicalFitPoolSize); | |||
323 | } | |||
324 | dHelicalFitPool_Available = dHelicalFitPool_All; | |||
325 | ||||
326 | if(dCDCTrackCirclePool_All.size() > MAX_DCDCTrackCirclePoolSize) | |||
327 | { | |||
328 | for(size_t loc_i = MAX_DCDCTrackCirclePoolSize; loc_i < dCDCTrackCirclePool_All.size(); ++loc_i) | |||
329 | delete dCDCTrackCirclePool_All[loc_i]; | |||
330 | dCDCTrackCirclePool_All.resize(MAX_DCDCTrackCirclePoolSize); | |||
331 | } | |||
332 | dCDCTrackCirclePool_Available = dCDCTrackCirclePool_All; | |||
333 | } | |||
334 | ||||
335 | DTrackCandidate_factory_CDC::DCDCTrkHit* DTrackCandidate_factory_CDC::Get_Resource_CDCTrkHit(void) | |||
336 | { | |||
337 | DCDCTrkHit* locCDCTrkHit; | |||
338 | if(dCDCTrkHitPool_Available.empty()) | |||
339 | { | |||
340 | locCDCTrkHit = new DCDCTrkHit; | |||
341 | dCDCTrkHitPool_All.push_back(locCDCTrkHit); | |||
342 | } | |||
343 | else | |||
344 | { | |||
345 | locCDCTrkHit = dCDCTrkHitPool_Available.back(); | |||
346 | dCDCTrkHitPool_Available.pop_back(); | |||
347 | } | |||
348 | locCDCTrkHit->Reset(); | |||
349 | return locCDCTrkHit; | |||
350 | } | |||
351 | ||||
352 | DTrackCandidate_factory_CDC::DCDCSuperLayerSeed* DTrackCandidate_factory_CDC::Get_Resource_CDCSuperLayerSeed(void) | |||
353 | { | |||
354 | DCDCSuperLayerSeed* locCDCSuperLayerSeed; | |||
355 | if(dCDCSuperLayerSeedPool_Available.empty()) | |||
356 | { | |||
357 | locCDCSuperLayerSeed = new DCDCSuperLayerSeed; | |||
358 | dCDCSuperLayerSeedPool_All.push_back(locCDCSuperLayerSeed); | |||
359 | } | |||
360 | else | |||
361 | { | |||
362 | locCDCSuperLayerSeed = dCDCSuperLayerSeedPool_Available.back(); | |||
363 | dCDCSuperLayerSeedPool_Available.pop_back(); | |||
364 | } | |||
365 | locCDCSuperLayerSeed->Reset(); | |||
366 | return locCDCSuperLayerSeed; | |||
367 | } | |||
368 | ||||
369 | DHelicalFit* DTrackCandidate_factory_CDC::Get_Resource_HelicalFit(void) | |||
370 | { | |||
371 | DHelicalFit* locHelicalFit; | |||
372 | if(dHelicalFitPool_Available.empty()) | |||
373 | { | |||
374 | locHelicalFit = new DHelicalFit; | |||
375 | dHelicalFitPool_All.push_back(locHelicalFit); | |||
376 | } | |||
377 | else | |||
378 | { | |||
379 | locHelicalFit = dHelicalFitPool_Available.back(); | |||
380 | dHelicalFitPool_Available.pop_back(); | |||
381 | } | |||
382 | locHelicalFit->Reset(); | |||
383 | return locHelicalFit; | |||
384 | } | |||
385 | ||||
386 | DTrackCandidate_factory_CDC::DCDCTrackCircle* DTrackCandidate_factory_CDC::Get_Resource_CDCTrackCircle(void) | |||
387 | { | |||
388 | DCDCTrackCircle* locCDCTrackCircle; | |||
389 | if(dCDCTrackCirclePool_Available.empty()) | |||
390 | { | |||
391 | locCDCTrackCircle = new DCDCTrackCircle; | |||
392 | dCDCTrackCirclePool_All.push_back(locCDCTrackCircle); | |||
393 | } | |||
394 | else | |||
395 | { | |||
396 | locCDCTrackCircle = dCDCTrackCirclePool_Available.back(); | |||
397 | dCDCTrackCirclePool_Available.pop_back(); | |||
398 | } | |||
399 | locCDCTrackCircle->Reset(); | |||
400 | return locCDCTrackCircle; | |||
401 | } | |||
402 | ||||
403 | //------------------ | |||
404 | // Get_CDCHits | |||
405 | //------------------ | |||
406 | jerror_t DTrackCandidate_factory_CDC::Get_CDCHits(JEventLoop* loop) | |||
407 | { | |||
408 | // Get the "raw" hits. These already have the wire associated with them. | |||
409 | vector<const DCDCTrackHit*> cdctrackhits; | |||
410 | loop->Get(cdctrackhits); | |||
| ||||
411 | dNumCDCHits = cdctrackhits.size(); | |||
412 | ||||
413 | // If there are no hits, then bail now | |||
414 | if(cdctrackhits.empty()) | |||
415 | return RESOURCE_UNAVAILABLE; | |||
416 | ||||
417 | // If there are too many hits, bail with a warning message | |||
418 | if(cdctrackhits.size() > MAX_ALLOWED_CDC_HITS) | |||
419 | { | |||
420 | cout << "Too many hits in CDC (" <<cdctrackhits.size() << ", max = " << MAX_ALLOWED_CDC_HITS << ")! Track finding in CDC bypassed for event " << loop->GetJEvent().GetEventNumber() << endl; | |||
421 | cdctrackhits.clear(); | |||
422 | return UNRECOVERABLE_ERROR; | |||
423 | } | |||
424 | ||||
425 | // clear old hits | |||
426 | cdctrkhits.clear(); | |||
427 | for(unsigned int i = 0; i < cdchits_by_superlayer.size(); i++) | |||
428 | cdchits_by_superlayer[i].clear(); | |||
429 | ||||
430 | // Create DCDCTrkHit objects out of these. | |||
431 | int oldwire = -1; | |||
432 | for(size_t i = 0; i< cdctrackhits.size(); ++i) | |||
433 | { | |||
434 | // Add to "master" list | |||
435 | // ONLY FIRST HIT OF A WIRE | |||
436 | int newwire = cdctrackhits[i]->wire->ring*1000 + cdctrackhits[i]->wire->straw; | |||
437 | if(newwire == oldwire) | |||
438 | continue; | |||
439 | oldwire = newwire; | |||
440 | ||||
441 | if(DEBUG_LEVEL > 40) | |||
442 | cout << "adding ring, straw = " << cdctrackhits[i]->wire->ring << ", " << cdctrackhits[i]->wire->straw << endl; | |||
443 | ||||
444 | // Add to "master" list | |||
445 | DCDCTrkHit* cdctrkhit = Get_Resource_CDCTrkHit(); | |||
446 | cdctrkhit->index = i; | |||
447 | cdctrkhit->hit = cdctrackhits[i]; | |||
448 | cdctrkhit->flags = NONE; | |||
449 | cdctrkhit->flags |= NOISE; // (see below) | |||
450 | cdctrkhits.push_back(cdctrkhit); | |||
451 | ||||
452 | // Sort into list of hits by superlayer | |||
453 | for(size_t j = 0; j < superlayer_boundaries.size(); ++j) | |||
454 | { | |||
455 | if(cdctrkhit->hit->wire->ring <= int(superlayer_boundaries[j])) | |||
456 | { | |||
457 | cdchits_by_superlayer[j].push_back(cdctrkhit); | |||
458 | break; | |||
459 | } | |||
460 | } | |||
461 | } | |||
462 | ||||
463 | // Sort the individual superlayer lists by decreasing values of R | |||
464 | for(size_t i = 0; i < cdchits_by_superlayer.size(); ++i) | |||
465 | stable_sort(cdchits_by_superlayer[i].begin(), cdchits_by_superlayer[i].end(), CDCSortByRdecreasing); | |||
466 | ||||
467 | // Filter out noise hits. All hits are initially flagged as "noise". | |||
468 | // Hits with a neighbor within MAX_HIT_DIST have their noise flags cleared. | |||
469 | // Also flag hits as out-of-time if their drift time is too large | |||
470 | for(size_t i = 0; i < cdctrkhits.size(); ++i) | |||
471 | { | |||
472 | DCDCTrkHit *trkhit1 = cdctrkhits[i]; | |||
473 | if(trkhit1->hit->tdrift > MAX_DRIFT_TIME) | |||
474 | trkhit1->flags |= OUT_OF_TIME; | |||
475 | if(!(trkhit1->flags & NOISE)) | |||
476 | continue; // this hit already not marked for noise | |||
477 | for(size_t j = 0; j < cdctrkhits.size(); ++j) | |||
478 | { | |||
479 | if(j == i) | |||
480 | continue; | |||
481 | double d2 = trkhit1->Dist2(cdctrkhits[j]); | |||
482 | if(d2 > 9.0*MAX_HIT_DIST2) | |||
483 | continue; | |||
484 | trkhit1->flags &= ~NOISE; | |||
485 | cdctrkhits[j]->flags &= ~NOISE; | |||
486 | break; | |||
487 | } | |||
488 | } | |||
489 | ||||
490 | return NOERROR; | |||
491 | } | |||
492 | ||||
493 | /*********************************************************************************************************************************************************************/ | |||
494 | /********************************************************************** BUILD SUPER LAYER SEEDS **********************************************************************/ | |||
495 | /*********************************************************************************************************************************************************************/ | |||
496 | ||||
497 | //--------------------- | |||
498 | // Find_SuperLayerSeeds | |||
499 | //--------------------- | |||
500 | void DTrackCandidate_factory_CDC::Find_SuperLayerSeeds(vector<DCDCTrkHit*>& locSuperLayerHits, unsigned int locSuperLayer) | |||
501 | { | |||
502 | // Sort through hits ring by ring to find DCDCRingSeed's from neighboring wires in the same ring. | |||
503 | // What we want is a list of DCDCRingSeed's for each ring, which will then be combined to form DCDCSuperLayerSeeds | |||
504 | // Each DCDCRingSeed is a list of adjacent hits ordered by straw number. | |||
505 | // If a DCDCRingSeed crosses the straw = 1 barrier: | |||
506 | // Then the first hit is the smallest straw with phi > pi, and the last hit is the largest straw with phi < pi | |||
507 | ||||
508 | // Clear DCDCSuperLayerSeed's | |||
509 | vector<DCDCSuperLayerSeed*>& locSuperLayerSeeds = dSuperLayerSeeds[locSuperLayer - 1]; | |||
510 | locSuperLayerSeeds.clear(); | |||
511 | ||||
512 | DCDCRingSeed locCDCRingSeed; | |||
513 | vector<DCDCRingSeed> locCDCRingSeeds; //list of DCDCRingSeed's in a given ring | |||
514 | vector<vector<DCDCRingSeed> > rings; //1st dimension is ring, 2nd dimension is DCDCRingSeed's in that ring | |||
515 | int last_ring = -1; | |||
516 | ||||
517 | for(size_t i = 0; i < locSuperLayerHits.size(); ++i) | |||
518 | { | |||
519 | DCDCTrkHit *trkhit = locSuperLayerHits[i]; | |||
520 | if(DEBUG_LEVEL > 20) | |||
521 | cout << "track hit ring, straw = " << trkhit->hit->wire->ring << ", " << trkhit->hit->wire->straw << endl; | |||
522 | ||||
523 | // Check if ring number has changed. | |||
524 | if(trkhit->hit->wire->ring != last_ring) | |||
525 | { | |||
526 | if(DEBUG_LEVEL > 20) | |||
527 | cout << "new ring, last ring = " << trkhit->hit->wire->ring << ", " << last_ring << endl; | |||
528 | //ring # has changed: save the current DCDCRingSeed (from the previous ring) (if not empty) | |||
529 | if(!locCDCRingSeed.hits.empty()) | |||
530 | locCDCRingSeeds.push_back(locCDCRingSeed); | |||
531 | //if > 1 DCDCRingSeed on the previous ring: compare first and last DCDCRingSeeds | |||
532 | //if they are adjacent (extending through the straw = 1 boundary): merge DCDCRingSeeds | |||
533 | if(locCDCRingSeeds.size() > 1) | |||
534 | { | |||
535 | unsigned int locMinStraw = locCDCRingSeeds[0].hits[0]->hit->wire->straw; | |||
536 | unsigned int locMaxStraw = locCDCRingSeeds[locCDCRingSeeds.size() - 1].hits[locCDCRingSeeds[locCDCRingSeeds.size() - 1].hits.size() - 1]->hit->wire->straw; | |||
537 | unsigned int locNumStrawsInRing = dNumStrawsPerRing[locCDCRingSeeds[0].hits[0]->hit->wire->ring - 1]; | |||
538 | if((locMinStraw + locNumStrawsInRing - locMaxStraw) <= 1) //merge ringseeds | |||
539 | { | |||
540 | if(DEBUG_LEVEL > 20) | |||
541 | cout << "straw boundary: merge ringseeds" << endl; | |||
542 | locCDCRingSeeds[0].hits.insert(locCDCRingSeeds[0].hits.begin(), locCDCRingSeeds[locCDCRingSeeds.size() - 1].hits.begin(), locCDCRingSeeds[locCDCRingSeeds.size() - 1].hits.end()); | |||
543 | //insert at beginning: straws now arranged as: ..., N - 2, N - 1, N, 1, 2, 3, ... | |||
544 | locCDCRingSeeds.pop_back(); | |||
545 | } | |||
546 | } | |||
547 | //if there was at least one DCDCRingSeed found on the previous ring, save it in the 2d vector | |||
548 | if(!locCDCRingSeeds.empty()) | |||
549 | rings.push_back(locCDCRingSeeds); | |||
550 | if(DEBUG_LEVEL > 3) | |||
551 | cout << " ringseed hits:" << locCDCRingSeed.hits.size() << " locCDCRingSeeds:" << locCDCRingSeeds.size() << endl; | |||
552 | //reset for finding the next group of hits | |||
553 | locCDCRingSeeds.clear(); | |||
554 | locCDCRingSeed.hits.clear(); | |||
555 | //save this hit and continue | |||
556 | locCDCRingSeed.hits.push_back(trkhit); | |||
557 | locCDCRingSeed.ring = trkhit->hit->wire->ring; | |||
558 | locCDCRingSeed.linked = false; | |||
559 | last_ring = trkhit->hit->wire->ring; | |||
560 | continue; | |||
561 | } | |||
562 | ||||
563 | // Check if this hit is a neighbor of the last hit added to the ringseed | |||
564 | if((unsigned int)abs(locCDCRingSeed.hits[locCDCRingSeed.hits.size() - 1]->hit->wire->straw - trkhit->hit->wire->straw) > 1) | |||
565 | { | |||
566 | //not a neighbor: save old and create new ringseed | |||
567 | if(DEBUG_LEVEL > 20) | |||
568 | cout << "straw diff" << endl; | |||
569 | if(!locCDCRingSeed.hits.empty()) | |||
570 | locCDCRingSeeds.push_back(locCDCRingSeed); | |||
571 | if(DEBUG_LEVEL > 3) | |||
572 | cout << "ringseed hits: " << locCDCRingSeed.hits.size() << endl; | |||
573 | locCDCRingSeed.hits.clear(); | |||
574 | locCDCRingSeed.linked = false; | |||
575 | } | |||
576 | ||||
577 | locCDCRingSeed.hits.push_back(trkhit); | |||
578 | if(DEBUG_LEVEL > 20) | |||
579 | cout << "push back hit straw = " << trkhit->hit->wire->straw << endl; | |||
580 | } | |||
581 | //save final seeds, check if need to merge | |||
582 | if(!locCDCRingSeed.hits.empty()) | |||
583 | locCDCRingSeeds.push_back(locCDCRingSeed); | |||
584 | if(locCDCRingSeeds.size() > 1) | |||
585 | { | |||
586 | //compare first and last ringseeds: if ringseed extends through straw boundary, merge ringseeds | |||
587 | unsigned int locMinStraw = locCDCRingSeeds[0].hits[0]->hit->wire->straw; | |||
588 | unsigned int locMaxStraw = locCDCRingSeeds[locCDCRingSeeds.size() - 1].hits[locCDCRingSeeds[locCDCRingSeeds.size() - 1].hits.size() - 1]->hit->wire->straw; | |||
589 | unsigned int locNumStrawsInRing = dNumStrawsPerRing[locCDCRingSeeds[0].hits[0]->hit->wire->ring - 1]; | |||
590 | if((locMinStraw + locNumStrawsInRing - locMaxStraw) <= 1) //merge ringseeds | |||
591 | { | |||
592 | if(DEBUG_LEVEL > 20) | |||
593 | cout << "straw boundary: merge ringseeds" << endl; | |||
594 | locCDCRingSeeds[0].hits.insert(locCDCRingSeeds[0].hits.begin(), locCDCRingSeeds[locCDCRingSeeds.size() - 1].hits.begin(), locCDCRingSeeds[locCDCRingSeeds.size() - 1].hits.end()); | |||
595 | //insert at beginning: straws now arranged as: ..., N - 2, N - 1, N, 1, 2, 3, ... | |||
596 | locCDCRingSeeds.pop_back(); | |||
597 | } | |||
598 | } | |||
599 | if(!locCDCRingSeeds.empty()) | |||
600 | rings.push_back(locCDCRingSeeds); | |||
601 | if(DEBUG_LEVEL > 3) | |||
602 | cout << " ringseed hits:" << locCDCRingSeed.hits.size() << " ringseeds:" << locCDCRingSeeds.size() << endl; | |||
603 | if(DEBUG_LEVEL > 3) | |||
604 | cout << "rings: " << rings.size() << endl; | |||
605 | ||||
606 | // Print all DCDCRingSeeds to screen | |||
607 | if(DEBUG_LEVEL > 45) | |||
608 | { | |||
609 | for(size_t i = 0; i < rings.size(); ++i) | |||
610 | { | |||
611 | for(size_t k = 0; k < rings[i].size(); ++k) | |||
612 | { | |||
613 | cout << "hits for ringseed ring, seed indices " << i << ", " << k << ":" << endl; | |||
614 | for(size_t j = 0; j < rings[i][k].hits.size(); ++j) | |||
615 | cout << "wire ring, straw = " << rings[i][k].hits[j]->hit->wire->ring << ", " << rings[i][k].hits[j]->hit->wire->straw << endl; | |||
616 | } | |||
617 | } | |||
618 | } | |||
619 | ||||
620 | // If we have no rings, then there must be no super layer seeds. Bail now. | |||
621 | if(rings.empty()) | |||
622 | return; | |||
623 | ||||
624 | // Loop over rings, creating DCDCSuperLayerSeed's from adjacent rings | |||
625 | for(ringiter ring = rings.begin(); ring != rings.end(); ++ring) | |||
626 | { | |||
627 | vector<DCDCRingSeed>& locCDCRingSeeds = *ring; | |||
628 | ringiter next_ring = ring; | |||
629 | ++next_ring; | |||
630 | ||||
631 | // Loop over ringseeds of this ring | |||
632 | for(size_t j = 0; j < locCDCRingSeeds.size(); ++j) | |||
633 | { | |||
634 | if(locCDCRingSeeds[j].linked) | |||
635 | continue; | |||
636 | ||||
637 | // This ringseed hasn't been used in a DCDCSuperLayerSeed yet. Start a new seed with it. | |||
638 | vector<DCDCRingSeed*> parent; | |||
639 | parent.push_back(&locCDCRingSeeds[j]); | |||
640 | Link_RingSeeds(parent, next_ring, rings.end(), locSuperLayer, 0); | |||
641 | } | |||
642 | } | |||
643 | ||||
644 | // Set wire orientations | |||
645 | for(size_t loc_i = 0; loc_i < locSuperLayerSeeds.size(); ++loc_i) | |||
646 | { | |||
647 | locSuperLayerSeeds[loc_i]->dSuperLayer = locSuperLayer; | |||
648 | locSuperLayerSeeds[loc_i]->dSeedIndex = loc_i; | |||
649 | if((locSuperLayer == 7) || (locSuperLayer == 4) || (locSuperLayer == 1)) | |||
650 | locSuperLayerSeeds[loc_i]->dWireOrientation = WIRE_DIRECTION_AXIAL; | |||
651 | else if((locSuperLayer == 2) || (locSuperLayer == 6)) | |||
652 | locSuperLayerSeeds[loc_i]->dWireOrientation = WIRE_DIRECTION_STEREOLEFT; | |||
653 | else | |||
654 | locSuperLayerSeeds[loc_i]->dWireOrientation = WIRE_DIRECTION_STEREORIGHT; | |||
655 | } | |||
656 | } | |||
657 | ||||
658 | //--------------- | |||
659 | // Link_RingSeeds | |||
660 | //--------------- | |||
661 | void DTrackCandidate_factory_CDC::Link_RingSeeds(vector<DCDCRingSeed*>& parent, ringiter ring, ringiter ringend, unsigned int locSuperLayer, unsigned int locNumPreviousRingsWithoutHit) | |||
662 | { | |||
663 | /// Combine DCDCRingSeed's from rings into DCDCSuperLayerSeed's | |||
664 | /// | |||
665 | /// This a a re-entrant routine (i.e. it calls itself recursively). Upon | |||
666 | /// entry, <i>parent</i> contains a list of pointers to all of the ringseeds | |||
667 | /// from the rings outside of <i>ring</i> that are to be combined into | |||
668 | /// a seed. This will search through all ringseeds of <i>ring</i> and if | |||
669 | /// any are found that can extend the parent, a copy of parent is made, | |||
670 | /// the current ringseed of this ring is added to it, and then it is | |||
671 | /// passed on to another call to this routine. If no matches are found, | |||
672 | /// then it will try skipping a ring to find matches (if enabled). | |||
673 | /// If still no matches are found (which will be the case for the outer-most ring), then | |||
674 | /// the ringseeds in <i>parent</i> will be combined into a single DCDCSuperLayerSeed. | |||
675 | ||||
676 | // Make sure parent has at least one ringseed | |||
677 | if(parent.empty()) | |||
678 | { | |||
679 | cout << "parent has no ringseeds!!" << endl; | |||
680 | return; | |||
681 | } | |||
682 | ||||
683 | // Set flag to keep track of whether this is the end of the seed or not | |||
684 | bool seed_extended = false; | |||
685 | if(ring != ringend) | |||
686 | { | |||
687 | // Last ringseed in parent list is the one we need to compare to | |||
688 | DCDCRingSeed *parent_ringseed = parent[parent.size() - 1]; | |||
689 | double r_parent = parent_ringseed->hits[0]->hit->wire->origin.Perp(); | |||
690 | ||||
691 | // Loop over ringseeds in this ring | |||
692 | vector<DCDCRingSeed> &locCDCRingSeeds = (*ring); | |||
693 | ++ring; // increment ring iterator to point to next level down in case we recall ouself below | |||
694 | ||||
695 | for(size_t i = 0; i < locCDCRingSeeds.size(); ++i) | |||
696 | { | |||
697 | // Calculate the transverse (to the beamline) distance between the two DCDCRingSeed's | |||
698 | double dr = r_parent - locCDCRingSeeds[i].hits[0]->hit->wire->origin.Perp(); | |||
699 | double locTransverseDist2 = fabs(MinDist2(locCDCRingSeeds[i], *parent_ringseed) - dr*dr); | |||
700 | // Check if this ringseed is close enough to the parent's to link them together | |||
701 | if(DEBUG_LEVEL > 20) | |||
702 | cout << "ring1, ring2, locTransverseDist2, MAX_HIT_DIST2, dr*dr = " << locCDCRingSeeds[i].hits[0]->hit->wire->ring << ", " << parent_ringseed->hits[0]->hit->wire->ring << ", " << locTransverseDist2 << ", " << MAX_HIT_DIST2 << ", " << dr*dr << endl; | |||
703 | if(locTransverseDist2 < MAX_HIT_DIST2) | |||
704 | { | |||
705 | // link them together | |||
706 | vector<DCDCRingSeed*> myparent = parent; | |||
707 | myparent.push_back(&locCDCRingSeeds[i]); | |||
708 | locCDCRingSeeds[i].linked = true; | |||
709 | // recursive call: try to link this grouping of DCDCRingSeed's to a DCDCRingSeed in the next ring | |||
710 | Link_RingSeeds(myparent, ring, ringend, locSuperLayer, 0); | |||
711 | seed_extended = true; | |||
712 | } | |||
713 | } | |||
714 | if((!seed_extended) && (locNumPreviousRingsWithoutHit < MAX_NUM_RINGSEED_RINGS_SKIPABLE)) | |||
715 | { | |||
716 | // no link was found, but try to skip this ring and find a match in the next ring | |||
717 | Link_RingSeeds(parent, ring, ringend, locSuperLayer, locNumPreviousRingsWithoutHit + 1); | |||
718 | seed_extended = true; | |||
719 | } | |||
720 | } | |||
721 | ||||
722 | // Check if this is the end of the line. | |||
723 | if(!seed_extended) | |||
724 | { | |||
725 | // This is the end of this seed. | |||
726 | // Check if this seed contains a spiral. | |||
727 | int locSpiralRingIndex = -1; | |||
728 | for(size_t i = 0; i < parent.size(); ++i) | |||
729 | { | |||
730 | if(parent[i]->hits.size() < MIN_STRAWS_DEFINITE_SPIRAL_TURN) | |||
731 | continue; | |||
732 | locSpiralRingIndex = i; | |||
733 | break; | |||
734 | } | |||
735 | ||||
736 | // Check whether this seed is an obvious intersection of two tracks (with one of them a spiral) | |||
737 | bool locSeparateSeedsFlag = false; | |||
738 | if((locSpiralRingIndex != -1) && (parent.size() > 1)) | |||
739 | { | |||
740 | double locAvgNumHitsInNonSpiralRing = 0.0; | |||
741 | for(size_t i = 0; i < parent.size(); ++i) | |||
742 | { | |||
743 | if(int(i) == locSpiralRingIndex) | |||
744 | continue; | |||
745 | locAvgNumHitsInNonSpiralRing += parent[i]->hits.size(); | |||
746 | } | |||
747 | locAvgNumHitsInNonSpiralRing /= double(parent.size() - 1); | |||
748 | if(locAvgNumHitsInNonSpiralRing < 2) | |||
749 | locSeparateSeedsFlag = true; | |||
750 | } | |||
751 | ||||
752 | //if obvious intersection: save spiral ring-seed separately | |||
753 | if(locSeparateSeedsFlag && (parent[locSpiralRingIndex]->hits.size() >= MIN_SEED_HITS)) | |||
754 | { | |||
755 | DCDCSuperLayerSeed* locSuperLayerSeed = Get_Resource_CDCSuperLayerSeed(); | |||
756 | for(size_t loc_i = 0; loc_i < parent[locSpiralRingIndex]->hits.size(); ++loc_i) | |||
757 | parent[locSpiralRingIndex]->hits[loc_i]->flags |= USED; | |||
758 | dSuperLayerSeeds[locSuperLayer - 1].push_back(locSuperLayerSeed); | |||
759 | locSuperLayerSeed->dCDCRingSeeds.push_back(*(parent[locSpiralRingIndex])); | |||
760 | } | |||
761 | ||||
762 | //save normal seed if enough hits | |||
763 | unsigned int locTotalNumHits = 0; | |||
764 | for(size_t i = 0; i < parent.size(); ++i) | |||
765 | { | |||
766 | if((int(i) == locSpiralRingIndex) && locSeparateSeedsFlag) | |||
767 | continue; | |||
768 | locTotalNumHits += parent[i]->hits.size(); | |||
769 | } | |||
770 | if(locTotalNumHits < MIN_SEED_HITS) | |||
771 | { | |||
772 | if(DEBUG_LEVEL > 10) | |||
773 | cout << "rejecting seed due to too few hits (have " << locTotalNumHits << " need " << MIN_SEED_HITS << ")" << endl; | |||
774 | return; | |||
775 | } | |||
776 | ||||
777 | DCDCSuperLayerSeed* locSuperLayerSeed = Get_Resource_CDCSuperLayerSeed(); | |||
778 | for(size_t i = 0; i < parent.size(); ++i) | |||
779 | { | |||
780 | if((int(i) == locSpiralRingIndex) && locSeparateSeedsFlag) | |||
781 | continue; | |||
782 | locSuperLayerSeed->dCDCRingSeeds.insert(locSuperLayerSeed->dCDCRingSeeds.begin(), *(parent[i])); //input rings were in reverse order!! | |||
783 | for(size_t loc_j = 0; loc_j < parent[i]->hits.size(); ++loc_j) | |||
784 | parent[i]->hits[loc_j]->flags |= USED; | |||
785 | } | |||
786 | dSuperLayerSeeds[locSuperLayer - 1].push_back(locSuperLayerSeed); | |||
787 | } | |||
788 | } | |||
789 | ||||
790 | //--------- | |||
791 | // MinDist2 | |||
792 | //--------- | |||
793 | double DTrackCandidate_factory_CDC::MinDist2(const DCDCRingSeed& locInnerRingSeed, const DCDCRingSeed& locOuterRingSeed) | |||
794 | { | |||
795 | const vector<DCDCTrkHit*>& locInnerSeedHits = locInnerRingSeed.hits; | |||
796 | const vector<DCDCTrkHit*>& locOuterSeedHits = locOuterRingSeed.hits; | |||
797 | return MinDist2(locInnerSeedHits, locOuterSeedHits); | |||
798 | } | |||
799 | ||||
800 | //--------- | |||
801 | // MinDist2 | |||
802 | //--------- | |||
803 | double DTrackCandidate_factory_CDC::MinDist2(const vector<DCDCTrkHit*>& locInnerSeedHits, const vector<DCDCTrkHit*>& locOuterSeedHits) | |||
804 | { | |||
805 | /// Returns the minimum distance squared between the two seeds. Assumes all of the hits in a given set are on the same ring. | |||
806 | /// First it checks if the two seeds overlap in phi: if so, then the radial difference between the rings (squared) is returned. | |||
807 | /// Otherwise, only the first and last hits of the adjacent rings between each seed's hit list are used. | |||
808 | /// to calculate a maximum of 4 distances (minimum of 1), of which the smallest is returned. | |||
809 | if(locInnerSeedHits.empty() || locOuterSeedHits.empty()) | |||
810 | { | |||
811 | cout << "Number of seed hits 0! (Ninner = " << locInnerSeedHits.size() << " ,Nouter = " << locOuterSeedHits.size() << ")" << endl; | |||
812 | return 1.0E10; | |||
813 | } | |||
814 | ||||
815 | DCDCTrkHit* locInnermostRingFirstStrawHit = locInnerSeedHits.front(); | |||
816 | DCDCTrkHit* locInnermostRingLastStrawHit = locInnerSeedHits.back(); | |||
817 | DCDCTrkHit* locOutermostRingFirstStrawHit = locOuterSeedHits.front(); | |||
818 | DCDCTrkHit* locOutermostRingLastStrawHit = locOuterSeedHits.back(); | |||
819 | ||||
820 | //see if seeds overlap in phi | |||
821 | float locInnermostRingFirstStrawPhi = locInnermostRingFirstStrawHit->hit->wire->phi; | |||
822 | float locInnermostRingLastStrawPhi = locInnermostRingLastStrawHit->hit->wire->phi; | |||
823 | float locOutermostRingFirstStrawPhi = locOutermostRingFirstStrawHit->hit->wire->phi; | |||
824 | float locOutermostRingLastStrawPhi = locOutermostRingLastStrawHit->hit->wire->phi; | |||
825 | if(DEBUG_LEVEL > 100) | |||
826 | cout << "inner ring: ring, first/last straws & phis = " << locInnermostRingFirstStrawHit->hit->wire->ring << ", " << locInnermostRingFirstStrawHit->hit->wire->straw << ", " << locInnermostRingLastStrawHit->hit->wire->straw << ", " << locInnermostRingFirstStrawPhi << ", " << locInnermostRingLastStrawPhi << endl; | |||
827 | if(DEBUG_LEVEL > 100) | |||
828 | cout << "outer ring: ring, first/last straws & phis = " << locOutermostRingFirstStrawHit->hit->wire->ring << ", " << locOutermostRingFirstStrawHit->hit->wire->straw << ", " << locOutermostRingLastStrawHit->hit->wire->straw << ", " << locOutermostRingFirstStrawPhi << ", " << locOutermostRingLastStrawPhi << endl; | |||
829 | ||||
830 | //account for phi = 0/2pi boundary | |||
831 | bool locInnerRingCrossesBoundaryFlag = (locInnermostRingLastStrawPhi < locInnermostRingFirstStrawPhi); | |||
832 | bool locOuterRingCrossesBoundaryFlag = (locOutermostRingLastStrawPhi < locOutermostRingFirstStrawPhi); | |||
833 | if(DEBUG_LEVEL > 100) | |||
834 | cout << "in/out boundary flags = " << locInnerRingCrossesBoundaryFlag << ", " << locOuterRingCrossesBoundaryFlag << endl; | |||
835 | if(locOuterRingCrossesBoundaryFlag) | |||
836 | locOutermostRingLastStrawPhi += M_TWO_PI6.28318530717958647692; | |||
837 | if(locInnerRingCrossesBoundaryFlag) | |||
838 | locInnermostRingLastStrawPhi += M_TWO_PI6.28318530717958647692; | |||
839 | if(locOuterRingCrossesBoundaryFlag & (!locInnerRingCrossesBoundaryFlag) && ((locOutermostRingLastStrawPhi - locInnermostRingLastStrawPhi) > M_PI3.14159265358979323846)) | |||
840 | { | |||
841 | locInnermostRingFirstStrawPhi += M_TWO_PI6.28318530717958647692; | |||
842 | locInnermostRingLastStrawPhi += M_TWO_PI6.28318530717958647692; | |||
843 | } | |||
844 | if(locInnerRingCrossesBoundaryFlag & (!locOuterRingCrossesBoundaryFlag) && ((locInnermostRingLastStrawPhi - locOutermostRingLastStrawPhi) > M_PI3.14159265358979323846)) | |||
845 | { | |||
846 | locOutermostRingFirstStrawPhi += M_TWO_PI6.28318530717958647692; | |||
847 | locOutermostRingLastStrawPhi += M_TWO_PI6.28318530717958647692; | |||
848 | } | |||
849 | ||||
850 | if(DEBUG_LEVEL > 100) | |||
851 | cout << "final inner ring: ring, first/last straws & phis = " << locInnermostRingFirstStrawHit->hit->wire->ring << ", " << locInnermostRingFirstStrawHit->hit->wire->straw << ", " << locInnermostRingLastStrawHit->hit->wire->straw << ", " << locInnermostRingFirstStrawPhi << ", " << locInnermostRingLastStrawPhi << endl; | |||
852 | if(DEBUG_LEVEL > 100) | |||
853 | cout << "final outer ring: ring, first/last straws & phis = " << locOutermostRingFirstStrawHit->hit->wire->ring << ", " << locOutermostRingFirstStrawHit->hit->wire->straw << ", " << locOutermostRingLastStrawHit->hit->wire->straw << ", " << locOutermostRingFirstStrawPhi << ", " << locOutermostRingLastStrawPhi << endl; | |||
854 | ||||
855 | //finally check for overlaps | |||
856 | double dr = locOutermostRingLastStrawHit->hit->wire->origin.Perp() - locInnermostRingFirstStrawHit->hit->wire->origin.Perp(); | |||
857 | if((locOutermostRingFirstStrawPhi >= locInnermostRingFirstStrawPhi) && (locOutermostRingFirstStrawPhi <= locInnermostRingLastStrawPhi)) | |||
858 | return dr*dr; | |||
859 | if((locOutermostRingLastStrawPhi >= locInnermostRingFirstStrawPhi) && (locOutermostRingLastStrawPhi <= locInnermostRingLastStrawPhi)) | |||
860 | return dr*dr; | |||
861 | if((locInnermostRingFirstStrawPhi >= locOutermostRingFirstStrawPhi) && (locInnermostRingFirstStrawPhi <= locOutermostRingLastStrawPhi)) | |||
862 | return dr*dr; //4th case not needed. this case only needed if innermost ring is one wire across | |||
863 | ||||
864 | //no overlap, make all 4 comparisons between hits | |||
865 | double d2, d2min; | |||
866 | d2min = locInnermostRingFirstStrawHit->Dist2(locOutermostRingFirstStrawHit); | |||
867 | if(locOutermostRingFirstStrawHit != locOutermostRingLastStrawHit) | |||
868 | { | |||
869 | d2 = locInnermostRingFirstStrawHit->Dist2(locOutermostRingLastStrawHit); | |||
870 | if(d2 < d2min) | |||
871 | d2min = d2; | |||
872 | } | |||
873 | if(locInnermostRingFirstStrawHit == locInnermostRingLastStrawHit) | |||
874 | return d2min; | |||
875 | ||||
876 | d2 = locInnermostRingLastStrawHit->Dist2(locOutermostRingFirstStrawHit); | |||
877 | if(d2 < d2min) | |||
878 | d2min = d2; | |||
879 | if(locOutermostRingFirstStrawHit != locOutermostRingLastStrawHit) | |||
880 | { | |||
881 | d2 = locInnermostRingLastStrawHit->Dist2(locOutermostRingLastStrawHit); | |||
882 | if(d2 < d2min) | |||
883 | d2min = d2; | |||
884 | } | |||
885 | ||||
886 | return d2min; | |||
887 | } | |||
888 | ||||
889 | //--------------------------------------- | |||
890 | // Reject_SuperLayerSeeds_HighSeedDensity | |||
891 | //--------------------------------------- | |||
892 | void DTrackCandidate_factory_CDC::Reject_SuperLayerSeeds_HighSeedDensity(unsigned int locSuperLayer) | |||
893 | { | |||
894 | //The track finding algorithm will grind to a halt if there are too many super layer seeds in a given area | |||
895 | //e.g. A slow spiral pion that loses energy very slowly will loop around many, many times before stopping, | |||
896 | //sometimes resulting in 40+ super layer seeds in a given super layer. | |||
897 | //Therefore, if the density of super layer seeds in a given region is too high, reject all super layer seeds passing through that region of space, except for the ones on the edges | |||
898 | //It will be impossible to determine track parameters in these regions anyway, so may as well reject them. | |||
899 | ||||
900 | if(SEED_DENSITY_BIN_STRAW_WIDTH == 0) | |||
901 | return; //rejection disabled | |||
902 | ||||
903 | vector<DCDCSuperLayerSeed*>& locSuperLayerSeeds = dSuperLayerSeeds[locSuperLayer - 1]; | |||
904 | if(locSuperLayerSeeds.size() <= MAX_SEEDS_IN_STRAW_BIN) | |||
905 | return; //not enough for there to even possibly be an issue | |||
906 | ||||
907 | // histogram phis of all seeds within this super layer | |||
908 | // We use a simple array to store our histogram here. We don't want to use ROOT histograms because they are not thread safe. | |||
909 | // Setup histogram | |||
910 | unsigned int hist[dNumSeedDensityPhiBins]; | |||
911 | for(unsigned int i = 0; i < dNumSeedDensityPhiBins; ++i) | |||
912 | hist[i] = 0; // clear histogram | |||
913 | double bin_width = M_TWO_PI6.28318530717958647692/(double)dNumSeedDensityPhiBins; | |||
914 | double hist_low_limit = 0.0; // lower edge of histogram limits | |||
915 | ||||
916 | //Find phi ranges of super layer seeds: store in map & histogram them | |||
917 | map<unsigned int, pair<double, double> > locMapPhiRanges; //key is seed index, pair is phi range (first/last) //first > last if passes through phi = 0 boundary | |||
918 | for(size_t loc_i = 0; loc_i < locSuperLayerSeeds.size(); ++loc_i) | |||
919 | { | |||
920 | double locSeedFirstPhi, locSeedLastPhi; | |||
921 | Calc_SuperLayerPhiRange(locSuperLayerSeeds[loc_i], locSeedFirstPhi, locSeedLastPhi); | |||
922 | locMapPhiRanges[locSuperLayerSeeds[loc_i]->dSeedIndex] = pair<double, double>(locSeedFirstPhi, locSeedLastPhi); | |||
923 | if(DEBUG_LEVEL > 20) | |||
924 | cout << "super layer, seed index, first phi, last phi = " << locSuperLayer << ", " << locSuperLayerSeeds[loc_i]->dSeedIndex << ", " << locSeedFirstPhi << ", " << locSeedLastPhi << endl; | |||
925 | ||||
926 | unsigned int locFirstPhiBin = (unsigned int)((locSeedFirstPhi - hist_low_limit)/bin_width); | |||
927 | unsigned int locLastPhiBin = (unsigned int)((locSeedLastPhi - hist_low_limit)/bin_width); | |||
928 | for(unsigned int locPhiBin = locFirstPhiBin; locPhiBin <= locLastPhiBin; ++locPhiBin) | |||
929 | ++hist[locPhiBin]; | |||
930 | } | |||
931 | ||||
932 | //determine search window size: | |||
933 | unsigned int locOuterRing = superlayer_boundaries[locSuperLayer - 1]; | |||
934 | unsigned int locAverageNumStrawsInRing = (dNumStrawsPerRing[locOuterRing - 4] + dNumStrawsPerRing[locOuterRing - 1])/2; //I know it floored; it's close enough | |||
935 | double locSearchBinPhiSize = double(SEED_DENSITY_BIN_STRAW_WIDTH)*M_TWO_PI6.28318530717958647692/double(locAverageNumStrawsInRing); | |||
936 | ||||
937 | //find the search start point: try to start somewhere where there are no seeds for a range that is at least as large as the window; else start at 0 | |||
938 | int locStartPhiBin = -1; | |||
939 | for(unsigned int locPhiBin = 0; locPhiBin < dNumSeedDensityPhiBins; ++locPhiBin) | |||
940 | { | |||
941 | if(hist[locPhiBin] > 0) | |||
942 | { | |||
943 | locStartPhiBin = -1; | |||
944 | continue; | |||
945 | } | |||
946 | if(locStartPhiBin == -1) | |||
947 | locStartPhiBin = locPhiBin; | |||
948 | else if((locPhiBin - locStartPhiBin) > locSearchBinPhiSize) | |||
949 | break; | |||
950 | } | |||
951 | if(locStartPhiBin == -1) | |||
952 | locStartPhiBin = 0; | |||
953 | ||||
954 | // loop over phi range, scanning with a window of size "locSearchBinPhiSize," finding where the density of seeds is too high and marking those seeds for rejection | |||
955 | set<unsigned int> locSeedsToReject; | |||
956 | for(unsigned int locPhiBin = 0; locPhiBin < dNumSeedDensityPhiBins; ++locPhiBin) | |||
957 | { | |||
958 | unsigned int locReadPhiBin = locStartPhiBin + locPhiBin; | |||
959 | if(locReadPhiBin >= dNumSeedDensityPhiBins) | |||
960 | locReadPhiBin -= dNumSeedDensityPhiBins; | |||
961 | ||||
962 | double locWindowPhiRangeMin = hist_low_limit + bin_width*(double(locReadPhiBin)); | |||
963 | if(locWindowPhiRangeMin >= M_TWO_PI6.28318530717958647692) | |||
964 | locWindowPhiRangeMin -= M_TWO_PI6.28318530717958647692; | |||
965 | double locWindowPhiRangeMax = locWindowPhiRangeMin + locSearchBinPhiSize; | |||
966 | ||||
967 | map<unsigned int, pair<double, double> >::const_iterator locSeedIterator = locMapPhiRanges.begin(); | |||
968 | vector<unsigned int> locSeedsInThisRange; | |||
969 | for(; locSeedIterator != locMapPhiRanges.end(); ++locSeedIterator) | |||
970 | { | |||
971 | double locSeedPhiRangeMin = locSeedIterator->second.first; | |||
972 | double locSeedPhiRangeMax = locSeedIterator->second.second; | |||
973 | if(Check_IfPhiRangesOverlap(locSeedPhiRangeMin, locSeedPhiRangeMax, locWindowPhiRangeMin, locWindowPhiRangeMax)) | |||
974 | locSeedsInThisRange.push_back(locSeedIterator->first); | |||
975 | } | |||
976 | if(locSeedsInThisRange.size() <= MAX_SEEDS_IN_STRAW_BIN) | |||
977 | continue; | |||
978 | ||||
979 | //mark these seeds for deletion | |||
980 | for(size_t loc_i = 0; loc_i < locSeedsInThisRange.size(); ++loc_i) | |||
981 | locSeedsToReject.insert(locSeedsInThisRange[loc_i]); | |||
982 | } | |||
983 | ||||
984 | //loop over seeds marked for rejection: keep the first and last seeds of each group | |||
985 | //ignore phi = 0 barrier for now | |||
986 | //also, mark phi regions as bad | |||
987 | set<unsigned int>::const_iterator locRejectIterator = locSeedsToReject.begin(); | |||
988 | int locBeginIndex = -1, locPreviousIndex = 0, locFirstIndex = 0, locEndIndex = 0; | |||
989 | set<unsigned int> locSeedsToNotReject; | |||
990 | for(; locRejectIterator != locSeedsToReject.end(); ++locRejectIterator) | |||
991 | { | |||
992 | unsigned int locCurrentIndex = *locRejectIterator; | |||
993 | if(DEBUG_LEVEL > 15) | |||
994 | cout << "Marked for rejection: super layer, seed index = " << locSuperLayer << ", " << locCurrentIndex << endl; | |||
995 | if(locBeginIndex == -1) | |||
996 | { | |||
997 | locFirstIndex = locCurrentIndex; | |||
998 | locBeginIndex = locCurrentIndex; | |||
999 | locSeedsToNotReject.insert(locBeginIndex); | |||
1000 | if(DEBUG_LEVEL > 15) | |||
1001 | cout << "don't reject: " << locBeginIndex << endl; | |||
1002 | } | |||
1003 | if(DEBUG_LEVEL > 30) | |||
1004 | cout << "window size, current phis, previous phis = " << locSearchBinPhiSize << ", " << locMapPhiRanges[locCurrentIndex].first << ", " << locMapPhiRanges[locCurrentIndex].second << ", " << locMapPhiRanges[locPreviousIndex].first << ", " << locMapPhiRanges[locPreviousIndex].second << endl; | |||
1005 | if(Check_IfPhiRangesOverlap(locMapPhiRanges[locCurrentIndex].first, locMapPhiRanges[locCurrentIndex].second, locMapPhiRanges[locPreviousIndex].first, locMapPhiRanges[locPreviousIndex].second + locSearchBinPhiSize)) | |||
1006 | { | |||
1007 | locPreviousIndex = locCurrentIndex; | |||
1008 | locEndIndex = locCurrentIndex; | |||
1009 | continue; | |||
1010 | } | |||
1011 | if(Check_IfPhiRangesOverlap(locMapPhiRanges[locCurrentIndex].first, locMapPhiRanges[locCurrentIndex].second, locMapPhiRanges[locPreviousIndex].first - locSearchBinPhiSize, locMapPhiRanges[locPreviousIndex].second)) | |||
1012 | { | |||
1013 | locPreviousIndex = locCurrentIndex; | |||
1014 | locEndIndex = locCurrentIndex; | |||
1015 | continue; | |||
1016 | } | |||
1017 | ||||
1018 | //seed isn't within locSearchBinPhiSize of previous seed: edge | |||
1019 | if(DEBUG_LEVEL > 15) | |||
1020 | cout << "Unmark for rejection: super layer, seed indexes = " << locSuperLayer << ", " << locBeginIndex << ", " << locPreviousIndex << endl; | |||
1021 | ||||
1022 | //too many seeds in this region: in future super layers, don't assume unmatched seeds in this region are new tracks | |||
1023 | dRejectedPhiRegions[locSuperLayer - 1].push_back(pair<double, double>(locMapPhiRanges[locBeginIndex].first, locMapPhiRanges[locPreviousIndex].second)); | |||
1024 | ||||
1025 | locSeedsToNotReject.insert(locPreviousIndex); | |||
1026 | locSeedsToNotReject.insert(locCurrentIndex); //beginning of new section | |||
1027 | locBeginIndex = locCurrentIndex; | |||
1028 | locPreviousIndex = locCurrentIndex; | |||
1029 | locEndIndex = locCurrentIndex; | |||
1030 | } | |||
1031 | locSeedsToNotReject.insert(locEndIndex); //don't reject the last one //will check overlap below | |||
1032 | ||||
1033 | if(DEBUG_LEVEL > 30) | |||
1034 | cout << "first phis, last phis = " << locMapPhiRanges[locFirstIndex].first << ", " << locMapPhiRanges[locFirstIndex].second << ", " << locMapPhiRanges[locEndIndex].first << ", " << locMapPhiRanges[locEndIndex].second << endl; | |||
1035 | ||||
1036 | //check to see if last overlaps with first //overlap across phi = 0 barrier | |||
1037 | if(Check_IfPhiRangesOverlap(locMapPhiRanges[locFirstIndex].first, locMapPhiRanges[locFirstIndex].second, locMapPhiRanges[locEndIndex].first, locMapPhiRanges[locEndIndex].second)) | |||
1038 | { | |||
1039 | if(DEBUG_LEVEL > 15) | |||
1040 | cout << "re-reject first/last = " << locFirstIndex << ", " << locEndIndex << endl; | |||
1041 | //do reject them | |||
1042 | locSeedsToNotReject.erase(locFirstIndex); | |||
1043 | locSeedsToNotReject.erase(locEndIndex); | |||
1044 | } | |||
1045 | ||||
1046 | ||||
1047 | // reject (and recycle) the seeds in areas where the seeds were too dense | |||
1048 | for(vector<DCDCSuperLayerSeed*>::iterator locvectorIterator = locSuperLayerSeeds.begin(); locvectorIterator != locSuperLayerSeeds.end();) | |||
1049 | { | |||
1050 | unsigned int locSeedIndex = (*locvectorIterator)->dSeedIndex; | |||
1051 | if((locSeedsToReject.find(locSeedIndex) != locSeedsToReject.end()) && (locSeedsToNotReject.find(locSeedIndex) == locSeedsToNotReject.end())) | |||
1052 | { | |||
1053 | if(DEBUG_LEVEL > 10) | |||
1054 | cout << "seed density too high, reject seed: " << locSeedIndex << endl; | |||
1055 | dCDCSuperLayerSeedPool_Available.push_back(*locvectorIterator); //recycle memory | |||
1056 | locvectorIterator = locSuperLayerSeeds.erase(locvectorIterator); | |||
1057 | } | |||
1058 | else | |||
1059 | ++locvectorIterator; | |||
1060 | } | |||
1061 | } | |||
1062 | ||||
1063 | //------------------------ | |||
1064 | // Calc_SuperLayerPhiRange | |||
1065 | //------------------------ | |||
1066 | void DTrackCandidate_factory_CDC::Calc_SuperLayerPhiRange(DCDCSuperLayerSeed* locSuperLayerSeed, double& locSeedFirstPhi, double& locSeedLastPhi) | |||
1067 | { | |||
1068 | // Calculate the phi-range across which the DCDCSuperLayerSeed extends. | |||
1069 | locSeedFirstPhi = 9.9E9; | |||
1070 | locSeedLastPhi = -9.9E9; | |||
1071 | for(size_t loc_j = 0; loc_j < locSuperLayerSeed->dCDCRingSeeds.size(); ++loc_j) | |||
1072 | { | |||
1073 | if (locSuperLayerSeed->dCDCRingSeeds[loc_j].hits.empty()) continue; | |||
1074 | DCDCTrkHit *locFirstStrawHit = locSuperLayerSeed->dCDCRingSeeds[loc_j].hits.front(); | |||
1075 | DCDCTrkHit *locLastStrawHit = locSuperLayerSeed->dCDCRingSeeds[loc_j].hits.back(); | |||
1076 | ||||
1077 | double locRingFirstPhi = locFirstStrawHit->hit->wire->phi; | |||
1078 | if(locRingFirstPhi < 0.0) | |||
1079 | locRingFirstPhi += M_TWO_PI6.28318530717958647692; | |||
1080 | double locRingLastPhi = locLastStrawHit->hit->wire->phi; | |||
1081 | if(locRingLastPhi < 0.0) | |||
1082 | locRingLastPhi += M_TWO_PI6.28318530717958647692; | |||
1083 | if(loc_j == 0) | |||
1084 | { | |||
1085 | locSeedFirstPhi = locRingFirstPhi; | |||
1086 | locSeedLastPhi = locRingLastPhi; | |||
1087 | continue; | |||
1088 | } | |||
1089 | ||||
1090 | if(locSeedFirstPhi > locSeedLastPhi) //seed goes across phi = 0 boundary | |||
1091 | { | |||
1092 | if(locRingFirstPhi > locRingLastPhi) //ring goes across phi = 0 boundary | |||
1093 | { | |||
1094 | if(locRingFirstPhi < locSeedFirstPhi) | |||
1095 | locSeedFirstPhi = locRingFirstPhi; | |||
1096 | if(locRingLastPhi > locSeedLastPhi) | |||
1097 | locSeedLastPhi = locRingLastPhi; | |||
1098 | } | |||
1099 | else | |||
1100 | { | |||
1101 | if((locRingFirstPhi > M_PI3.14159265358979323846) && (locRingFirstPhi < locSeedFirstPhi)) | |||
1102 | locSeedFirstPhi = locRingFirstPhi; | |||
1103 | else if((locRingLastPhi < M_PI3.14159265358979323846) && (locRingLastPhi > locSeedLastPhi)) | |||
1104 | locSeedLastPhi = locRingLastPhi; | |||
1105 | } | |||
1106 | } | |||
1107 | else //seed does not (so far) go across phi = 0 boundary | |||
1108 | { | |||
1109 | if(locRingFirstPhi > locRingLastPhi) //ring goes across phi = 0 boundary | |||
1110 | { | |||
1111 | locSeedFirstPhi = locRingFirstPhi; | |||
1112 | if(locRingLastPhi > locSeedLastPhi) | |||
1113 | locSeedLastPhi = locRingLastPhi; | |||
1114 | } | |||
1115 | else | |||
1116 | { | |||
1117 | if(locRingFirstPhi < locSeedFirstPhi) | |||
1118 | locSeedFirstPhi = locRingFirstPhi; | |||
1119 | if(locRingLastPhi > locSeedLastPhi) | |||
1120 | locSeedLastPhi = locRingLastPhi; | |||
1121 | } | |||
1122 | } | |||
1123 | } | |||
1124 | } | |||
1125 | ||||
1126 | //------------------------- | |||
1127 | // Check_IfPhiRangesOverlap | |||
1128 | //------------------------- | |||
1129 | bool DTrackCandidate_factory_CDC::Check_IfPhiRangesOverlap(double locFirstSeedPhi, double locLastSeedPhi, double locTargetFirstPhi, double locTargetLastPhi) | |||
1130 | { | |||
1131 | //if first phi > last phi 2nd, then it extends through the phi = 0 boundary | |||
1132 | if(locFirstSeedPhi > locLastSeedPhi) //seed extends through phi = 0 boundary | |||
1133 | { | |||
1134 | if(locTargetFirstPhi > locTargetLastPhi) //hist range extends through phi = 0 boundary | |||
1135 | return true; //clearly both intersect: both cross phi = 0 | |||
1136 | else | |||
1137 | { | |||
1138 | //S: F---|---L | |||
1139 | //H: FXXXL | FXXXL | |||
1140 | if(locTargetLastPhi > locFirstSeedPhi) | |||
1141 | return true; | |||
1142 | else if(locTargetFirstPhi < locLastSeedPhi) | |||
1143 | return true; | |||
1144 | } | |||
1145 | } | |||
1146 | else //seed does not extend through phi = 0 boundary | |||
1147 | { | |||
1148 | if(locTargetFirstPhi > locTargetLastPhi) //hist range extends through phi = 0 boundary | |||
1149 | { | |||
1150 | //H: F---|---L | |||
1151 | //S: FXXXL | FXXXL | |||
1152 | if(locLastSeedPhi > locTargetFirstPhi) | |||
1153 | return true; | |||
1154 | else if(locFirstSeedPhi < locTargetLastPhi) | |||
1155 | return true; | |||
1156 | } | |||
1157 | else | |||
1158 | { | |||
1159 | if((locTargetFirstPhi > locFirstSeedPhi) && (locTargetFirstPhi < locLastSeedPhi)) | |||
1160 | return true; | |||
1161 | else if((locTargetLastPhi > locFirstSeedPhi) && (locTargetLastPhi < locLastSeedPhi)) | |||
1162 | return true; | |||
1163 | else if((locFirstSeedPhi > locTargetFirstPhi) && (locFirstSeedPhi < locTargetLastPhi)) | |||
1164 | return true; | |||
1165 | } | |||
1166 | } | |||
1167 | return false; | |||
1168 | } | |||
1169 | ||||
1170 | /*********************************************************************************************************************************************************************/ | |||
1171 | /********************************************************************** SEARCH FOR SPIRAL LINKS **********************************************************************/ | |||
1172 | /*********************************************************************************************************************************************************************/ | |||
1173 | ||||
1174 | //--------------------- | |||
1175 | // Set_SpiralLinkParams | |||
1176 | //--------------------- | |||
1177 | void DTrackCandidate_factory_CDC::Set_SpiralLinkParams(void) | |||
1178 | { | |||
1179 | // Search for Spiral Links within and between super layer seeds | |||
1180 | //don't worry about getting every case: it's better to have extra particles reconstructed than to be overzealous and lose some!! | |||
1181 | for(size_t loc_i = 0; loc_i < dSuperLayerSeeds.size(); ++loc_i) | |||
1182 | { | |||
1183 | vector<DCDCSuperLayerSeed*>& locSuperLayerSeeds = dSuperLayerSeeds[loc_i]; | |||
1184 | for(size_t loc_j = 0; loc_j < locSuperLayerSeeds.size(); ++loc_j) | |||
1185 | { | |||
1186 | for(size_t loc_k = loc_j + 1; loc_k < locSuperLayerSeeds.size(); ++loc_k) | |||
1187 | { | |||
1188 | if(SearchFor_SpiralTurn_TwoSeedsSharingManyHits(locSuperLayerSeeds[loc_j], locSuperLayerSeeds[loc_k])) | |||
1189 | continue; | |||
1190 | if(SearchFor_SpiralTurn_TwoSeedsSharingFewHits(locSuperLayerSeeds[loc_j], locSuperLayerSeeds[loc_k])) | |||
1191 | continue; | |||
1192 | if(SearchFor_SpiralTurn_MissingOrBetweenRings(locSuperLayerSeeds[loc_j], locSuperLayerSeeds[loc_k])) | |||
1193 | continue; | |||
1194 | } | |||
1195 | // if this super layer seed has not yet been linked to any other seed, check to see if itself is the spiral turn | |||
1196 | // e.g. only (and many) hits in one ring of super-layer 7. | |||
1197 | if(locSuperLayerSeeds[loc_j]->dSpiralLinkParams.empty()) //empty if not identified as a spiral yet | |||
1198 | SearchFor_SpiralTurn_SingleSeed(locSuperLayerSeeds[loc_j]); | |||
1199 | } | |||
1200 | } | |||
1201 | } | |||
1202 | ||||
1203 | //--------------------------------------------- | |||
1204 | // SearchFor_SpiralTurn_TwoSeedsSharingManyHits | |||
1205 | //--------------------------------------------- | |||
1206 | bool DTrackCandidate_factory_CDC::SearchFor_SpiralTurn_TwoSeedsSharingManyHits(DCDCSuperLayerSeed* locSuperLayerSeed1, DCDCSuperLayerSeed* locSuperLayerSeed2) | |||
1207 | { | |||
1208 | //check if two seeds share at least MIN_STRAWS_POTENTIAL_SPIRAL_TURN on the same ring | |||
1209 | ||||
1210 | int locMaxSpiralNumHits = 0; //can have more than one potential spiral turn on a seed: could have two tracks (or two spiral arms) turning near each other | |||
1211 | //search all rings: spiral turn may not be on outermost ring if two tracks are crossing | |||
1212 | for(size_t loc_i = 0; loc_i < locSuperLayerSeed1->dCDCRingSeeds.size(); ++loc_i) | |||
1213 | { | |||
1214 | int locRing = locSuperLayerSeed1->dCDCRingSeeds[loc_i].ring; | |||
1215 | if(!locSuperLayerSeed1->Are_AllHitsOnRingShared(locSuperLayerSeed2, locRing)) | |||
1216 | continue; //the hits on this ring aren't the same in both DCDCSuperLayerSeed's | |||
1217 | int locLocalRingNumber = (locRing - 1)%4 + 1; //ranges from 1 -> 4 //ring of super layer | |||
1218 | ||||
1219 | // find how many straws are in this ring | |||
1220 | int locNumHits = locSuperLayerSeed1->dCDCRingSeeds[loc_i].hits.size(); | |||
1221 | if(locNumHits < locMaxSpiralNumHits) | |||
1222 | continue; //already found a potential spiral link in this seed with a > # of straws | |||
1223 | ||||
1224 | if(locNumHits >= int(MIN_STRAWS_POTENTIAL_SPIRAL_TURN)) | |||
1225 | { | |||
1226 | // check to make sure the hits on the first and last rings (in this super layer) of both DCDCSuperLayerSeed's aren't identical | |||
1227 | //if so, then if there truly is a spiral, this is the wrong combination of DCDCSuperLayerSeed's for it | |||
1228 | int locFirstRing1 = locSuperLayerSeed1->dCDCRingSeeds.front().ring; | |||
1229 | int locFirstRing2 = locSuperLayerSeed2->dCDCRingSeeds.front().ring; | |||
1230 | int locLastRing1 = locSuperLayerSeed1->dCDCRingSeeds.back().ring; | |||
1231 | int locLastRing2 = locSuperLayerSeed2->dCDCRingSeeds.back().ring; | |||
1232 | if((locFirstRing1 == locFirstRing2) && (locLastRing1 == locLastRing2)) | |||
1233 | { | |||
1234 | if(locSuperLayerSeed1->Are_AllHitsOnRingShared(locSuperLayerSeed2, locFirstRing1) && locSuperLayerSeed1->Are_AllHitsOnRingShared(locSuperLayerSeed2, locLastRing1)) | |||
1235 | continue; | |||
1236 | } | |||
1237 | ||||
1238 | int locTempSpiralNumHits = 0; | |||
1239 | if((locLocalRingNumber != 1) && (locLocalRingNumber != 4)) | |||
1240 | { | |||
1241 | //spiral turn is not on an edge ring, it is on one of the two middle rings instead: there must also be MIN_STRAWS_ADJACENT_TO_SPIRAL_TURN hits in an adjacent ring | |||
1242 | //if spiral turn was on an edge ring, there may be many hits in the adjacent ring that is in another super layer, so can't do this check | |||
1243 | if(!SearchFor_SpiralTurn_ManyHitsAdjacentRing(locSuperLayerSeed1, locSuperLayerSeed2, locRing + 1, MIN_STRAWS_ADJACENT_TO_SPIRAL_TURN, locTempSpiralNumHits)) | |||
1244 | { | |||
1245 | if(!SearchFor_SpiralTurn_ManyHitsAdjacentRing(locSuperLayerSeed1, locSuperLayerSeed2, locRing - 1, MIN_STRAWS_ADJACENT_TO_SPIRAL_TURN, locTempSpiralNumHits)) | |||
1246 | continue; //not a spiral turn: there was only a few straws on the adjacent rings //perhaps this was two nearby tracks instead | |||
1247 | } | |||
1248 | } | |||
1249 | ||||
1250 | // is potential spiral turn, save results | |||
1251 | locMaxSpiralNumHits = locNumHits; | |||
1252 | DSpiralParams_t locSpiralTurnParams; | |||
1253 | //try to determine whether the track is turning inwards or outwards in this ring | |||
1254 | int locSpiralTurnRingFlag = 0; | |||
1255 | if(locSuperLayerSeed1->dCDCRingSeeds.size() == 1) | |||
1256 | locSpiralTurnRingFlag = ((locRing - 1)%4 > 1) ? 1 : -1; | |||
1257 | else if(loc_i == 0) | |||
1258 | locSpiralTurnRingFlag = -1; //turn on innermost ring | |||
1259 | else if(loc_i == (locSuperLayerSeed1->dCDCRingSeeds.size() - 1)) | |||
1260 | locSpiralTurnRingFlag = 1; //turn on outermost ring | |||
1261 | else if(locSuperLayerSeed1->dCDCRingSeeds[loc_i + 1].hits.size() > locSuperLayerSeed1->dCDCRingSeeds[loc_i - 1].hits.size()) | |||
1262 | locSpiralTurnRingFlag = -1; //more hits on outer ring than inner ring: turn on innermost ring | |||
1263 | else | |||
1264 | locSpiralTurnRingFlag = 1; //turn on outermost ring (if hit vector sizes are equal, assume outermost) | |||
1265 | locSpiralTurnParams.dSpiralTurnRingFlag = locSpiralTurnRingFlag; | |||
1266 | locSpiralTurnParams.dSpiralTurnRing = locRing; | |||
1267 | locSpiralTurnParams.dDefiniteSpiralTurnRingFlag = (locNumHits >= int(MIN_STRAWS_DEFINITE_SPIRAL_TURN)) ? locSpiralTurnRingFlag : 0; | |||
1268 | locSuperLayerSeed1->dSpiralLinkParams[locSuperLayerSeed2->dSeedIndex] = locSpiralTurnParams; | |||
1269 | locSuperLayerSeed2->dSpiralLinkParams[locSuperLayerSeed1->dSeedIndex] = locSpiralTurnParams; | |||
1270 | if(DEBUG_LEVEL > 10) | |||
1271 | cout << "SL" << locSuperLayerSeed1->dSuperLayer << " Seed" << locSuperLayerSeed1->dSeedIndex << " Spiral-linked to SL" << locSuperLayerSeed2->dSuperLayer << " Seed" << locSuperLayerSeed2->dSeedIndex << ": Share Many Hits, Ring = " << locRing << endl; | |||
1272 | } | |||
1273 | } | |||
1274 | return (locMaxSpiralNumHits > 0); | |||
1275 | } | |||
1276 | ||||
1277 | //-------------------------------------------- | |||
1278 | // SearchFor_SpiralTurn_TwoSeedsSharingFewHits | |||
1279 | //-------------------------------------------- | |||
1280 | bool DTrackCandidate_factory_CDC::SearchFor_SpiralTurn_TwoSeedsSharingFewHits(DCDCSuperLayerSeed* locSuperLayerSeed1, DCDCSuperLayerSeed* locSuperLayerSeed2) | |||
1281 | { | |||
1282 | // check if: two seeds share a few hits on a given ring, and at least one has very many (unshared) hits on an adjacent ring: spiral turn | |||
1283 | ||||
1284 | int locMaxSpiralNumHits = 0; //can have more than one potential spiral turn on a seed: could have two tracks (or two spiral arms) turning near each other | |||
1285 | for(size_t loc_i = 0; loc_i < locSuperLayerSeed1->dCDCRingSeeds.size(); ++loc_i) | |||
1286 | { | |||
1287 | int locRing = locSuperLayerSeed1->dCDCRingSeeds[loc_i].ring; | |||
1288 | if(!locSuperLayerSeed1->Are_AllHitsOnRingShared(locSuperLayerSeed2, locRing)) | |||
1289 | continue; | |||
1290 | ||||
1291 | //check locRing - 1 for many hits: check if track is turning back inwards | |||
1292 | int locTempSpiralNumHits = -2; | |||
1293 | if(SearchFor_SpiralTurn_ManyHitsAdjacentRing(locSuperLayerSeed1, locSuperLayerSeed2, locRing - 1, MIN_STRAWS_POTENTIAL_SPIRAL_TURN, locTempSpiralNumHits)) | |||
1294 | { | |||
1295 | //is potential spiral turn | |||
1296 | if(locTempSpiralNumHits > locMaxSpiralNumHits) | |||
1297 | { | |||
1298 | locMaxSpiralNumHits = locTempSpiralNumHits; | |||
1299 | DSpiralParams_t locSpiralTurnParams; | |||
1300 | int locSpiralTurnRingFlag = 1; //turning inwards | |||
1301 | locSpiralTurnParams.dSpiralTurnRingFlag = locSpiralTurnRingFlag; | |||
1302 | locSpiralTurnParams.dSpiralTurnRing = locRing; | |||
1303 | bool locIsDefiniteSpiralTurn = (locTempSpiralNumHits > int(MIN_STRAWS_DEFINITE_SPIRAL_TURN)); | |||
1304 | locSpiralTurnParams.dDefiniteSpiralTurnRingFlag = locIsDefiniteSpiralTurn ? locSpiralTurnRingFlag : 0; | |||
1305 | locSuperLayerSeed1->dSpiralLinkParams[locSuperLayerSeed2->dSeedIndex] = locSpiralTurnParams; | |||
1306 | locSuperLayerSeed2->dSpiralLinkParams[locSuperLayerSeed1->dSeedIndex] = locSpiralTurnParams; | |||
1307 | if(DEBUG_LEVEL > 10) | |||
1308 | cout << "SL" << locSuperLayerSeed1->dSuperLayer << " Seed" << locSuperLayerSeed1->dSeedIndex << " Spiral-linked to SL" << locSuperLayerSeed2->dSuperLayer << " Seed" << locSuperLayerSeed2->dSeedIndex << ": Share Few Hits, Ring = " << locRing << endl; | |||
1309 | } | |||
1310 | } | |||
1311 | ||||
1312 | //check locRing + 1 for many hits: check if track is turning back outwards | |||
1313 | locTempSpiralNumHits = -2; | |||
1314 | if(SearchFor_SpiralTurn_ManyHitsAdjacentRing(locSuperLayerSeed1, locSuperLayerSeed2, locRing + 1, MIN_STRAWS_POTENTIAL_SPIRAL_TURN, locTempSpiralNumHits)) | |||
1315 | { | |||
1316 | //is potential spiral turn | |||
1317 | if(locTempSpiralNumHits > locMaxSpiralNumHits) | |||
1318 | { | |||
1319 | locMaxSpiralNumHits = locTempSpiralNumHits; | |||
1320 | DSpiralParams_t locSpiralTurnParams; | |||
1321 | int locSpiralTurnRingFlag = -1; //turning outwards | |||
1322 | locSpiralTurnParams.dSpiralTurnRingFlag = locSpiralTurnRingFlag; | |||
1323 | locSpiralTurnParams.dSpiralTurnRing = locRing; | |||
1324 | bool locIsDefiniteSpiralTurn = (locTempSpiralNumHits > int(MIN_STRAWS_DEFINITE_SPIRAL_TURN)); | |||
1325 | locSpiralTurnParams.dDefiniteSpiralTurnRingFlag = locIsDefiniteSpiralTurn ? locSpiralTurnRingFlag : 0; | |||
1326 | locSuperLayerSeed1->dSpiralLinkParams[locSuperLayerSeed2->dSeedIndex] = locSpiralTurnParams; | |||
1327 | locSuperLayerSeed2->dSpiralLinkParams[locSuperLayerSeed1->dSeedIndex] = locSpiralTurnParams; | |||
1328 | if(DEBUG_LEVEL > 10) | |||
1329 | cout << "SL" << locSuperLayerSeed1->dSuperLayer << " Seed" << locSuperLayerSeed1->dSeedIndex << " Spiral-linked to SL" << locSuperLayerSeed2->dSuperLayer << " Seed" << locSuperLayerSeed2->dSeedIndex << ": Share Few Hits, Ring = " << locRing << endl; | |||
1330 | } | |||
1331 | } | |||
1332 | } | |||
1333 | ||||
1334 | return (locMaxSpiralNumHits > 0); | |||
1335 | } | |||
1336 | ||||
1337 | //------------------------------------------ | |||
1338 | // SearchFor_SpiralTurn_ManyHitsAdjacentRing | |||
1339 | //------------------------------------------ | |||
1340 | bool DTrackCandidate_factory_CDC::SearchFor_SpiralTurn_ManyHitsAdjacentRing(DCDCSuperLayerSeed* locSuperLayerSeed1, DCDCSuperLayerSeed* locSuperLayerSeed2, int locRingToCheck, int locMinStrawsAdjacentRing, int& locMaxSpiralNumHits) | |||
1341 | { | |||
1342 | //utility function, used to confirm if there are many hits on both seeds in the given ring | |||
1343 | if(locSuperLayerSeed1->Are_AllHitsOnRingShared(locSuperLayerSeed2, locRingToCheck)) | |||
1344 | return false; //these hits are the same | |||
1345 | ||||
1346 | vector<DCDCTrkHit*> locHits1; | |||
1347 | for(size_t loc_i = 0; loc_i < locSuperLayerSeed1->dCDCRingSeeds.size(); ++loc_i) | |||
1348 | { | |||
1349 | if(locSuperLayerSeed1->dCDCRingSeeds[loc_i].ring != locRingToCheck) | |||
1350 | continue; | |||
1351 | locHits1 = locSuperLayerSeed1->dCDCRingSeeds[loc_i].hits; | |||
1352 | break; | |||
1353 | } | |||
1354 | if(locHits1.empty()) | |||
1355 | return false; | |||
1356 | ||||
1357 | vector<DCDCTrkHit*> locHits2; | |||
1358 | for(size_t loc_j = 0; loc_j < locSuperLayerSeed2->dCDCRingSeeds.size(); ++loc_j) | |||
1359 | { | |||
1360 | if(locSuperLayerSeed2->dCDCRingSeeds[loc_j].ring != locRingToCheck) | |||
1361 | continue; | |||
1362 | locHits2 = locSuperLayerSeed2->dCDCRingSeeds[loc_j].hits; | |||
1363 | break; | |||
1364 | } | |||
1365 | if(locHits2.empty()) | |||
1366 | return false; | |||
1367 | ||||
1368 | int locNumHits1 = locHits1.size(); | |||
1369 | int locNumHits2 = locHits2.size(); | |||
1370 | ||||
1371 | if((locNumHits1 < int(locMinStrawsAdjacentRing)) || (locNumHits2 < int(locMinStrawsAdjacentRing))) | |||
1372 | return false; //neither seed has enough hits on the adjacent ring: return false | |||
1373 | ||||
1374 | // check to make sure the hits on the inner & outer rings of both seeds aren't identical | |||
1375 | //if there truly is a spiral, then this is the wrong combo of seeds for it | |||
1376 | int locFirstRing1 = locSuperLayerSeed1->dCDCRingSeeds.front().ring; | |||
1377 | int locFirstRing2 = locSuperLayerSeed2->dCDCRingSeeds.front().ring; | |||
1378 | int locLastRing1 = locSuperLayerSeed1->dCDCRingSeeds.back().ring; | |||
1379 | int locLastRing2 = locSuperLayerSeed2->dCDCRingSeeds.back().ring; | |||
1380 | if((locFirstRing1 == locFirstRing2) && (locLastRing1 == locLastRing2)) | |||
1381 | { | |||
1382 | if(locSuperLayerSeed1->Are_AllHitsOnRingShared(locSuperLayerSeed2, locFirstRing1) && locSuperLayerSeed1->Are_AllHitsOnRingShared(locSuperLayerSeed2, locLastRing1)) | |||
1383 | return false; | |||
1384 | } | |||
1385 | ||||
1386 | locMaxSpiralNumHits = locNumHits1; | |||
1387 | if(locNumHits2 > locMaxSpiralNumHits) | |||
1388 | locMaxSpiralNumHits = locNumHits2; | |||
1389 | ||||
1390 | return true; | |||
1391 | } | |||
1392 | ||||
1393 | //------------------------------------------- | |||
1394 | // SearchFor_SpiralTurn_MissingOrBetweenRings | |||
1395 | //------------------------------------------- | |||
1396 | bool DTrackCandidate_factory_CDC::SearchFor_SpiralTurn_MissingOrBetweenRings(DCDCSuperLayerSeed* locSuperLayerSeed1, DCDCSuperLayerSeed* locSuperLayerSeed2) | |||
1397 | { | |||
1398 | // sometimes the spiral turn occurs between rings (or in a region with a dead high-voltage board). this function attempts to find these | |||
1399 | // the signature is that both seeds have many hits in a given ring. these hits must be different but nearby, and the majority of the hits in the other rings must be further away from the other seed | |||
1400 | int locMaxSpiralNumHits = 0; //can have more than one potential spiral turn on a seed: could have two tracks (or two spiral arms) turning near each other | |||
1401 | for(size_t loc_i = 0; loc_i < locSuperLayerSeed1->dCDCRingSeeds.size(); ++loc_i) | |||
1402 | { | |||
1403 | int locRing = locSuperLayerSeed1->dCDCRingSeeds[loc_i].ring; | |||
1404 | ||||
1405 | //make sure there are enough straws on this ring in seed1 | |||
1406 | vector<DCDCTrkHit*>& locHits1 = locSuperLayerSeed1->dCDCRingSeeds[loc_i].hits; | |||
1407 | int locNumHits1 = locHits1.size(); | |||
1408 | if(locNumHits1 < int(MIN_STRAWS_POTENTIAL_SPIRAL_TURN)) | |||
1409 | continue; //not enough straws | |||
1410 | ||||
1411 | for(size_t loc_j = 0; loc_j < locSuperLayerSeed2->dCDCRingSeeds.size(); ++loc_j) | |||
1412 | { | |||
1413 | if(locSuperLayerSeed2->dCDCRingSeeds[loc_j].ring != locRing) | |||
1414 | continue; //select the same ring as in seed1 | |||
1415 | ||||
1416 | vector<DCDCTrkHit*>& locHits2 = locSuperLayerSeed2->dCDCRingSeeds[loc_j].hits; | |||
1417 | if(locHits2 == locHits1) | |||
1418 | break; //hits are shared: if truly was a spiral, will have been picked up earlier | |||
1419 | ||||
1420 | //make sure there are enough straws on this ring in seed2 | |||
1421 | int locNumHits2 = locHits2.size(); | |||
1422 | if(locNumHits2 < int(MIN_STRAWS_POTENTIAL_SPIRAL_TURN)) | |||
1423 | break; //not enough straws | |||
1424 | ||||
1425 | bool locAtLeastOneSeedDefiniteTurnFlag = (locNumHits1 >= int(MIN_STRAWS_DEFINITE_SPIRAL_TURN)); | |||
1426 | if(locNumHits2 >= int(MIN_STRAWS_DEFINITE_SPIRAL_TURN)) | |||
1427 | locAtLeastOneSeedDefiniteTurnFlag = true; | |||
1428 | ||||
1429 | //check to make sure the seeds are nearby | |||
1430 | int locStrawNumDiff = abs(locHits2.front()->hit->wire->straw - locHits1.back()->hit->wire->straw); | |||
1431 | int locNumStrawsInRing = dNumStrawsPerRing[locRing - 1]; | |||
1432 | if(locStrawNumDiff > locNumStrawsInRing/2) | |||
1433 | locStrawNumDiff = locNumStrawsInRing - locStrawNumDiff; //crosses straw count edge | |||
1434 | int locNumHits = locStrawNumDiff - 1; | |||
1435 | if(locNumHits > int(MAX_STRAWS_BETWEEN_LINK_SPIRAL_TURN)) | |||
1436 | break; //straw groups are too far apart | |||
1437 | ||||
1438 | // check to make sure the hits on the inner & outer rings of both seeds aren't identical | |||
1439 | //if there truly is a spiral, then this is the wrong combo of seeds for it | |||
1440 | int locFirstRing1 = locSuperLayerSeed1->dCDCRingSeeds.front().ring; | |||
1441 | int locFirstRing2 = locSuperLayerSeed2->dCDCRingSeeds.front().ring; | |||
1442 | int locLastRing1 = locSuperLayerSeed1->dCDCRingSeeds.back().ring; | |||
1443 | int locLastRing2 = locSuperLayerSeed2->dCDCRingSeeds.back().ring; | |||
1444 | if((locFirstRing1 == locFirstRing2) && (locLastRing1 == locLastRing2)) | |||
1445 | { | |||
1446 | if(locSuperLayerSeed1->Are_AllHitsOnRingShared(locSuperLayerSeed2, locFirstRing1) && locSuperLayerSeed1->Are_AllHitsOnRingShared(locSuperLayerSeed2, locLastRing1)) | |||
1447 | continue; | |||
1448 | } | |||
1449 | ||||
1450 | if((locNumHits1 < locMaxSpiralNumHits) && (locNumHits2 < locMaxSpiralNumHits)) | |||
1451 | continue; //a seed with more hits was found earlier | |||
1452 | if(locNumHits1 > locMaxSpiralNumHits) | |||
1453 | locMaxSpiralNumHits = locNumHits1; | |||
1454 | if(locNumHits2 > locMaxSpiralNumHits) | |||
1455 | locMaxSpiralNumHits = locNumHits2; | |||
1456 | ||||
1457 | //will use results from circle fits to make sure the seeds are turning in the correct direction. | |||
1458 | DSpiralParams_t locSpiralTurnParams; | |||
1459 | // try to determine if the spiral is turning inwards or outwards | |||
1460 | int locSpiralTurnRingFlag = 0; | |||
1461 | if(locSuperLayerSeed1->dCDCRingSeeds.size() == 1) | |||
1462 | locSpiralTurnRingFlag = ((locRing - 1)%4 > 1) ? 1 : -1; | |||
1463 | else if(loc_i == 0) | |||
1464 | locSpiralTurnRingFlag = -1; //turn on innermost ring | |||
1465 | else if(loc_i == (locSuperLayerSeed1->dCDCRingSeeds.size() - 1)) | |||
1466 | locSpiralTurnRingFlag = 1; //turn on outermost ring | |||
1467 | else if(locSuperLayerSeed1->dCDCRingSeeds[loc_i + 1].hits.size() > locSuperLayerSeed1->dCDCRingSeeds[loc_i - 1].hits.size()) | |||
1468 | locSpiralTurnRingFlag = -1; //more hits on outer ring than inner ring: turn on innermost ring | |||
1469 | else | |||
1470 | locSpiralTurnRingFlag = 1; //turn on outermost ring (if hit vector sizes are equal, assume outermost) | |||
1471 | locSpiralTurnParams.dSpiralTurnRingFlag = locSpiralTurnRingFlag; | |||
1472 | locSpiralTurnParams.dSpiralTurnRing = locRing; | |||
1473 | locSpiralTurnParams.dDefiniteSpiralTurnRingFlag = locAtLeastOneSeedDefiniteTurnFlag ? locSpiralTurnRingFlag : 0; | |||
1474 | locSuperLayerSeed1->dSpiralLinkParams[locSuperLayerSeed2->dSeedIndex] = locSpiralTurnParams; | |||
1475 | locSuperLayerSeed2->dSpiralLinkParams[locSuperLayerSeed1->dSeedIndex] = locSpiralTurnParams; | |||
1476 | ||||
1477 | if(DEBUG_LEVEL > 10) | |||
1478 | cout << "SL" << locSuperLayerSeed1->dSuperLayer << " Seed" << locSuperLayerSeed1->dSeedIndex << " Spiral-linked to SL" << locSuperLayerSeed2->dSuperLayer << " Seed" << locSuperLayerSeed2->dSeedIndex << ": Share No Hits, Ring = " << locRing << endl; | |||
1479 | } | |||
1480 | } | |||
1481 | ||||
1482 | return (locMaxSpiralNumHits > 0); | |||
1483 | } | |||
1484 | ||||
1485 | //-------------------------------- | |||
1486 | // SearchFor_SpiralTurn_SingleSeed | |||
1487 | //-------------------------------- | |||
1488 | bool DTrackCandidate_factory_CDC::SearchFor_SpiralTurn_SingleSeed(DCDCSuperLayerSeed* locSuperLayerSeed) | |||
1489 | { | |||
1490 | // search for a spiral turn contained within this DCDCSuperLayerSeed | |||
1491 | // signature is a ring with many hits | |||
1492 | int locMaxSpiralNumHits = 0; //can have more than one potential spiral turn on a seed: could have two tracks (or two spiral arms) turning near each other | |||
1493 | for(size_t loc_i = 0; loc_i < locSuperLayerSeed->dCDCRingSeeds.size(); ++loc_i) | |||
1494 | { | |||
1495 | int locRing = locSuperLayerSeed->dCDCRingSeeds[loc_i].ring; | |||
1496 | int locNumHits = locSuperLayerSeed->dCDCRingSeeds[loc_i].hits.size(); | |||
1497 | if(locNumHits < locMaxSpiralNumHits) | |||
1498 | continue; //already found a potential spiral link in this seed with a > # of straws | |||
1499 | ||||
1500 | if(locNumHits < int(MIN_STRAWS_POTENTIAL_SPIRAL_TURN)) | |||
1501 | continue; //not enough straws in seed | |||
1502 | locMaxSpiralNumHits = locNumHits; | |||
1503 | ||||
1504 | DSpiralParams_t locSpiralTurnParams; | |||
1505 | int locSpiralTurnRingFlag = ((locRing - 1)%4 > 1) ? 1 : -1; | |||
1506 | locSpiralTurnParams.dSpiralTurnRingFlag = locSpiralTurnRingFlag; | |||
1507 | locSpiralTurnParams.dSpiralTurnRing = locRing; | |||
1508 | locSpiralTurnParams.dDefiniteSpiralTurnRingFlag = (locNumHits >= int(MIN_STRAWS_DEFINITE_SPIRAL_TURN)) ? locSpiralTurnRingFlag : 0; | |||
1509 | locSuperLayerSeed->dSpiralLinkParams[locSuperLayerSeed->dSeedIndex] = locSpiralTurnParams; | |||
1510 | if(DEBUG_LEVEL > 10) | |||
1511 | cout << "SL" << locSuperLayerSeed->dSuperLayer << " Seed" << locSuperLayerSeed->dSeedIndex << " Self-spiral-linked: Ring = " << locRing << endl; | |||
1512 | } | |||
1513 | return (locMaxSpiralNumHits > 0); | |||
1514 | } | |||
1515 | ||||
1516 | //---------------------- | |||
1517 | // Print_SuperLayerSeeds | |||
1518 | //---------------------- | |||
1519 | void DTrackCandidate_factory_CDC::Print_SuperLayerSeeds(void) | |||
1520 | { | |||
1521 | cout << "HITS BY SUPER LAYER & SEED INDEX:" << endl; | |||
1522 | for(unsigned int loc_i = 0; loc_i < 7; ++loc_i) | |||
1523 | { | |||
1524 | cout << " SUPER LAYER " << loc_i + 1 << ":" << endl; | |||
1525 | for(unsigned int loc_j = 0; loc_j < dSuperLayerSeeds[loc_i].size(); ++loc_j) | |||
1526 | { | |||
1527 | cout << " Seed Index " << loc_j << ":" << endl; | |||
1528 | DCDCSuperLayerSeed* locSuperLayerSeed = dSuperLayerSeeds[loc_i][loc_j]; | |||
1529 | vector<DCDCTrkHit*> locHits; | |||
1530 | locSuperLayerSeed->Get_Hits(locHits); | |||
1531 | for(unsigned int loc_k = 0; loc_k < locHits.size(); ++loc_k) | |||
1532 | cout << "ring, straw, E (keV) = " << locHits[loc_k]->hit->wire->ring << ", " << locHits[loc_k]->hit->wire->straw << ", " << 1.0E6*locHits[loc_k]->hit->dE << endl; | |||
1533 | for(map<int, DSpiralParams_t>::iterator locIterator = locSuperLayerSeed->dSpiralLinkParams.begin(); locIterator != locSuperLayerSeed->dSpiralLinkParams.end(); ++locIterator) | |||
1534 | cout << "dSpiralLinkSeedIndex, dSpiralTurnRingFlag, dSpiralTurnRing, dDefiniteSpiralTurnRingFlag = " << locIterator->first << ", " << locIterator->second.dSpiralTurnRingFlag << ", " << locIterator->second.dSpiralTurnRing << ", " << locIterator->second.dDefiniteSpiralTurnRingFlag << endl; | |||
1535 | } | |||
1536 | } | |||
1537 | } | |||
1538 | ||||
1539 | /*********************************************************************************************************************************************************************/ | |||
1540 | /************************************************************************ Build Track Circles ************************************************************************/ | |||
1541 | /*********************************************************************************************************************************************************************/ | |||
1542 | ||||
1543 | //------------------- | |||
1544 | // Build_TrackCircles | |||
1545 | //------------------- | |||
1546 | bool DTrackCandidate_factory_CDC::Build_TrackCircles(vector<DCDCTrackCircle*>& locCDCTrackCircles) | |||
1547 | { | |||
1548 | //return false if had to bail due to failure (i.e. too many track circles) | |||
1549 | //return true even if no track circles: it worked, it's just there aren't any | |||
1550 | ||||
1551 | //link DCDCSuperLayers together to form track circles | |||
1552 | locCDCTrackCircles.clear(); | |||
1553 | for(unsigned int locOuterSuperLayer = 2; locOuterSuperLayer <= 7; ++locOuterSuperLayer) | |||
1554 | { | |||
1555 | unsigned int locInnerSuperLayer = locOuterSuperLayer - 1; | |||
1556 | if(locCDCTrackCircles.empty()) | |||
1557 | { | |||
1558 | // no track circles yet: create new track circle objects using the super layer seeds in locInnerSuperLayer | |||
1559 | if(locInnerSuperLayer > MAX_SUPERLAYER_NEW_TRACK) | |||
1560 | return true; // don't create track circles beyond super layer MAX_SUPERLAYER_NEW_TRACK (e.g. knockout electrons from BCAL), return: no track circles!!! | |||
1561 | if(dSuperLayerSeeds[locInnerSuperLayer - 1].empty()) | |||
1562 | continue; // no inner seeds, try next super layer | |||
1563 | //build new DCDCTrackCircle's: one for each super layer seed in this (inner) super layer | |||
1564 | for(size_t loc_j = 0; loc_j < dSuperLayerSeeds[locInnerSuperLayer - 1].size(); ++loc_j) | |||
1565 | { | |||
1566 | DCDCSuperLayerSeed* locSuperLayerSeed = dSuperLayerSeeds[locInnerSuperLayer - 1][loc_j]; | |||
1567 | DCDCTrackCircle* locCDCTrackCircle = Get_Resource_CDCTrackCircle(); | |||
1568 | if((locInnerSuperLayer == 1) || (locInnerSuperLayer == 4) || (locInnerSuperLayer == 7)) | |||
1569 | locCDCTrackCircle->dSuperLayerSeeds_Axial.push_back(locSuperLayerSeed); | |||
1570 | else if((locInnerSuperLayer == 2) || (locInnerSuperLayer == 3)) | |||
1571 | locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.push_back(vector<DCDCSuperLayerSeed*>(1, locSuperLayerSeed)); | |||
1572 | else | |||
1573 | locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.push_back(vector<DCDCSuperLayerSeed*>(1, locSuperLayerSeed)); | |||
1574 | locCDCTrackCircles.push_back(locCDCTrackCircle); | |||
1575 | } | |||
1576 | } | |||
1577 | //link existing track circles to DCDCSuperLayerSeed's in the outer super layer. Any unused DCDCSuperLayerSeed's will be used to make new track circles | |||
1578 | if(!Link_SuperLayers(locCDCTrackCircles, locOuterSuperLayer)) | |||
1579 | return false; //too many track circles | |||
1580 | } | |||
1581 | //if still no tracks, make DCDCSuperLayerSeed's in super layer 7 into new tracks (if allowed (probably shouldn't be)) | |||
1582 | if(locCDCTrackCircles.empty() && (MAX_SUPERLAYER_NEW_TRACK >= 7)) | |||
1583 | { | |||
1584 | for(size_t loc_j = 0; loc_j < dSuperLayerSeeds[6].size(); ++loc_j) | |||
1585 | { | |||
1586 | DCDCSuperLayerSeed* locSuperLayerSeed = dSuperLayerSeeds[6][loc_j]; | |||
1587 | DCDCTrackCircle* locCDCTrackCircle = Get_Resource_CDCTrackCircle(); | |||
1588 | locCDCTrackCircle->dSuperLayerSeeds_Axial.push_back(locSuperLayerSeed); | |||
1589 | locCDCTrackCircles.push_back(locCDCTrackCircle); | |||
1590 | } | |||
1591 | } | |||
1592 | if(locCDCTrackCircles.empty()) | |||
1593 | return true; | |||
1594 | ||||
1595 | //shouldn't be possible, but check to see if too many (should've failed sooner) | |||
1596 | if(locCDCTrackCircles.size() >= MAX_ALLOWED_TRACK_CIRCLES) | |||
1597 | { | |||
1598 | if(DEBUG_LEVEL > 10) | |||
1599 | cout << "Too many track circles; bailing" << endl; | |||
1600 | locCDCTrackCircles.clear(); | |||
1601 | return true; | |||
1602 | } | |||
1603 | ||||
1604 | // Reject track circles if they are definitely a spiral arm that turns back outwards in its inner super layer | |||
1605 | Reject_DefiniteSpiralArms(locCDCTrackCircles); | |||
1606 | if(locCDCTrackCircles.empty()) | |||
1607 | return true; | |||
1608 | ||||
1609 | // Reject track circles that don't contain at least one axial and one stereo super layer, unless that axial is super layer 1 | |||
1610 | Drop_IncompleteGroups(locCDCTrackCircles); | |||
1611 | if(locCDCTrackCircles.empty()) | |||
1612 | return true; | |||
1613 | ||||
1614 | if(DEBUG_LEVEL > 5) | |||
1615 | { | |||
1616 | cout << "LINKED TRACK CIRCLES" << endl; | |||
1617 | Print_TrackCircles(locCDCTrackCircles); | |||
1618 | } | |||
1619 | ||||
1620 | //fit circles to the DCDCTrackCircle's. This will reject fits if they aren't very good | |||
1621 | //1st false: fit all circles //2nd false: don't add intersections between stereo layers (wait until specific stereo super layers have been selected) | |||
1622 | Fit_Circles(locCDCTrackCircles, false, false); | |||
1623 | if(locCDCTrackCircles.empty()) | |||
1624 | return true; | |||
1625 | stable_sort(locCDCTrackCircles.begin(), locCDCTrackCircles.end(), CDCSortByChiSqPerNDFDecreasing); //sort by circle-fit weighted chisq/ndf (largest first) | |||
1626 | ||||
1627 | if(DEBUG_LEVEL > 5) | |||
1628 | { | |||
1629 | cout << "post circle fit" << endl; | |||
1630 | Print_TrackCircles(locCDCTrackCircles); | |||
1631 | } | |||
1632 | ||||
1633 | return true; | |||
1634 | } | |||
1635 | ||||
1636 | //----------------- | |||
1637 | // Link_SuperLayers | |||
1638 | //----------------- | |||
1639 | bool DTrackCandidate_factory_CDC::Link_SuperLayers(vector<DCDCTrackCircle*>& locCDCTrackCircles, unsigned int locOuterSuperLayer) | |||
1640 | { | |||
1641 | /// Loop over the DCDCTrackCircles and the next super layer seeds and compare the positions of | |||
1642 | /// their first and last hits to see if we should link them together. | |||
1643 | /// If at <= MAX_SUPERLAYER_NEW_TRACK: Any seeds from the outer super layer that are not linked will be added to the <i>DCDCTrackCircle</i> list. | |||
1644 | /// Will try to link by skipping a super layer if a link was not previously performed and ENABLE_DEAD_HV_BOARD_LINKING is set to true (default false) | |||
1645 | ||||
1646 | if(DEBUG_LEVEL > 3) | |||
1647 | cout << "Linking seeds, locOuterSuperLayer = " << locOuterSuperLayer << endl; | |||
1648 | ||||
1649 | //Link locCDCTrackCircles's to the next super layer seeds | |||
1650 | unsigned int locInnerSuperLayer = locOuterSuperLayer - 1; | |||
1651 | if((locInnerSuperLayer == 1) || (locInnerSuperLayer == 4)) //else linking from stereo | |||
1652 | Link_SuperLayers_FromAxial(locCDCTrackCircles, locOuterSuperLayer, locInnerSuperLayer); | |||
1653 | else if((locOuterSuperLayer == 4) || (locOuterSuperLayer == 7)) | |||
1654 | { | |||
1655 | if(!Link_SuperLayers_FromStereo_ToAxial(locCDCTrackCircles, locOuterSuperLayer, locInnerSuperLayer)) | |||
1656 | return false; //linking failed: too many track circles | |||
1657 | } | |||
1658 | else | |||
1659 | Link_SuperLayers_FromStereo_ToStereo(locCDCTrackCircles, locOuterSuperLayer, locInnerSuperLayer); | |||
1660 | if(DEBUG_LEVEL > 25) | |||
1661 | { | |||
1662 | cout << "Link-to SL" << locOuterSuperLayer << ", v1" << endl; | |||
1663 | Print_TrackCircles(locCDCTrackCircles); | |||
1664 | } | |||
1665 | ||||
1666 | //For DCDCTrackCircle's that failed to link, try checking to see if can link to the previous super layer (e.g. a HV board was dead) | |||
1667 | if(ENABLE_DEAD_HV_BOARD_LINKING && (locInnerSuperLayer != 1)) | |||
1668 | { | |||
1669 | --locInnerSuperLayer; | |||
1670 | if(DEBUG_LEVEL > 3) | |||
1671 | cout << "Try to skip super layer (e.g. HV board dead); new inner super layer = " << locInnerSuperLayer << endl; | |||
1672 | if((locInnerSuperLayer == 1) || (locInnerSuperLayer == 4)) | |||
1673 | Link_SuperLayers_FromAxial(locCDCTrackCircles, locOuterSuperLayer, locInnerSuperLayer); | |||
1674 | else if((locOuterSuperLayer == 4) || (locOuterSuperLayer == 7)) | |||
1675 | { | |||
1676 | if(!Link_SuperLayers_FromStereo_ToAxial(locCDCTrackCircles, locOuterSuperLayer, locInnerSuperLayer)) | |||
1677 | return false; //linking failed: too many track circles | |||
1678 | } | |||
1679 | else | |||
1680 | Link_SuperLayers_FromStereo_ToStereo(locCDCTrackCircles, locOuterSuperLayer, locInnerSuperLayer); | |||
1681 | if(DEBUG_LEVEL > 25) | |||
1682 | { | |||
1683 | cout << "Link-to SL" << locOuterSuperLayer << ", v2" << endl; | |||
1684 | Print_TrackCircles(locCDCTrackCircles); | |||
1685 | } | |||
1686 | } | |||
1687 | ||||
1688 | // For outer seeds that failed to link, save as new track circles (even if they are stereo layers), UNLESS they are after MAX_SUPERLAYER_NEW_TRACK | |||
1689 | // UNLESS: a region at about the same phi in a previous super layer had a very high density of hits (such that all seeds in it were rejected) | |||
1690 | // Don't want to create new tracks in this case! | |||
1691 | if(locOuterSuperLayer <= MAX_SUPERLAYER_NEW_TRACK) | |||
1692 | { | |||
1693 | if(DEBUG_LEVEL > 3) | |||
1694 | cout << "Save any unlinked as new track circles" << endl; | |||
1695 | for(size_t loc_i = 0; loc_i < dSuperLayerSeeds[locOuterSuperLayer - 1].size(); ++loc_i) | |||
1696 | { | |||
1697 | DCDCSuperLayerSeed* locSuperLayerSeed = dSuperLayerSeeds[locOuterSuperLayer - 1][loc_i]; | |||
1698 | if(locSuperLayerSeed->linked) | |||
1699 | continue; //previously linked, don't create new object | |||
1700 | //make sure this seed doesn't correspond to a region in phi where all of the seeds were deleted earlier | |||
1701 | //calc phi range of seed | |||
1702 | double locSeedFirstPhi, locSeedLastPhi; | |||
1703 | Calc_SuperLayerPhiRange(locSuperLayerSeed, locSeedFirstPhi, locSeedLastPhi); | |||
1704 | bool locHitDensityPreviouslyTooHighFlag = false; | |||
1705 | for(size_t loc_j = 1; loc_j < locOuterSuperLayer; ++loc_j) | |||
1706 | { | |||
1707 | for(size_t loc_k = 0; loc_k < dRejectedPhiRegions[loc_j].size(); ++loc_k) | |||
1708 | { | |||
1709 | if(!Check_IfPhiRangesOverlap(locSeedFirstPhi, locSeedLastPhi, dRejectedPhiRegions[loc_j][loc_k].first, dRejectedPhiRegions[loc_j][loc_k].second)) | |||
1710 | continue; | |||
1711 | locHitDensityPreviouslyTooHighFlag = true; | |||
1712 | break; | |||
1713 | } | |||
1714 | if(locHitDensityPreviouslyTooHighFlag) | |||
1715 | break; | |||
1716 | } | |||
1717 | if(locHitDensityPreviouslyTooHighFlag) | |||
1718 | continue; | |||
1719 | //create new track circle | |||
1720 | if(DEBUG_LEVEL > 10) | |||
1721 | cout << "Unlinked seed; create new track circle: super layer & seed index = " << locSuperLayerSeed->dSuperLayer << ", " << locSuperLayerSeed->dSeedIndex << endl; | |||
1722 | if(locCDCTrackCircles.size() >= MAX_ALLOWED_TRACK_CIRCLES) | |||
1723 | { | |||
1724 | if(DEBUG_LEVEL > 10) | |||
1725 | cout << "Too many track circles; bailing" << endl; | |||
1726 | locCDCTrackCircles.clear(); | |||
1727 | return false; | |||
1728 | } | |||
1729 | DCDCTrackCircle* locCDCTrackCircle = Get_Resource_CDCTrackCircle(); | |||
1730 | if((locOuterSuperLayer == 4) || (locOuterSuperLayer == 7)) | |||
1731 | locCDCTrackCircle->dSuperLayerSeeds_Axial.push_back(locSuperLayerSeed); | |||
1732 | else if((locOuterSuperLayer == 2) || (locOuterSuperLayer == 3)) | |||
1733 | locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.push_back(vector<DCDCSuperLayerSeed*>(1, locSuperLayerSeed)); | |||
1734 | else | |||
1735 | locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.push_back(vector<DCDCSuperLayerSeed*>(1, locSuperLayerSeed)); | |||
1736 | locCDCTrackCircles.push_back(locCDCTrackCircle); | |||
1737 | } | |||
1738 | if(DEBUG_LEVEL > 25) | |||
1739 | { | |||
1740 | cout << "Link-to SL" << locOuterSuperLayer << ", v3" << endl; | |||
1741 | Print_TrackCircles(locCDCTrackCircles); | |||
1742 | } | |||
1743 | } | |||
1744 | ||||
1745 | return true; | |||
1746 | } | |||
1747 | ||||
1748 | //--------------------------- | |||
1749 | // Link_SuperLayers_FromAxial | |||
1750 | //--------------------------- | |||
1751 | void DTrackCandidate_factory_CDC::Link_SuperLayers_FromAxial(vector<DCDCTrackCircle*>& locCDCTrackCircles, unsigned int locOuterSuperLayer, unsigned int locInnerSuperLayer) | |||
1752 | { | |||
1753 | //Link locCDCTrackCircles from an axial super layer to a stereo super layer (must be stereo: cannot skip two (both stereo) super layers) | |||
1754 | for(size_t loc_i = 0; loc_i < locCDCTrackCircles.size(); ++loc_i) | |||
1755 | { | |||
1756 | DCDCTrackCircle* locCDCTrackCircle = locCDCTrackCircles[loc_i]; | |||
1757 | if(locCDCTrackCircle->dSuperLayerSeeds_Axial.empty()) | |||
1758 | continue; // no axial super layer seeds to link from | |||
1759 | DCDCSuperLayerSeed* locSuperLayerSeed1 = locCDCTrackCircle->dSuperLayerSeeds_Axial.back(); | |||
1760 | if(locSuperLayerSeed1->dSuperLayer != locInnerSuperLayer) | |||
1761 | continue; // e.g. the track ended earlier | |||
1762 | if(DEBUG_LEVEL > 10) | |||
1763 | cout << "Seed 1 Super Layer, Seed Index = " << locSuperLayerSeed1->dSuperLayer << ", " << locSuperLayerSeed1->dSeedIndex << endl; | |||
1764 | if(!Check_IfShouldAttemptLink(locSuperLayerSeed1, true)) | |||
1765 | continue; //don't attempt seed link if the inner seed was a definite spiral turn that was turning back inwards, etc. | |||
1766 | ||||
1767 | // if trying to skip a layer, first check to make sure this seed wasn't already linked (to layer "locInnerSuperLayer + 1") | |||
1768 | if((locInnerSuperLayer == 1) && (!locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.empty())) | |||
1769 | continue; //already linked to some inner stereo seeds | |||
1770 | else if((locInnerSuperLayer == 4) && (!locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.empty())) | |||
1771 | continue; //already linked to some outer stereo seeds | |||
1772 | ||||
1773 | for(size_t loc_j = 0; loc_j < dSuperLayerSeeds[locOuterSuperLayer - 1].size(); ++loc_j) | |||
1774 | { | |||
1775 | DCDCSuperLayerSeed* locSuperLayerSeed2 = dSuperLayerSeeds[locOuterSuperLayer - 1][loc_j]; | |||
1776 | if(DEBUG_LEVEL > 10) | |||
1777 | cout << "Seed 2 Super Layer, Seed Index = " << locSuperLayerSeed2->dSuperLayer << ", " << locSuperLayerSeed2->dSeedIndex << endl; | |||
1778 | if(!Check_IfShouldAttemptLink(locSuperLayerSeed2, false)) | |||
1779 | continue; //don't attempt seed link if the outer seed was a definite spiral turn that was turning back outwards, etc. | |||
1780 | if(DEBUG_LEVEL > 10) | |||
1781 | cout << "Attempting Seed Link" << endl; | |||
1782 | if(!Attempt_SeedLink(locSuperLayerSeed1, locSuperLayerSeed2)) //see if seeds are nearby enough to link | |||
1783 | continue; | |||
1784 | //LINK SUCCESSFUL!! | |||
1785 | if(DEBUG_LEVEL > 10) | |||
1786 | cout << "LINK SUCCESSFUL" << endl; | |||
1787 | locSuperLayerSeed1->linked = true; | |||
1788 | locSuperLayerSeed2->linked = true; | |||
1789 | ||||
1790 | //create new group of stereo seeds (assumes linking to stereo: cannot axial (would skip too many)) | |||
1791 | if(locOuterSuperLayer < 4) | |||
1792 | locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.push_back(vector<DCDCSuperLayerSeed*>(1, locSuperLayerSeed2)); | |||
1793 | else | |||
1794 | locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.push_back(vector<DCDCSuperLayerSeed*>(1, locSuperLayerSeed2)); | |||
1795 | } | |||
1796 | } | |||
1797 | } | |||
1798 | ||||
1799 | //------------------------------------ | |||
1800 | // Link_SuperLayers_FromStereo_ToAxial | |||
1801 | //------------------------------------ | |||
1802 | bool DTrackCandidate_factory_CDC::Link_SuperLayers_FromStereo_ToAxial(vector<DCDCTrackCircle*>& locCDCTrackCircles, unsigned int locOuterSuperLayer, unsigned int locInnerSuperLayer) | |||
1803 | { | |||
1804 | // Link from a stereo super layer to an axial super layer. Unfortunately, this is extremely messy. | |||
1805 | //If you're editing this, I stronly suggest reading the simpler Link_SuperLayers_FromStereo_ToStereo function to make sure you understand it first. Good luck! :) | |||
1806 | ||||
1807 | //since linking to axial, will create new track circles (one for each unique combo of axial seeds) | |||
1808 | vector<DCDCTrackCircle*> locNewCDCTrackCircles; //will eventually return this vector (by setting locCDCTrackCircles to it at the end) | |||
1809 | ||||
1810 | // first save all track circles for output (into locNewCDCTrackCircles) that definitely will NOT be linked from: | |||
1811 | //those that already have an axial layer greater than the stereo we're linking from | |||
1812 | //this happens when trying to skip a super layer (e.g. a dead hv board), but this circle link was linked successfully | |||
1813 | //do this first, so that if an axial combo is created later that somehow is identical (e.g. due to skipping a super layer due to a dead HV board) | |||
1814 | //the stereo seeds will just be merged with the already existing one | |||
1815 | for(size_t loc_i = 0; loc_i < locCDCTrackCircles.size(); ++loc_i) | |||
1816 | { | |||
1817 | DCDCTrackCircle* locCDCTrackCircle = locCDCTrackCircles[loc_i]; | |||
1818 | if(!locCDCTrackCircle->dSuperLayerSeeds_Axial.empty()) | |||
1819 | { | |||
1820 | if(locCDCTrackCircle->dSuperLayerSeeds_Axial.back()->dSuperLayer > locInnerSuperLayer) | |||
1821 | { | |||
1822 | locNewCDCTrackCircles.push_back(locCDCTrackCircle); | |||
1823 | continue; | |||
1824 | } | |||
1825 | } | |||
1826 | } | |||
1827 | ||||
1828 | // loop over track circles | |||
1829 | for(size_t loc_i = 0; loc_i < locCDCTrackCircles.size(); ++loc_i) | |||
1830 | { | |||
1831 | DCDCTrackCircle* locCDCTrackCircle = locCDCTrackCircles[loc_i]; | |||
1832 | ||||
1833 | // if trying to skip a layer, first check to make sure this seed wasn't already linked (to layer "locInnerSuperLayer + 1") | |||
1834 | // axial checked here, stereo checked for each stereo series below | |||
1835 | if(!locCDCTrackCircle->dSuperLayerSeeds_Axial.empty()) | |||
1836 | { | |||
1837 | // circle already saved in the output (above), so just skip linking here | |||
1838 | if(locCDCTrackCircle->dSuperLayerSeeds_Axial.back()->dSuperLayer > locInnerSuperLayer) | |||
1839 | continue; | |||
1840 | } | |||
1841 | ||||
1842 | // determine if linking from the stereo seeds stored in the dSuperLayerSeeds_InnerStereo or dSuperLayerSeeds_OuterStereo vectors | |||
1843 | bool locFromInnerStereoFlag = (locInnerSuperLayer < 4); | |||
1844 | if(!locCDCTrackCircle->dSuperLayerSeeds_Axial.empty()) | |||
1845 | { | |||
1846 | if(locCDCTrackCircle->dSuperLayerSeeds_Axial.back()->dSuperLayer != 4) | |||
1847 | locFromInnerStereoFlag = true; //middle axial layer is missing, store stereo layer as inner | |||
1848 | } | |||
1849 | ||||
1850 | //get a vector containing all of the series's of seeds to loop over | |||
1851 | vector<vector<DCDCSuperLayerSeed*> > locPreLinkedCDCSuperLayerSeeds; | |||
1852 | if(locFromInnerStereoFlag) //if on outer stereo seeds but axial seed 4 is missing, use inner stereo seeds | |||
1853 | locPreLinkedCDCSuperLayerSeeds = locCDCTrackCircle->dSuperLayerSeeds_InnerStereo; | |||
1854 | else //use outer stereo seeds | |||
1855 | locPreLinkedCDCSuperLayerSeeds = locCDCTrackCircle->dSuperLayerSeeds_OuterStereo; //for looping over | |||
1856 | ||||
1857 | bool locTrackCircleSavedFlag = false; //make sure that this track circle is saved in the output even if no future link is found | |||
1858 | //loop over each series of stereo seeds | |||
1859 | for(size_t loc_j = 0; loc_j < locPreLinkedCDCSuperLayerSeeds.size(); ++loc_j) | |||
1860 | { | |||
1861 | //get the last DCDCSuperLayerSeed in this stereo seed series | |||
1862 | vector<DCDCSuperLayerSeed*> locStereoSeedSeries = locPreLinkedCDCSuperLayerSeeds[loc_j]; | |||
1863 | DCDCSuperLayerSeed* locSuperLayerSeed1 = locPreLinkedCDCSuperLayerSeeds[loc_j].back(); | |||
1864 | if(DEBUG_LEVEL > 10) | |||
1865 | cout << "Seed 1 Super Layer, Seed Index = " << locSuperLayerSeed1->dSuperLayer << ", " << locSuperLayerSeed1->dSeedIndex << endl; | |||
1866 | ||||
1867 | bool locInnerSeedLinkSuccessfulFlag = false; | |||
1868 | //don't attempt seed link if wrong super layer, or if the inner seed was a definite spiral turn that was turning back inwards, etc. | |||
1869 | if((locSuperLayerSeed1->dSuperLayer == locInnerSuperLayer) && Check_IfShouldAttemptLink(locSuperLayerSeed1, true)) | |||
1870 | { | |||
1871 | //attempt to link to the outer superlayer | |||
1872 | for(size_t loc_k = 0; loc_k < dSuperLayerSeeds[locOuterSuperLayer - 1].size(); ++loc_k) | |||
1873 | { | |||
1874 | DCDCSuperLayerSeed* locSuperLayerSeed2 = dSuperLayerSeeds[locOuterSuperLayer - 1][loc_k]; | |||
1875 | if(DEBUG_LEVEL > 10) | |||
1876 | cout << "Seed 2 Super Layer, Seed Index = " << locSuperLayerSeed2->dSuperLayer << ", " << locSuperLayerSeed2->dSeedIndex << endl; | |||
1877 | if(!Check_IfShouldAttemptLink(locSuperLayerSeed2, false)) | |||
1878 | continue; //don't attempt seed link if the outer seed was a definite spiral turn that was turning back outwards, etc. | |||
1879 | if(DEBUG_LEVEL > 10) | |||
1880 | cout << "Attempting Seed Link" << endl; | |||
1881 | if(!Attempt_SeedLink(locSuperLayerSeed1, locSuperLayerSeed2)) //see if seeds are nearby enough to link | |||
1882 | continue; | |||
1883 | //LINK SUCCESSFUL!! | |||
1884 | if(DEBUG_LEVEL > 10) | |||
1885 | cout << "LINK SUCCESSFUL" << endl; | |||
1886 | locSuperLayerSeed1->linked = true; | |||
1887 | locSuperLayerSeed2->linked = true; | |||
1888 | locInnerSeedLinkSuccessfulFlag = true; | |||
1889 | ||||
1890 | //make new vector of axial seeds | |||
1891 | vector<DCDCSuperLayerSeed*> locNewCDCSuperLayerSeeds_Axial = locCDCTrackCircle->dSuperLayerSeeds_Axial; | |||
1892 | locNewCDCSuperLayerSeeds_Axial.push_back(locSuperLayerSeed2); | |||
1893 | ||||
1894 | //see if should create new DCDCTrackCircle object (axial combo is unique) or use a (probably recently created) existing one (it is not unique) | |||
1895 | DCDCTrackCircle* locNewCDCTrackCircle = NULL__null; | |||
1896 | for(size_t loc_l = 0; loc_l < locNewCDCTrackCircles.size(); ++loc_l) | |||
1897 | { | |||
1898 | if(locNewCDCSuperLayerSeeds_Axial != locNewCDCTrackCircles[loc_l]->dSuperLayerSeeds_Axial) | |||
1899 | continue; | |||
1900 | //all axial layers are identical: use previous object | |||
1901 | locNewCDCTrackCircle = locNewCDCTrackCircles[loc_l]; | |||
1902 | } | |||
1903 | if(locNewCDCTrackCircle == NULL__null) | |||
1904 | { | |||
1905 | //new combination of axial layers, create new object | |||
1906 | if(locNewCDCTrackCircles.size() >= MAX_ALLOWED_TRACK_CIRCLES) | |||
1907 | { | |||
1908 | if(DEBUG_LEVEL > 10) | |||
1909 | cout << "Too many track circles; bailing" << endl; | |||
1910 | locCDCTrackCircles.clear(); | |||
1911 | return false; | |||
1912 | } | |||
1913 | locNewCDCTrackCircle = Get_Resource_CDCTrackCircle(); | |||
1914 | locNewCDCTrackCircle->dSuperLayerSeeds_Axial = locNewCDCSuperLayerSeeds_Axial; | |||
1915 | if(!locFromInnerStereoFlag) //if on outer stereo, keep inner stereo results (but not outer stereo!!: will save below) | |||
1916 | locNewCDCTrackCircle->dSuperLayerSeeds_InnerStereo = locCDCTrackCircle->dSuperLayerSeeds_InnerStereo; | |||
1917 | locNewCDCTrackCircles.push_back(locNewCDCTrackCircle); //store new circle for return | |||
1918 | locTrackCircleSavedFlag = true; | |||
1919 | } | |||
1920 | //save this current series of stereo seeds | |||
1921 | if(locFromInnerStereoFlag) | |||
1922 | locNewCDCTrackCircle->dSuperLayerSeeds_InnerStereo.push_back(locStereoSeedSeries); | |||
1923 | else | |||
1924 | locNewCDCTrackCircle->dSuperLayerSeeds_OuterStereo.push_back(locStereoSeedSeries); | |||
1925 | } | |||
1926 | } | |||
1927 | if(!locInnerSeedLinkSuccessfulFlag) | |||
1928 | { | |||
1929 | //this inner seed series was not linked to an axial seed: need to make sure this group is still saved in the "new" vector | |||
1930 | //see if should create new DCDCTrackCircle object (axial combo is unique) or use a (probably recently created) existing one (it is not unique) | |||
1931 | DCDCTrackCircle* locNewCDCTrackCircle = NULL__null; | |||
1932 | for(size_t loc_l = 0; loc_l < locNewCDCTrackCircles.size(); ++loc_l) | |||
1933 | { | |||
1934 | if(locCDCTrackCircle->dSuperLayerSeeds_Axial != locNewCDCTrackCircles[loc_l]->dSuperLayerSeeds_Axial) | |||
1935 | continue; | |||
1936 | //all axial layers are identical: use previous object | |||
1937 | locNewCDCTrackCircle = locNewCDCTrackCircles[loc_l]; | |||
1938 | } | |||
1939 | if(locNewCDCTrackCircle == NULL__null) | |||
1940 | { | |||
1941 | //new combination of axial layers, create new object | |||
1942 | if(locNewCDCTrackCircles.size() >= MAX_ALLOWED_TRACK_CIRCLES) | |||
1943 | { | |||
1944 | if(DEBUG_LEVEL > 10) | |||
1945 | cout << "Too many track circles; bailing" << endl; | |||
1946 | locCDCTrackCircles.clear(); | |||
1947 | return false; | |||
1948 | } | |||
1949 | locNewCDCTrackCircle = Get_Resource_CDCTrackCircle(); | |||
1950 | locNewCDCTrackCircle->dSuperLayerSeeds_Axial = locCDCTrackCircle->dSuperLayerSeeds_Axial; | |||
1951 | if(!locFromInnerStereoFlag) //if on outer stereo, keep inner stereo results (but not outer stereo!!: will save below) | |||
1952 | locNewCDCTrackCircle->dSuperLayerSeeds_InnerStereo = locCDCTrackCircle->dSuperLayerSeeds_InnerStereo; | |||
1953 | locNewCDCTrackCircles.push_back(locNewCDCTrackCircle); //store new circle for return | |||
1954 | locTrackCircleSavedFlag = true; | |||
1955 | } | |||
1956 | //save this current series of stereo seeds | |||
1957 | if(locFromInnerStereoFlag) | |||
1958 | locNewCDCTrackCircle->dSuperLayerSeeds_InnerStereo.push_back(locStereoSeedSeries); | |||
1959 | else | |||
1960 | locNewCDCTrackCircle->dSuperLayerSeeds_OuterStereo.push_back(locStereoSeedSeries); | |||
1961 | } | |||
1962 | } | |||
1963 | //if true: no combination of stereo seeds from this track circle was linked as a new object, keep as a unique combination | |||
1964 | if(!locTrackCircleSavedFlag) | |||
1965 | locNewCDCTrackCircles.push_back(locCDCTrackCircle); | |||
1966 | } | |||
1967 | ||||
1968 | locCDCTrackCircles = locNewCDCTrackCircles; //"return" "new" track circle objects | |||
1969 | return true; | |||
1970 | } | |||
1971 | ||||
1972 | //------------------------------------- | |||
1973 | // Link_SuperLayers_FromStereo_ToStereo | |||
1974 | //------------------------------------- | |||
1975 | void DTrackCandidate_factory_CDC::Link_SuperLayers_FromStereo_ToStereo(vector<DCDCTrackCircle*>& locCDCTrackCircles, unsigned int locOuterSuperLayer, unsigned int locInnerSuperLayer) | |||
1976 | { | |||
1977 | // Link from a stereo super layer to a stereo super layer. | |||
1978 | ||||
1979 | // loop over track circles | |||
1980 | for(size_t loc_i = 0; loc_i < locCDCTrackCircles.size(); ++loc_i) | |||
1981 | { | |||
1982 | DCDCTrackCircle* locCDCTrackCircle = locCDCTrackCircles[loc_i]; | |||
1983 | ||||
1984 | // if trying to skip a layer, first check to make sure this seed wasn't already linked (to layer "locInnerSuperLayer + 1") | |||
1985 | // axial checked here, stereo checked for each stereo series below | |||
1986 | if(!locCDCTrackCircle->dSuperLayerSeeds_Axial.empty()) | |||
1987 | { | |||
1988 | if(locCDCTrackCircle->dSuperLayerSeeds_Axial.back()->dSuperLayer > locInnerSuperLayer) | |||
1989 | continue; | |||
1990 | } | |||
1991 | ||||
1992 | // determine if linking from the stereo seeds stored in the dSuperLayerSeeds_InnerStereo or dSuperLayerSeeds_OuterStereo vectors | |||
1993 | bool locFromInnerStereoFlag = (locInnerSuperLayer < 4); | |||
1994 | if(!locCDCTrackCircle->dSuperLayerSeeds_Axial.empty()) | |||
1995 | { | |||
1996 | if(locCDCTrackCircle->dSuperLayerSeeds_Axial.back()->dSuperLayer != 4) | |||
1997 | locFromInnerStereoFlag = true; //middle axial layer is missing, store stereo layer as inner | |||
1998 | } | |||
1999 | ||||
2000 | //get series of seeds to loop over | |||
2001 | vector<vector<DCDCSuperLayerSeed*> > locPreLinkedCDCSuperLayerSeeds; | |||
2002 | if(locFromInnerStereoFlag) | |||
2003 | { | |||
2004 | //if on outer stereo seeds but axial seed 4 is missing, use inner stereo seeds | |||
2005 | locPreLinkedCDCSuperLayerSeeds = locCDCTrackCircle->dSuperLayerSeeds_InnerStereo; | |||
2006 | locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.clear(); //reset the existing combos: will re-fill below with the new combos | |||
2007 | } | |||
2008 | else | |||
2009 | { | |||
2010 | //use outer stereo seeds | |||
2011 | locPreLinkedCDCSuperLayerSeeds = locCDCTrackCircle->dSuperLayerSeeds_OuterStereo; //for looping over | |||
2012 | locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.clear(); //reset the existing combos: will re-fill below with the new combos | |||
2013 | } | |||
2014 | ||||
2015 | //loop over each series of stereo seeds | |||
2016 | for(size_t loc_j = 0; loc_j < locPreLinkedCDCSuperLayerSeeds.size(); ++loc_j) | |||
2017 | { | |||
2018 | //get the last DCDCSuperLayerSeed in this stereo seed series | |||
2019 | vector<DCDCSuperLayerSeed*> locStereoSeedSeries = locPreLinkedCDCSuperLayerSeeds[loc_j]; | |||
2020 | DCDCSuperLayerSeed* locSuperLayerSeed1 = locPreLinkedCDCSuperLayerSeeds[loc_j].back(); | |||
2021 | if(DEBUG_LEVEL > 10) | |||
2022 | cout << "Seed 1 Super Layer, Seed Index = " << locSuperLayerSeed1->dSuperLayer << ", " << locSuperLayerSeed1->dSeedIndex << endl; | |||
2023 | ||||
2024 | bool locInnerSeedLinkSuccessfulFlag = false; | |||
2025 | //don't attempt seed link if wrong super layer, or if the inner seed was a definite spiral turn that was turning back inwards, etc. | |||
2026 | if((locSuperLayerSeed1->dSuperLayer == locInnerSuperLayer) && Check_IfShouldAttemptLink(locSuperLayerSeed1, true)) | |||
2027 | { | |||
2028 | //attempt to link to the outer superlayer | |||
2029 | for(size_t loc_k = 0; loc_k < dSuperLayerSeeds[locOuterSuperLayer - 1].size(); ++loc_k) | |||
2030 | { | |||
2031 | DCDCSuperLayerSeed* locSuperLayerSeed2 = dSuperLayerSeeds[locOuterSuperLayer - 1][loc_k]; | |||
2032 | if(DEBUG_LEVEL > 10) | |||
2033 | cout << "Seed 2 Super Layer, Seed Index = " << locSuperLayerSeed2->dSuperLayer << ", " << locSuperLayerSeed2->dSeedIndex << endl; | |||
2034 | if(!Check_IfShouldAttemptLink(locSuperLayerSeed2, false)) | |||
2035 | continue; //don't attempt seed link if the outer seed was a definite spiral turn that was turning back outwards, etc. | |||
2036 | if(DEBUG_LEVEL > 10) | |||
2037 | cout << "Attempting Seed Link" << endl; | |||
2038 | if(!Attempt_SeedLink(locSuperLayerSeed1, locSuperLayerSeed2)) //see if seeds are nearby enough to link | |||
2039 | continue; | |||
2040 | //LINK SUCCESSFUL!! | |||
2041 | if(DEBUG_LEVEL > 10) | |||
2042 | cout << "LINK SUCCESSFUL" << endl; | |||
2043 | locSuperLayerSeed1->linked = true; | |||
2044 | locSuperLayerSeed2->linked = true; | |||
2045 | locInnerSeedLinkSuccessfulFlag = true; | |||
2046 | ||||
2047 | //create vector of new stereo seed series | |||
2048 | vector<DCDCSuperLayerSeed*> locNewStereoSeedSeries = locStereoSeedSeries; | |||
2049 | locNewStereoSeedSeries.push_back(locSuperLayerSeed2); | |||
2050 | ||||
2051 | //save new combination of stereo seeds | |||
2052 | if(locFromInnerStereoFlag) | |||
2053 | locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.push_back(locNewStereoSeedSeries); | |||
2054 | else //outer and middle axial layer isn't missing | |||
2055 | locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.push_back(locNewStereoSeedSeries); | |||
2056 | } | |||
2057 | } | |||
2058 | if(!locInnerSeedLinkSuccessfulFlag) | |||
2059 | { | |||
2060 | //failed to match, but keep seed series | |||
2061 | if(locFromInnerStereoFlag) | |||
2062 | locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.push_back(locStereoSeedSeries); | |||
2063 | else //outer and middle axial layer isn't missing | |||
2064 | locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.push_back(locStereoSeedSeries); | |||
2065 | } | |||
2066 | } | |||
2067 | } | |||
2068 | } | |||
2069 | ||||
2070 | //-------------------------- | |||
2071 | // Check_IfShouldAttemptLink | |||
2072 | //-------------------------- | |||
2073 | bool DTrackCandidate_factory_CDC::Check_IfShouldAttemptLink(const DCDCSuperLayerSeed* locSuperLayerSeed, bool locInnerSeedFlag) | |||
2074 | { | |||
2075 | // don't attempt linking if a definite spiral turn on one of the seeds is turning in the wrong direction | |||
2076 | if(locSuperLayerSeed->dSpiralLinkParams.empty()) | |||
2077 | return true; //should definitely attempt it if not a spiral turn | |||
2078 | ||||
2079 | //get spiral link information | |||
2080 | const map<int, DSpiralParams_t>& locSpiralLinkParams = locSuperLayerSeed->dSpiralLinkParams; | |||
2081 | bool locSelfLinkFlag = (locSpiralLinkParams.find(locSuperLayerSeed->dSeedIndex) != locSpiralLinkParams.end()); //true if spiral-link is within itself | |||
2082 | ||||
2083 | // determine if turning inwards, outwards, or indeterminate | |||
2084 | bool locIsTurningOutwardsFlag = false; | |||
2085 | bool locIsTurningInwardsFlag = false; | |||
2086 | map<int, DSpiralParams_t>::const_iterator locIterator; | |||
2087 | for(locIterator = locSuperLayerSeed->dSpiralLinkParams.begin(); locIterator != locSuperLayerSeed->dSpiralLinkParams.end(); ++locIterator) | |||
2088 | { | |||
2089 | if(locIterator->second.dDefiniteSpiralTurnRingFlag == -1) | |||
2090 | locIsTurningOutwardsFlag = true; | |||
2091 | else if(locIterator->second.dDefiniteSpiralTurnRingFlag == 1) | |||
2092 | locIsTurningInwardsFlag = true; | |||
2093 | } | |||
2094 | if(locIsTurningOutwardsFlag == locIsTurningInwardsFlag) | |||
2095 | return true; //either not a definite spiral turn (both are false), or indeterminate turning direction (both are true) | |||
2096 | ||||
2097 | //check spiral turn direction | |||
2098 | if(locInnerSeedFlag) | |||
2099 | { | |||
2100 | if(!locSelfLinkFlag) | |||
2101 | { | |||
2102 | if(locIsTurningInwardsFlag) | |||
2103 | { | |||
2104 | //spiral turn not linked to itself, inner seed is turning inwards : don't link to next super layer | |||
2105 | if(DEBUG_LEVEL > 10) | |||
2106 | cout << "Seed1 part of spiral turn in different direction, don't link it here." << endl; | |||
2107 | return false; | |||
2108 | } | |||
2109 | } | |||
2110 | else if(locIsTurningOutwardsFlag) | |||
2111 | { | |||
2112 | //spiral turn linked to itself (single ring), on ring in inner-half of the inner super layer used for matching : don't link to next super layer | |||
2113 | if(DEBUG_LEVEL > 10) | |||
2114 | cout << "Seed1 part of spiral turn in different direction, don't link it here." << endl; | |||
2115 | return false; | |||
2116 | } | |||
2117 | } | |||
2118 | else | |||
2119 | { | |||
2120 | if(!locSelfLinkFlag) | |||
2121 | { | |||
2122 | if(locIsTurningOutwardsFlag) | |||
2123 | { | |||
2124 | //spiral turn not linked to itself, outer seed is turning outwards : don't link to previous super layer | |||
2125 | if(DEBUG_LEVEL > 10) | |||
2126 | cout << "Seed2 part of spiral turn in different direction, don't link it here." << endl; | |||
2127 | return false; | |||
2128 | } | |||
2129 | } | |||
2130 | else if(locIsTurningInwardsFlag) | |||
2131 | { | |||
2132 | //spiral turn linked to itself (single ring), on ring in outer-half of the outer super layer used for matching : don't link to previous super layer | |||
2133 | if(DEBUG_LEVEL > 10) | |||
2134 | cout << "Seed2 part of spiral turn in different direction, don't link it here." << endl; | |||
2135 | return false; | |||
2136 | } | |||
2137 | } | |||
2138 | return true; | |||
2139 | } | |||
2140 | ||||
2141 | //----------------- | |||
2142 | // Attempt_SeedLink | |||
2143 | //----------------- | |||
2144 | bool DTrackCandidate_factory_CDC::Attempt_SeedLink(DCDCSuperLayerSeed* locSuperLayerSeed1, DCDCSuperLayerSeed* locSuperLayerSeed2) | |||
2145 | { | |||
2146 | //locSuperLayerSeed1 should be the inner of the two | |||
2147 | wire_direction_t locWireDirection1 = locSuperLayerSeed1->dWireOrientation; | |||
2148 | DCDCRingSeed& locRingSeed1 = locSuperLayerSeed1->dCDCRingSeeds.back(); //largest ring of inner seed selected | |||
2149 | ||||
2150 | //locSuperLayerSeed2 should be the outer of the two | |||
2151 | wire_direction_t locWireDirection2 = locSuperLayerSeed2->dWireOrientation; | |||
2152 | DCDCRingSeed& locRingSeed2 = locSuperLayerSeed2->dCDCRingSeeds.front(); //smallest ring of outer seed selected | |||
2153 | ||||
2154 | return Attempt_SeedLink(locRingSeed1, locRingSeed2, locWireDirection1, locWireDirection2); | |||
2155 | } | |||
2156 | ||||
2157 | //----------------- | |||
2158 | // Attempt_SeedLink | |||
2159 | //----------------- | |||
2160 | bool DTrackCandidate_factory_CDC::Attempt_SeedLink(DCDCRingSeed& locRingSeed1, DCDCRingSeed& locRingSeed2, wire_direction_t locWireDirection1, wire_direction_t locWireDirection2) | |||
2161 | { | |||
2162 | //attempt seed link between ring-seeds | |||
2163 | //should only be called when linking super layers together, and when attempting to link to unused hits | |||
2164 | vector<DCDCTrkHit*> &hits1 = locRingSeed1.hits; | |||
2165 | if(hits1.empty()) | |||
2166 | return false; | |||
2167 | ||||
2168 | vector<DCDCTrkHit*> &hits2 = locRingSeed2.hits; | |||
2169 | if(hits2.empty()) | |||
2170 | return false; | |||
2171 | ||||
2172 | const DCDCWire* wire1 = hits1[0]->hit->wire; | |||
2173 | const DCDCWire* wire2 = hits2[0]->hit->wire; | |||
2174 | ||||
2175 | // Determine the minimum distance between the two sets of hits | |||
2176 | double locMinDist2 = MinDist2(locRingSeed1, locRingSeed2); | |||
2177 | ||||
2178 | // Determine the maximum-allowed transverse distance for linking: is dependent on the orientation of the wires | |||
2179 | //if axial, distance is MAX_HIT_DIST | |||
2180 | //if stereo, distance is MAX_HIT_DIST + 1/2 of the length of the projection of the straw onto the X-Y plane | |||
2181 | //why 1/2? because the wire position (origin) is reported at the midpoint of the straw | |||
2182 | double locMaxDist2; | |||
2183 | if((locWireDirection1 == WIRE_DIRECTION_AXIAL) && (locWireDirection2 == WIRE_DIRECTION_AXIAL)) | |||
2184 | locMaxDist2 = MAX_HIT_DIST2; | |||
2185 | else if((locWireDirection1 == WIRE_DIRECTION_AXIAL) && (locWireDirection2 != WIRE_DIRECTION_AXIAL)) | |||
2186 | { | |||
2187 | locMaxDist2 = MAX_HIT_DIST + 0.5*wire2->L*fabs(sin(wire2->stereo)); | |||
2188 | locMaxDist2 *= locMaxDist2; | |||
2189 | } | |||
2190 | else if((locWireDirection1 != WIRE_DIRECTION_AXIAL) && (locWireDirection2 == WIRE_DIRECTION_AXIAL)) | |||
2191 | { | |||
2192 | locMaxDist2 = MAX_HIT_DIST + 0.5*wire1->L*fabs(sin(wire1->stereo)); | |||
2193 | locMaxDist2 *= locMaxDist2; | |||
2194 | } | |||
2195 | else if((locWireDirection1 == WIRE_DIRECTION_STEREORIGHT) && (locWireDirection2 == WIRE_DIRECTION_STEREOLEFT)) | |||
2196 | { | |||
2197 | locMaxDist2 = MAX_HIT_DIST + 0.5*wire1->L*fabs(sin(wire1->stereo)) + 0.5*wire2->L*fabs(sin(wire2->stereo)); | |||
2198 | locMaxDist2 *= locMaxDist2; | |||
2199 | } | |||
2200 | else if((locWireDirection1 == WIRE_DIRECTION_STEREOLEFT) && (locWireDirection2 == WIRE_DIRECTION_STEREORIGHT)) | |||
2201 | { | |||
2202 | locMaxDist2 = MAX_HIT_DIST + 0.5*wire1->L*fabs(sin(wire1->stereo)) + 0.5*wire2->L*fabs(sin(wire2->stereo)); | |||
2203 | locMaxDist2 *= locMaxDist2; | |||
2204 | } | |||
2205 | else //both stereo left or right | |||
2206 | locMaxDist2 = MAX_HIT_DIST2; | |||
2207 | ||||
2208 | double dr = wire2->origin.Perp() - wire1->origin.Perp(); | |||
2209 | if(DEBUG_LEVEL > 20) | |||
2210 | cout << "locMinDist2, locMaxDist2, dr = " << locMinDist2 << ", " << locMaxDist2 << ", " << dr << endl; | |||
2211 | ||||
2212 | //calculate transverse distance, return whether or not it is too large | |||
2213 | double locTransverseDist2 = locMinDist2 - dr*dr; | |||
2214 | return (locTransverseDist2 < locMaxDist2); | |||
2215 | } | |||
2216 | ||||
2217 | //------------------- | |||
2218 | // Print_TrackCircles | |||
2219 | //------------------- | |||
2220 | void DTrackCandidate_factory_CDC::Print_TrackCircles(vector<DCDCTrackCircle*>& locCDCTrackCircles) | |||
2221 | { | |||
2222 | cout << "Track Circle Super Layer Seeds (Axial, Inner/Outer Stereo):" << endl; | |||
2223 | for(size_t loc_i = 0; loc_i < locCDCTrackCircles.size(); ++loc_i) | |||
2224 | { | |||
2225 | cout << "Track Circle Index = " << loc_i << endl; | |||
2226 | Print_TrackCircle(locCDCTrackCircles[loc_i]); | |||
2227 | } | |||
2228 | } | |||
2229 | ||||
2230 | //------------------ | |||
2231 | // Print_TrackCircle | |||
2232 | //------------------ | |||
2233 | void DTrackCandidate_factory_CDC::Print_TrackCircle(DCDCTrackCircle* locCDCTrackCircle) | |||
2234 | { | |||
2235 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_Axial.size(); ++loc_j) | |||
2236 | cout << "Axial Super Layer, Seed Index = " << locCDCTrackCircle->dSuperLayerSeeds_Axial[loc_j]->dSuperLayer << ", " << locCDCTrackCircle->dSuperLayerSeeds_Axial[loc_j]->dSeedIndex << endl; | |||
2237 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.size(); ++loc_j) | |||
2238 | { | |||
2239 | cout << "Inner Stereo Series " << loc_j << ":" << endl; | |||
2240 | for(size_t loc_k = 0; loc_k < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_j].size(); ++loc_k) | |||
2241 | cout << "Super Layer, Seed Index = " << locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_j][loc_k]->dSuperLayer << ", " << locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_j][loc_k]->dSeedIndex << endl; | |||
2242 | } | |||
2243 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.size(); ++loc_j) | |||
2244 | { | |||
2245 | cout << "Outer Stereo Series " << loc_j << ":" << endl; | |||
2246 | for(size_t loc_k = 0; loc_k < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_j].size(); ++loc_k) | |||
2247 | cout << "Super Layer, Seed Index = " << locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_j][loc_k]->dSuperLayer << ", " << locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_j][loc_k]->dSeedIndex << endl; | |||
2248 | } | |||
2249 | const DHelicalFit* locFit = locCDCTrackCircle->fit; | |||
2250 | if(locFit != NULL__null) | |||
2251 | { | |||
2252 | cout << "Fit h, x0, y0, r0, phi = " << locFit->h << ", " << locFit->x0 << ", " << locFit->y0 << ", " << locFit->r0 << ", " << locFit->phi << endl; | |||
2253 | cout << "Fit Weighted chisq/ndf = " << locCDCTrackCircle->dWeightedChiSqPerDF << endl; | |||
2254 | cout << "Stereo Weighted chisq/ndf = " << locCDCTrackCircle->dWeightedChiSqPerDF_Stereo << endl; | |||
2255 | } | |||
2256 | } | |||
2257 | ||||
2258 | //-------------------------- | |||
2259 | // Reject_DefiniteSpiralArms | |||
2260 | //-------------------------- | |||
2261 | void DTrackCandidate_factory_CDC::Reject_DefiniteSpiralArms(vector<DCDCTrackCircle*>& locCDCTrackCircles) | |||
2262 | { | |||
2263 | //disregard all DCDCTrackCircle objects where the innermost super layer is definitely a spiral turn | |||
2264 | //e.g. the track has already turned backed inwards towards the target, but then turns back outward again towards the BCAL | |||
2265 | vector<DCDCTrackCircle*>::iterator locIterator; | |||
2266 | for(locIterator = locCDCTrackCircles.begin(); locIterator != locCDCTrackCircles.end();) | |||
2267 | { | |||
2268 | DCDCTrackCircle* locCDCTrackCircle = *locIterator; | |||
2269 | ||||
2270 | // get the innermost super layer seed | |||
2271 | DCDCSuperLayerSeed* locInnermostSuperLayerSeed = NULL__null; | |||
2272 | if(!locCDCTrackCircle->dSuperLayerSeeds_Axial.empty()) | |||
2273 | locInnermostSuperLayerSeed = locCDCTrackCircle->dSuperLayerSeeds_Axial.front(); | |||
2274 | if(!locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.empty()) | |||
2275 | { | |||
2276 | DCDCSuperLayerSeed* locTempSuperLayerSeed = locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[0].front(); | |||
2277 | if(locInnermostSuperLayerSeed == NULL__null) | |||
2278 | locInnermostSuperLayerSeed = locTempSuperLayerSeed; | |||
2279 | else if(locTempSuperLayerSeed->dSuperLayer < locInnermostSuperLayerSeed->dSuperLayer) | |||
2280 | locInnermostSuperLayerSeed = locTempSuperLayerSeed; | |||
2281 | } | |||
2282 | else if(!locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.empty()) | |||
2283 | { | |||
2284 | DCDCSuperLayerSeed* locTempSuperLayerSeed = locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[0].front(); | |||
2285 | if(locInnermostSuperLayerSeed == NULL__null) | |||
2286 | locInnermostSuperLayerSeed = locTempSuperLayerSeed; | |||
2287 | else if(locTempSuperLayerSeed->dSuperLayer < locInnermostSuperLayerSeed->dSuperLayer) | |||
2288 | locInnermostSuperLayerSeed = locTempSuperLayerSeed; | |||
2289 | } | |||
2290 | if (locInnermostSuperLayerSeed == NULL__null) | |||
2291 | continue; //is impossible, but clears the warning from the static analyzer | |||
2292 | ||||
2293 | //loop over spiral links, see if one of them is a definite spiral link | |||
2294 | bool locIsDefinitelyTurningFlag = false; | |||
2295 | map<int, DSpiralParams_t>::iterator locSpiralIterator; | |||
2296 | for(locSpiralIterator = locInnermostSuperLayerSeed->dSpiralLinkParams.begin(); locSpiralIterator != locInnermostSuperLayerSeed->dSpiralLinkParams.end(); ++locSpiralIterator) | |||
2297 | { | |||
2298 | if(locSpiralIterator->second.dDefiniteSpiralTurnRingFlag == 0) | |||
2299 | continue; | |||
2300 | locIsDefinitelyTurningFlag = true; | |||
2301 | break; | |||
2302 | } | |||
2303 | ||||
2304 | //if definitely a spiral turn in its innermost super layer: then delete the track circle: does not originate from the target | |||
2305 | if(locIsDefinitelyTurningFlag) | |||
2306 | { | |||
2307 | Recycle_DCDCTrackCircle(locCDCTrackCircle); //recycle | |||
2308 | locIterator = locCDCTrackCircles.erase(locIterator); | |||
2309 | } | |||
2310 | else | |||
2311 | ++locIterator; | |||
2312 | } | |||
2313 | } | |||
2314 | ||||
2315 | //---------------------- | |||
2316 | // Drop_IncompleteGroups | |||
2317 | //---------------------- | |||
2318 | void DTrackCandidate_factory_CDC::Drop_IncompleteGroups(vector<DCDCTrackCircle*>& locCDCTrackCircles) | |||
2319 | { | |||
2320 | // Only interested in groups that contain either: | |||
2321 | // At least super layer 1 (forward going particles) | |||
2322 | // Or at least one stereo layer and one axial layer | |||
2323 | vector<DCDCTrackCircle*>::iterator locIterator; | |||
2324 | for(locIterator = locCDCTrackCircles.begin(); locIterator != locCDCTrackCircles.end();) | |||
2325 | { | |||
2326 | DCDCTrackCircle* locCDCTrackCircle = *locIterator; | |||
2327 | if(locCDCTrackCircle->dSuperLayerSeeds_Axial.empty()) | |||
2328 | { | |||
2329 | Recycle_DCDCTrackCircle(locCDCTrackCircle); //recycle | |||
2330 | locIterator = locCDCTrackCircles.erase(locIterator); //no axial super layers | |||
2331 | continue; | |||
2332 | } | |||
2333 | ||||
2334 | if(locCDCTrackCircle->dSuperLayerSeeds_Axial.front()->dSuperLayer == 1) | |||
2335 | { | |||
2336 | ++locIterator; //has super layer 1: group is OK | |||
2337 | continue; | |||
2338 | } | |||
2339 | ||||
2340 | if(locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.empty() && locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.empty()) | |||
2341 | { | |||
2342 | Recycle_DCDCTrackCircle(locCDCTrackCircle); //recycle | |||
2343 | locIterator = locCDCTrackCircles.erase(locIterator); //no stereo super layers | |||
2344 | } | |||
2345 | else | |||
2346 | ++locIterator; //has at least one axial & one stereo super layer: group is OK | |||
2347 | } | |||
2348 | } | |||
2349 | ||||
2350 | //------------ | |||
2351 | // Fit_Circles | |||
2352 | //------------ | |||
2353 | void DTrackCandidate_factory_CDC::Fit_Circles(vector<DCDCTrackCircle*>& locCDCTrackCircles, bool locFitOnlyIfNullFitFlag, bool locAddStereoLayerIntersectionsFlag, bool locFitDuringLinkingFlag) | |||
2354 | { | |||
2355 | /// Do a quick fit of the 2-D projection of the axial hits in the seed to a circle | |||
2356 | /// Include intersection between stereo layer seeds if locAddStereoLayerIntersectionsFlag = true (assumes only one stereo seed series for each inner/outer) | |||
2357 | /// Determine the sign of the charge (and correspondingly the initial phi angle) | |||
2358 | /// assuming that the majority of hits come from the outgoing part of the track. | |||
2359 | ||||
2360 | /// If the resulting circle passes within MAX_HIT_DIST the majority of the hits, | |||
2361 | /// then the fit was a success. Otherwise it is a failure and the DCDCTrackCircle is discarded. | |||
2362 | ||||
2363 | /// locFitOnlyIfNullFitFlag should be false unless just truncated the input set of circles | |||
2364 | /// if true, this will skip fitting circles that have DCDCTrackCircle::fit != NULL (i.e. were not truncated) | |||
2365 | ||||
2366 | double locAxialStrawVariance = 0.214401; //[d/sqrt(12)]^2, d = 1.604 = straw diameter | |||
2367 | vector<DCDCTrackCircle*>::iterator locIterator; | |||
2368 | for(locIterator = locCDCTrackCircles.begin(); locIterator != locCDCTrackCircles.end();) | |||
2369 | { | |||
2370 | DCDCTrackCircle* locCDCTrackCircle = *locIterator; | |||
2371 | size_t locNumAxialSuperLayers = locCDCTrackCircle->dSuperLayerSeeds_Axial.size(); | |||
2372 | ||||
2373 | if(locFitDuringLinkingFlag && (locNumAxialSuperLayers < 2)) | |||
2374 | { | |||
2375 | //just trying to reduce number of circles during super layer linking; don't try to fit & don't reject yet | |||
2376 | ++locIterator; | |||
2377 | continue; | |||
2378 | } | |||
2379 | ||||
2380 | if(locCDCTrackCircle->dSuperLayerSeeds_Axial.empty()) | |||
2381 | { | |||
2382 | //no axial hits: cannot fit circle: reject | |||
2383 | Recycle_DCDCTrackCircle(locCDCTrackCircle); //recycle | |||
2384 | locIterator = locCDCTrackCircles.erase(locIterator); | |||
2385 | continue; | |||
2386 | } | |||
2387 | ||||
2388 | if(locFitOnlyIfNullFitFlag && (locCDCTrackCircle->fit != NULL__null)) | |||
2389 | { | |||
2390 | ++locIterator; | |||
2391 | continue; //fit is not null: & locFitOnlyIfNullFitFlag is true: circle not truncated, don't refit | |||
2392 | } | |||
2393 | ||||
2394 | // Setup the fit (add hits) | |||
2395 | DHelicalFit* locFit = Get_Resource_HelicalFit(); | |||
2396 | unsigned int locNumHitsInFit = 0; | |||
2397 | for(size_t loc_i = 0; loc_i < locNumAxialSuperLayers; ++loc_i) | |||
2398 | { | |||
2399 | vector<DCDCTrkHit*> hits; | |||
2400 | locCDCTrackCircle->dSuperLayerSeeds_Axial[loc_i]->Get_Hits(hits); | |||
2401 | for(size_t k = 0; k < hits.size(); ++k) | |||
2402 | { | |||
2403 | if(hits[k]->flags & OUT_OF_TIME) | |||
2404 | continue; | |||
2405 | DVector3 pos = hits[k]->hit->wire->origin; | |||
2406 | locFit->AddHitXYZ(pos.x(), pos.y(), pos.z(), locAxialStrawVariance, locAxialStrawVariance, 0.0); | |||
2407 | ++locNumHitsInFit; | |||
2408 | } | |||
2409 | } | |||
2410 | ||||
2411 | //add intersections between stereo super layers if desired | |||
2412 | //only uses the first combination of stereo super layers (series) | |||
2413 | if(locAddStereoLayerIntersectionsFlag) | |||
2414 | { | |||
2415 | DCDCSuperLayerSeed* locInnerSuperLayerSeed = locCDCTrackCircle->Get_SuperLayerSeed(2); | |||
2416 | DCDCSuperLayerSeed* locOuterSuperLayerSeed = locCDCTrackCircle->Get_SuperLayerSeed(3); | |||
2417 | if((locInnerSuperLayerSeed != NULL__null) && (locOuterSuperLayerSeed != NULL__null)) | |||
2418 | { | |||
2419 | // Add intersection between super layers 2 & 3 | |||
2420 | DVector3 locIntersection = Find_IntersectionBetweenSuperLayers(locInnerSuperLayerSeed, locOuterSuperLayerSeed); | |||
2421 | //are these the correct uncertainties? | |||
2422 | locFit->AddHitXYZ(locIntersection.x(), locIntersection.y(), locIntersection.z(), locAxialStrawVariance, locAxialStrawVariance, 0.0); | |||
2423 | } | |||
2424 | locInnerSuperLayerSeed = locCDCTrackCircle->Get_SuperLayerSeed(5); | |||
2425 | locOuterSuperLayerSeed = locCDCTrackCircle->Get_SuperLayerSeed(6); | |||
2426 | if((locInnerSuperLayerSeed != NULL__null) && (locOuterSuperLayerSeed != NULL__null)) | |||
2427 | { | |||
2428 | // Add intersection between super layers 5 & 6 | |||
2429 | DVector3 locIntersection = Find_IntersectionBetweenSuperLayers(locInnerSuperLayerSeed, locOuterSuperLayerSeed); | |||
2430 | //are these the correct uncertainties? | |||
2431 | locFit->AddHitXYZ(locIntersection.x(), locIntersection.y(), locIntersection.z(), locAxialStrawVariance, locAxialStrawVariance, 0.0); | |||
2432 | } | |||
2433 | } | |||
2434 | ||||
2435 | //place a tighter constraint on the beam center if fewer hits: tracks with detached vertices may not go through the center | |||
2436 | double locBeamRMS = BeamRMS0.5*locNumAxialSuperLayers; //1sigma = 0.5, 1.0, 1.5 //3sigma = 1.5, 3.0, 4.5 | |||
2437 | ||||
2438 | // Perform the fit | |||
2439 | if(locFit->FitCircleRiemann(TARGET_Z, locBeamRMS) != NOERROR) | |||
2440 | { | |||
2441 | if(DEBUG_LEVEL > 3) | |||
2442 | cout << "Riemann fit failed. Attempting regression fit..." << endl; | |||
2443 | if(locFit->FitCircle() != NOERROR) | |||
2444 | { | |||
2445 | if(DEBUG_LEVEL > 3) | |||
2446 | cout << "Regression circle fit failed. Trying straight line." << endl; | |||
2447 | if(locFit->FitCircleStraightTrack() != NOERROR) | |||
2448 | { | |||
2449 | if(DEBUG_LEVEL > 3) | |||
2450 | cout << "Trying straight line fit failed. Giving up." << endl; | |||
2451 | Recycle_DCDCTrackCircle(locCDCTrackCircle); //recycle | |||
2452 | locIterator = locCDCTrackCircles.erase(locIterator); | |||
2453 | continue; | |||
2454 | } | |||
2455 | } | |||
2456 | else | |||
2457 | locFit->FindSenseOfRotation(); | |||
2458 | } | |||
2459 | else | |||
2460 | locFit->GuessChargeFromCircleFit(); // for Riemann fit | |||
2461 | ||||
2462 | // Check if majority of hits are close to circle. Also calculate the avg drift time for the hits close to the circle. | |||
2463 | double x0 = locFit->x0; | |||
2464 | double y0 = locFit->y0; | |||
2465 | double r0 = locFit->r0; | |||
2466 | size_t locNumHitsCloseToCircle = 0; | |||
2467 | double locAverageDriftTime = 0.0; | |||
2468 | unsigned int locTotalNumHits = 0; | |||
2469 | for(size_t loc_i = 0; loc_i < locNumAxialSuperLayers; ++loc_i) | |||
2470 | { | |||
2471 | vector<DCDCTrkHit*> hits; | |||
2472 | locCDCTrackCircle->dSuperLayerSeeds_Axial[loc_i]->Get_Hits(hits); | |||
2473 | locTotalNumHits += hits.size(); | |||
2474 | for(size_t k = 0; k < hits.size(); ++k) | |||
2475 | { | |||
2476 | if(hits[k]->flags & OUT_OF_TIME) | |||
2477 | continue; | |||
2478 | double dx = hits[k]->hit->wire->origin.X() - x0; | |||
2479 | double dy = hits[k]->hit->wire->origin.Y() - y0; | |||
2480 | double d = sqrt(dx*dx + dy*dy); | |||
2481 | if(DEBUG_LEVEL > 15) | |||
2482 | cout << "dist = " << d - r0 << endl; | |||
2483 | if(fabs(d - r0) > MAX_HIT_DIST) | |||
2484 | continue; | |||
2485 | ++locNumHitsCloseToCircle; | |||
2486 | locAverageDriftTime += hits[k]->hit->tdrift; | |||
2487 | } | |||
2488 | } | |||
2489 | locAverageDriftTime /= ((double)locNumHitsCloseToCircle); | |||
2490 | ||||
2491 | if(DEBUG_LEVEL > 3) | |||
2492 | cout << "Circle fit: Nhits=" << locFit->GetNhits() << " h=" << locFit->h << " N=" << locNumHitsCloseToCircle << " phi=" << locFit->phi << endl; | |||
2493 | if(locNumHitsCloseToCircle < MIN_SEED_HITS) | |||
2494 | { | |||
2495 | if(DEBUG_LEVEL > 3) | |||
2496 | cout << "Rejected circle fit due to too few hits on track (N=" << locNumHitsCloseToCircle << " MIN_SEED_HITS=" << MIN_SEED_HITS << ")" << endl; | |||
2497 | Recycle_DCDCTrackCircle(locCDCTrackCircle); //recycle | |||
2498 | locIterator = locCDCTrackCircles.erase(locIterator); | |||
2499 | continue; | |||
2500 | } | |||
2501 | ||||
2502 | if(locNumHitsCloseToCircle < locTotalNumHits/2) | |||
2503 | { | |||
2504 | if(DEBUG_LEVEL > 3) | |||
2505 | cout << "Rejected circle fit due to minority of hits on track (N=" << locNumHitsCloseToCircle << " locTotalNumHits/2=" << locTotalNumHits/2 << ")" << endl; | |||
2506 | Recycle_DCDCTrackCircle(locCDCTrackCircle); //recycle | |||
2507 | locIterator = locCDCTrackCircles.erase(locIterator); | |||
2508 | continue; | |||
2509 | } | |||
2510 | ||||
2511 | // Fit is good, save fit results | |||
2512 | locCDCTrackCircle->fit = locFit; | |||
2513 | double locWeightedChiSqPerDF = ((fabs(locFit->chisq) > 0.0) && (locFit->ndof > 0)) ? locFit->chisq/(float(locFit->ndof*locNumAxialSuperLayers*locNumAxialSuperLayers)) : 9.9E50; | |||
2514 | if(DEBUG_LEVEL > 10) | |||
2515 | cout << "chisq, ndof, numaxial, weightedchisq = " << locFit->chisq << ", " << locFit->ndof << ", " << locNumAxialSuperLayers << ", " << locWeightedChiSqPerDF << endl; | |||
2516 | locCDCTrackCircle->dWeightedChiSqPerDF = locWeightedChiSqPerDF; | |||
2517 | locCDCTrackCircle->dAverageDriftTime = locAverageDriftTime; | |||
2518 | ||||
2519 | ++locIterator; | |||
2520 | } | |||
2521 | } | |||
2522 | ||||
2523 | //------------------------------------ | |||
2524 | // Find_IntersectionBetweenSuperLayers | |||
2525 | //------------------------------------ | |||
2526 | DVector3 DTrackCandidate_factory_CDC::Find_IntersectionBetweenSuperLayers(const DCDCSuperLayerSeed* locInnerSuperLayerSeed, const DCDCSuperLayerSeed* locOuterSuperLayerSeed) | |||
2527 | { | |||
2528 | const DCDCRingSeed& locInnerSuperLayerRing = locInnerSuperLayerSeed->dCDCRingSeeds.back(); //last ring of inner super layer | |||
2529 | const DCDCRingSeed& locOuterSuperLayerRing = locOuterSuperLayerSeed->dCDCRingSeeds.front(); //first ring of outer super layer | |||
2530 | ||||
2531 | const DCDCWire* first_wire = locInnerSuperLayerRing.hits.front()->hit->wire; | |||
2532 | const DCDCWire* second_wire = locOuterSuperLayerRing.hits.front()->hit->wire; | |||
2533 | ||||
2534 | DVector3 u0=first_wire->origin; | |||
2535 | DVector3 udir=first_wire->udir; | |||
2536 | DVector3 v0=second_wire->origin; | |||
2537 | DVector3 vdir=second_wire->udir; | |||
2538 | DVector3 diff=u0-v0; | |||
2539 | double u_dot_v=udir.Dot(vdir); | |||
2540 | double u_dot_diff=udir.Dot(diff); | |||
2541 | double v_dot_diff=vdir.Dot(diff); | |||
2542 | double scale=1./(1.-u_dot_v*u_dot_v); | |||
2543 | double ul=scale*(u_dot_v*v_dot_diff-u_dot_diff); | |||
2544 | double vl=scale*(v_dot_diff-u_dot_v*u_dot_diff); | |||
2545 | DVector3 pos=0.5*(u0+ul*udir+v0+vl*vdir); | |||
2546 | ||||
2547 | if(DEBUG_LEVEL > 10) | |||
2548 | cout << "XYZ intersection between SL" << locInnerSuperLayerSeed->dSuperLayer << " and SL" << locOuterSuperLayerSeed->dSuperLayer << ": " << pos.X() << ", " << pos.Y() << ", " << pos.Z() << endl; | |||
2549 | return pos; | |||
2550 | } | |||
2551 | ||||
2552 | /*********************************************************************************************************************************************************************/ | |||
2553 | /*************************************************************** Filter Track Circles and Stereo Wires ***************************************************************/ | |||
2554 | /*********************************************************************************************************************************************************************/ | |||
2555 | ||||
2556 | //----------------------- | |||
2557 | // Handle_StereoAndFilter | |||
2558 | //----------------------- | |||
2559 | void DTrackCandidate_factory_CDC::Handle_StereoAndFilter(vector<DCDCTrackCircle*>& locCDCTrackCircles, bool locFinalPassFlag) | |||
2560 | { | |||
2561 | // If not on final (refinement) pass: First (potentially) truncate and then filter track circles based on track circle fit results | |||
2562 | if(!locFinalPassFlag) | |||
2563 | { | |||
2564 | Truncate_TrackCircles(locCDCTrackCircles); | |||
2565 | Set_HitBitPattern_Axial(locCDCTrackCircles); | |||
2566 | Filter_TrackCircles_Axial(locCDCTrackCircles); | |||
2567 | if(DEBUG_LEVEL > 5) | |||
2568 | { | |||
2569 | cout << "post filter clone seeds" << endl; | |||
2570 | Print_TrackCircles(locCDCTrackCircles); | |||
2571 | } | |||
2572 | } | |||
2573 | ||||
2574 | // Create new stereo super layer seeds and select the best ones. | |||
2575 | //This is done one track at a time to prevent memory spikes (memory is recycled as "new" stereo hits are rejected) | |||
2576 | vector<DCDCTrackCircle*>::iterator locIterator; | |||
2577 | size_t locCircleCounter = 0; | |||
2578 | for(locIterator = locCDCTrackCircles.begin(); locIterator != locCDCTrackCircles.end();) | |||
2579 | { | |||
2580 | if(DEBUG_LEVEL > 5) | |||
2581 | cout << "Create new Super Layer Seeds for Track Circle " << locCircleCounter << endl; | |||
2582 | // Create new super layer seeds: find the intersection between the stereo hits and the circle fit and create new seeds with that information | |||
2583 | Create_NewCDCSuperLayerSeeds(*locIterator); | |||
2584 | if(DEBUG_LEVEL > 5) | |||
2585 | cout << "Select Super Layer Seeds for Track Circle " << locCircleCounter << endl; | |||
2586 | // Select the combination of super layer seeds that give the best determination of theta/z for this track. | |||
2587 | // Rejects the track if on the final pass and no valid theta/z can be calculated. | |||
2588 | if(Select_CDCSuperLayerSeeds(*locIterator, locFinalPassFlag)) | |||
2589 | ++locIterator; | |||
2590 | else | |||
2591 | { | |||
2592 | Recycle_DCDCTrackCircle(*locIterator); //recycle | |||
2593 | locIterator = locCDCTrackCircles.erase(locIterator); | |||
2594 | } | |||
2595 | ++locCircleCounter; | |||
2596 | } | |||
2597 | Set_HitBitPattern_All(locCDCTrackCircles); | |||
2598 | ||||
2599 | // If not on final (refinement) pass: Filter track circles based on stereo results | |||
2600 | if(!locFinalPassFlag) | |||
2601 | { | |||
2602 | if(DEBUG_LEVEL > 5) | |||
2603 | { | |||
2604 | cout << "stereo-selected track circles" << endl; | |||
2605 | Print_TrackCircles(locCDCTrackCircles); | |||
2606 | } | |||
2607 | // Filter out duplicates seeds and definite spiral arms. | |||
2608 | Filter_TrackCircles_Stereo(locCDCTrackCircles); | |||
2609 | if(DEBUG_LEVEL > 5) | |||
2610 | { | |||
2611 | cout << "stereo-filtered track circles" << endl; | |||
2612 | Print_TrackCircles(locCDCTrackCircles); | |||
2613 | } | |||
2614 | } | |||
2615 | } | |||
2616 | ||||
2617 | //------------------------ | |||
2618 | // Set_HitBitPattern_Axial | |||
2619 | //------------------------ | |||
2620 | void DTrackCandidate_factory_CDC::Set_HitBitPattern_Axial(vector<DCDCTrackCircle*>& locCDCTrackCircles) | |||
2621 | { | |||
2622 | unsigned int locNumBits = 8*sizeof(unsigned int); | |||
2623 | for(size_t loc_i = 0; loc_i < locCDCTrackCircles.size(); ++loc_i) | |||
2624 | { | |||
2625 | DCDCTrackCircle* locCDCTrackCircle = locCDCTrackCircles[loc_i]; | |||
2626 | locCDCTrackCircle->HitBitPattern.clear(); | |||
2627 | locCDCTrackCircle->HitBitPattern.resize(dNumCDCHits/(8*sizeof(unsigned int)) + 1); | |||
2628 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_Axial.size(); ++loc_j) | |||
2629 | { | |||
2630 | vector<DCDCTrkHit*> locHits; | |||
2631 | locCDCTrackCircle->dSuperLayerSeeds_Axial[loc_j]->Get_Hits(locHits); | |||
2632 | for(size_t loc_k = 0; loc_k < locHits.size(); ++loc_k) | |||
2633 | locCDCTrackCircle->HitBitPattern[locHits[loc_k]->index/locNumBits] |= 1 << locHits[loc_k]->index % locNumBits; | |||
2634 | } | |||
2635 | } | |||
2636 | } | |||
2637 | ||||
2638 | //---------------------- | |||
2639 | // Truncate_TrackCircles | |||
2640 | //---------------------- | |||
2641 | void DTrackCandidate_factory_CDC::Truncate_TrackCircles(vector<DCDCTrackCircle*>& locCDCTrackCircles) | |||
2642 | { | |||
2643 | if(locCDCTrackCircles.empty()) | |||
2644 | return; | |||
2645 | ||||
2646 | // This routine is designed to save tracks that exit the drift chamber early (e.g. before SL7) when there are other tracks nearby (in phi) | |||
2647 | // The problem is when these tracks get mixed together, the track that goes most-radially-outward in the CDC generally wins | |||
2648 | // e.g. A track not reaching SL7 can match to the other track's SL7, so its fit is worse than it should be | |||
2649 | // And, if the two tracks share many hits (such as SL7), then the track not hitting SL7 tends to get rejected | |||
2650 | ||||
2651 | // It should almost be impossible for two tracks to have identical DCDCSuperLayerSeed's AND for all hits to belong to both tracks. | |||
2652 | // Two crossing tracks should almost always have different DCDCSuperLayerSeed's that share hits between them. | |||
2653 | // If the DCDCSuperLayerSeed truly ought to belong to both tracks, stripping hits won't kill the track anyway: it should still be reconstructable | |||
2654 | ||||
2655 | // To save these tracks, look for pairs of tracks that have identical axial DCDCSuperLayerSeed's: first in super layer 7 | |||
2656 | // If the seeds in SL7 are identical, strip SL6 & SL7 from the track with the worse circle-fit weighted chisq/ndf. | |||
2657 | // If the seeds in SL4 are also identical in this pair, strip everything but SL1 & SL2 from the track with the worse circle-fit weighted chisq/ndf and refit it. | |||
2658 | // If the axial super layer seeds in the truncated circle are not unique, merge it with the other existing DCDCTrackCircle | |||
2659 | // If this truncated DCDCTrackCircle is merely a subset of a different DCDCTrackCircle, delete it. | |||
2660 | // Refit the newly-truncated track circles. | |||
2661 | ||||
2662 | // Next look for pairs of tracks that have identical DCDCSuperLayerSeed's in super layer 4 | |||
2663 | // If the track with the worse circle-fit weighted chisq/ndf has an SL7, DO NOT truncate it (it is a unique SL7 (else would have been rejected earlier)) | |||
2664 | // Otherwise, if the seeds in SL4 are identical, strip SL3+ from the track with the worse circle-fit weighted chisq/ndf and refit it. | |||
2665 | // If the axial super layer seeds in the truncated circle are not unique, merge it with the other existing DCDCTrackCircle | |||
2666 | // If this truncated DCDCTrackCircle is merely a subset of a different DCDCTrackCircle, delete it. | |||
2667 | // Refit the newly-truncated track circles. | |||
2668 | ||||
2669 | //first initialize "DCDCTrackCircle::dHasNonTruncatedSeedsFlag" variables | |||
2670 | //these are useful for determining whether or not any of the stereo seeds in the track circle are unique, or whether they all came from a truncation | |||
2671 | //this is necessary because after truncating a circle, it may have the same axial super layers as another track circle, with which it will be merged. | |||
2672 | //You need to know if any of the stereo combinations in a track circle are unique when determining whether the truncation result is merely a subset of another track | |||
2673 | for(size_t loc_i = 0; loc_i < locCDCTrackCircles.size(); ++loc_i) | |||
2674 | { | |||
2675 | if(!locCDCTrackCircles[loc_i]->dSuperLayerSeeds_InnerStereo.empty()) | |||
2676 | locCDCTrackCircles[loc_i]->dHasNonTruncatedSeedsFlag_InnerStereo = true; | |||
2677 | if(!locCDCTrackCircles[loc_i]->dSuperLayerSeeds_OuterStereo.empty()) | |||
2678 | locCDCTrackCircles[loc_i]->dHasNonTruncatedSeedsFlag_OuterStereo = true; | |||
2679 | else if(locCDCTrackCircles[loc_i]->Get_LastSuperLayerSeed()->dSuperLayer > 4) | |||
2680 | locCDCTrackCircles[loc_i]->dHasNonTruncatedSeedsFlag_OuterStereo = true; //e.g. SL4 is missing, so outers are grouped with inners | |||
2681 | } | |||
2682 | ||||
2683 | //assumes input circles are sorted, with largest chisq/ndf first and smallest last | |||
2684 | //want to compare the worst fit to the best fit | |||
2685 | vector<DCDCTrackCircle*>::iterator locIterator_Validating, locIterator_ToCompareTo; | |||
2686 | ||||
2687 | // FIRST CHECK FOR SAME SUPER LAYER SEED IN SL7 | |||
2688 | bool locTruncationPerformedFlag = false; | |||
2689 | for(locIterator_Validating = locCDCTrackCircles.begin(); locIterator_Validating != locCDCTrackCircles.end(); ++locIterator_Validating) | |||
2690 | { | |||
2691 | DCDCTrackCircle* locCDCTrackCircle_Validating = *locIterator_Validating; //this has the worst circle-fit weighted chisq/ndf (and decreasing) | |||
2692 | if(DEBUG_LEVEL > 10) | |||
2693 | { | |||
2694 | cout << "validating: search for SL7 truncation for circle with axial seeds:" << endl; | |||
2695 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle_Validating->dSuperLayerSeeds_Axial.size(); ++loc_j) | |||
2696 | cout << "Axial Super Layer, Seed Index = " << locCDCTrackCircle_Validating->dSuperLayerSeeds_Axial[loc_j]->dSuperLayer << ", " << locCDCTrackCircle_Validating->dSuperLayerSeeds_Axial[loc_j]->dSeedIndex << endl; | |||
2697 | } | |||
2698 | ||||
2699 | DCDCSuperLayerSeed* locSuperLayerSeed_Validating = locCDCTrackCircle_Validating->Get_SuperLayerSeed(7); | |||
2700 | if(locSuperLayerSeed_Validating == NULL__null) | |||
2701 | continue; //this track circle has no SL7 | |||
2702 | ||||
2703 | for(locIterator_ToCompareTo = --(locCDCTrackCircles.end()); locIterator_ToCompareTo != locIterator_Validating; --locIterator_ToCompareTo) | |||
2704 | { | |||
2705 | DCDCTrackCircle* locCDCTrackCircle_ToCompareTo = *locIterator_ToCompareTo; //this has the best circle-fit weighted chisq/ndf (and increasing) | |||
2706 | if(DEBUG_LEVEL > 10) | |||
2707 | { | |||
2708 | cout << "to-compare-to: search for SL7 truncation for circle with axial seeds:" << endl; | |||
2709 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle_ToCompareTo->dSuperLayerSeeds_Axial.size(); ++loc_j) | |||
2710 | cout << "Axial Super Layer, Seed Index = " << locCDCTrackCircle_ToCompareTo->dSuperLayerSeeds_Axial[loc_j]->dSuperLayer << ", " << locCDCTrackCircle_ToCompareTo->dSuperLayerSeeds_Axial[loc_j]->dSeedIndex << endl; | |||
2711 | } | |||
2712 | ||||
2713 | DCDCSuperLayerSeed* locSuperLayerSeed_ToCompareTo = locCDCTrackCircle_ToCompareTo->Get_SuperLayerSeed(7); | |||
2714 | if(locSuperLayerSeed_Validating != locSuperLayerSeed_ToCompareTo) | |||
2715 | continue; //different seed for SL7 | |||
2716 | ||||
2717 | //track circles have identical seeds in SL7: should almost never be possible for both to be good tracks AND for all of the hits to belong to both | |||
2718 | // if two tracks are crossing they should almost always have different super layer seeds (that share hits) | |||
2719 | // if they are somehow both good tracks, stripping hits won't be the end of the world: track should still be reconstructable with a subset of them | |||
2720 | ||||
2721 | //check to see if SL4 is identical also | |||
2722 | locSuperLayerSeed_Validating = locCDCTrackCircle_Validating->Get_SuperLayerSeed(4); | |||
2723 | locSuperLayerSeed_ToCompareTo = locCDCTrackCircle_ToCompareTo->Get_SuperLayerSeed(4); | |||
2724 | if(locSuperLayerSeed_Validating == locSuperLayerSeed_ToCompareTo) | |||
2725 | { | |||
2726 | // SL4 is identical (or missing from both): strip everything from (and including) SL3 and outwards from the track with lower chisq/ndf | |||
2727 | //don't trust SL3 since it led to SL4: hit selector can (in theory) pick up the hits later if needed | |||
2728 | //impossible for SL1 to also be identical: would be same object because all axials would be the same | |||
2729 | if(DEBUG_LEVEL > 5) | |||
2730 | cout << "SL7's and SL4's identical: truncate to SL2" << endl; | |||
2731 | locCDCTrackCircle_Validating->Truncate_Circle(2); //2: new last super layer | |||
2732 | if(DEBUG_LEVEL > 20) | |||
2733 | { | |||
2734 | cout << "post truncate" << endl; | |||
2735 | Print_TrackCircle(locCDCTrackCircle_Validating); | |||
2736 | } | |||
2737 | } | |||
2738 | else | |||
2739 | { | |||
2740 | // SL4 is different: strip SL6 & SL7 from the track with lower chisq/ndf | |||
2741 | //don't trust SL6 since it led to SL7: hit selector can (in theory) pick up the hits later if needed | |||
2742 | if(DEBUG_LEVEL > 5) | |||
2743 | cout << "SL7's identical (but not SL4's): truncate to SL5" << endl; | |||
2744 | locCDCTrackCircle_Validating->Truncate_Circle(5); //5: new last super layer | |||
2745 | if(DEBUG_LEVEL > 20) | |||
2746 | { | |||
2747 | cout << "post truncate" << endl; | |||
2748 | Print_TrackCircle(locCDCTrackCircle_Validating); | |||
2749 | } | |||
2750 | } | |||
2751 | ||||
2752 | //reset fit | |||
2753 | dHelicalFitPool_Available.push_back(locCDCTrackCircle_Validating->fit); //will redo the fit: recycle the memory | |||
2754 | locCDCTrackCircle_Validating->fit = NULL__null; //indicate need to reperform fit | |||
2755 | ||||
2756 | //update truncation sources | |||
2757 | locCDCTrackCircle_Validating->dTruncationSourceCircles.push_back(locCDCTrackCircle_ToCompareTo); | |||
2758 | ||||
2759 | locTruncationPerformedFlag = true; | |||
2760 | break; //truncation successful | |||
2761 | } | |||
2762 | } | |||
2763 | ||||
2764 | if(locTruncationPerformedFlag) | |||
2765 | { | |||
2766 | //now merge any track circles that have identical axial super layers | |||
2767 | //e.g. two tracks have SL1 & SL4 but different SL7, and their SL7's are rejected by other tracks who have the same SL7s | |||
2768 | //loop order doesn't really matter here, keeping consistent anyway | |||
2769 | for(locIterator_Validating = locCDCTrackCircles.begin(); locIterator_Validating != locCDCTrackCircles.end();) | |||
2770 | { | |||
2771 | DCDCTrackCircle* locCDCTrackCircle_Validating = *locIterator_Validating; | |||
2772 | bool locMergedTrackCircleFlag = false; | |||
2773 | for(locIterator_ToCompareTo = --(locCDCTrackCircles.end()); locIterator_ToCompareTo != locIterator_Validating; --locIterator_ToCompareTo) | |||
2774 | { | |||
2775 | DCDCTrackCircle* locCDCTrackCircle_ToCompareTo = *locIterator_ToCompareTo; | |||
2776 | if(locCDCTrackCircle_Validating->dSuperLayerSeeds_Axial != locCDCTrackCircle_ToCompareTo->dSuperLayerSeeds_Axial) | |||
2777 | continue; //not identical | |||
2778 | //identical axial super layers: merge track circles (absorb the "Validating" one into the "ToCompareTo" one //which is which doesn't matter) | |||
2779 | if(DEBUG_LEVEL > 20) | |||
2780 | { | |||
2781 | cout << "sl7 merging circles: validating = " << endl; | |||
2782 | Print_TrackCircle(locCDCTrackCircle_Validating); | |||
2783 | cout << "sl7 merging circles: to-compare-to = " << endl; | |||
2784 | Print_TrackCircle(locCDCTrackCircle_ToCompareTo); | |||
2785 | } | |||
2786 | locCDCTrackCircle_ToCompareTo->Absorb_TrackCircle(locCDCTrackCircle_Validating); | |||
2787 | if(DEBUG_LEVEL > 20) | |||
2788 | { | |||
2789 | cout << "sl7 merge circles: output = " << endl; | |||
2790 | Print_TrackCircle(locCDCTrackCircle_ToCompareTo); | |||
2791 | } | |||
2792 | locMergedTrackCircleFlag = true; | |||
2793 | break; | |||
2794 | } | |||
2795 | if(locMergedTrackCircleFlag) | |||
2796 | { | |||
2797 | Recycle_DCDCTrackCircle(locCDCTrackCircle_Validating); //recycle | |||
2798 | locIterator_Validating = locCDCTrackCircles.erase(locIterator_Validating); | |||
2799 | } | |||
2800 | else | |||
2801 | ++locIterator_Validating; | |||
2802 | } | |||
2803 | ||||
2804 | //now check to see if any of the newly-truncated track circles is merely a subset of a different circle (regardless of which chisq/ndf is lower) | |||
2805 | //is a subset if the axials are a subset AND the outermost stereo layers dHasNonTruncatedSeedsFlag is false | |||
2806 | //if one is a subset of another, delete it | |||
2807 | for(locIterator_Validating = locCDCTrackCircles.begin(); locIterator_Validating != locCDCTrackCircles.end();) | |||
2808 | { | |||
2809 | DCDCTrackCircle* locCDCTrackCircle_Validating = *locIterator_Validating; | |||
2810 | if(locCDCTrackCircle_Validating->dSuperLayerSeeds_Axial.size() == 3) | |||
2811 | { | |||
2812 | ++locIterator_Validating; | |||
2813 | continue; //not going to be a subset | |||
2814 | } | |||
2815 | if(DEBUG_LEVEL > 20) | |||
2816 | { | |||
2817 | cout << "sl7 checking-for-subsets: validating = " << endl; | |||
2818 | Print_TrackCircle(locCDCTrackCircle_Validating); | |||
2819 | } | |||
2820 | bool locRejectTrackFlag = false; | |||
2821 | for(locIterator_ToCompareTo = locCDCTrackCircles.begin(); locIterator_ToCompareTo != locCDCTrackCircles.end(); ++locIterator_ToCompareTo) | |||
2822 | { | |||
2823 | if(locIterator_ToCompareTo == locIterator_Validating) | |||
2824 | continue; | |||
2825 | DCDCTrackCircle* locCDCTrackCircle_ToCompareTo = *locIterator_ToCompareTo; | |||
2826 | if(DEBUG_LEVEL > 20) | |||
2827 | { | |||
2828 | cout << "sl7 checking-for-subsets: to-compare-to = " << endl; | |||
2829 | Print_TrackCircle(locCDCTrackCircle_ToCompareTo); | |||
2830 | } | |||
2831 | ||||
2832 | if(!locCDCTrackCircle_ToCompareTo->Check_IfInputIsSubset(locCDCTrackCircle_Validating)) | |||
2833 | continue; //not a subset | |||
2834 | ||||
2835 | if(DEBUG_LEVEL > 10) | |||
2836 | cout << "rejecting subset circle" << endl; | |||
2837 | locRejectTrackFlag = true; //is a subset | |||
2838 | break; | |||
2839 | } | |||
2840 | if(locRejectTrackFlag) | |||
2841 | { | |||
2842 | Recycle_DCDCTrackCircle(locCDCTrackCircle_Validating); //recycle | |||
2843 | locIterator_Validating = locCDCTrackCircles.erase(locIterator_Validating); | |||
2844 | } | |||
2845 | else | |||
2846 | ++locIterator_Validating; | |||
2847 | } | |||
2848 | ||||
2849 | //now fit the newly-truncated track circles | |||
2850 | Fit_Circles(locCDCTrackCircles, true, false); //true: fit only truncated circles //false: don't add stereo intersections | |||
2851 | stable_sort(locCDCTrackCircles.begin(), locCDCTrackCircles.end(), CDCSortByChiSqPerNDFDecreasing); //sort by fit chisq/ndf | |||
2852 | if(DEBUG_LEVEL > 5) | |||
2853 | { | |||
2854 | cout << "Post-SL7-turncation track circles" << endl; | |||
2855 | Print_TrackCircles(locCDCTrackCircles); | |||
2856 | } | |||
2857 | } | |||
2858 | ||||
2859 | // NOW CHECK FOR SAME SUPER LAYER SEED IN SL4 | |||
2860 | locTruncationPerformedFlag = false; | |||
2861 | for(locIterator_Validating = locCDCTrackCircles.begin(); locIterator_Validating != locCDCTrackCircles.end();) | |||
2862 | { | |||
2863 | DCDCTrackCircle* locCDCTrackCircle_Validating = *locIterator_Validating; | |||
2864 | if(DEBUG_LEVEL > 10) | |||
2865 | { | |||
2866 | cout << "validating: search for SL4 truncation for circle with axial seeds:" << endl; | |||
2867 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle_Validating->dSuperLayerSeeds_Axial.size(); ++loc_j) | |||
2868 | cout << "Axial Super Layer, Seed Index = " << locCDCTrackCircle_Validating->dSuperLayerSeeds_Axial[loc_j]->dSuperLayer << ", " << locCDCTrackCircle_Validating->dSuperLayerSeeds_Axial[loc_j]->dSeedIndex << endl; | |||
2869 | } | |||
2870 | ||||
2871 | DCDCSuperLayerSeed* locSuperLayerSeed_Validating = locCDCTrackCircle_Validating->Get_SuperLayerSeed(4); | |||
2872 | if(locSuperLayerSeed_Validating == NULL__null) | |||
2873 | { | |||
2874 | ++locIterator_Validating; | |||
2875 | continue; //this track circle has no SL4 | |||
2876 | } | |||
2877 | ||||
2878 | if(locCDCTrackCircle_Validating->Get_SuperLayerSeed(7) != NULL__null) | |||
2879 | { | |||
2880 | //this track circle has a unique SL7 (if not unique would have been truncated earlier): do not truncate it | |||
2881 | //rejecting SL4 from the track with the SL7 would leave an unphysical combination | |||
2882 | //this track may have a low chisq/ndf because there is a kink in the track, or maybe the eloss is large and the circle doesn't quite catch SL7 very well | |||
2883 | //if the SL7 is truly bad (e.g. slightly different from a different, true SL7), then the 50% common-hit requirement should kill it (if SL4 is indeed identical) | |||
2884 | ++locIterator_Validating; | |||
2885 | continue; | |||
2886 | } | |||
2887 | ||||
2888 | DCDCSuperLayerSeed* locSuperLayerSeed1_Validating = locCDCTrackCircle_Validating->Get_SuperLayerSeed(1); | |||
2889 | bool locRejectTrackFlag = false; | |||
2890 | for(locIterator_ToCompareTo = --(locCDCTrackCircles.end()); locIterator_ToCompareTo != locIterator_Validating; --locIterator_ToCompareTo) | |||
2891 | { | |||
2892 | DCDCTrackCircle* locCDCTrackCircle_ToCompareTo = *locIterator_ToCompareTo; | |||
2893 | if(DEBUG_LEVEL > 10) | |||
2894 | { | |||
2895 | cout << "to-compare-to: search for SL4 truncation for circle with axial seeds:" << endl; | |||
2896 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle_ToCompareTo->dSuperLayerSeeds_Axial.size(); ++loc_j) | |||
2897 | cout << "Axial Super Layer, Seed Index = " << locCDCTrackCircle_ToCompareTo->dSuperLayerSeeds_Axial[loc_j]->dSuperLayer << ", " << locCDCTrackCircle_ToCompareTo->dSuperLayerSeeds_Axial[loc_j]->dSeedIndex << endl; | |||
2898 | } | |||
2899 | ||||
2900 | DCDCSuperLayerSeed* locSuperLayerSeed_ToCompareTo = locCDCTrackCircle_ToCompareTo->Get_SuperLayerSeed(4); | |||
2901 | if(locSuperLayerSeed_Validating != locSuperLayerSeed_ToCompareTo) | |||
2902 | continue; //different seed for SL4 | |||
2903 | ||||
2904 | //SL4 is identical, check status of SL1 | |||
2905 | DCDCSuperLayerSeed* locSuperLayerSeed1_ToCompareTo = locCDCTrackCircle_ToCompareTo->Get_SuperLayerSeed(1); | |||
2906 | if(locSuperLayerSeed1_Validating == locSuperLayerSeed1_ToCompareTo) | |||
2907 | { | |||
2908 | //SL1 & SL4 are identical: only difference is that locCDCTrackCircle_ToCompareTo has SL7 | |||
2909 | //locCDCTrackCircle_Validating is merely a subset of locCDCTrackCircle_ToCompareTo (which has a better chisq/ndf): reject it | |||
2910 | if(DEBUG_LEVEL > 5) | |||
2911 | cout << "SL1 and SL4 are identical, while SL7 of validating is missing: reject validating track" << endl; | |||
2912 | locRejectTrackFlag = true; | |||
2913 | break; | |||
2914 | } | |||
2915 | ||||
2916 | //track circles have identical seeds in SL4, and at least one track does not have an SL7 (although both may not): | |||
2917 | //should almost never be possible for both to be good tracks AND for all of the hits to belong to both | |||
2918 | // if two tracks are crossing they should almost always have different super layer seeds (that share hits) | |||
2919 | // if they are somehow both good tracks, stripping hits won't be the end of the world: track should still be reconstructable with a subset of them | |||
2920 | ||||
2921 | //truncate the circle //don't trust SL3 since it led to SL4: hit selector can (in theory) pick up the hits later if needed | |||
2922 | if(DEBUG_LEVEL > 5) | |||
2923 | cout << "SL4 is identical, SL1 is not, while SL7 of validating is missing: truncate to SL2" << endl; | |||
2924 | locCDCTrackCircle_Validating->Truncate_Circle(2); //2: new last super layer | |||
2925 | ||||
2926 | //reset fit if not already done | |||
2927 | if(locCDCTrackCircle_Validating->fit != NULL__null) | |||
2928 | { | |||
2929 | dHelicalFitPool_Available.push_back(locCDCTrackCircle_Validating->fit); //will redo the fit: recycle the memory | |||
2930 | locCDCTrackCircle_Validating->fit = NULL__null; //indicate need to reperform fit | |||
2931 | } | |||
2932 | ||||
2933 | //update truncation sources | |||
2934 | bool locIsAlreadyTruncationSourceFlag = false; | |||
2935 | for(size_t loc_i = 0; loc_i < locCDCTrackCircle_Validating->dTruncationSourceCircles.size(); ++loc_i) | |||
2936 | { | |||
2937 | if(locCDCTrackCircle_Validating->dTruncationSourceCircles[loc_i] != locCDCTrackCircle_ToCompareTo) | |||
2938 | continue; | |||
2939 | locIsAlreadyTruncationSourceFlag = true; | |||
2940 | break; | |||
2941 | } | |||
2942 | if(!locIsAlreadyTruncationSourceFlag) | |||
2943 | locCDCTrackCircle_Validating->dTruncationSourceCircles.push_back(locCDCTrackCircle_ToCompareTo); | |||
2944 | ||||
2945 | locTruncationPerformedFlag = true; | |||
2946 | break; //truncation successful | |||
2947 | } | |||
2948 | ||||
2949 | if(locRejectTrackFlag) | |||
2950 | { | |||
2951 | Recycle_DCDCTrackCircle(locCDCTrackCircle_Validating); //recycle | |||
2952 | locIterator_Validating = locCDCTrackCircles.erase(locIterator_Validating); | |||
2953 | } | |||
2954 | else | |||
2955 | ++locIterator_Validating; | |||
2956 | } | |||
2957 | ||||
2958 | if(locTruncationPerformedFlag) | |||
2959 | { | |||
2960 | //now merge any track circles that have identical axial super layers | |||
2961 | for(locIterator_Validating = locCDCTrackCircles.begin(); locIterator_Validating != locCDCTrackCircles.end();) | |||
2962 | { | |||
2963 | DCDCTrackCircle* locCDCTrackCircle_Validating = *locIterator_Validating; | |||
2964 | bool locMergedTrackCircleFlag = false; | |||
2965 | for(locIterator_ToCompareTo = --(locCDCTrackCircles.end()); locIterator_ToCompareTo != locIterator_Validating; --locIterator_ToCompareTo) | |||
2966 | { | |||
2967 | DCDCTrackCircle* locCDCTrackCircle_ToCompareTo = *locIterator_ToCompareTo; | |||
2968 | if(locCDCTrackCircle_Validating->dSuperLayerSeeds_Axial != locCDCTrackCircle_ToCompareTo->dSuperLayerSeeds_Axial) | |||
2969 | continue; //not identical | |||
2970 | //identical axial super layers: merge track circles (absorb the "Validating" one into the "ToCompareTo" one //which is which doesn't matter) | |||
2971 | locCDCTrackCircle_ToCompareTo->Absorb_TrackCircle(locCDCTrackCircle_Validating); | |||
2972 | locMergedTrackCircleFlag = true; | |||
2973 | break; | |||
2974 | } | |||
2975 | if(locMergedTrackCircleFlag) | |||
2976 | { | |||
2977 | Recycle_DCDCTrackCircle(locCDCTrackCircle_Validating); //recycle | |||
2978 | locIterator_Validating = locCDCTrackCircles.erase(locIterator_Validating); | |||
2979 | } | |||
2980 | else | |||
2981 | ++locIterator_Validating; | |||
2982 | } | |||
2983 | ||||
2984 | //now check to see if any of the newly-truncated track circles is merely a subset of a different circle (regardless of which chisq/ndf is lower) | |||
2985 | //is a subset if the axials are a subset AND the outermost stereo layers dHasNonTruncatedSeedsFlag is false | |||
2986 | //if one is a subset of another, delete it | |||
2987 | for(locIterator_Validating = locCDCTrackCircles.begin(); locIterator_Validating != locCDCTrackCircles.end();) | |||
2988 | { | |||
2989 | DCDCTrackCircle* locCDCTrackCircle_Validating = *locIterator_Validating; | |||
2990 | bool locRejectTrackFlag = false; | |||
2991 | if(DEBUG_LEVEL > 20) | |||
2992 | { | |||
2993 | cout << "sl4 checking-for-subsets: validating = " << endl; | |||
2994 | Print_TrackCircle(locCDCTrackCircle_Validating); | |||
2995 | } | |||
2996 | for(locIterator_ToCompareTo = locCDCTrackCircles.begin(); locIterator_ToCompareTo != locCDCTrackCircles.end(); ++locIterator_ToCompareTo) | |||
2997 | { | |||
2998 | if(locIterator_ToCompareTo == locIterator_Validating) | |||
2999 | continue; | |||
3000 | DCDCTrackCircle* locCDCTrackCircle_ToCompareTo = *locIterator_ToCompareTo; | |||
3001 | if(DEBUG_LEVEL > 20) | |||
3002 | { | |||
3003 | cout << "sl4 checking-for-subsets: to-compare-to = " << endl; | |||
3004 | Print_TrackCircle(locCDCTrackCircle_ToCompareTo); | |||
3005 | } | |||
3006 | ||||
3007 | if(!locCDCTrackCircle_ToCompareTo->Check_IfInputIsSubset(locCDCTrackCircle_Validating)) | |||
3008 | continue; //not a subset | |||
3009 | ||||
3010 | locRejectTrackFlag = true; //is a subset | |||
3011 | if(DEBUG_LEVEL > 10) | |||
3012 | cout << "rejecting subset circle" << endl; | |||
3013 | break; | |||
3014 | } | |||
3015 | if(locRejectTrackFlag) | |||
3016 | { | |||
3017 | Recycle_DCDCTrackCircle(locCDCTrackCircle_Validating); //recycle | |||
3018 | locIterator_Validating = locCDCTrackCircles.erase(locIterator_Validating); | |||
3019 | } | |||
3020 | else | |||
3021 | ++locIterator_Validating; | |||
3022 | } | |||
3023 | ||||
3024 | //now fit the newly-truncated track circles | |||
3025 | Fit_Circles(locCDCTrackCircles, true, false); //true: fit only truncated circles //false: don't add stereo intersections | |||
3026 | stable_sort(locCDCTrackCircles.begin(), locCDCTrackCircles.end(), CDCSortByChiSqPerNDFDecreasing); //sort by fit chisq/ndf | |||
3027 | if(DEBUG_LEVEL > 5) | |||
3028 | { | |||
3029 | cout << "Post-SL4-turncation track circles" << endl; | |||
3030 | Print_TrackCircles(locCDCTrackCircles); | |||
3031 | } | |||
3032 | } | |||
3033 | } | |||
3034 | ||||
3035 | //-------------------------- | |||
3036 | // Filter_TrackCircles_Axial | |||
3037 | //-------------------------- | |||
3038 | void DTrackCandidate_factory_CDC::Filter_TrackCircles_Axial(vector<DCDCTrackCircle*>& locCDCTrackCircles) | |||
3039 | { | |||
3040 | if(locCDCTrackCircles.empty()) | |||
3041 | return; | |||
3042 | ||||
3043 | //assumes input circles are sorted, with largest chisq/ndf first and smallest last | |||
3044 | //want to compare the worst fit to the best fit | |||
3045 | vector<DCDCTrackCircle*>::iterator locIterator_Validating, locIterator_ToCompareTo; | |||
3046 | ||||
3047 | //FIRST: If circles share > MAX_COMMON_HIT_FRACTION of axial hits, reject circle with larger chisq/ndf | |||
3048 | for(locIterator_Validating = locCDCTrackCircles.begin(); locIterator_Validating != locCDCTrackCircles.end();) | |||
3049 | { | |||
3050 | DCDCTrackCircle* locCDCTrackCircle_Validating = *locIterator_Validating; | |||
3051 | if(locCDCTrackCircle_Validating->dSuperLayerSeeds_Axial.empty()) | |||
3052 | continue; //no axial hits to share (somehow) | |||
3053 | ||||
3054 | size_t locNumHits_Validating = 0; | |||
3055 | vector<DCDCTrkHit*> hits; | |||
3056 | for(size_t loc_i = 0; loc_i < locCDCTrackCircle_Validating->dSuperLayerSeeds_Axial.size(); ++loc_i) | |||
3057 | { | |||
3058 | locCDCTrackCircle_Validating->dSuperLayerSeeds_Axial[loc_i]->Get_Hits(hits); | |||
3059 | locNumHits_Validating += hits.size(); | |||
3060 | } | |||
3061 | ||||
3062 | bool locRejectTrackCircleFlag = false; | |||
3063 | for(locIterator_ToCompareTo = --(locCDCTrackCircles.end()); locIterator_ToCompareTo != locIterator_Validating; --locIterator_ToCompareTo) | |||
3064 | { | |||
3065 | DCDCTrackCircle* locCDCTrackCircle_ToCompareTo = *locIterator_ToCompareTo; | |||
3066 | if(locCDCTrackCircle_ToCompareTo->dSuperLayerSeeds_Axial.empty()) | |||
3067 | continue; //no axial hits to share (somehow) | |||
3068 | ||||
3069 | //If seeds share > MAX_COMMON_HIT_FRACTION of hits, reject seed with larger chisq/ndf | |||
3070 | size_t locNumCommonHits = 0; | |||
3071 | size_t locNumWords = locCDCTrackCircle_Validating->HitBitPattern.size(); | |||
3072 | for(size_t loc_i = 0; loc_i < locNumWords; ++loc_i) | |||
3073 | locNumCommonHits += bitcount(locCDCTrackCircle_Validating->HitBitPattern[loc_i] & locCDCTrackCircle_ToCompareTo->HitBitPattern[loc_i]); | |||
3074 | double locHitFraction = double(locNumCommonHits)/double(locNumHits_Validating); | |||
3075 | ||||
3076 | if(locHitFraction > MAX_COMMON_HIT_FRACTION) | |||
3077 | { | |||
3078 | locRejectTrackCircleFlag = true; | |||
3079 | break; | |||
3080 | } | |||
3081 | } | |||
3082 | if(locRejectTrackCircleFlag) | |||
3083 | { | |||
3084 | //free up some memory by clearing the seed vectors via reset | |||
3085 | Recycle_DCDCTrackCircle(locCDCTrackCircle_Validating); //recycle | |||
3086 | locIterator_Validating = locCDCTrackCircles.erase(locIterator_Validating); | |||
3087 | } | |||
3088 | else | |||
3089 | ++locIterator_Validating; //track circle is valid (for now) | |||
3090 | } | |||
3091 | } | |||
3092 | ||||
3093 | //----------------------------- | |||
3094 | // Create_NewCDCSuperLayerSeeds | |||
3095 | //----------------------------- | |||
3096 | void DTrackCandidate_factory_CDC::Create_NewCDCSuperLayerSeeds(DCDCTrackCircle* locCDCTrackCircle) | |||
3097 | { | |||
3098 | // Create new stereo DCDCSuperLayerSeed objects, finding the intersections of each stereo wire with the fit circle | |||
3099 | ||||
3100 | map<DCDCSuperLayerSeed*, DCDCSuperLayerSeed*> locConvertedSuperLayerSeeds; | |||
3101 | map<DCDCSuperLayerSeed*, DCDCSuperLayerSeed*>::iterator locMapIterator; //map from orig super layer to new super layer | |||
3102 | map<DCDCTrkHit*, DCDCTrkHit*> locProjectedStereoHitMap; //map from orig (super layer, non-circle-projected) stereo hit to circle-projected (hit-z-group) hit | |||
3103 | ||||
3104 | //inner stereo | |||
3105 | for(size_t loc_i = 0; loc_i < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.size(); ++loc_i) | |||
3106 | { | |||
3107 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_i].size(); ++loc_j) | |||
3108 | { | |||
3109 | DCDCSuperLayerSeed* locCDCSuperLayerSeed = locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_i][loc_j]; | |||
3110 | locMapIterator = locConvertedSuperLayerSeeds.find(locCDCSuperLayerSeed); | |||
3111 | if(locMapIterator != locConvertedSuperLayerSeeds.end()) | |||
3112 | { | |||
3113 | locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_i][loc_j] = locMapIterator->second; | |||
3114 | continue; //already converted | |||
3115 | } | |||
3116 | DCDCSuperLayerSeed* locNewCDCSuperLayerSeed = Create_NewStereoSuperLayerSeed(locCDCSuperLayerSeed, locCDCTrackCircle, locProjectedStereoHitMap); | |||
3117 | locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_i][loc_j] = locNewCDCSuperLayerSeed; | |||
3118 | locConvertedSuperLayerSeeds[locCDCSuperLayerSeed] = locNewCDCSuperLayerSeed; | |||
3119 | } | |||
3120 | } | |||
3121 | ||||
3122 | //outer stereo | |||
3123 | for(size_t loc_i = 0; loc_i < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.size(); ++loc_i) | |||
3124 | { | |||
3125 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_i].size(); ++loc_j) | |||
3126 | { | |||
3127 | DCDCSuperLayerSeed* locCDCSuperLayerSeed = locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_i][loc_j]; | |||
3128 | locMapIterator = locConvertedSuperLayerSeeds.find(locCDCSuperLayerSeed); | |||
3129 | if(locMapIterator != locConvertedSuperLayerSeeds.end()) | |||
3130 | { | |||
3131 | locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_i][loc_j] = locMapIterator->second; | |||
3132 | continue; //already converted | |||
3133 | } | |||
3134 | DCDCSuperLayerSeed* locNewCDCSuperLayerSeed = Create_NewStereoSuperLayerSeed(locCDCSuperLayerSeed, locCDCTrackCircle, locProjectedStereoHitMap); | |||
3135 | locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_i][loc_j] = locNewCDCSuperLayerSeed; | |||
3136 | locConvertedSuperLayerSeeds[locCDCSuperLayerSeed] = locNewCDCSuperLayerSeed; | |||
3137 | } | |||
3138 | } | |||
3139 | } | |||
3140 | ||||
3141 | //------------------------------- | |||
3142 | // Create_NewStereoSuperLayerSeed | |||
3143 | //------------------------------- | |||
3144 | DTrackCandidate_factory_CDC::DCDCSuperLayerSeed* DTrackCandidate_factory_CDC::Create_NewStereoSuperLayerSeed(DCDCSuperLayerSeed* locCDCSuperLayerSeed, const DCDCTrackCircle* locCDCTrackCircle, map<DCDCTrkHit*, DCDCTrkHit*>& locProjectedStereoHitMap) | |||
3145 | { | |||
3146 | //locProjectedStereoHitMap is map from orig (super layer, non-circle-projected) stereo hit to circle-projected hit | |||
3147 | DCDCSuperLayerSeed* locNewCDCSuperLayerSeed = Get_Resource_CDCSuperLayerSeed(); | |||
3148 | *locNewCDCSuperLayerSeed = *locCDCSuperLayerSeed; | |||
3149 | ||||
3150 | // Project all stereo hits in this super layer onto the circle fit | |||
3151 | ||||
3152 | for(size_t loc_i = 0; loc_i < locCDCSuperLayerSeed->dCDCRingSeeds.size(); ++loc_i) | |||
3153 | { | |||
3154 | vector<DCDCTrkHit*>& hits = locCDCSuperLayerSeed->dCDCRingSeeds[loc_i].hits; | |||
3155 | vector<DCDCTrkHit*> locProjectedHits; | |||
3156 | for(size_t loc_l = 0; loc_l < hits.size(); ++loc_l) | |||
3157 | { | |||
3158 | if(fabs(hits[loc_l]->hit->tdrift - locCDCTrackCircle->dAverageDriftTime) > MAX_SEED_TIME_DIFF) | |||
3159 | continue; // Ignore hits that are out of time with the group | |||
3160 | ||||
3161 | // If haven't done so already, Calculate intersection points between circle and stereo wire | |||
3162 | DCDCTrkHit* locProjectedCDCTrkHit = NULL__null; | |||
3163 | map<DCDCTrkHit*, DCDCTrkHit*>::iterator locHitIterator = locProjectedStereoHitMap.find(hits[loc_l]); | |||
3164 | if(locHitIterator == locProjectedStereoHitMap.end()) | |||
3165 | { | |||
3166 | // Clone the hit and set it's stereo-hit-position | |||
3167 | DVector3 locStereoHitPos; | |||
3168 | double locPhiStereo = 0.0, var_z = 9.9E9; | |||
3169 | locProjectedCDCTrkHit = Get_Resource_CDCTrkHit(); | |||
3170 | *locProjectedCDCTrkHit = *hits[loc_l]; | |||
3171 | //if below is false: wire doesn't intersect the circle: in this case, don't reject hit outright: ignore for theta/z, but let wire-based tracking try to use it | |||
3172 | //e.g., track has a spiral turn in SL6, and since there is no SL7, the circle-fit is extrapolated into SL6 and doesn't quite catch the spiral turn | |||
3173 | if(Calc_StereoPosition(locProjectedCDCTrkHit->hit->wire, locCDCTrackCircle->fit, locStereoHitPos, var_z, locPhiStereo)) | |||
3174 | locProjectedCDCTrkHit->dValidStereoHitPosFlag = true; | |||
3175 | locProjectedCDCTrkHit->dStereoHitPos = locStereoHitPos; | |||
3176 | locProjectedCDCTrkHit->var_z = var_z; | |||
3177 | locProjectedCDCTrkHit->dPhiStereo = locPhiStereo; | |||
3178 | dStereoHitNumUsedMap[locProjectedCDCTrkHit] = 1; | |||
3179 | } | |||
3180 | else | |||
3181 | { | |||
3182 | //hit was already projected onto this circle (e.g. in a different super layer seed), just reuse the results/memory | |||
3183 | locProjectedCDCTrkHit = locHitIterator->second; | |||
3184 | ++dStereoHitNumUsedMap[locProjectedCDCTrkHit]; | |||
3185 | } | |||
3186 | ||||
3187 | // Save the hit | |||
3188 | locProjectedHits.push_back(locProjectedCDCTrkHit); | |||
3189 | } | |||
3190 | locNewCDCSuperLayerSeed->dCDCRingSeeds[loc_i].hits = locProjectedHits; | |||
3191 | } | |||
3192 | ||||
3193 | return locNewCDCSuperLayerSeed; | |||
3194 | } | |||
3195 | ||||
3196 | //-------------------- | |||
3197 | // Calc_StereoPosition | |||
3198 | //-------------------- | |||
3199 | bool DTrackCandidate_factory_CDC::Calc_StereoPosition(const DCDCWire *wire, const DHelicalFit* fit, DVector3 &pos, double &var_z, double& locPhiStereo, double d) | |||
3200 | { | |||
3201 | // Calculate intersection point between circle and stereo wire | |||
3202 | DVector3 origin = wire->origin; | |||
3203 | DVector3 dir = (1./wire->udir.z())*wire->udir; | |||
3204 | double dx = origin.x() - fit->x0; | |||
3205 | double dy = origin.y() - fit->y0; | |||
3206 | double ux = dir.x(); | |||
3207 | double uy = dir.y(); | |||
3208 | double temp1 = ux*ux + uy*uy; | |||
3209 | double temp2 = ux*dy - uy*dx; | |||
3210 | double b = -ux*dx - uy*dy; | |||
3211 | double dr = fit->r0 - d; | |||
3212 | double r0_sq = dr*dr; | |||
3213 | double A = r0_sq*temp1 - temp2*temp2; | |||
3214 | ||||
3215 | // Check that this wire intersects this circle | |||
3216 | if(A < 0.0) | |||
3217 | return false; // line along wire does not intersect circle, ever. | |||
3218 | ||||
3219 | // Guess for variance for z: assume straw cell size?? | |||
3220 | double temp = 1.6/sin(wire->stereo); | |||
3221 | var_z = temp*temp/12.; | |||
3222 | ||||
3223 | // Calculate intersection points for the two roots | |||
3224 | double B = sqrt(A); | |||
3225 | double dz1 = (b - B)/temp1; | |||
3226 | double dz2 = (b + B)/temp1; | |||
3227 | ||||
3228 | if(DEBUG_LEVEL > 15) | |||
3229 | cout<<"dz1="<<dz1<<" dz2="<<dz2<<endl; | |||
3230 | ||||
3231 | // At this point we must decide which value of alpha to use. | |||
3232 | // For now, we just use the value closest to zero (i.e. closest to | |||
3233 | // the center of the wire). | |||
3234 | double dz = dz1; | |||
3235 | if(fabs(dz2) < fabs(dz1)) | |||
3236 | dz = dz2; | |||
3237 | ||||
3238 | // Compute the position for this hit | |||
3239 | pos = origin + dz*dir; | |||
3240 | ||||
3241 | // distance along wire relative to origin | |||
3242 | double s = dz/cos(wire->stereo); | |||
3243 | ||||
3244 | if(DEBUG_LEVEL > 15) | |||
3245 | cout<<"s="<<s<<" ring="<<wire->ring<<" straw="<<wire->straw<<" stereo="<<wire->stereo<<endl; | |||
3246 | ||||
3247 | // Compute phi for the stereo wire | |||
3248 | DVector2 R(fit->x0, fit->y0); | |||
3249 | locPhiStereo = atan2(pos.Y() - R.Y(), pos.X() - R.X()); | |||
3250 | R *= -1.0; // make R point from center of circle to beamline instead of other way around | |||
3251 | locPhiStereo -= R.Phi(); // make angle relative to beamline | |||
3252 | ||||
3253 | // We want this to go either from 0 to +2pi for positive charge, or 0 to -2pi for negative. | |||
3254 | double phi_hi = fit->h > 0.0 ? +M_TWO_PI6.28318530717958647692 : 0.0; | |||
3255 | double phi_lo = fit->h > 0.0 ? 0.0 : -M_TWO_PI6.28318530717958647692; | |||
3256 | while(locPhiStereo < phi_lo) | |||
3257 | locPhiStereo += M_TWO_PI6.28318530717958647692; | |||
3258 | while(locPhiStereo > phi_hi) | |||
3259 | locPhiStereo -= M_TWO_PI6.28318530717958647692; | |||
3260 | ||||
3261 | return true; | |||
3262 | } | |||
3263 | ||||
3264 | //-------------------------- | |||
3265 | // Select_CDCSuperLayerSeeds | |||
3266 | //-------------------------- | |||
3267 | bool DTrackCandidate_factory_CDC::Select_CDCSuperLayerSeeds(DCDCTrackCircle* locCDCTrackCircle, bool locFinalPassFlag) | |||
3268 | { | |||
3269 | // If on initial pass (locFinalPassFlag = false): | |||
3270 | // Calculates the theta/z of the track for each possible combination of stereo super layer seeds. | |||
3271 | // The combination with the smallest chisq/ndf is selected, and the rest of the super layer seeds are deleted. | |||
3272 | // If there are no stereo hits, DO NOT reject the track, as Add_UnusedHits hasn't been called yet, and may find some. | |||
3273 | ||||
3274 | // If on final pass (locFinalPassFlag = true): | |||
3275 | // Calculate the theta/z of the track using a subset of the remaining stereo hits | |||
3276 | // A subset is used to give the best-possible calculation of theta/z by ignoring hits where the circle-fit may be inaccurate | |||
3277 | // This is because the projection of the stereo hits onto the circle may be bad in this region, giving a bad theta/z result | |||
3278 | // If there are no stereo hits, reject the track. | |||
3279 | ||||
3280 | // Select the best combinations of stereo hits and determine theta/z | |||
3281 | double locBestTheta = 0.0, locBestZ = TARGET_Z, locBestChiSqPerNDF = 9.9E99; | |||
3282 | vector<DCDCSuperLayerSeed*> locBestSuperLayerSeeds_Inner; | |||
3283 | vector<DCDCSuperLayerSeed*> locBestSuperLayerSeeds_Outer; | |||
3284 | bool locGoodStereoComboFoundFlag = false; | |||
3285 | ||||
3286 | if((!locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.empty()) && (!locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.empty())) | |||
3287 | { | |||
3288 | //hits in both the inner & outer stereo super layers | |||
3289 | for(size_t loc_i = 0; loc_i < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.size(); ++loc_i) | |||
3290 | { | |||
3291 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.size(); ++loc_j) | |||
3292 | { | |||
3293 | //get the hits from this inner combination | |||
3294 | vector<DCDCTrkHit*> locComboHits; | |||
3295 | Select_ThetaZStereoHits(locCDCTrackCircle, loc_i, loc_j, locFinalPassFlag, locComboHits); | |||
3296 | ||||
3297 | //Evaluate theta & z for this combination, returning the chisq/ndf from the fit | |||
3298 | double locTheta = 0.0, locZ = TARGET_Z, locChiSqPerNDF = 9.9E50; | |||
3299 | if(DEBUG_LEVEL > 5) | |||
3300 | cout << "in/out try theta/z, num stereo hits = " << locComboHits.size() << endl; | |||
3301 | if(!Find_ThetaZ(locCDCTrackCircle->fit, locComboHits, locTheta, locZ, locChiSqPerNDF)) | |||
3302 | continue; //combo didn't work for some reason, try a different one | |||
3303 | if(!((locChiSqPerNDF < 1.0) || (locChiSqPerNDF > -1.0))) | |||
3304 | continue; // NaN | |||
3305 | locGoodStereoComboFoundFlag = true; | |||
3306 | if(DEBUG_LEVEL > 5) | |||
3307 | cout << "in/out good theta/z: theta, z, chisq, best-chisq = " << locTheta << ", " << locZ << ", " << locChiSqPerNDF << ", " << locBestChiSqPerNDF << endl; | |||
3308 | if(locChiSqPerNDF >= locBestChiSqPerNDF) | |||
3309 | continue; | |||
3310 | // This is the best combination of stereo seeds so far, save the results | |||
3311 | locBestSuperLayerSeeds_Inner.clear(); | |||
3312 | for(size_t loc_k = 0; loc_k < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_i].size(); ++loc_k) | |||
3313 | locBestSuperLayerSeeds_Inner.push_back(locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_i][loc_k]); | |||
3314 | locBestSuperLayerSeeds_Outer.clear(); | |||
3315 | for(size_t loc_k = 0; loc_k < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_j].size(); ++loc_k) | |||
3316 | locBestSuperLayerSeeds_Outer.push_back(locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_j][loc_k]); | |||
3317 | locBestTheta = locTheta; | |||
3318 | locBestZ = locZ; | |||
3319 | locBestChiSqPerNDF = locChiSqPerNDF; | |||
3320 | } | |||
3321 | } | |||
3322 | } | |||
3323 | else if(!locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.empty()) | |||
3324 | { | |||
3325 | //no hits in the outer super layers (or super layer 4 was missing) | |||
3326 | for(size_t loc_i = 0; loc_i < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.size(); ++loc_i) | |||
3327 | { | |||
3328 | //get the hits from this inner combination | |||
3329 | vector<DCDCTrkHit*> locComboHits; | |||
3330 | Select_ThetaZStereoHits(locCDCTrackCircle, loc_i, -1, locFinalPassFlag, locComboHits); | |||
3331 | ||||
3332 | //Evaluate theta & z for this combination, returning the chisq/ndf from the fit | |||
3333 | double locTheta = 0.0, locZ = TARGET_Z, locChiSqPerNDF = 9.9E50; | |||
3334 | if(DEBUG_LEVEL > 5) | |||
3335 | cout << "in-only try theta/z, num stereo hits = " << locComboHits.size() << endl; | |||
3336 | if(!Find_ThetaZ(locCDCTrackCircle->fit, locComboHits, locTheta, locZ, locChiSqPerNDF)) | |||
3337 | continue; //combo didn't work for some reason, try a different one | |||
3338 | if(!((locChiSqPerNDF < 1.0) || (locChiSqPerNDF > -1.0))) | |||
3339 | continue; // NaN | |||
3340 | locGoodStereoComboFoundFlag = true; | |||
3341 | if(DEBUG_LEVEL > 5) | |||
3342 | cout << "in-only good theta/z: theta, z, chisq, best-chisq = " << locTheta << ", " << locZ << ", " << locChiSqPerNDF << ", " << locBestChiSqPerNDF << endl; | |||
3343 | if(locChiSqPerNDF >= locBestChiSqPerNDF) | |||
3344 | continue; | |||
3345 | // This is the best combination of stereo seeds so far, save the results | |||
3346 | locBestSuperLayerSeeds_Inner.clear(); | |||
3347 | for(size_t loc_k = 0; loc_k < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_i].size(); ++loc_k) | |||
3348 | locBestSuperLayerSeeds_Inner.push_back(locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_i][loc_k]); | |||
3349 | locBestSuperLayerSeeds_Outer.clear(); | |||
3350 | locBestTheta = locTheta; | |||
3351 | locBestZ = locZ; | |||
3352 | locBestChiSqPerNDF = locChiSqPerNDF; | |||
3353 | } | |||
3354 | } | |||
3355 | else if(!locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.empty()) | |||
3356 | { | |||
3357 | // no hits in the inner super layers: e.g. decay product (e.g. p) of a long-lived decaying neutral particle (e.g. lambda) | |||
3358 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.size(); ++loc_j) | |||
3359 | { | |||
3360 | //get the hits from this inner combination | |||
3361 | vector<DCDCTrkHit*> locComboHits; | |||
3362 | Select_ThetaZStereoHits(locCDCTrackCircle, -1, loc_j, locFinalPassFlag, locComboHits); | |||
3363 | ||||
3364 | //Evaluate theta & z for this combination, returning the chisq/ndf from the fit | |||
3365 | double locTheta = 0.0, locZ = TARGET_Z, locChiSqPerNDF = 9.9E50; | |||
3366 | if(DEBUG_LEVEL > 5) | |||
3367 | cout << "out-only try theta/z, num stereo hits = " << locComboHits.size() << endl; | |||
3368 | if(!Find_ThetaZ(locCDCTrackCircle->fit, locComboHits, locTheta, locZ, locChiSqPerNDF)) | |||
3369 | continue; //combo didn't work for some reason, try a different one | |||
3370 | if(!((locChiSqPerNDF < 1.0) || (locChiSqPerNDF > -1.0))) | |||
3371 | continue; // NaN | |||
3372 | locGoodStereoComboFoundFlag = true; | |||
3373 | if(DEBUG_LEVEL > 5) | |||
3374 | cout << "out-only good theta/z: theta, z, chisq, best-chisq = " << locTheta << ", " << locZ << ", " << locChiSqPerNDF << ", " << locBestChiSqPerNDF << endl; | |||
3375 | if(locChiSqPerNDF >= locBestChiSqPerNDF) | |||
3376 | continue; | |||
3377 | // This is the best combination of stereo seeds so far, save the results | |||
3378 | locBestSuperLayerSeeds_Inner.clear(); | |||
3379 | locBestSuperLayerSeeds_Outer.clear(); | |||
3380 | for(size_t loc_k = 0; loc_k < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_j].size(); ++loc_k) | |||
3381 | locBestSuperLayerSeeds_Outer.push_back(locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_j][loc_k]); | |||
3382 | locBestTheta = locTheta; | |||
3383 | locBestZ = locZ; | |||
3384 | locBestChiSqPerNDF = locChiSqPerNDF; | |||
3385 | } | |||
3386 | } | |||
3387 | else //no stereo hits | |||
3388 | return (!locFinalPassFlag); //return true if don't wan't to filter, false if you do | |||
3389 | ||||
3390 | //save the results to the track circle | |||
3391 | locCDCTrackCircle->dTheta = locBestTheta; | |||
3392 | locCDCTrackCircle->dVertexZ = locBestZ; | |||
3393 | double locNumStereoSuperLayers = double(locBestSuperLayerSeeds_Inner.size() + locBestSuperLayerSeeds_Outer.size()); | |||
3394 | locCDCTrackCircle->dWeightedChiSqPerDF_Stereo = locBestChiSqPerNDF/(locNumStereoSuperLayers*locNumStereoSuperLayers); | |||
3395 | ||||
3396 | set<DCDCSuperLayerSeed*> locAlreadyRecycledSuperLayerSeeds; //a seed can appear in more than one combo: don't recycle the same memory more than once!! | |||
3397 | ||||
3398 | // recycle the unused super layer seeds and store only the best ones: inner | |||
3399 | if(!locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.empty()) | |||
3400 | { | |||
3401 | for(size_t loc_i = 0; loc_i < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.size(); ++loc_i) | |||
3402 | { | |||
3403 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_i].size(); ++loc_j) | |||
3404 | { | |||
3405 | DCDCSuperLayerSeed* locCDCSuperLayerSeed = locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[loc_i][loc_j]; | |||
3406 | if(locAlreadyRecycledSuperLayerSeeds.find(locCDCSuperLayerSeed) != locAlreadyRecycledSuperLayerSeeds.end()) | |||
3407 | continue; //already recycled! | |||
3408 | bool locKeepSuperLayerSeed = false; | |||
3409 | for(size_t loc_k = 0; loc_k < locBestSuperLayerSeeds_Inner.size(); ++loc_k) | |||
3410 | { | |||
3411 | if(locBestSuperLayerSeeds_Inner[loc_k] != locCDCSuperLayerSeed) | |||
3412 | continue; | |||
3413 | locKeepSuperLayerSeed = true; //one of the best, don't recycle!! | |||
3414 | break; | |||
3415 | } | |||
3416 | if(locKeepSuperLayerSeed) | |||
3417 | continue; | |||
3418 | Recycle_DCDCSuperLayerSeed(locCDCSuperLayerSeed); //no longer in use | |||
3419 | locAlreadyRecycledSuperLayerSeeds.insert(locCDCSuperLayerSeed); | |||
3420 | } | |||
3421 | } | |||
3422 | locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.clear(); | |||
3423 | if(locGoodStereoComboFoundFlag) | |||
3424 | locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.push_back(locBestSuperLayerSeeds_Inner); | |||
3425 | } | |||
3426 | locAlreadyRecycledSuperLayerSeeds.clear(); | |||
3427 | ||||
3428 | // recycle the unused super layer seeds and store only the best ones: outer | |||
3429 | if(!locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.empty()) | |||
3430 | { | |||
3431 | for(size_t loc_i = 0; loc_i < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.size(); ++loc_i) | |||
3432 | { | |||
3433 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_i].size(); ++loc_j) | |||
3434 | { | |||
3435 | DCDCSuperLayerSeed* locCDCSuperLayerSeed = locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[loc_i][loc_j]; | |||
3436 | if(locAlreadyRecycledSuperLayerSeeds.find(locCDCSuperLayerSeed) != locAlreadyRecycledSuperLayerSeeds.end()) | |||
3437 | continue; //already recycled! | |||
3438 | bool locKeepSuperLayerSeed = false; | |||
3439 | for(size_t loc_k = 0; loc_k < locBestSuperLayerSeeds_Outer.size(); ++loc_k) | |||
3440 | { | |||
3441 | if(locBestSuperLayerSeeds_Outer[loc_k] != locCDCSuperLayerSeed) | |||
3442 | continue; | |||
3443 | locKeepSuperLayerSeed = true; //one of the best, don't recycle!! | |||
3444 | break; | |||
3445 | } | |||
3446 | if(locKeepSuperLayerSeed) | |||
3447 | continue; | |||
3448 | Recycle_DCDCSuperLayerSeed(locCDCSuperLayerSeed); //no longer in use | |||
3449 | locAlreadyRecycledSuperLayerSeeds.insert(locCDCSuperLayerSeed); | |||
3450 | } | |||
3451 | } | |||
3452 | locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.clear(); | |||
3453 | if(locGoodStereoComboFoundFlag) | |||
3454 | locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.push_back(locBestSuperLayerSeeds_Outer); | |||
3455 | } | |||
3456 | ||||
3457 | return locGoodStereoComboFoundFlag; | |||
3458 | } | |||
3459 | ||||
3460 | //------------------------ | |||
3461 | // Select_ThetaZStereoHits | |||
3462 | //------------------------ | |||
3463 | void DTrackCandidate_factory_CDC::Select_ThetaZStereoHits(const DCDCTrackCircle* locCDCTrackCircle, int locInnerSeedSeriesIndex, int locOuterSeedSeriesIndex, bool locFinalPassFlag, vector<DCDCTrkHit*>& locComboHits) | |||
3464 | { | |||
3465 | //tracks at the edges of the CDC's phase space OFTEN fail because the circle-fit is not perfect | |||
3466 | //this causes the projected-hit-position on the circle of the stereo hits to be incorrect | |||
3467 | //which then causes the calculated theta/z to be bad, which causes the momentum magnitude to be bad | |||
3468 | //this is especially a concern for tracks without hits in Super Layer (SL) 7: e.g. spiraling tracks in SL6 or tracks leaving the CDC | |||
3469 | //this is because the circle fit is extrapolated out to SL5 & SL6 and the errors are much larger | |||
3470 | //therefore, you must be VERY careful when selecting which stereo hits to use for the final calculation of theta & z | |||
3471 | //for the initial calculation: use all stereo hits: the initial calculation is intended to select which stereo super layer seeds are best, nothing more | |||
3472 | ||||
3473 | locComboHits.clear(); | |||
3474 | ||||
3475 | // Get super layer seeds for this combination | |||
3476 | vector<DCDCSuperLayerSeed*> locSuperLayerSeeds; | |||
3477 | if(locInnerSeedSeriesIndex >= 0) | |||
3478 | { | |||
3479 | for(size_t loc_k = 0; loc_k < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[locInnerSeedSeriesIndex].size(); ++loc_k) | |||
3480 | locSuperLayerSeeds.push_back(locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[locInnerSeedSeriesIndex][loc_k]); | |||
3481 | } | |||
3482 | if(locOuterSeedSeriesIndex >= 0) | |||
3483 | { | |||
3484 | for(size_t loc_k = 0; loc_k < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[locOuterSeedSeriesIndex].size(); ++loc_k) | |||
3485 | locSuperLayerSeeds.push_back(locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[locOuterSeedSeriesIndex][loc_k]); | |||
3486 | } | |||
3487 | ||||
3488 | //select initial hits: prune hits that don't intersect the circle | |||
3489 | vector<DCDCTrkHit*> locHits; | |||
3490 | map<unsigned int, vector<DCDCTrkHit*> > locHitsBySuperLayer; //key is super layer | |||
3491 | unsigned int locTotalNumStereoHits = 0; | |||
3492 | for(size_t loc_k = 0; loc_k < locSuperLayerSeeds.size(); ++loc_k) | |||
3493 | { | |||
3494 | locSuperLayerSeeds[loc_k]->Get_Hits(locHits); | |||
3495 | for(vector<DCDCTrkHit*>::iterator locIterator = locHits.begin(); locIterator != locHits.end();) | |||
3496 | { | |||
3497 | if((*locIterator)->dValidStereoHitPosFlag) | |||
3498 | ++locIterator; | |||
3499 | else | |||
3500 | locIterator = locHits.erase(locIterator); | |||
3501 | } | |||
3502 | locHitsBySuperLayer[locSuperLayerSeeds[loc_k]->dSuperLayer] = locHits; | |||
3503 | locTotalNumStereoHits += locHits.size(); | |||
3504 | } | |||
3505 | ||||
3506 | // see if no more pruning is necessary | |||
3507 | // don't prune anymore if on initial pass, or if very few stereo hits | |||
3508 | if((!locFinalPassFlag) || (locTotalNumStereoHits <= MIN_PRUNED_STEREO_HITS)) | |||
3509 | { | |||
3510 | // no more pruning, add hits to locComboHits and return | |||
3511 | map<unsigned int, vector<DCDCTrkHit*> >::iterator locMapIterator; | |||
3512 | for(locMapIterator = locHitsBySuperLayer.begin(); locMapIterator != locHitsBySuperLayer.end(); ++locMapIterator) | |||
3513 | locComboHits.insert(locComboHits.end(), locMapIterator->second.begin(), locMapIterator->second.end()); | |||
3514 | if(DEBUG_LEVEL > 10) | |||
3515 | cout << "no more pruning, total num stereo hits = " << locTotalNumStereoHits << endl; | |||
3516 | return; //either on first pass (eval'ing which stereo seed is best), or not enough hits to prune: return | |||
3517 | } | |||
3518 | ||||
3519 | // Now, select the stereo hits whose projection onto the cirlce-fit are closest to the axial hits | |||
3520 | // the closer the stereo hits are to the axial hits, the better the estimation of theta/z will be | |||
3521 | ||||
3522 | //calc delta-phi for all remaining hits and sort them | |||
3523 | //delta-phi: between the intersection-of-the-stereo-hit-with-the-circle and the nearest axial hits | |||
3524 | vector<pair<DCDCTrkHit*, double> > locDeltaPhis; | |||
3525 | for(size_t loc_k = 0; loc_k < locSuperLayerSeeds.size(); ++loc_k) | |||
3526 | { | |||
3527 | unsigned int locSuperLayer = locSuperLayerSeeds[loc_k]->dSuperLayer; | |||
3528 | Calc_StereoHitDeltaPhis(locSuperLayer, locHitsBySuperLayer[locSuperLayer], locCDCTrackCircle, locDeltaPhis); | |||
3529 | } | |||
3530 | stable_sort(locDeltaPhis.begin(), locDeltaPhis.end(), CDCSort_DeltaPhis); | |||
3531 | ||||
3532 | if(locDeltaPhis.size() <= MIN_PRUNED_STEREO_HITS) | |||
3533 | { | |||
3534 | for(size_t loc_k = 0; loc_k < locDeltaPhis.size(); ++loc_k) | |||
3535 | locComboHits.push_back(locDeltaPhis[loc_k].first); | |||
3536 | return; | |||
3537 | } | |||
3538 | ||||
3539 | // take at least the "MIN_PRUNED_STEREO_HITS" hits with the smallest delta_phi | |||
3540 | double locMaxHitDeltaPhi = locDeltaPhis[MIN_PRUNED_STEREO_HITS - 1].second; | |||
3541 | ||||
3542 | // now, potentially expand the max-delta-phi range in certain cases: | |||
3543 | double locDeltaPhiRangeExtension = 0.0; | |||
3544 | //if first statement below is true, want all the stereo hits: | |||
3545 | //track was matched to another track circle as a spiral turn, and it turns in its last axial layer (4 or 7) | |||
3546 | //because it is turning sharply, as much info/hits as possible is needed to give an accurate theta | |||
3547 | //however, if it was turning in a stereo layer, then the sharpest part of the turn was not included in the circle fit | |||
3548 | //in this case the hit-projections onto the circle are probably way off, so only expand to pi if turning on axial layer | |||
3549 | //if second statement below is true, then the track was very unlikely to spiral, because the radius of the circle indicates it (likely) passed through the bcal | |||
3550 | //in this case, all stereo hits within a reasonable distance (10 degrees) from the track circle are probably OK. | |||
3551 | //note: expanding beyond 10-15 degrees kills candidates at theta >= 120: | |||
3552 | //these tracks leave the CDC at SL6 and sooner, and extrapolating the circle fit out to SL6 gives spurious results, so truncate the theta-search | |||
3553 | //if neither statement below is true, then the track likely spiraled in a stereo super layer: | |||
3554 | //don't trust the stereo information as much: only take stereo hits very close to the axial hits | |||
3555 | ||||
3556 | unsigned int locLastSuperLayer = locCDCTrackCircle->Get_LastSuperLayerSeed()->dSuperLayer; | |||
3557 | if(((locLastSuperLayer == 4) || (locLastSuperLayer == 7)) && (locCDCTrackCircle->dSpiralTurnRing != -1)) | |||
3558 | locDeltaPhiRangeExtension = M_PI3.14159265358979323846; //spiral turn on axial layer: all stereo hits good | |||
3559 | else if(locCDCTrackCircle->fit->r0 > 65.0/2.0) //BCAL is at r = ~65 | |||
3560 | locDeltaPhiRangeExtension = 10.0; //unlikely to spiral, all stereo hits reasonably close are good | |||
3561 | else | |||
3562 | locDeltaPhiRangeExtension = 5.0; //likely spiraled, trust stereo information less | |||
3563 | locMaxHitDeltaPhi += locDeltaPhiRangeExtension; | |||
3564 | ||||
3565 | if(DEBUG_LEVEL > 10) | |||
3566 | cout << "prune with max delta-phi, fit circle r0 = " << locMaxHitDeltaPhi << ", " << locCDCTrackCircle->fit->r0 << endl; | |||
3567 | size_t locDeltaPhiIndex = 0; | |||
3568 | // add stereo hits to locComboHits whose projection onto the circle fit are within locMaxHitDeltaPhi of the nearest axial hit phi | |||
3569 | for(locDeltaPhiIndex = 0; locDeltaPhiIndex < locDeltaPhis.size(); ++locDeltaPhiIndex) | |||
3570 | { | |||
3571 | if(locDeltaPhis[locDeltaPhiIndex].second > locMaxHitDeltaPhi) | |||
3572 | break; | |||
3573 | locComboHits.push_back(locDeltaPhis[locDeltaPhiIndex].first); | |||
3574 | } | |||
3575 | ||||
3576 | //make sure to have at least one wire from each super layer | |||
3577 | // this is especially useful for spiral turns in SL6, where the majority of the theta-constraining information comes from SL5 and SL6 | |||
3578 | // you don't want very many of these hits because they can throw you off, but having at least one really helps | |||
3579 | // this is experimental: it may not be necessary if the above locMaxHitDeltaPhi section is better fine-tuned | |||
3580 | ||||
3581 | // to keep track of which super layers need hits, delete keys from locHitsBySuperLayer map if hits from them are already selected | |||
3582 | map<unsigned int, vector<DCDCTrkHit*> >::iterator locMapIterator; | |||
3583 | for(size_t loc_i = 0; loc_i < locComboHits.size(); ++loc_i) | |||
3584 | { | |||
3585 | unsigned int locSuperLayer = (locComboHits[loc_i]->hit->wire->ring - 1)/4 + 1; | |||
3586 | locMapIterator = locHitsBySuperLayer.find(locSuperLayer); | |||
3587 | if(locMapIterator == locHitsBySuperLayer.end()) | |||
3588 | continue; //already have a hit of that type | |||
3589 | locHitsBySuperLayer.erase(locMapIterator); //have a hit of this type | |||
3590 | if(locHitsBySuperLayer.empty()) | |||
3591 | break; | |||
3592 | } | |||
3593 | ||||
3594 | //locHitsBySuperLayer now only contains the keys of super layers that don't have hits yet: loop over them | |||
3595 | for(locMapIterator = locHitsBySuperLayer.begin(); locMapIterator != locHitsBySuperLayer.end(); ++locMapIterator) | |||
3596 | { | |||
3597 | // search for the hit with the lowest delta-phi from this (locMapIterator->first) super layer | |||
3598 | for(size_t loc_i = locDeltaPhiIndex; loc_i < locDeltaPhis.size(); ++loc_i) //everything before locDeltaPhiIndex was already included | |||
3599 | { | |||
3600 | unsigned int locSuperLayer = (locDeltaPhis[loc_i].first->hit->wire->ring - 1)/4 + 1; | |||
3601 | if(locSuperLayer != locMapIterator->first) | |||
3602 | continue; | |||
3603 | locComboHits.push_back(locDeltaPhis[loc_i].first); //use best hit on this super layer | |||
3604 | if(DEBUG_LEVEL > 10) | |||
3605 | cout << "Add stereo hit on SL" << locSuperLayer << ": ring, straw = " << locDeltaPhis[loc_i].first->hit->wire->ring << ", " << locDeltaPhis[loc_i].first->hit->wire->straw << endl; | |||
3606 | break; | |||
3607 | } | |||
3608 | } | |||
3609 | ||||
3610 | if(DEBUG_LEVEL > 10) | |||
3611 | cout << "final #hits = " << locComboHits.size() << endl; | |||
3612 | } | |||
3613 | ||||
3614 | //------------------------ | |||
3615 | // Calc_StereoHitDeltaPhis | |||
3616 | //------------------------ | |||
3617 | void DTrackCandidate_factory_CDC::Calc_StereoHitDeltaPhis(unsigned int locSuperLayer, vector<DCDCTrkHit*>& locHits, const DCDCTrackCircle* locCDCTrackCircle, vector<pair<DCDCTrkHit*, double> >& locDeltaPhis) | |||
3618 | { | |||
3619 | // calc delta-phi for hits: distance from projected-stereo-hit-position to the nearest axial hits | |||
3620 | // because the circle fit is not perfect, the stereo hit position gets progessively worse the sharper the track is turning | |||
3621 | // this screws up the theta/z calculation, so just ignore the hits that are the farthest away | |||
3622 | // don't do this unless on the final pass though: even a moderately bad theta/z is (in theory) still good enough for vetoing totally wrong hit combinations | |||
3623 | ||||
3624 | if(DEBUG_LEVEL > 10) | |||
3625 | cout << "Calc_StereoHitDeltaPhis, SL = " << locSuperLayer << ", #hits = " << locHits.size() << endl; | |||
3626 | ||||
3627 | //get the axial super layer seeds nearest this seed: | |||
3628 | DCDCSuperLayerSeed* locPriorAxialSuperLayerSeed = NULL__null; | |||
3629 | DCDCSuperLayerSeed* locNextAxialSuperLayerSeed = NULL__null; | |||
3630 | for(size_t loc_k = 0; loc_k < locCDCTrackCircle->dSuperLayerSeeds_Axial.size(); ++loc_k) | |||
3631 | { | |||
3632 | if(locCDCTrackCircle->dSuperLayerSeeds_Axial[loc_k]->dSuperLayer < locSuperLayer) | |||
3633 | locPriorAxialSuperLayerSeed = locCDCTrackCircle->dSuperLayerSeeds_Axial[loc_k]; | |||
3634 | else if((locCDCTrackCircle->dSuperLayerSeeds_Axial[loc_k]->dSuperLayer > locSuperLayer) && (locNextAxialSuperLayerSeed == NULL__null)) | |||
3635 | locNextAxialSuperLayerSeed = locCDCTrackCircle->dSuperLayerSeeds_Axial[loc_k]; | |||
3636 | } | |||
3637 | ||||
3638 | //get the rings in the axial super layer seeds nearest this stereo seed: | |||
3639 | DCDCRingSeed* locPriorAxialRingSeed = NULL__null; | |||
3640 | if(locPriorAxialSuperLayerSeed != NULL__null) | |||
3641 | { | |||
3642 | locPriorAxialRingSeed = &(locPriorAxialSuperLayerSeed->dCDCRingSeeds.back()); | |||
3643 | if(DEBUG_LEVEL > 10) | |||
3644 | cout << "Prior axial ring = " << locPriorAxialRingSeed->ring << endl; | |||
3645 | } | |||
3646 | DCDCRingSeed* locNextAxialRingSeed = NULL__null; | |||
3647 | if(locNextAxialSuperLayerSeed != NULL__null) | |||
3648 | { | |||
3649 | locNextAxialRingSeed = &(locNextAxialSuperLayerSeed->dCDCRingSeeds.front()); | |||
3650 | if(DEBUG_LEVEL > 10) | |||
3651 | cout << "Next axial ring = " << locNextAxialRingSeed->ring << endl; | |||
3652 | } | |||
3653 | if((locPriorAxialRingSeed == NULL__null) && (locNextAxialRingSeed == NULL__null)) | |||
3654 | return; //no axial hits: shoudldn't be possible ... | |||
3655 | ||||
3656 | // calculate min-delta-phi for each hit (to the nearest axial ring seed) | |||
3657 | for(size_t loc_i = 0; loc_i < locHits.size(); ++loc_i) | |||
3658 | { | |||
3659 | vector<DCDCTrkHit*> locTempvector(1, locHits[loc_i]); | |||
3660 | double locMinDeltaPhi = M_PI3.14159265358979323846; | |||
3661 | //compare to prior axial ring | |||
3662 | if(locPriorAxialRingSeed != NULL__null) | |||
3663 | { | |||
3664 | double locDeltaPhi = MinDeltaPhi(locPriorAxialRingSeed->hits, locTempvector); | |||
3665 | if(locDeltaPhi < locMinDeltaPhi) | |||
3666 | locMinDeltaPhi = locDeltaPhi; | |||
3667 | } | |||
3668 | //compare to next axial ring | |||
3669 | if(locNextAxialRingSeed != NULL__null) | |||
3670 | { | |||
3671 | double locDeltaPhi = MinDeltaPhi(locTempvector, locNextAxialRingSeed->hits); | |||
3672 | if(locDeltaPhi < locMinDeltaPhi) | |||
3673 | locMinDeltaPhi = locDeltaPhi; | |||
3674 | } | |||
3675 | locMinDeltaPhi *= 180.0/M_PI3.14159265358979323846; | |||
3676 | if(DEBUG_LEVEL > 10) | |||
3677 | cout << "Ring, Straw, min delta phi = " << locHits[loc_i]->hit->wire->ring << ", " << locHits[loc_i]->hit->wire->straw << ", " << locMinDeltaPhi << endl; | |||
3678 | //store the minimum | |||
3679 | locDeltaPhis.push_back(pair<DCDCTrkHit*, double>(locHits[loc_i], locMinDeltaPhi)); | |||
3680 | } | |||
3681 | } | |||
3682 | ||||
3683 | //------------ | |||
3684 | // MinDeltaPhi | |||
3685 | //------------ | |||
3686 | double DTrackCandidate_factory_CDC::MinDeltaPhi(const vector<DCDCTrkHit*>& locInnerSeedHits, const vector<DCDCTrkHit*>& locOuterSeedHits) | |||
3687 | { | |||
3688 | /// Returns the minimum delta-phi between the two groups of hits. Assumes all of the hits in a given set are on the same ring. | |||
3689 | /// First it checks if the two seeds overlap in phi: if so, then return 0 | |||
3690 | /// Otherwise, only the first and last hits of the adjacent rings between each seed's hit list are used. | |||
3691 | /// to calculate a maximum of 4 delta-phis (minimum of 1) of which, the smallest is returned. | |||
3692 | if(locInnerSeedHits.empty() || locOuterSeedHits.empty()) | |||
3693 | { | |||
3694 | cout << "Number of seed hits 0! (Ninner = " << locInnerSeedHits.size() << " ,Nouter = " << locOuterSeedHits.size() << ")" << endl; | |||
3695 | return M_PI3.14159265358979323846; | |||
3696 | } | |||
3697 | ||||
3698 | DCDCTrkHit* locInnermostRingFirstStrawHit = locInnerSeedHits.front(); | |||
3699 | DCDCTrkHit* locInnermostRingLastStrawHit = locInnerSeedHits.back(); | |||
3700 | DCDCTrkHit* locOutermostRingFirstStrawHit = locOuterSeedHits.front(); | |||
3701 | DCDCTrkHit* locOutermostRingLastStrawHit = locOuterSeedHits.back(); | |||
3702 | ||||
3703 | //see if seeds overlap in phi | |||
3704 | float locInnermostRingFirstStrawPhi = locInnermostRingFirstStrawHit->hit->wire->phi; | |||
3705 | float locInnermostRingLastStrawPhi = locInnermostRingLastStrawHit->hit->wire->phi; | |||
3706 | float locOutermostRingFirstStrawPhi = locOutermostRingFirstStrawHit->hit->wire->phi; | |||
3707 | float locOutermostRingLastStrawPhi = locOutermostRingLastStrawHit->hit->wire->phi; | |||
3708 | if(DEBUG_LEVEL > 100) | |||
3709 | cout << "inner ring: ring, first/last straws & phis = " << locInnermostRingFirstStrawHit->hit->wire->ring << ", " << locInnermostRingFirstStrawHit->hit->wire->straw << ", " << locInnermostRingLastStrawHit->hit->wire->straw << ", " << locInnermostRingFirstStrawPhi << ", " << locInnermostRingLastStrawPhi << endl; | |||
3710 | if(DEBUG_LEVEL > 100) | |||
3711 | cout << "outer ring: ring, first/last straws & phis = " << locOutermostRingFirstStrawHit->hit->wire->ring << ", " << locOutermostRingFirstStrawHit->hit->wire->straw << ", " << locOutermostRingLastStrawHit->hit->wire->straw << ", " << locOutermostRingFirstStrawPhi << ", " << locOutermostRingLastStrawPhi << endl; | |||
3712 | ||||
3713 | //account for phi = 0/2pi boundary | |||
3714 | bool locInnerRingCrossesBoundaryFlag = (locInnermostRingLastStrawPhi < locInnermostRingFirstStrawPhi); | |||
3715 | bool locOuterRingCrossesBoundaryFlag = (locOutermostRingLastStrawPhi < locOutermostRingFirstStrawPhi); | |||
3716 | if(DEBUG_LEVEL > 100) | |||
3717 | cout << "in/out boundary flags = " << locInnerRingCrossesBoundaryFlag << ", " << locOuterRingCrossesBoundaryFlag << endl; | |||
3718 | if(locOuterRingCrossesBoundaryFlag) | |||
3719 | locOutermostRingLastStrawPhi += M_TWO_PI6.28318530717958647692; | |||
3720 | if(locInnerRingCrossesBoundaryFlag) | |||
3721 | locInnermostRingLastStrawPhi += M_TWO_PI6.28318530717958647692; | |||
3722 | if(locOuterRingCrossesBoundaryFlag & (!locInnerRingCrossesBoundaryFlag) && ((locOutermostRingLastStrawPhi - locInnermostRingLastStrawPhi) > M_PI3.14159265358979323846)) | |||
3723 | { | |||
3724 | locInnermostRingFirstStrawPhi += M_TWO_PI6.28318530717958647692; | |||
3725 | locInnermostRingLastStrawPhi += M_TWO_PI6.28318530717958647692; | |||
3726 | } | |||
3727 | if(locInnerRingCrossesBoundaryFlag & (!locOuterRingCrossesBoundaryFlag) && ((locInnermostRingLastStrawPhi - locOutermostRingLastStrawPhi) > M_PI3.14159265358979323846)) | |||
3728 | { | |||
3729 | locOutermostRingFirstStrawPhi += M_TWO_PI6.28318530717958647692; | |||
3730 | locOutermostRingLastStrawPhi += M_TWO_PI6.28318530717958647692; | |||
3731 | } | |||
3732 | ||||
3733 | if(DEBUG_LEVEL > 100) | |||
3734 | cout << "final inner ring: ring, first/last straws & phis = " << locInnermostRingFirstStrawHit->hit->wire->ring << ", " << locInnermostRingFirstStrawHit->hit->wire->straw << ", " << locInnermostRingLastStrawHit->hit->wire->straw << ", " << locInnermostRingFirstStrawPhi << ", " << locInnermostRingLastStrawPhi << endl; | |||
3735 | if(DEBUG_LEVEL > 100) | |||
3736 | cout << "final outer ring: ring, first/last straws & phis = " << locOutermostRingFirstStrawHit->hit->wire->ring << ", " << locOutermostRingFirstStrawHit->hit->wire->straw << ", " << locOutermostRingLastStrawHit->hit->wire->straw << ", " << locOutermostRingFirstStrawPhi << ", " << locOutermostRingLastStrawPhi << endl; | |||
3737 | ||||
3738 | if((locOutermostRingFirstStrawPhi >= locInnermostRingFirstStrawPhi) && (locOutermostRingFirstStrawPhi <= locInnermostRingLastStrawPhi)) | |||
3739 | return 0.0; | |||
3740 | if((locOutermostRingLastStrawPhi >= locInnermostRingFirstStrawPhi) && (locOutermostRingLastStrawPhi <= locInnermostRingLastStrawPhi)) | |||
3741 | return 0.0; | |||
3742 | if((locInnermostRingFirstStrawPhi >= locOutermostRingFirstStrawPhi) && (locInnermostRingFirstStrawPhi <= locOutermostRingLastStrawPhi)) | |||
3743 | return 0.0; //4th case not needed. this case only needed if innermost ring is one wire across | |||
3744 | ||||
3745 | //make all 4 comparisons between hits | |||
3746 | double locDeltaPhi, locMinDeltaPhi; | |||
3747 | locMinDeltaPhi = fabs(locInnermostRingFirstStrawPhi - locOutermostRingFirstStrawPhi); | |||
3748 | if(locMinDeltaPhi > M_PI3.14159265358979323846) | |||
3749 | locMinDeltaPhi = fabs(locMinDeltaPhi - M_TWO_PI6.28318530717958647692); | |||
3750 | if(locOutermostRingFirstStrawHit != locOutermostRingLastStrawHit) | |||
3751 | { | |||
3752 | locDeltaPhi = fabs(locInnermostRingFirstStrawPhi - locOutermostRingLastStrawPhi); | |||
3753 | if(locDeltaPhi > M_PI3.14159265358979323846) | |||
3754 | locDeltaPhi = fabs(locDeltaPhi - M_TWO_PI6.28318530717958647692); | |||
3755 | if(locDeltaPhi < locMinDeltaPhi) | |||
3756 | locMinDeltaPhi = locDeltaPhi; | |||
3757 | } | |||
3758 | if(locInnermostRingFirstStrawHit == locInnermostRingLastStrawHit) | |||
3759 | return locMinDeltaPhi; | |||
3760 | ||||
3761 | locDeltaPhi = fabs(locInnermostRingLastStrawPhi - locOutermostRingFirstStrawPhi); | |||
3762 | if(locDeltaPhi > M_PI3.14159265358979323846) | |||
3763 | locDeltaPhi = fabs(locDeltaPhi - M_TWO_PI6.28318530717958647692); | |||
3764 | if(locDeltaPhi < locMinDeltaPhi) | |||
3765 | locMinDeltaPhi = locDeltaPhi; | |||
3766 | if(locOutermostRingFirstStrawHit != locOutermostRingLastStrawHit) | |||
3767 | { | |||
3768 | locDeltaPhi = fabs(locInnermostRingLastStrawPhi - locOutermostRingLastStrawPhi); | |||
3769 | if(locDeltaPhi > M_PI3.14159265358979323846) | |||
3770 | locDeltaPhi = fabs(locDeltaPhi - M_TWO_PI6.28318530717958647692); | |||
3771 | if(locDeltaPhi < locMinDeltaPhi) | |||
3772 | locMinDeltaPhi = locDeltaPhi; | |||
3773 | } | |||
3774 | ||||
3775 | return locMinDeltaPhi; | |||
3776 | } | |||
3777 | ||||
3778 | //------------ | |||
3779 | // Find_ThetaZ | |||
3780 | //------------ | |||
3781 | bool DTrackCandidate_factory_CDC::Find_ThetaZ(const DHelicalFit* locFit, const vector<DCDCTrkHit*>& locStereoHits, double& locTheta, double& locZ, double& locChiSqPerNDF) | |||
3782 | { | |||
3783 | // Calculate theta/z for the input stereo hits | |||
3784 | if(locStereoHits.empty()) | |||
3785 | return false; | |||
3786 | ||||
3787 | if(Find_ThetaZ_Regression(locFit, locStereoHits, locTheta, locZ, locChiSqPerNDF)) | |||
3788 | return true; | |||
3789 | double locThetaMin, locThetaMax; | |||
3790 | ||||
3791 | // Regression fit failed, try using histogram methods | |||
3792 | bool locThetaOKFlag = Find_Theta(locFit, locStereoHits, locTheta, locThetaMin, locThetaMax, locChiSqPerNDF); | |||
3793 | if(locThetaOKFlag) | |||
3794 | { | |||
3795 | if(Find_Z(locFit, locStereoHits, locThetaMin, locThetaMax, locZ)) | |||
3796 | return true; | |||
3797 | } | |||
3798 | ||||
3799 | // Histogram methods failed. | |||
3800 | ||||
3801 | // Assume that the track came from the center of the target | |||
3802 | locChiSqPerNDF = 9.9E8; | |||
3803 | locZ = TARGET_Z; | |||
3804 | if(locThetaOKFlag) | |||
3805 | return true; | |||
3806 | ||||
3807 | // Use a point in one of the stereo layers to estimate tanl | |||
3808 | double x = locStereoHits[0]->dStereoHitPos.X(); | |||
3809 | double y = locStereoHits[0]->dStereoHitPos.Y(); | |||
3810 | double tworc = 2.0*locFit->r0; | |||
3811 | double ratio = sqrt(x*x + y*y)/tworc; | |||
3812 | if(ratio >= 1.0) | |||
3813 | return false; | |||
3814 | ||||
3815 | double tanl = (locStereoHits[0]->dStereoHitPos.Z() - locZ)/(tworc*asin(ratio)); | |||
3816 | locTheta = M_PI_21.57079632679489661923 - atan(tanl); | |||
3817 | return true; | |||
3818 | } | |||
3819 | ||||
3820 | //----------------------- | |||
3821 | // Find_ThetaZ_Regression | |||
3822 | //----------------------- | |||
3823 | // Linear regression to find tan(lambda) and z_vertex. | |||
3824 | // This method assumes that there are errors in both the z positions and | |||
3825 | // the arc lengths. | |||
3826 | // Algorithm from Numerical Recipes in C (2nd. ed.), pp. 668-669. | |||
3827 | bool DTrackCandidate_factory_CDC::Find_ThetaZ_Regression(const DHelicalFit* locFit, const vector<DCDCTrkHit*>& locStereoHits, double& locTheta, double& locZ, double& locChiSqPerNDF) | |||
3828 | { | |||
3829 | if(DEBUG_LEVEL > 3) | |||
3830 | cout<<"Finding theta and z via linear regression method."<<endl; | |||
3831 | ||||
3832 | if(locStereoHits.empty() || (!(locFit->normal.Mag() > 0.0))) | |||
3833 | return false; | |||
3834 | ||||
3835 | // Vector of intersections between the circle and the stereo wires | |||
3836 | vector<intersection_t> intersections; | |||
3837 | for(size_t m = 0; m < locStereoHits.size(); ++m) | |||
3838 | { | |||
3839 | DCDCTrkHit* trkhit = locStereoHits[m]; | |||
3840 | ||||
3841 | //DVector3_with_perp intersection; | |||
3842 | intersection_t intersection; | |||
3843 | intersection.x = trkhit->dStereoHitPos.X(); | |||
3844 | intersection.y = trkhit->dStereoHitPos.Y(); | |||
3845 | intersection.perp2 = intersection.x*intersection.x + intersection.y*intersection.y; | |||
3846 | intersection.z = trkhit->dStereoHitPos.Z(); | |||
3847 | intersection.var_z = trkhit->var_z; | |||
3848 | intersections.push_back(intersection); | |||
3849 | } | |||
3850 | ||||
3851 | // Now, sort the entries | |||
3852 | stable_sort(intersections.begin(), intersections.end(), CDCSort_Intersections); | |||
3853 | ||||
3854 | // Compute the arc lengths between the origin in x and y and (xi,yi) | |||
3855 | vector<double> arclengths(intersections.size()); | |||
3856 | vector<double> ratios(intersections.size()); | |||
3857 | double xc = locFit->x0; | |||
3858 | double yc = locFit->y0; | |||
3859 | double rc = locFit->r0; | |||
3860 | double two_rc = 2.*rc; | |||
3861 | ||||
3862 | // Find POCA to beam line | |||
3863 | double myphi = atan2(yc, xc); | |||
3864 | double y0 = yc - rc*sin(myphi); | |||
3865 | double x0 = xc - rc*cos(myphi); | |||
3866 | ||||
3867 | // Arc length to first measurement | |||
3868 | double diffx = intersections[0].x - x0; | |||
3869 | double diffy = intersections[0].y - y0; | |||
3870 | double chord = sqrt(diffx*diffx + diffy*diffy); | |||
3871 | double ratio = chord/two_rc; | |||
3872 | double s = (ratio < 1.) ? two_rc*asin(ratio) : M_PI_21.57079632679489661923*two_rc; | |||
3873 | arclengths[0] = s; | |||
3874 | ratios[0] = ratio; | |||
3875 | ||||
3876 | // Find arc lengths for the rest of the stereo hits | |||
3877 | for(size_t m = 1; m < arclengths.size(); ++m) | |||
3878 | { | |||
3879 | diffx = intersections[m].x - intersections[m - 1].x; | |||
3880 | diffy = intersections[m].y - intersections[m - 1].y; | |||
3881 | chord = sqrt(diffx*diffx + diffy*diffy); | |||
3882 | ratio = chord/two_rc; | |||
3883 | if(ratio > 0.999) | |||
3884 | return false; | |||
3885 | double ds = two_rc*asin(ratio); | |||
3886 | s += ds; | |||
3887 | arclengths[m] = s; | |||
3888 | ratios[m] = ratio; | |||
3889 | } | |||
3890 | ||||
3891 | //Linear regression to find z0, tanl | |||
3892 | double tanl = 0.,z0 = 0.; | |||
3893 | if(arclengths.size() > 1) // Do fit only if have more than one measurement | |||
3894 | { | |||
3895 | DCDCLineFit fit; | |||
3896 | size_t n = fit.n = intersections.size(); | |||
3897 | fit.s.resize(n); | |||
3898 | fit.var_s.resize(n); | |||
3899 | fit.z.resize(n); | |||
3900 | fit.var_z.resize(n); | |||
3901 | fit.w.resize(n); | |||
3902 | ||||
3903 | // Find average variances for z and s | |||
3904 | double avg_var_s = 0., avg_var_z = 0.; | |||
3905 | double var_r = 1.6*1.6/12.; // assume cell size | |||
3906 | for (size_t m = 0; m < n; ++m) | |||
3907 | { | |||
3908 | fit.s[m] = arclengths[m]; | |||
3909 | fit.var_s[m] = var_r/(1. - ratios[m]*ratios[m]); | |||
3910 | ||||
3911 | avg_var_s += fit.var_s[m]; | |||
3912 | avg_var_z += intersections[m].var_z; | |||
3913 | ||||
3914 | if(DEBUG_LEVEL>5) | |||
3915 | cout<<"Using CDC hit "<<m<<" z="<<intersections[m].z << " s=" << arclengths[m] <<endl; | |||
3916 | } | |||
3917 | ||||
3918 | // Scale z errors according to the ratio of the average variances | |||
3919 | double scale2 = avg_var_s/avg_var_z; | |||
3920 | double scale = sqrt(scale2); | |||
3921 | vector<double> weight(n); | |||
3922 | for (size_t m = 0; m < n; ++m) | |||
3923 | { | |||
3924 | fit.z[m] = scale*intersections[m].z; | |||
3925 | fit.var_z[m] = scale2*intersections[m].var_z; | |||
3926 | weight[m] = fit.var_s[m] + fit.var_z[m]; | |||
3927 | } | |||
3928 | ||||
3929 | // Perform preliminary fit to find the (scaled) slope tanl | |||
3930 | double sumv=0., sumx=0.; | |||
3931 | double sumy=0., sumxx=0., sumxy=0.; | |||
3932 | for(size_t m = 0; m < n; ++m) | |||
3933 | { | |||
3934 | //double temp = 1./var_z[m]; | |||
3935 | double temp = 1./weight[m]; | |||
3936 | sumv += temp; | |||
3937 | sumx += arclengths[m]*temp; | |||
3938 | sumy += fit.z[m]*temp; | |||
3939 | sumxx += arclengths[m]*arclengths[m]*temp; | |||
3940 | sumxy += arclengths[m]*fit.z[m]*temp; | |||
3941 | } | |||
3942 | double Delta = sumv*sumxx - sumx*sumx; | |||
3943 | if(!(fabs(Delta) > 0.0)) | |||
3944 | return false; | |||
3945 | ||||
3946 | tanl = (sumv*sumxy - sumx*sumy)/Delta; | |||
3947 | fit.z0 = (sumxx*sumy - sumx*sumxy)/Delta; | |||
3948 | ||||
3949 | // Convert tanl to an angle and create two other reference angles | |||
3950 | double angle[3]; | |||
3951 | angle[0] = 0.; | |||
3952 | angle[1] = atan(tanl); | |||
3953 | angle[2] = 1.571; | |||
3954 | // Compute chi^2 values for line fits with these three angles | |||
3955 | double ch[3]; | |||
3956 | for (unsigned int m = 0; m < 3; ++m) | |||
3957 | ch[m] = fit.ChiXY(angle[m]); | |||
3958 | ||||
3959 | // Bracket the minimum chi^2 | |||
3960 | fit.BracketMinimumChisq(angle[0], angle[1], angle[2], ch[0], ch[1], ch[2]); | |||
3961 | // Find the minimum chi^2 using Brent's method and compute the best value for lambda | |||
3962 | double lambda = 0.; | |||
3963 | locChiSqPerNDF = fit.FindMinimumChisq(angle[0], angle[1], angle[2], lambda)/2.0; //2 degrees of freedom | |||
3964 | // Undo the scaling | |||
3965 | z0 = fit.z0/scale; | |||
3966 | tanl = tan(lambda)/scale; | |||
3967 | } | |||
3968 | else | |||
3969 | { | |||
3970 | z0 = TARGET_Z; | |||
3971 | tanl = (intersections[0].z - z0)/arclengths[0]; | |||
3972 | locChiSqPerNDF = 9.9E9; //only two hits: technically is zero, but if possible want to pick a group of stereo hits with more hits | |||
3973 | } | |||
3974 | ||||
3975 | locTheta = M_PI_21.57079632679489661923 - atan(tanl); | |||
3976 | locZ = z0; | |||
3977 | ||||
3978 | return true; | |||
3979 | } | |||
3980 | ||||
3981 | //----------- | |||
3982 | // Find_Theta | |||
3983 | //----------- | |||
3984 | bool DTrackCandidate_factory_CDC::Find_Theta(const DHelicalFit* locFit, const vector<DCDCTrkHit*>& locStereoHits, double& locTheta, double& locThetaMin, double& locThetaMax, double& locChiSqPerNDF) | |||
3985 | { | |||
3986 | if(locStereoHits.empty()) | |||
3987 | return false; | |||
3988 | /// Find the theta value using the input stereo hits. | |||
3989 | /// The values for dPhiStereo and dStereoHitPos.Z() are assumed to be valid. | |||
3990 | /// The value of locFit.r0 is also used to calculate theta. | |||
3991 | /// | |||
3992 | /// This uses a histogramming technique that looks at the overlaps of the | |||
3993 | /// angle ranges subtended by each hit between the given target limits. | |||
3994 | /// The overlaps usually lead to a range of values for theta. The limits | |||
3995 | /// of these are stored in locThetaMin and locThetaMax. | |||
3996 | /// The centroid of the range is stored in the theta field. | |||
3997 | ||||
3998 | // We use a simple array to store our histogram here. We don't want to use | |||
3999 | // ROOT histograms because they are not thread safe. | |||
4000 | unsigned int Nbins = 1000; | |||
4001 | unsigned int hist[Nbins]; | |||
4002 | for(unsigned int i=0; i<Nbins; ++i) | |||
4003 | hist[i] = 0; // clear histogram | |||
4004 | double bin_width = M_TWO_PI6.28318530717958647692/(double)Nbins; | |||
4005 | double hist_low_limit = -M_PI3.14159265358979323846; // lower edge of histogram limits | |||
4006 | ||||
4007 | // Loop over CDC hits, filling the histogram | |||
4008 | double r0 = locFit->r0; | |||
4009 | for(unsigned int i=0; i < locStereoHits.size(); ++i) | |||
4010 | { | |||
4011 | DCDCTrkHit *trkhit = locStereoHits[i]; | |||
4012 | ||||
4013 | // Calculate upper and lower limits in theta | |||
4014 | double alpha = r0*trkhit->dPhiStereo; | |||
4015 | if(locFit->h < 0.0) | |||
4016 | alpha = -alpha; | |||
4017 | double tmin = atan2(alpha, trkhit->dStereoHitPos.Z() - VERTEX_Z_MIN); | |||
4018 | double tmax = atan2(alpha, trkhit->dStereoHitPos.Z() - VERTEX_Z_MAX); | |||
4019 | if(tmin>tmax) | |||
4020 | { | |||
4021 | double tmp = tmin; | |||
4022 | tmin=tmax; | |||
4023 | tmax=tmp; | |||
4024 | } | |||
4025 | if(DEBUG_LEVEL>3) | |||
4026 | cout<<" -- phi_stereo="<<trkhit->dPhiStereo<<" z_stereo="<<trkhit->dStereoHitPos.Z()<<" alpha="<<alpha<<endl; | |||
4027 | if(DEBUG_LEVEL>3) | |||
4028 | cout<<" -- tmin="<<tmin<<" tmax="<<tmax<<endl; | |||
4029 | ||||
4030 | // Find index of bins corresponding to tmin and tmax | |||
4031 | unsigned int imin = (unsigned int)floor((tmin-hist_low_limit)/bin_width); | |||
4032 | unsigned int imax = (unsigned int)floor((tmax-hist_low_limit)/bin_width); | |||
4033 | ||||
4034 | // If entire range of this hit is outside of the histogram limit | |||
4035 | // then discard this hit. | |||
4036 | if(imin>=Nbins) | |||
4037 | continue; | |||
4038 | ||||
4039 | // Clip limits of bin range to our histogram limits | |||
4040 | if(imin>=Nbins) | |||
4041 | imin=Nbins-1; | |||
4042 | if(imax>=Nbins) | |||
4043 | imax=Nbins-1; | |||
4044 | ||||
4045 | // Increment all bins between imin and imax | |||
4046 | for(unsigned int j=imin; j<=imax; ++j) | |||
4047 | ++hist[j]; | |||
4048 | } | |||
4049 | ||||
4050 | // Look for the indexes of the plateau | |||
4051 | unsigned int istart=0; | |||
4052 | unsigned int iend=0; | |||
4053 | for(unsigned int i=1; i<Nbins; ++i) | |||
4054 | { | |||
4055 | if(hist[i]>hist[istart]) | |||
4056 | { | |||
4057 | istart = i; | |||
4058 | if(DEBUG_LEVEL>3) | |||
4059 | cout<<" -- istart="<<istart<<" (theta="<<hist_low_limit + bin_width*(0.5+(double)istart)<<" , N="<<hist[i]<<")"<<endl; | |||
4060 | } | |||
4061 | if(hist[i] == hist[istart]) | |||
4062 | iend = i; | |||
4063 | } | |||
4064 | ||||
4065 | // If there are no entries in the histogram, then return false | |||
4066 | if(hist[istart] == 0) | |||
4067 | return false; | |||
4068 | ||||
4069 | // Calculate theta limits | |||
4070 | locThetaMin = hist_low_limit + bin_width*(0.5+(double)istart); | |||
4071 | locThetaMax = hist_low_limit + bin_width*(0.5+(double)iend); | |||
4072 | locTheta = (locThetaMax + locThetaMin)/2.0; | |||
4073 | if(DEBUG_LEVEL>3) | |||
4074 | cout<<"istart="<<istart<<" iend="<<iend<<" theta_min="<<locThetaMin<<" theta_max="<<locThetaMax<<endl; | |||
4075 | locChiSqPerNDF = 9.9E5; //NEED TO CALCULATE THIS!!! | |||
4076 | ||||
4077 | return true; | |||
4078 | } | |||
4079 | ||||
4080 | //------- | |||
4081 | // Find_Z | |||
4082 | //------- | |||
4083 | bool DTrackCandidate_factory_CDC::Find_Z(const DHelicalFit* locFit, const vector<DCDCTrkHit*>& locStereoHits, double locThetaMin, double locThetaMax, double& locZ) | |||
4084 | { | |||
4085 | if(locStereoHits.empty()) | |||
4086 | return false; | |||
4087 | ||||
4088 | /// Find the z value of the vertex using the stereo hits. | |||
4089 | /// The values for dPhiStereo and dStereoHitPos.Z() are assumed to be valid. | |||
4090 | /// | |||
4091 | /// This uses a histogramming technique that looks at the overlaps of the | |||
4092 | /// z ranges subtended by each hit between the given theta limits. | |||
4093 | /// The overlaps usually lead to a range of values for z_vertex. | |||
4094 | /// The centroid of the range is returned as locZ. | |||
4095 | ||||
4096 | // We use a simple array to store our histogram here. We don't want to use | |||
4097 | // ROOT histograms because they are not thread safe. | |||
4098 | unsigned int Nbins = 300; | |||
4099 | unsigned int hist[Nbins]; | |||
4100 | for(unsigned int i=0; i<Nbins; ++i) | |||
4101 | hist[i] = 0; // clear histogram | |||
4102 | double bin_width = 0.5; // bins are 5mm | |||
4103 | double hist_low_limit = 0.0; // lower edge of histogram limits | |||
4104 | ||||
4105 | // Loop over CDC hits, filling the histogram | |||
4106 | double r0 = locFit->r0; | |||
4107 | double tan_alpha_min = tan(locThetaMin)/r0; | |||
4108 | double tan_alpha_max = tan(locThetaMax)/r0; | |||
4109 | for(unsigned int i=0; i< locStereoHits.size(); ++i) | |||
4110 | { | |||
4111 | DCDCTrkHit* trkhit = locStereoHits[i]; | |||
4112 | ||||
4113 | // Calculate upper and lower limits in z | |||
4114 | double q_sign = locFit->h > 0.0 ? +1.0:-1.0; | |||
4115 | double zmin = trkhit->dStereoHitPos.Z() - q_sign*trkhit->dPhiStereo/tan_alpha_min; | |||
4116 | double zmax = trkhit->dStereoHitPos.Z() - q_sign*trkhit->dPhiStereo/tan_alpha_max; | |||
4117 | if(zmin>zmax) | |||
4118 | { | |||
4119 | double tmp = zmin; | |||
4120 | zmin=zmax; | |||
4121 | zmax=tmp; | |||
4122 | } | |||
4123 | if(DEBUG_LEVEL>3) | |||
4124 | cout<<" -- phi_stereo="<<trkhit->dPhiStereo<<" z_stereo="<<trkhit->dStereoHitPos.Z()<<endl; | |||
4125 | if(DEBUG_LEVEL>3) | |||
4126 | cout<<" -- zmin="<<zmin<<" zmax="<<zmax<<endl; | |||
4127 | ||||
4128 | // Find index of bins corresponding to tmin and tmax | |||
4129 | unsigned int imin = (unsigned int)floor((zmin-hist_low_limit)/bin_width); | |||
4130 | unsigned int imax = (unsigned int)floor((zmax-hist_low_limit)/bin_width); | |||
4131 | ||||
4132 | // If entire range of this hit is outside of the histogram limit | |||
4133 | // then discard this hit. | |||
4134 | if(imax<=0 || imin>=Nbins) | |||
4135 | continue; | |||
4136 | ||||
4137 | // Clip limits of bin range to our histogram limits | |||
4138 | if(imin>=Nbins) | |||
4139 | imin=Nbins-1; | |||
4140 | if(imax>=Nbins) | |||
4141 | imax=Nbins-1; | |||
4142 | ||||
4143 | // Increment all bins between imin and imax | |||
4144 | for(unsigned int j=imin; j<=imax; ++j) | |||
4145 | ++hist[j]; | |||
4146 | } | |||
4147 | ||||
4148 | // Look for the indexes of the plateau | |||
4149 | unsigned int istart=0; | |||
4150 | unsigned int iend=0; | |||
4151 | for(unsigned int i=1; i<Nbins; ++i) | |||
4152 | { | |||
4153 | if(hist[i]>hist[istart]) | |||
4154 | { | |||
4155 | istart = i; | |||
4156 | if(DEBUG_LEVEL>3) | |||
4157 | cout<<" -- istart="<<istart<<" (z="<<hist_low_limit + bin_width*(0.5+(double)istart)<<" , N="<<hist[i]<<")"<<endl; | |||
4158 | } | |||
4159 | if(hist[i] == hist[istart]) | |||
4160 | iend = i; | |||
4161 | } | |||
4162 | ||||
4163 | // If there are no entries in the histogram, then return false | |||
4164 | if(hist[istart] == 0) | |||
4165 | return false; | |||
4166 | ||||
4167 | // Calculate z limits | |||
4168 | double locZMin = hist_low_limit + bin_width*(0.5+(double)istart); | |||
4169 | double locZMax = hist_low_limit + bin_width*(0.5+(double)iend); | |||
4170 | locZ = (locZMax + locZMin)/2.0; | |||
4171 | if(DEBUG_LEVEL>3) | |||
4172 | cout<<"istart="<<istart<<" iend="<<iend<<" z_min="<<locZMin<<" z_max="<<locZMax<<" hits[istart]="<<hist[istart]<<endl; | |||
4173 | return true; | |||
4174 | } | |||
4175 | ||||
4176 | //--------------------------- | |||
4177 | // Recycle_DCDCSuperLayerSeed | |||
4178 | //--------------------------- | |||
4179 | void DTrackCandidate_factory_CDC::Recycle_DCDCSuperLayerSeed(DCDCSuperLayerSeed* locCDCSuperLayerSeed) | |||
4180 | { | |||
4181 | // this function should ONLY be called for stereo super layers AFTER the hits have been projected onto the circle (new hit objects were made) | |||
4182 | // this is useful for recycling the memory used by the projected hits and seeds | |||
4183 | // first loop over the hits: see if can recycle those as well (each hit can be used in multiple seeds) | |||
4184 | ||||
4185 | vector<DCDCTrkHit*> locHits; | |||
4186 | locCDCSuperLayerSeed->Get_Hits(locHits); | |||
4187 | for(size_t loc_i = 0; loc_i < locHits.size(); ++loc_i) | |||
4188 | { | |||
4189 | DCDCTrkHit* locCDCTrkHit = locHits[loc_i]; | |||
4190 | if(dStereoHitNumUsedMap[locCDCTrkHit] == 1) //this is the last remaining DCDCSuperLayerSeed this hit is used in: recycle it | |||
4191 | dCDCTrkHitPool_Available.push_back(locCDCTrkHit); | |||
4192 | else | |||
4193 | --dStereoHitNumUsedMap[locCDCTrkHit]; | |||
4194 | } | |||
4195 | dCDCSuperLayerSeedPool_Available.push_back(locCDCSuperLayerSeed); //recycle | |||
4196 | } | |||
4197 | ||||
4198 | //--------------------------- | |||
4199 | // Recycle_DCDCTrackCircle | |||
4200 | //--------------------------- | |||
4201 | void DTrackCandidate_factory_CDC::Recycle_DCDCTrackCircle(DCDCTrackCircle* locCDCTrackCircle) | |||
4202 | { | |||
4203 | if(locCDCTrackCircle->fit != NULL__null) | |||
4204 | { | |||
4205 | dHelicalFitPool_Available.push_back(locCDCTrackCircle->fit); | |||
4206 | locCDCTrackCircle->fit = NULL__null; | |||
4207 | } | |||
4208 | locCDCTrackCircle->Reset(); | |||
4209 | dCDCTrackCirclePool_Available.push_back(locCDCTrackCircle); //recycle | |||
4210 | } | |||
4211 | ||||
4212 | //---------------------- | |||
4213 | // Set_HitBitPattern_All | |||
4214 | //---------------------- | |||
4215 | void DTrackCandidate_factory_CDC::Set_HitBitPattern_All(vector<DCDCTrackCircle*>& locCDCTrackCircles) | |||
4216 | { | |||
4217 | unsigned int locNumBits = 8*sizeof(unsigned int); | |||
4218 | for(size_t loc_i = 0; loc_i < locCDCTrackCircles.size(); ++loc_i) | |||
4219 | { | |||
4220 | DCDCTrackCircle* locCDCTrackCircle = locCDCTrackCircles[loc_i]; | |||
4221 | locCDCTrackCircle->HitBitPattern.clear(); | |||
4222 | locCDCTrackCircle->HitBitPattern.resize(dNumCDCHits/(8*sizeof(unsigned int)) + 1); | |||
4223 | vector<DCDCTrkHit*> locHits; | |||
4224 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_Axial.size(); ++loc_j) | |||
4225 | { | |||
4226 | locCDCTrackCircle->dSuperLayerSeeds_Axial[loc_j]->Get_Hits(locHits); | |||
4227 | for(size_t loc_k = 0; loc_k < locHits.size(); ++loc_k) | |||
4228 | locCDCTrackCircle->HitBitPattern[locHits[loc_k]->index/locNumBits] |= 1 << locHits[loc_k]->index % locNumBits; | |||
4229 | } | |||
4230 | ||||
4231 | if(!locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.empty()) | |||
4232 | { | |||
4233 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[0].size(); ++loc_j) | |||
4234 | { | |||
4235 | locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[0][loc_j]->Get_Hits(locHits); | |||
4236 | for(size_t loc_k = 0; loc_k < locHits.size(); ++loc_k) | |||
4237 | locCDCTrackCircle->HitBitPattern[locHits[loc_k]->index/locNumBits] |= 1 << locHits[loc_k]->index % locNumBits; | |||
4238 | } | |||
4239 | } | |||
4240 | if(!locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.empty()) | |||
4241 | { | |||
4242 | for(size_t loc_j = 0; loc_j < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[0].size(); ++loc_j) | |||
4243 | { | |||
4244 | locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[0][loc_j]->Get_Hits(locHits); | |||
4245 | for(size_t loc_k = 0; loc_k < locHits.size(); ++loc_k) | |||
4246 | locCDCTrackCircle->HitBitPattern[locHits[loc_k]->index/locNumBits] |= 1 << locHits[loc_k]->index % locNumBits; | |||
4247 | } | |||
4248 | } | |||
4249 | } | |||
4250 | } | |||
4251 | ||||
4252 | //--------------------------- | |||
4253 | // Filter_TrackCircles_Stereo | |||
4254 | //--------------------------- | |||
4255 | void DTrackCandidate_factory_CDC::Filter_TrackCircles_Stereo(vector<DCDCTrackCircle*>& locCDCTrackCircles) | |||
4256 | { | |||
4257 | if(locCDCTrackCircles.empty()) | |||
4258 | return; | |||
4259 | ||||
4260 | //sort track circles so that the ones with the best stereo chisq/ndf are first | |||
4261 | stable_sort(locCDCTrackCircles.begin(), locCDCTrackCircles.end(), CDCSortByStereoChiSqPerNDFIncreasing); | |||
4262 | ||||
4263 | if(DEBUG_LEVEL > 5) | |||
4264 | { | |||
4265 | cout << "filter stereo, circles sorted by stereo chisq/ndf" << endl; | |||
4266 | Print_TrackCircles(locCDCTrackCircles); | |||
4267 | } | |||
4268 | ||||
4269 | //FIRST: Delete super layer seeds if they are shared between circles: delete it from the one with the worst dWeightedChiSqPerDF_Stereo | |||
4270 | // This is typically a problem when a track exits the CDC before reaching SL5 or SL6, and picks up the SL5 & SL6 hits from a nearby track instead | |||
4271 | // However, DO NOT delete the super layer seed if it is the last one on the track | |||
4272 | for(size_t loc_i = 0; loc_i < (locCDCTrackCircles.size() - 1); ++loc_i) | |||
4273 | { | |||
4274 | //assume this track circle has no wrong seeds (since it has the best chisq/ndf of all circles containing any of these seeds) | |||
4275 | DCDCTrackCircle* locTrackCircle_ToCompareTo = locCDCTrackCircles[loc_i]; | |||
4276 | vector<DCDCSuperLayerSeed*> locStereoSuperLayerSeeds; | |||
4277 | locTrackCircle_ToCompareTo->Get_AllStereoSuperLayerSeeds(locStereoSuperLayerSeeds); | |||
4278 | //if any of the following track circles has any of the stereo super layer seeds in this track circle, then delete those seeds from those circles | |||
4279 | //should recycle... | |||
4280 | bool locSeedsStrippedFlag_AnyCircle = false; | |||
4281 | for(size_t loc_j = loc_i + 1; loc_j < locCDCTrackCircles.size(); ++loc_j) | |||
4282 | { | |||
4283 | DCDCTrackCircle* locTrackCircle_Validating = locCDCTrackCircles[loc_j]; | |||
4284 | if(locTrackCircle_Validating->Get_NumStereoSuperLayerSeeds() <= 1) | |||
4285 | continue; //don't strip the last stereo hits!! (stripping isn't perfrect, maybe they are correct, or maybe hit selector will pick the correct ones) | |||
4286 | bool locSeedsStrippedFlag = false; | |||
4287 | for(size_t loc_k = 0; loc_k < locStereoSuperLayerSeeds.size(); ++loc_k) | |||
4288 | { | |||
4289 | if(locTrackCircle_Validating->Get_NumStereoSuperLayerSeeds() <= 1) | |||
4290 | break; | |||
4291 | //remember, can't compare pointers directly (made new objects for projection to track circle), must compare dSuperLayer and dSeedIndex | |||
4292 | unsigned int locSuperLayer = locStereoSuperLayerSeeds[loc_k]->dSuperLayer; | |||
4293 | unsigned int locSeedIndex = locStereoSuperLayerSeeds[loc_k]->dSeedIndex; | |||
4294 | DCDCSuperLayerSeed* locSuperLayerSeed = locTrackCircle_Validating->Get_SuperLayerSeed(locSuperLayer); | |||
4295 | if(locSuperLayerSeed == NULL__null) | |||
4296 | continue; | |||
4297 | if((locSuperLayerSeed->dSuperLayer != locSuperLayer) || (locSuperLayerSeed->dSeedIndex != locSeedIndex)) | |||
4298 | continue; | |||
4299 | //stereo super layer is shared by both track circles, reject it from the one with the worse stereo chisq/ndf (weighted) | |||
4300 | if(DEBUG_LEVEL > 10) | |||
4301 | cout << "strip SL" << locSuperLayer << " from track circle " << loc_j << endl; | |||
4302 | locTrackCircle_Validating->Strip_StereoSuperLayerSeed(locSuperLayer); | |||
4303 | locSeedsStrippedFlag = true; //may want to recalc theta/z | |||
4304 | locSeedsStrippedFlag_AnyCircle = true; | |||
4305 | } | |||
4306 | if(locSeedsStrippedFlag) //recalc theta/z to get new chisq/ndf | |||
4307 | Select_CDCSuperLayerSeeds(locTrackCircle_Validating, false); | |||
4308 | } | |||
4309 | ||||
4310 | if(locSeedsStrippedFlag_AnyCircle) //re-sort if fits have been re-performed | |||
4311 | stable_sort(locCDCTrackCircles.begin() + loc_i + 1, locCDCTrackCircles.end(), CDCSortByStereoChiSqPerNDFIncreasing); | |||
4312 | } | |||
4313 | ||||
4314 | //restore sort by circle-fit chisq/ndf (weighted) | |||
4315 | stable_sort(locCDCTrackCircles.begin(), locCDCTrackCircles.end(), CDCSortByChiSqPerNDFDecreasing); | |||
4316 | ||||
4317 | if(DEBUG_LEVEL > 5) | |||
4318 | { | |||
4319 | cout << "filter stereo, circles sorted by axial chisq/ndf" << endl; | |||
4320 | Print_TrackCircles(locCDCTrackCircles); | |||
4321 | } | |||
4322 | } | |||
4323 | ||||
4324 | //--------------- | |||
4325 | // Add_UnusedHits | |||
4326 | //--------------- | |||
4327 | void DTrackCandidate_factory_CDC::Add_UnusedHits(vector<DCDCTrackCircle*>& locCDCTrackCircles) | |||
4328 | { | |||
4329 | if(DEBUG_LEVEL > 5) | |||
4330 | cout << "Add unused hits" << endl; | |||
4331 | ||||
4332 | // If the last super layer of a track is not 7, search for lone, unused hits on the next super layer and add them to the track | |||
4333 | // Only add them if they can link to the previous super layer, and wouldn't skip too many rings | |||
4334 | // Add at most one hit: prefer the hit on the innermost ring | |||
4335 | //If more than one hit on the innermost axial ring: choose the one closest to the circle fit | |||
4336 | //If more than one hit on the innermost stereo ring: ambiguous, don't add any hits | |||
4337 | for(size_t loc_i = 0; loc_i < locCDCTrackCircles.size(); ++loc_i) | |||
4338 | { | |||
4339 | DCDCSuperLayerSeed* locLastSuperLayerSeed = locCDCTrackCircles[loc_i]->Get_LastSuperLayerSeed(); | |||
4340 | unsigned int locLastSuperLayer = locLastSuperLayerSeed->dSuperLayer; | |||
4341 | if(DEBUG_LEVEL > 5) | |||
4342 | cout << "i, last super layer = " << loc_i << ", " << locLastSuperLayer << endl; | |||
4343 | if(locLastSuperLayer == 7) | |||
4344 | continue; | |||
4345 | unsigned int locSearchSuperLayer = locLastSuperLayer + 1; | |||
4346 | const DHelicalFit* locFit = locCDCTrackCircles[loc_i]->fit; | |||
4347 | ||||
4348 | //make sure the next super layer doesn't correspond to a region where all of the seeds were deleted earlier (density too high) | |||
4349 | double locSeedFirstPhi, locSeedLastPhi; | |||
4350 | Calc_SuperLayerPhiRange(locLastSuperLayerSeed, locSeedFirstPhi, locSeedLastPhi); | |||
4351 | bool locHitDensityTooHighFlag = false; | |||
4352 | for(size_t loc_k = 0; loc_k < dRejectedPhiRegions[locSearchSuperLayer].size(); ++loc_k) | |||
4353 | { | |||
4354 | if(!Check_IfPhiRangesOverlap(locSeedFirstPhi, locSeedLastPhi, dRejectedPhiRegions[locSearchSuperLayer][loc_k].first, dRejectedPhiRegions[locSearchSuperLayer][loc_k].second)) | |||
4355 | continue; | |||
4356 | locHitDensityTooHighFlag = true; | |||
4357 | break; | |||
4358 | } | |||
4359 | if(locHitDensityTooHighFlag) | |||
4360 | { | |||
4361 | if(DEBUG_LEVEL > 5) | |||
4362 | cout << "hit density too high, don't add unused hits" << endl; | |||
4363 | continue; //hit density in this region is too high, ignore all hits here | |||
4364 | } | |||
4365 | ||||
4366 | //make sure we don't skip too many rings | |||
4367 | int locLastHitRing = locLastSuperLayerSeed->dCDCRingSeeds.back().ring; | |||
4368 | if((4*locLastSuperLayer - locLastHitRing) > MAX_NUM_RINGSEED_RINGS_SKIPABLE) | |||
4369 | { | |||
4370 | if(DEBUG_LEVEL > 5) | |||
4371 | cout << "too many rings missing at the end of the last super layer: actual, max = " << 4*locLastSuperLayer - locLastHitRing << ", " << MAX_NUM_RINGSEED_RINGS_SKIPABLE << endl; | |||
4372 | continue; //too many rings missing at the end of the last super layer | |||
4373 | } | |||
4374 | ||||
4375 | wire_direction_t locWireDirection; | |||
4376 | if((locSearchSuperLayer == 1) || (locSearchSuperLayer == 4) || (locSearchSuperLayer == 7)) | |||
4377 | locWireDirection = WIRE_DIRECTION_AXIAL; | |||
4378 | else if((locSearchSuperLayer == 2) || (locSearchSuperLayer == 6)) | |||
4379 | locWireDirection = WIRE_DIRECTION_STEREOLEFT; | |||
4380 | else | |||
4381 | locWireDirection = WIRE_DIRECTION_STEREORIGHT; | |||
4382 | ||||
4383 | //ok, look for unused hits within a certain angle/distance from the circle fit | |||
4384 | DCDCTrkHit* locBestTrkHit = NULL__null; | |||
4385 | int locAmbiguousHitRing = -1; //if != -1, ignore all hits in or above this ring //set if > 1 stereo hit that matches on this ring | |||
4386 | double locBestDeltaPhi = 9.9E9; //for axial if > 1 hit on innermost ring | |||
4387 | for(size_t loc_j = 0; loc_j < cdchits_by_superlayer[locSearchSuperLayer - 1].size(); ++loc_j) | |||
4388 | { | |||
4389 | DCDCTrkHit* locTrkHit = cdchits_by_superlayer[locSearchSuperLayer - 1][loc_j]; | |||
4390 | if(locTrkHit->flags & USED) | |||
4391 | continue; //not a lone hit: used in a super layer seed | |||
4392 | if(locTrkHit->hit->wire->ring == locAmbiguousHitRing) | |||
4393 | continue; // already > 1 stereo hit on this ring: ambiguous as to which hit is best | |||
4394 | ||||
4395 | //make sure we don't skip too many rings | |||
4396 | int locNumRingsSkipped = locTrkHit->hit->wire->ring - locLastHitRing - 1; | |||
4397 | if(locNumRingsSkipped > int(MAX_NUM_RINGSEED_RINGS_SKIPABLE)) | |||
4398 | { | |||
4399 | if(DEBUG_LEVEL > 5) | |||
4400 | cout << "would skip too many rings: actual, max = " << locNumRingsSkipped << ", " << MAX_NUM_RINGSEED_RINGS_SKIPABLE << endl; | |||
4401 | continue; //would skip too many rings | |||
4402 | } | |||
4403 | ||||
4404 | // see if the hit has small-enough transverse distance to the previous super layer | |||
4405 | DCDCRingSeed locRingSeed; | |||
4406 | locRingSeed.hits.push_back(locTrkHit); | |||
4407 | locRingSeed.ring = locTrkHit->hit->wire->ring; | |||
4408 | locRingSeed.linked = false; | |||
4409 | if(!Attempt_SeedLink(locLastSuperLayerSeed->dCDCRingSeeds.back(), locRingSeed, locLastSuperLayerSeed->dWireOrientation, locWireDirection)) | |||
4410 | { | |||
4411 | if(DEBUG_LEVEL > 5) | |||
4412 | cout << "new hit isn't close to wires in previous seed" << endl; | |||
4413 | continue; //new hit isn't close to wires in previous seed | |||
4414 | } | |||
4415 | if(DEBUG_LEVEL > 5) | |||
4416 | cout << "hit is close to wires in previous seed, ring = " << locTrkHit->hit->wire->ring << endl; | |||
4417 | ||||
4418 | // If axial, require that the hit be near the circle fit. | |||
4419 | double locDeltaPhi = 9.9E9; | |||
4420 | if((locSearchSuperLayer == 4) || (locSearchSuperLayer == 7)) | |||
4421 | { | |||
4422 | // Find the position on the circle that is closest to locTrkHit | |||
4423 | const DVector3 locOrigin = locTrkHit->hit->wire->origin; | |||
4424 | double dx = locOrigin.x() - locFit->x0; | |||
4425 | double dy = locOrigin.y() - locFit->y0; | |||
4426 | double one_over_denom = 1.0/sqrt(dx*dx + dy*dy); | |||
4427 | double x = locFit->x0 + locFit->r0*dx*one_over_denom; | |||
4428 | double y = locFit->y0 + locFit->r0*dy*one_over_denom; | |||
4429 | DVector2 locCirclePosition(x, y); | |||
4430 | ||||
4431 | // Compare phi values to see if the seeds are close enough to link | |||
4432 | locDeltaPhi = fabs(locCirclePosition.Phi() - locOrigin.Phi()); | |||
4433 | while(locDeltaPhi > M_PI3.14159265358979323846) | |||
4434 | locDeltaPhi -= M_TWO_PI6.28318530717958647692; | |||
4435 | locDeltaPhi *= 180.0/M_PI3.14159265358979323846; | |||
4436 | if(DEBUG_LEVEL > 5) | |||
4437 | cout << "hit is axial, check if delta phi is close enough: " << fabs(locDeltaPhi) << ", " << MAX_UNUSED_HIT_LINK_ANGLE << endl; | |||
4438 | if(fabs(locDeltaPhi) > MAX_UNUSED_HIT_LINK_ANGLE) | |||
4439 | continue; //hit is too far away from the current circle fit | |||
4440 | } | |||
4441 | ||||
4442 | //Have a matching unused hit. Now make sure it is the best one so far. | |||
4443 | ||||
4444 | if(locBestTrkHit == NULL__null) | |||
4445 | { | |||
4446 | //No best hit before, save this result | |||
4447 | locBestTrkHit = locTrkHit; | |||
4448 | locBestDeltaPhi = locDeltaPhi; | |||
4449 | if(DEBUG_LEVEL > 5) | |||
4450 | cout << "brand new track hit, delta phi = " << locBestDeltaPhi << endl; | |||
4451 | continue; | |||
4452 | } | |||
4453 | ||||
4454 | if(locTrkHit->hit->wire->ring > locBestTrkHit->hit->wire->ring) | |||
4455 | { | |||
4456 | //ring is larger: new hit not as good as the current best one | |||
4457 | if(DEBUG_LEVEL > 5) | |||
4458 | cout << "new hit not as good as the current best one" << endl; | |||
4459 | continue; | |||
4460 | } | |||
4461 | ||||
4462 | if(locTrkHit->hit->wire->ring < locBestTrkHit->hit->wire->ring) | |||
4463 | { | |||
4464 | //ring is smaller: new hit better than the one we had before | |||
4465 | locAmbiguousHitRing = -1; | |||
4466 | locBestTrkHit = locTrkHit; | |||
4467 | locBestDeltaPhi = locDeltaPhi; | |||
4468 | if(DEBUG_LEVEL > 5) | |||
4469 | cout << "new best track hit (better ring), delta phi = " << locBestDeltaPhi << endl; | |||
4470 | continue; | |||
4471 | } | |||
4472 | ||||
4473 | //The new hit is on the same ring as the previous best hit. | |||
4474 | ||||
4475 | if((locSearchSuperLayer != 4) && (locSearchSuperLayer != 7)) | |||
4476 | { | |||
4477 | //stereo: can't tell which hit is best, label ring as ambiguous | |||
4478 | locAmbiguousHitRing = locBestTrkHit->hit->wire->ring; | |||
4479 | locBestTrkHit = NULL__null; | |||
4480 | if(DEBUG_LEVEL > 5) | |||
4481 | cout << "stereo, can't tell which hit is best, label ring " << locAmbiguousHitRing << " as ambiguous" << endl; | |||
4482 | continue; | |||
4483 | } | |||
4484 | ||||
4485 | //Axial, see if closest to the track circle (smallest delta phi) | |||
4486 | if(locDeltaPhi >= locBestDeltaPhi) | |||
4487 | { | |||
4488 | //delta-phi is larger: new hit not as good as the current best one | |||
4489 | if(DEBUG_LEVEL > 5) | |||
4490 | cout << "axial, not the best hit, phis = " << locDeltaPhi << ", " << locBestDeltaPhi << endl; | |||
4491 | continue; | |||
4492 | } | |||
4493 | ||||
4494 | //delta-phi is smaller: new hit better than the current best one: save it | |||
4495 | locBestTrkHit = locTrkHit; | |||
4496 | locBestDeltaPhi = locDeltaPhi; | |||
4497 | if(DEBUG_LEVEL > 5) | |||
4498 | cout << "new best track hit (same ring), delta phi = " << locBestDeltaPhi << endl; | |||
4499 | } | |||
4500 | if(locBestTrkHit == NULL__null) | |||
4501 | continue; // no hit found for this track (or hits were ambiguous) | |||
4502 | ||||
4503 | // add best hit to track: create new DCDCSuperLayerSeed for it, add to circle fit | |||
4504 | locBestTrkHit->flags |= USED; | |||
4505 | DCDCRingSeed locRingSeed; | |||
4506 | locRingSeed.hits.push_back(locBestTrkHit); | |||
4507 | locRingSeed.ring = locBestTrkHit->hit->wire->ring; | |||
4508 | locRingSeed.linked = true; | |||
4509 | ||||
4510 | DCDCSuperLayerSeed* locNewSuperLayerSeed = Get_Resource_CDCSuperLayerSeed(); | |||
4511 | locNewSuperLayerSeed->dCDCRingSeeds.push_back(locRingSeed); | |||
4512 | locNewSuperLayerSeed->dSuperLayer = locSearchSuperLayer; | |||
4513 | locNewSuperLayerSeed->dSeedIndex = dSuperLayerSeeds[locSearchSuperLayer - 1].size(); | |||
4514 | locNewSuperLayerSeed->linked = true; | |||
4515 | locNewSuperLayerSeed->dWireOrientation = locWireDirection; | |||
4516 | dSuperLayerSeeds[locSearchSuperLayer - 1].push_back(locNewSuperLayerSeed); | |||
4517 | locCDCTrackCircles[loc_i]->Add_LastSuperLayerSeed(locNewSuperLayerSeed); | |||
4518 | } | |||
4519 | } | |||
4520 | ||||
4521 | //----------------------- | |||
4522 | // Create_TrackCandidiate | |||
4523 | //----------------------- | |||
4524 | void DTrackCandidate_factory_CDC::Create_TrackCandidiate(DCDCTrackCircle* locCDCTrackCircle) | |||
4525 | { | |||
4526 | DVector3 pos, mom; | |||
4527 | if(!Calc_PositionAndMomentum(locCDCTrackCircle, pos, mom)) | |||
4528 | { | |||
4529 | if(DEBUG_LEVEL > 5) | |||
4530 | cout << "Track momentum not greater than zero (or NaN), DTrackCandidate object not created." << endl; | |||
4531 | return; //don't create object!! | |||
4532 | } | |||
4533 | ||||
4534 | DTrackCandidate *locTrackCandidate = new DTrackCandidate; | |||
4535 | //circle fit parameters | |||
4536 | locTrackCandidate->rc=locCDCTrackCircle->fit->r0; | |||
4537 | locTrackCandidate->xc=locCDCTrackCircle->fit->x0; | |||
4538 | locTrackCandidate->yc=locCDCTrackCircle->fit->y0; | |||
4539 | Particle_t locPID = (locCDCTrackCircle->fit->h*dFactorForSenseOfRotation > 0.0) ? PiPlus : PiMinus; | |||
4540 | locTrackCandidate->setPID(locPID); | |||
4541 | locTrackCandidate->chisq = locCDCTrackCircle->fit->chisq; | |||
4542 | locTrackCandidate->Ndof = locCDCTrackCircle->fit->ndof; | |||
4543 | locTrackCandidate->setPosition(pos); | |||
4544 | locTrackCandidate->setMomentum(mom); | |||
4545 | ||||
4546 | // Add axial hits (if any) | |||
4547 | vector<DCDCTrkHit*> locHits; | |||
4548 | for(size_t loc_i = 0; loc_i < locCDCTrackCircle->dSuperLayerSeeds_Axial.size(); ++loc_i) | |||
4549 | { | |||
4550 | locCDCTrackCircle->dSuperLayerSeeds_Axial[loc_i]->Get_Hits(locHits); | |||
4551 | for(size_t loc_j = 0; loc_j < locHits.size(); ++loc_j) | |||
4552 | { | |||
4553 | locTrackCandidate->AddAssociatedObject(locHits[loc_j]->hit); | |||
4554 | locTrackCandidate->used_cdc_indexes.push_back(locHits[loc_j]->index); | |||
4555 | } | |||
4556 | } | |||
4557 | ||||
4558 | // Add inner stereo hits (if any) | |||
4559 | if(!locCDCTrackCircle->dSuperLayerSeeds_InnerStereo.empty()) | |||
4560 | { | |||
4561 | for(size_t loc_i = 0; loc_i < locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[0].size(); ++loc_i) //only one seed series: the "best" one | |||
4562 | { | |||
4563 | locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[0][loc_i]->Get_Hits(locHits); | |||
4564 | for(size_t loc_j = 0; loc_j < locHits.size(); ++loc_j) | |||
4565 | { | |||
4566 | locTrackCandidate->AddAssociatedObject(locHits[loc_j]->hit); | |||
4567 | locTrackCandidate->used_cdc_indexes.push_back(locHits[loc_j]->index); | |||
4568 | } | |||
4569 | } | |||
4570 | } | |||
4571 | ||||
4572 | // Add outer stereo hits (if any) | |||
4573 | if(!locCDCTrackCircle->dSuperLayerSeeds_OuterStereo.empty()) | |||
4574 | { | |||
4575 | for(size_t loc_i = 0; loc_i < locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[0].size(); ++loc_i) //only one seed series: the "best" one | |||
4576 | { | |||
4577 | locCDCTrackCircle->dSuperLayerSeeds_OuterStereo[0][loc_i]->Get_Hits(locHits); | |||
4578 | for(size_t loc_j = 0; loc_j < locHits.size(); ++loc_j) | |||
4579 | { | |||
4580 | locTrackCandidate->AddAssociatedObject(locHits[loc_j]->hit); | |||
4581 | locTrackCandidate->used_cdc_indexes.push_back(locHits[loc_j]->index); | |||
4582 | } | |||
4583 | } | |||
4584 | } | |||
4585 | ||||
4586 | if(DEBUG_LEVEL>3) | |||
4587 | cout<<"Final Candidate parameters: p="<<mom.Mag()<<" theta="<<mom.Theta()<<" phi="<<mom.Phi()<<" z="<<pos.Z()<<endl; | |||
4588 | ||||
4589 | _data.push_back(locTrackCandidate); | |||
4590 | } | |||
4591 | ||||
4592 | //------------------------- | |||
4593 | // Calc_PositionAndMomentum | |||
4594 | //------------------------- | |||
4595 | bool DTrackCandidate_factory_CDC::Calc_PositionAndMomentum(DCDCTrackCircle* locCDCTrackCircle, DVector3 &pos, DVector3 &mom) | |||
4596 | { | |||
4597 | // Get the position and momentum at a fixed radius from the beam line | |||
4598 | ||||
4599 | // Direction tangent | |||
4600 | double tanl = tan(M_PI_21.57079632679489661923 - locCDCTrackCircle->dTheta); | |||
4601 | ||||
4602 | // Squared radius of cylinder outside start counter but inside CDC inner | |||
4603 | // radius | |||
4604 | double r2 = 90.0; | |||
4605 | ||||
4606 | // Circle parameters | |||
4607 | double xc = locCDCTrackCircle->fit->x0; | |||
4608 | double yc = locCDCTrackCircle->fit->y0; | |||
4609 | double rc = locCDCTrackCircle->fit->r0; | |||
4610 | double rc2 = rc*rc; | |||
4611 | double xc2 = xc*xc; | |||
4612 | double yc2 = yc*yc; | |||
4613 | double xc2_plus_yc2 = xc2 + yc2; | |||
4614 | ||||
4615 | // variables needed for intersection of circles | |||
4616 | double a = (r2 - xc2_plus_yc2 - rc2)/(2.*rc); | |||
4617 | double temp1 = yc*sqrt(xc2_plus_yc2 - a*a); | |||
4618 | double temp2 = xc*a; | |||
4619 | double cosphi_plus = (temp2 + temp1)/xc2_plus_yc2; | |||
4620 | double cosphi_minus = (temp2 - temp1)/xc2_plus_yc2; | |||
4621 | ||||
4622 | // Check for intersections | |||
4623 | if(!isfinite(temp1) || !isfinite(temp2)) | |||
4624 | { | |||
4625 | // We did not find an intersection between the two circles, so return | |||
4626 | // sensible defaults for pos and mom | |||
4627 | double my_seed_phi = locCDCTrackCircle->fit->phi; | |||
4628 | double my_center_phi = atan2(yc,xc); | |||
4629 | double xv = xc - rc*cos(my_center_phi); | |||
4630 | double yv = yc - rc*sin(my_center_phi); | |||
4631 | pos.SetXYZ(xv, yv, locCDCTrackCircle->dVertexZ); | |||
4632 | ||||
4633 | double pt = 0.003*fabs(dMagneticField->GetBz(pos.x(), pos.y(), pos.z()))*rc; | |||
4634 | mom.SetXYZ(pt*cos(my_seed_phi), pt*sin(my_seed_phi), pt*tanl); | |||
4635 | return (mom.Mag() > 0.0); | |||
4636 | } | |||
4637 | ||||
4638 | // if we have intersections, find both solutions | |||
4639 | double phi_plus = -acos(cosphi_plus); | |||
4640 | double phi_minus = -acos(cosphi_minus); | |||
4641 | double x_plus = xc + rc*cosphi_plus; | |||
4642 | double x_minus = xc + rc*cosphi_minus; | |||
4643 | double y_plus = yc + rc*sin(phi_plus); | |||
4644 | double y_minus = yc + rc*sin(phi_minus); | |||
4645 | ||||
4646 | // if the resulting radial position on the circle from the fit does not agree | |||
4647 | // with the radius to which we are matching, we have the wrong sign for phi+ | |||
4648 | // or phi- | |||
4649 | double r2_plus = x_plus*x_plus + y_plus*y_plus; | |||
4650 | double r2_minus = x_minus*x_minus + y_minus*y_minus; | |||
4651 | if(fabs(r2 - r2_plus) > EPS1e-3) | |||
4652 | { | |||
4653 | phi_plus *= -1.; | |||
4654 | y_plus = yc + rc*sin(phi_plus); | |||
4655 | } | |||
4656 | if(fabs(r2 - r2_minus) > EPS1e-3) | |||
4657 | { | |||
4658 | phi_minus *= -1.; | |||
4659 | y_minus = yc + rc*sin(phi_minus); | |||
4660 | } | |||
4661 | ||||
4662 | // Choose phi- or phi+ depending on proximity to one of the cdc hits | |||
4663 | DCDCTrkHit* locFirstHit = NULL__null; | |||
4664 | if(locCDCTrackCircle->dSuperLayerSeeds_Axial.empty()) | |||
4665 | locFirstHit = locCDCTrackCircle->dSuperLayerSeeds_InnerStereo[0][0]->dCDCRingSeeds[0].hits[0]; | |||
4666 | else | |||
4667 | locFirstHit = locCDCTrackCircle->dSuperLayerSeeds_Axial[0]->dCDCRingSeeds[0].hits[0]; | |||
4668 | ||||
4669 | double xwire = locFirstHit->hit->wire->origin.x(); | |||
4670 | double ywire = locFirstHit->hit->wire->origin.y(); | |||
4671 | double dx = x_minus - xwire; | |||
4672 | double dy = y_minus - ywire; | |||
4673 | double d2_minus = dx*dx + dy*dy; | |||
4674 | dx = x_plus - xwire; | |||
4675 | dy = y_plus - ywire; | |||
4676 | double d2_plus = dx*dx + dy*dy; | |||
4677 | if(d2_plus > d2_minus) | |||
4678 | { | |||
4679 | phi_minus *= -1.; | |||
4680 | if(locCDCTrackCircle->fit->h < 0) | |||
4681 | phi_minus += M_PI3.14159265358979323846; | |||
4682 | double myphi = atan2(yc, xc); | |||
4683 | double xv = xc - rc*cos(myphi); | |||
4684 | double yv = yc - rc*sin(myphi); | |||
4685 | double dx = x_minus - xv; | |||
4686 | double dy = y_minus - yv; | |||
4687 | double chord = sqrt(dx*dx + dy*dy); | |||
4688 | double two_rc = 2.*rc; | |||
4689 | double ratio = chord/two_rc; | |||
4690 | double ds = (ratio < 1.) ? (two_rc*asin(ratio)) : (two_rc*M_PI_21.57079632679489661923); | |||
4691 | pos.SetXYZ(x_minus, y_minus, locCDCTrackCircle->dVertexZ + ds*tanl); | |||
4692 | ||||
4693 | double pt = 0.003*fabs(dMagneticField->GetBz(pos.x(), pos.y(), pos.z()))*rc; | |||
4694 | mom.SetXYZ(pt*sin(phi_minus), pt*cos(phi_minus), pt*tanl); | |||
4695 | } | |||
4696 | else | |||
4697 | { | |||
4698 | phi_plus *= -1.; | |||
4699 | if(locCDCTrackCircle->fit->h < 0) | |||
4700 | phi_plus += M_PI3.14159265358979323846; | |||
4701 | double myphi = atan2(yc, xc); | |||
4702 | double xv = xc - rc*cos(myphi); | |||
4703 | double yv = yc - rc*sin(myphi); | |||
4704 | double dx = x_plus - xv; | |||
4705 | double dy = y_plus - yv; | |||
4706 | double chord = sqrt(dx*dx + dy*dy); | |||
4707 | double two_rc = 2.*rc; | |||
4708 | double ratio = chord/two_rc; | |||
4709 | double ds = (ratio < 1.) ? (two_rc*asin(ratio)) : (two_rc*M_PI_21.57079632679489661923); | |||
4710 | pos.SetXYZ(x_plus, y_plus, locCDCTrackCircle->dVertexZ + ds*tanl); | |||
4711 | ||||
4712 | double pt =0.003*fabs(dMagneticField->GetBz(pos.x(), pos.y(), pos.z()))*rc; | |||
4713 | mom.SetXYZ(pt*sin(phi_plus), pt*cos(phi_plus), pt*tanl); | |||
4714 | } | |||
4715 | return (mom.Mag() > 0.0); | |||
4716 | } | |||
4717 | ||||
4718 | //------------------ | |||
4719 | // erun | |||
4720 | //------------------ | |||
4721 | jerror_t DTrackCandidate_factory_CDC::erun(void) | |||
4722 | { | |||
4723 | return NOERROR; | |||
4724 | } | |||
4725 | ||||
4726 | //------------------ | |||
4727 | // fini | |||
4728 | //------------------ | |||
4729 | jerror_t DTrackCandidate_factory_CDC::fini(void) | |||
4730 | { | |||
4731 | // Delete memory in resource pools | |||
4732 | for(size_t loc_i = 0; loc_i < dCDCTrkHitPool_All.size(); ++loc_i) | |||
4733 | delete dCDCTrkHitPool_All[loc_i]; | |||
4734 | ||||
4735 | for(size_t loc_i = 0; loc_i < dCDCSuperLayerSeedPool_All.size(); ++loc_i) | |||
4736 | delete dCDCSuperLayerSeedPool_All[loc_i]; | |||
4737 | ||||
4738 | for(size_t loc_i = 0; loc_i < dHelicalFitPool_All.size(); ++loc_i) | |||
4739 | delete dHelicalFitPool_All[loc_i]; | |||
4740 | ||||
4741 | for(size_t loc_i = 0; loc_i < dCDCTrackCirclePool_All.size(); ++loc_i) | |||
4742 | delete dCDCTrackCirclePool_All[loc_i]; | |||
4743 | ||||
4744 | return NOERROR; | |||
4745 | } | |||
4746 | ||||
4747 | void DTrackCandidate_factory_CDC::DCDCTrkHit::Reset(void) | |||
4748 | { | |||
4749 | hit = NULL__null; | |||
4750 | index = 0; | |||
4751 | flags = NONE; | |||
4752 | var_z = 0.0; | |||
4753 | dStereoHitPos.SetXYZ(0.0, 0.0, 0.0); | |||
4754 | dPhiStereo = 0.0; | |||
4755 | dValidStereoHitPosFlag = false; | |||
4756 | } | |||
4757 | ||||
4758 | void DTrackCandidate_factory_CDC::DCDCSuperLayerSeed::Reset(void) | |||
4759 | { | |||
4760 | dSuperLayer = 0; | |||
4761 | dSeedIndex = 0; | |||
4762 | linked = false; | |||
4763 | dSpiralLinkParams.clear(); | |||
4764 | dCDCRingSeeds.clear(); | |||
4765 | } | |||
4766 | ||||
4767 | bool DTrackCandidate_factory_CDC::DCDCSuperLayerSeed::Are_AllHitsOnRingShared(const DCDCSuperLayerSeed* locCDCSuperLayerSeed, int locRing) const | |||
4768 | { | |||
4769 | vector<DCDCTrkHit*> locRingHits; | |||
4770 | for(size_t loc_i = 0; loc_i < dCDCRingSeeds.size(); ++loc_i) | |||
4771 | { | |||
4772 | if(dCDCRingSeeds[loc_i].ring != locRing) | |||
4773 | continue; | |||
4774 | locRingHits = dCDCRingSeeds[loc_i].hits; | |||
4775 | break; | |||
4776 | } | |||
4777 | ||||
4778 | vector<DCDCTrkHit*> locRingHits_CompareTo; | |||
4779 | for(size_t loc_i = 0; loc_i < locCDCSuperLayerSeed->dCDCRingSeeds.size(); ++loc_i) | |||
4780 | { | |||
4781 | if(locCDCSuperLayerSeed->dCDCRingSeeds[loc_i].ring != locRing) | |||
4782 | continue; | |||
4783 | locRingHits_CompareTo = locCDCSuperLayerSeed->dCDCRingSeeds[loc_i].hits; | |||
4784 | break; | |||
4785 | } | |||
4786 | ||||
4787 | return (locRingHits == locRingHits_CompareTo); | |||
4788 | } | |||
4789 | ||||
4790 | void DTrackCandidate_factory_CDC::DCDCTrackCircle::Reset(void) | |||
4791 | { | |||
4792 | dSuperLayerSeeds_Axial.clear(); | |||
4793 | dSuperLayerSeeds_InnerStereo.clear(); | |||
4794 | dSuperLayerSeeds_OuterStereo.clear(); | |||
4795 | fit = NULL__null; | |||
4796 | dWeightedChiSqPerDF = 0.0; | |||
4797 | dWeightedChiSqPerDF_Stereo = 0.0; | |||
4798 | dAverageDriftTime = 0.0; | |||
4799 | HitBitPattern.clear(); | |||
4800 | dTheta = 0.0; | |||
4801 | dVertexZ = 0.0; | |||
4802 | dSpiralTurnRing = -1; | |||
4803 | dTruncationSourceCircles.clear(); | |||
4804 | dHasNonTruncatedSeedsFlag_InnerStereo = false; | |||
4805 | dHasNonTruncatedSeedsFlag_OuterStereo = false; | |||
4806 | } | |||
4807 | ||||
4808 | DTrackCandidate_factory_CDC::DCDCSuperLayerSeed* DTrackCandidate_factory_CDC::DCDCTrackCircle::Get_LastSuperLayerSeed(void) const | |||
4809 | { | |||
4810 | //only checks the first combination of stereo seeds | |||
4811 | DCDCSuperLayerSeed* locLastAxialSuperLayerSeed = NULL__null; | |||
4812 | if(!dSuperLayerSeeds_Axial.empty()) | |||
4813 | { | |||
4814 | locLastAxialSuperLayerSeed = dSuperLayerSeeds_Axial.back(); | |||
4815 | if(locLastAxialSuperLayerSeed->dSuperLayer == 7) | |||
4816 | return locLastAxialSuperLayerSeed; | |||
4817 | } | |||
4818 | if(!dSuperLayerSeeds_OuterStereo.empty()) | |||
4819 | { | |||
4820 | DCDCSuperLayerSeed* locLastOuterStereoSuperLayerSeed = dSuperLayerSeeds_OuterStereo[0].back(); | |||
4821 | if(locLastOuterStereoSuperLayerSeed != NULL__null){ | |||
4822 | if(locLastAxialSuperLayerSeed == NULL__null) return locLastOuterStereoSuperLayerSeed; | |||
4823 | if(locLastOuterStereoSuperLayerSeed->dSuperLayer > locLastAxialSuperLayerSeed->dSuperLayer){ | |||
4824 | return locLastOuterStereoSuperLayerSeed; | |||
4825 | }else{ | |||
4826 | return locLastAxialSuperLayerSeed; | |||
4827 | } | |||
4828 | } | |||
4829 | } | |||
4830 | if(!dSuperLayerSeeds_InnerStereo.empty()) | |||
4831 | { | |||
4832 | DCDCSuperLayerSeed* locLastInnerStereoSuperLayerSeed = dSuperLayerSeeds_InnerStereo[0].back(); | |||
4833 | if(locLastInnerStereoSuperLayerSeed != NULL__null){ | |||
4834 | if(locLastAxialSuperLayerSeed == NULL__null) return locLastInnerStereoSuperLayerSeed; | |||
4835 | if(locLastInnerStereoSuperLayerSeed->dSuperLayer > locLastAxialSuperLayerSeed->dSuperLayer){ | |||
4836 | return locLastInnerStereoSuperLayerSeed; | |||
4837 | }else{ | |||
4838 | return locLastAxialSuperLayerSeed; | |||
4839 | } | |||
4840 | } | |||
4841 | } | |||
4842 | return locLastAxialSuperLayerSeed; | |||
4843 | } | |||
4844 | ||||
4845 | DTrackCandidate_factory_CDC::DCDCSuperLayerSeed* DTrackCandidate_factory_CDC::DCDCTrackCircle::Get_SuperLayerSeed(unsigned int locSuperLayer) const | |||
4846 | { | |||
4847 | //only checks the first combination of stereo seeds | |||
4848 | if((locSuperLayer == 1) || (locSuperLayer == 4) || (locSuperLayer == 7)) | |||
4849 | { | |||
4850 | for(size_t loc_i = 0; loc_i < dSuperLayerSeeds_Axial.size(); ++loc_i) | |||
4851 | { | |||
4852 | if(dSuperLayerSeeds_Axial[loc_i]->dSuperLayer == locSuperLayer) | |||
4853 | return dSuperLayerSeeds_Axial[loc_i]; | |||
4854 | } | |||
4855 | return NULL__null; | |||
4856 | } | |||
4857 | else if((locSuperLayer == 2) || (locSuperLayer == 3)) | |||
4858 | { | |||
4859 | if(dSuperLayerSeeds_InnerStereo.empty()) | |||
4860 | return NULL__null; | |||
4861 | for(size_t loc_i = 0; loc_i < dSuperLayerSeeds_InnerStereo[0].size(); ++loc_i) | |||
4862 | { | |||
4863 | if(dSuperLayerSeeds_InnerStereo[0][loc_i]->dSuperLayer == locSuperLayer) | |||
4864 | return dSuperLayerSeeds_InnerStereo[0][loc_i]; | |||
4865 | } | |||
4866 | } | |||
4867 | else //outer SL seeds could be listed as inner (e.g. no SL4) | |||
4868 | { | |||
4869 | if(!dSuperLayerSeeds_OuterStereo.empty()) | |||
4870 | { | |||
4871 | for(size_t loc_i = 0; loc_i < dSuperLayerSeeds_OuterStereo[0].size(); ++loc_i) | |||
4872 | { | |||
4873 | if(dSuperLayerSeeds_OuterStereo[0][loc_i]->dSuperLayer == locSuperLayer) | |||
4874 | return dSuperLayerSeeds_OuterStereo[0][loc_i]; | |||
4875 | } | |||
4876 | } | |||
4877 | if(!dSuperLayerSeeds_InnerStereo.empty()) | |||
4878 | { | |||
4879 | for(size_t loc_i = 0; loc_i < dSuperLayerSeeds_InnerStereo[0].size(); ++loc_i) | |||
4880 | { | |||
4881 | if(dSuperLayerSeeds_InnerStereo[0][loc_i]->dSuperLayer == locSuperLayer) | |||
4882 | return dSuperLayerSeeds_InnerStereo[0][loc_i]; | |||
4883 | } | |||
4884 | } | |||
4885 | } | |||
4886 | return NULL__null; | |||
4887 | } | |||
4888 | ||||
4889 | void DTrackCandidate_factory_CDC::DCDCTrackCircle::Strip_StereoSuperLayerSeed(unsigned int locSuperLayer) | |||
4890 | { | |||
4891 | //assumes at most one stereo series of each type!!! | |||
4892 | vector<DCDCSuperLayerSeed*>::iterator locIterator; | |||
4893 | if(!dSuperLayerSeeds_OuterStereo.empty()) | |||
4894 | { | |||
4895 | for(locIterator = dSuperLayerSeeds_OuterStereo[0].begin(); locIterator != dSuperLayerSeeds_OuterStereo[0].end(); ++locIterator) | |||
4896 | { | |||
4897 | if((*locIterator)->dSuperLayer != locSuperLayer) | |||
4898 | continue; | |||
4899 | dSuperLayerSeeds_OuterStereo[0].erase(locIterator); | |||
4900 | if(dSuperLayerSeeds_OuterStereo[0].empty()) | |||
4901 | dSuperLayerSeeds_OuterStereo.clear(); | |||
4902 | return; | |||
4903 | } | |||
4904 | } | |||
4905 | if(!dSuperLayerSeeds_InnerStereo.empty()) | |||
4906 | { | |||
4907 | for(locIterator = dSuperLayerSeeds_InnerStereo[0].begin(); locIterator != dSuperLayerSeeds_InnerStereo[0].end(); ++locIterator) | |||
4908 | { | |||
4909 | if((*locIterator)->dSuperLayer != locSuperLayer) | |||
4910 | continue; | |||
4911 | dSuperLayerSeeds_InnerStereo[0].erase(locIterator); | |||
4912 | if(dSuperLayerSeeds_InnerStereo[0].empty()) | |||
4913 | dSuperLayerSeeds_InnerStereo.clear(); | |||
4914 | return; | |||
4915 | } | |||
4916 | } | |||
4917 | } | |||
4918 | ||||
4919 | void DTrackCandidate_factory_CDC::DCDCTrackCircle::Add_LastSuperLayerSeed(DCDCSuperLayerSeed* locSuperLayerSeed) | |||
4920 | { | |||
4921 | //assumes at most one stereo series of each type!!! | |||
4922 | unsigned int locSuperLayer = locSuperLayerSeed->dSuperLayer; | |||
4923 | if((locSuperLayer == 1) || (locSuperLayer == 4) || (locSuperLayer == 7)) | |||
4924 | dSuperLayerSeeds_Axial.push_back(locSuperLayerSeed); | |||
4925 | else if((locSuperLayer == 2) || (locSuperLayer == 3)) | |||
4926 | { | |||
4927 | if(dSuperLayerSeeds_InnerStereo.empty()) | |||
4928 | dSuperLayerSeeds_InnerStereo.resize(1); | |||
4929 | dSuperLayerSeeds_InnerStereo[0].push_back(locSuperLayerSeed); | |||
4930 | } | |||
4931 | else //is super layer 5 or 6 | |||
4932 | { | |||
4933 | unsigned int locLastAxialLayer = dSuperLayerSeeds_Axial.empty() ? 0 : dSuperLayerSeeds_Axial.back()->dSuperLayer; | |||
4934 | if(dSuperLayerSeeds_InnerStereo.empty() || (locLastAxialLayer == 4)) | |||
4935 | { | |||
4936 | if(dSuperLayerSeeds_OuterStereo.empty()) | |||
4937 | dSuperLayerSeeds_OuterStereo.resize(1); | |||
4938 | dSuperLayerSeeds_OuterStereo[0].push_back(locSuperLayerSeed); | |||
4939 | } | |||
4940 | else //put in inner stereo to keep combinations correct | |||
4941 | dSuperLayerSeeds_InnerStereo[0].push_back(locSuperLayerSeed); | |||
4942 | } | |||
4943 | } | |||
4944 | ||||
4945 | void DTrackCandidate_factory_CDC::DCDCTrackCircle::Truncate_Circle(unsigned int locNewLastSuperLayer) | |||
4946 | { | |||
4947 | //truncate this circle by rejecting all super layers down to locNewLastSuperLayer | |||
4948 | //DOES NOT recycle any memory (these seeds may be used by other circles!!) | |||
4949 | for(size_t loc_i = 0; loc_i < dSuperLayerSeeds_Axial.size(); ++loc_i) | |||
4950 | { | |||
4951 | if(dSuperLayerSeeds_Axial[loc_i]->dSuperLayer <= locNewLastSuperLayer) | |||
4952 | continue; | |||
4953 | ((loc_i == 0) ? dSuperLayerSeeds_Axial.clear() : dSuperLayerSeeds_Axial.resize(loc_i)); | |||
4954 | break; | |||
4955 | } | |||
4956 | ||||
4957 | //outer stereo | |||
4958 | vector<vector<DCDCSuperLayerSeed*> >::iterator locIterator, locIterator2; | |||
4959 | if(locNewLastSuperLayer < 5) | |||
4960 | dSuperLayerSeeds_OuterStereo.clear(); | |||
4961 | else if(locNewLastSuperLayer < 7) | |||
4962 | { | |||
4963 | bool locClippedEveryStereoSeedFlag = true; | |||
4964 | for(locIterator = dSuperLayerSeeds_OuterStereo.begin(); locIterator != dSuperLayerSeeds_OuterStereo.end();) | |||
4965 | { | |||
4966 | vector<DCDCSuperLayerSeed*>& locSeedSeries = *locIterator; | |||
4967 | bool locClippedstereoSeriesFlag = false; | |||
4968 | for(size_t loc_j = 0; loc_j < locSeedSeries.size(); ++loc_j) | |||
4969 | { | |||
4970 | if(locSeedSeries[loc_j]->dSuperLayer <= locNewLastSuperLayer) | |||
4971 | continue; | |||
4972 | locClippedstereoSeriesFlag = true; | |||
4973 | if(loc_j == 0) | |||
4974 | { | |||
4975 | locSeedSeries.clear(); | |||
4976 | break; | |||
4977 | } | |||
4978 | locSeedSeries.resize(loc_j); | |||
4979 | //now, check if another seed series is exactly like this one: if so, clear it | |||
4980 | for(locIterator2 = dSuperLayerSeeds_OuterStereo.begin(); locIterator2 != dSuperLayerSeeds_OuterStereo.end(); ++locIterator2) | |||
4981 | { | |||
4982 | if(locIterator2 == locIterator) | |||
4983 | continue; | |||
4984 | vector<DCDCSuperLayerSeed*>& locSeedSeries2 = *locIterator2; | |||
4985 | if(locSeedSeries == locSeedSeries2) | |||
4986 | { | |||
4987 | locSeedSeries.clear(); | |||
4988 | break; | |||
4989 | } | |||
4990 | } | |||
4991 | break; | |||
4992 | } | |||
4993 | if(!locClippedstereoSeriesFlag) | |||
4994 | locClippedEveryStereoSeedFlag = false; | |||
4995 | (locSeedSeries.empty() ? (locIterator = dSuperLayerSeeds_OuterStereo.erase(locIterator)) : ++locIterator); | |||
4996 | } | |||
4997 | if(locClippedEveryStereoSeedFlag) | |||
4998 | dHasNonTruncatedSeedsFlag_OuterStereo = false; | |||
4999 | } | |||
5000 | ||||
5001 | //inner stereo | |||
5002 | if(locNewLastSuperLayer < 2) | |||
5003 | { | |||
5004 | dSuperLayerSeeds_InnerStereo.clear(); | |||
5005 | return; | |||
5006 | } | |||
5007 | else if(locNewLastSuperLayer < 7) //7 instead of 4: could be outer super layers in inner (if SL4 is missing) | |||
5008 | { | |||
5009 | bool locClippedEveryStereoSeedFlag = true; | |||
5010 | for(locIterator = dSuperLayerSeeds_InnerStereo.begin(); locIterator != dSuperLayerSeeds_InnerStereo.end();) | |||
5011 | { | |||
5012 | vector<DCDCSuperLayerSeed*>& locSeedSeries = *locIterator; | |||
5013 | bool locClippedstereoSeriesFlag = false; | |||
5014 | for(size_t loc_j = 0; loc_j < locSeedSeries.size(); ++loc_j) | |||
5015 | { | |||
5016 | if(locSeedSeries[loc_j]->dSuperLayer <= locNewLastSuperLayer) | |||
5017 | continue; | |||
5018 | locClippedstereoSeriesFlag = true; | |||
5019 | if(loc_j == 0) | |||
5020 | { | |||
5021 | locSeedSeries.clear(); | |||
5022 | break; | |||
5023 | } | |||
5024 | locSeedSeries.resize(loc_j); | |||
5025 | //now, check if another seed series is exactly like this one: if so, clear it | |||
5026 | for(locIterator2 = dSuperLayerSeeds_InnerStereo.begin(); locIterator2 != dSuperLayerSeeds_InnerStereo.end(); ++locIterator2) | |||
5027 | { | |||
5028 | if(locIterator2 == locIterator) | |||
5029 | continue; | |||
5030 | vector<DCDCSuperLayerSeed*>& locSeedSeries2 = *locIterator2; | |||
5031 | if(locSeedSeries == locSeedSeries2) | |||
5032 | { | |||
5033 | locSeedSeries.clear(); | |||
5034 | break; | |||
5035 | } | |||
5036 | } | |||
5037 | break; | |||
5038 | } | |||
5039 | if(!locClippedstereoSeriesFlag) | |||
5040 | locClippedEveryStereoSeedFlag = false; | |||
5041 | (locSeedSeries.empty() ? (locIterator = dSuperLayerSeeds_InnerStereo.erase(locIterator)) : ++locIterator); | |||
5042 | } | |||
5043 | if(locClippedEveryStereoSeedFlag) | |||
5044 | dHasNonTruncatedSeedsFlag_InnerStereo = false; | |||
5045 | } | |||
5046 | } | |||
5047 | ||||
5048 | void DTrackCandidate_factory_CDC::DCDCTrackCircle::Absorb_TrackCircle(const DCDCTrackCircle* locTrackCircle) | |||
5049 | { | |||
5050 | //used when merging track circles: this track circle will absorb the stereo combinations from the other one | |||
5051 | for(size_t loc_i = 0; loc_i < locTrackCircle->dSuperLayerSeeds_InnerStereo.size(); ++loc_i) | |||
5052 | { | |||
5053 | const vector<DCDCSuperLayerSeed*>& locSeedSeries = locTrackCircle->dSuperLayerSeeds_InnerStereo[loc_i]; | |||
5054 | bool locComboAlreadyPresentFlag = false; | |||
5055 | for(size_t loc_j = 0; loc_j < dSuperLayerSeeds_InnerStereo.size(); ++loc_j) | |||
5056 | { | |||
5057 | if(locSeedSeries == dSuperLayerSeeds_InnerStereo[loc_j]) | |||
5058 | { | |||
5059 | locComboAlreadyPresentFlag = true; | |||
5060 | break; | |||
5061 | } | |||
5062 | else if((locSeedSeries.size() == 1) && (locSeedSeries[0] == dSuperLayerSeeds_InnerStereo[loc_j][0])) | |||
5063 | { | |||
5064 | locComboAlreadyPresentFlag = true; //is a subset of an existing combo | |||
5065 | break; | |||
5066 | } | |||
5067 | } | |||
5068 | if(!locComboAlreadyPresentFlag) | |||
5069 | dSuperLayerSeeds_InnerStereo.push_back(locSeedSeries); | |||
5070 | } | |||
5071 | ||||
5072 | for(size_t loc_i = 0; loc_i < locTrackCircle->dSuperLayerSeeds_OuterStereo.size(); ++loc_i) | |||
5073 | { | |||
5074 | const vector<DCDCSuperLayerSeed*>& locSeedSeries = locTrackCircle->dSuperLayerSeeds_OuterStereo[loc_i]; | |||
5075 | bool locComboAlreadyPresentFlag = false; | |||
5076 | for(size_t loc_j = 0; loc_j < dSuperLayerSeeds_OuterStereo.size(); ++loc_j) | |||
5077 | { | |||
5078 | if(locSeedSeries == dSuperLayerSeeds_OuterStereo[loc_j]) | |||
5079 | { | |||
5080 | locComboAlreadyPresentFlag = true; | |||
5081 | break; | |||
5082 | } | |||
5083 | else if((locSeedSeries.size() == 1) && (locSeedSeries[0] == dSuperLayerSeeds_OuterStereo[loc_j][0])) | |||
5084 | { | |||
5085 | locComboAlreadyPresentFlag = true; //is a subset of an existing combo | |||
5086 | break; | |||
5087 | } | |||
5088 | } | |||
5089 | if(!locComboAlreadyPresentFlag) | |||
5090 | dSuperLayerSeeds_OuterStereo.push_back(locSeedSeries); | |||
5091 | } | |||
5092 | ||||
5093 | if(locTrackCircle->dHasNonTruncatedSeedsFlag_InnerStereo) | |||
5094 | dHasNonTruncatedSeedsFlag_InnerStereo = true; | |||
5095 | if(locTrackCircle->dHasNonTruncatedSeedsFlag_OuterStereo) | |||
5096 | dHasNonTruncatedSeedsFlag_OuterStereo = true; | |||
5097 | ||||
5098 | for(size_t loc_i = 0; loc_i < locTrackCircle->dTruncationSourceCircles.size(); ++loc_i) | |||
5099 | { | |||
5100 | bool locIsAlreadyTruncationSourceFlag = false; | |||
5101 | for(size_t loc_j = 0; loc_j < dTruncationSourceCircles.size(); ++loc_j) | |||
5102 | { | |||
5103 | if(locTrackCircle->dTruncationSourceCircles[loc_i] != dTruncationSourceCircles[loc_j]) | |||
5104 | continue; | |||
5105 | locIsAlreadyTruncationSourceFlag = true; | |||
5106 | break; | |||
5107 | } | |||
5108 | if(!locIsAlreadyTruncationSourceFlag) | |||
5109 | dTruncationSourceCircles.push_back(locTrackCircle->dTruncationSourceCircles[loc_i]); | |||
5110 | } | |||
5111 | } | |||
5112 | ||||
5113 | bool DTrackCandidate_factory_CDC::DCDCTrackCircle::Check_IfInputIsSubset(const DCDCTrackCircle* locTrackCircle) | |||
5114 | { | |||
5115 | //returns false if they are effectively identical | |||
5116 | if(locTrackCircle->dSuperLayerSeeds_Axial.empty()) | |||
5117 | return false; | |||
5118 | if(locTrackCircle->Get_LastSuperLayerSeed()->dSuperLayer == 7) | |||
5119 | return false; //can't be subset if hasn't been truncated yet | |||
5120 | if(locTrackCircle->dSuperLayerSeeds_Axial.size() >= dSuperLayerSeeds_Axial.size()) | |||
5121 | return false; //can't be subset if same # or greater of axial super layers (if identical should merge them instead) | |||
5122 | ||||
5123 | for(size_t loc_i = 0; loc_i < locTrackCircle->dSuperLayerSeeds_Axial.size(); ++loc_i) | |||
5124 | { | |||
5125 | DCDCSuperLayerSeed* locSuperLayerSeed = locTrackCircle->dSuperLayerSeeds_Axial[loc_i]; | |||
5126 | if(Get_SuperLayerSeed(locSuperLayerSeed->dSuperLayer) != locSuperLayerSeed) | |||
5127 | return false; | |||
5128 | } | |||
5129 | //all axial seeds are a subset, now check the stereo dHasNonTruncatedSeedsFlag flags | |||
5130 | DCDCSuperLayerSeed* locLastSuperLayerSeed = locTrackCircle->Get_LastSuperLayerSeed(); | |||
5131 | if((locLastSuperLayerSeed->dSuperLayer == 1) || (locLastSuperLayerSeed->dSuperLayer == 4)) | |||
5132 | return true; | |||
5133 | ||||
5134 | DCDCSuperLayerSeed* locLastAxialSuperLayerSeed = locTrackCircle->dSuperLayerSeeds_Axial.back(); | |||
5135 | if(locLastAxialSuperLayerSeed->dSuperLayer == 4) | |||
5136 | return locTrackCircle->dHasNonTruncatedSeedsFlag_OuterStereo; | |||
5137 | else | |||
5138 | return locTrackCircle->dHasNonTruncatedSeedsFlag_InnerStereo; | |||
5139 | } | |||
5140 | ||||
5141 | void DTrackCandidate_factory_CDC::DCDCTrackCircle::Get_AllStereoSuperLayerSeeds(vector<DCDCSuperLayerSeed*>& locStereoSuperLayerSeeds) | |||
5142 | { | |||
5143 | //assumes there is only one seed series | |||
5144 | locStereoSuperLayerSeeds.clear(); | |||
5145 | if(!dSuperLayerSeeds_InnerStereo.empty()) | |||
5146 | locStereoSuperLayerSeeds = dSuperLayerSeeds_InnerStereo[0]; | |||
5147 | if(!dSuperLayerSeeds_OuterStereo.empty()) | |||
5148 | locStereoSuperLayerSeeds.insert(locStereoSuperLayerSeeds.begin(), dSuperLayerSeeds_OuterStereo[0].begin(), dSuperLayerSeeds_OuterStereo[0].end()); | |||
5149 | } | |||
5150 | ||||
5151 | unsigned int DTrackCandidate_factory_CDC::DCDCTrackCircle::Get_NumStereoSuperLayerSeeds(void) | |||
5152 | { | |||
5153 | //assumes there is only one seed series | |||
5154 | unsigned int locNumStereoSuperLayerSeeds = 0; | |||
5155 | if(!dSuperLayerSeeds_InnerStereo.empty()) | |||
5156 | locNumStereoSuperLayerSeeds += dSuperLayerSeeds_InnerStereo[0].size(); | |||
5157 | if(!dSuperLayerSeeds_OuterStereo.empty()) | |||
5158 | locNumStereoSuperLayerSeeds += dSuperLayerSeeds_OuterStereo[0].size(); | |||
5159 | return locNumStereoSuperLayerSeeds; | |||
5160 | } | |||
5161 | ||||
5162 | //------------------------------------------------------------------------- | |||
5163 | // Routines for fitting a line to the stereo data | |||
5164 | //------------------------------------------------------------------------- | |||
5165 | // Compute the chi^2 for a line fit given errors in both s and z. Also | |||
5166 | // computes current best guess for the scaled intercept z0. | |||
5167 | // Taken from Numerical Recipes in C (2nd ed.), p. 670. | |||
5168 | double DTrackCandidate_factory_CDC::DCDCLineFit::ChiXY(double lambda) | |||
5169 | { | |||
5170 | double tanl=tan(lambda); | |||
5171 | double sumw=0.,avg_s=0.,avg_z=0.,my_chi2=0.; | |||
5172 | for (unsigned i=0;i<n;i++){ | |||
5173 | w[i]=1./(tanl*tanl*var_s[i]+var_z[i]); | |||
5174 | sumw+=w[i]; | |||
5175 | avg_s+=w[i]*s[i]; | |||
5176 | avg_z+=w[i]*z[i]; | |||
5177 | } | |||
5178 | avg_s/=sumw; | |||
5179 | avg_z/=sumw; | |||
5180 | z0=avg_z-tanl*avg_s; | |||
5181 | for (unsigned int i=0;i<n;i++){ | |||
5182 | double temp=z[i]-z0-tanl*s[i]; | |||
5183 | my_chi2+=w[i]*temp*temp; | |||
5184 | } | |||
5185 | return my_chi2; | |||
5186 | } | |||
5187 | ||||
5188 | // Routine to bracket the minimum chi^2, from Numerical Recipes in C (2nd ed.), | |||
5189 | // pp. 400-401. | |||
5190 | #define SHFT(w,x,y,z)(w)=(x);(x)=(y);(y)=(z) (w)=(x);(x)=(y);(y)=(z) | |||
5191 | #define SIGN(x,y)((y)>=0.0 ? fabs(x):-fabs(x)) ((y)>=0.0 ? fabs(x):-fabs(x)) | |||
5192 | void DTrackCandidate_factory_CDC::DCDCLineFit::BracketMinimumChisq(double &a,double &b,double &c,double &chi2a,double &chi2b,double &chi2c) | |||
5193 | { | |||
5194 | const double GOLD=1.618034; | |||
5195 | const double GLIMIT=100.0; | |||
5196 | ||||
5197 | chi2a=ChiXY(a); | |||
5198 | chi2b=ChiXY(b); | |||
5199 | double chi2u=0.; | |||
5200 | if (chi2b>chi2a){ | |||
5201 | double dummy=0.; | |||
5202 | SHFT(dummy,a,b,dummy)(dummy)=(a);(a)=(b);(b)=(dummy); | |||
5203 | SHFT(dummy,chi2b,chi2a,dummy)(dummy)=(chi2b);(chi2b)=(chi2a);(chi2a)=(dummy); | |||
5204 | } | |||
5205 | c=b+GOLD*(b-a); | |||
5206 | chi2c=ChiXY(c); | |||
5207 | while (chi2b>chi2c){ | |||
5208 | double r=(b-a)*(chi2b-chi2c); | |||
5209 | double q=(b-c)*(chi2b-chi2a); | |||
5210 | double q_minus_r=q-r; | |||
5211 | double fabs_q_minus_r=fabs(q_minus_r); | |||
5212 | double max=(fabs_q_minus_r>1.e-20)?fabs_q_minus_r:1.e-20; | |||
5213 | double u=b-((b-c)*q-(b-a)*r)/(2.*SIGN(max,q_minus_r)((q_minus_r)>=0.0 ? fabs(max):-fabs(max))); | |||
5214 | double ulim=b+GLIMIT*(c-b); | |||
5215 | if ((b-u)*(u-c)>0.0){ | |||
5216 | chi2u=ChiXY(u); | |||
5217 | if (chi2u<chi2c){ | |||
5218 | a=b; | |||
5219 | b=u; | |||
5220 | chi2a=chi2b; | |||
5221 | chi2b=chi2u; | |||
5222 | return; | |||
5223 | } | |||
5224 | else if (chi2u>chi2b){ | |||
5225 | c=u; | |||
5226 | chi2c=chi2u; | |||
5227 | return; | |||
5228 | } | |||
5229 | u=c+GOLD*(c-b); | |||
5230 | chi2u=ChiXY(u); | |||
5231 | } | |||
5232 | else if ((c-u)*(u-ulim)>0.0){ | |||
5233 | chi2u=ChiXY(u); | |||
5234 | if (chi2u<chi2c){ | |||
5235 | SHFT(b,c,u,c+GOLD*(c-b))(b)=(c);(c)=(u);(u)=(c+GOLD*(c-b)); | |||
5236 | SHFT(chi2b,chi2c,chi2u,ChiXY(u))(chi2b)=(chi2c);(chi2c)=(chi2u);(chi2u)=(ChiXY(u)); | |||
5237 | } | |||
5238 | } | |||
5239 | else if ((u-ulim)*(ulim-c)>=0.0){ | |||
5240 | u=ulim; | |||
5241 | chi2u=ChiXY(u); | |||
5242 | } | |||
5243 | else{ | |||
5244 | u=c+GOLD*(c-b); | |||
5245 | chi2u=ChiXY(u); | |||
5246 | } | |||
5247 | SHFT(a,b,c,u)(a)=(b);(b)=(c);(c)=(u); | |||
5248 | SHFT(chi2a,chi2b,chi2c,chi2u)(chi2a)=(chi2b);(chi2b)=(chi2c);(chi2c)=(chi2u); | |||
5249 | } | |||
5250 | } | |||
5251 | ||||
5252 | // Use Brent's algorithm to find the "true" (within tolerance) minimum chi^2 | |||
5253 | // after bracketting. Taken from Numerical Recipes in C (2nd. Ed.), pp. 404-405. | |||
5254 | double DTrackCandidate_factory_CDC::DCDCLineFit::FindMinimumChisq(double ax,double bx, double cx, double &xmin) | |||
5255 | { | |||
5256 | const double CGOLD=0.3819660; | |||
5257 | double a=(ax<cx)?ax:cx; | |||
5258 | double b=(ax>cx)?ax:cx; | |||
5259 | double x=bx,w=bx,v=bx; | |||
5260 | double fx=ChiXY(x),fv=fx,fw=fx,fu=0.; | |||
5261 | double tol=1e-3,err=0.0,d=0.,u=0.; | |||
5262 | for (int iter=1;iter<=100;iter++){ | |||
5263 | double xm=0.5*(a+b); | |||
5264 | double tol1=tol*fabs(x)+1e-10; | |||
5265 | double tol2=2.0*tol1; | |||
5266 | if (fabs(x-xm)<=(tol2-0.5*(b-a))){ | |||
5267 | xmin=x; | |||
5268 | return fx; | |||
5269 | } | |||
5270 | if (fabs(err)>tol1){ | |||
5271 | double r=(x-w)*(fx-fv); | |||
5272 | double q=(x-v)*(fx-fw); | |||
5273 | double p=(x-v)*q-(x-w)*r; | |||
5274 | q=2.0*(q-r); | |||
5275 | if (q>0.0) p=-p; | |||
5276 | q=fabs(q); | |||
5277 | double etemp=err; | |||
5278 | err=d; | |||
5279 | if (fabs(p)>=fabs(0.5*q*etemp) || p<=q*(a-x)|| p>=q*(b-x)){ | |||
5280 | d=CGOLD*(err=(x>=xm ? a-x : b-x)); | |||
5281 | } | |||
5282 | else{ | |||
5283 | d=p/q; | |||
5284 | u=x+d; | |||
5285 | if (u-a < tol2 || b-u < tol2) d=SIGN(tol1,xm-x)((xm-x)>=0.0 ? fabs(tol1):-fabs(tol1)); | |||
5286 | } | |||
5287 | } else { | |||
5288 | d=CGOLD*(err=(x>=xm ? a-x : b-x )); | |||
5289 | } | |||
5290 | u=(fabs(d)>=tol1 ? x+d : x+SIGN(tol1,d)((d)>=0.0 ? fabs(tol1):-fabs(tol1))); | |||
5291 | fu=ChiXY(u); | |||
5292 | if (fu<=fx){ | |||
5293 | if (u>=x) a=x; | |||
5294 | else b=x; | |||
5295 | SHFT(v,w,x,u)(v)=(w);(w)=(x);(x)=(u); | |||
5296 | SHFT(fv,fw,fx,fu)(fv)=(fw);(fw)=(fx);(fx)=(fu); | |||
5297 | } | |||
5298 | else{ | |||
5299 | if (u<x) a=u; | |||
5300 | else b=u; | |||
5301 | if (fu<=fw || w==x){ | |||
5302 | v=w; | |||
5303 | w=u; | |||
5304 | fv=fw; | |||
5305 | fw=fu; | |||
5306 | } | |||
5307 | else if (fu<=fv || v==x || v==w){ | |||
5308 | v=u; | |||
5309 | fv=fu; | |||
5310 | } | |||
5311 | } | |||
5312 | } | |||
5313 | xmin=x; | |||
5314 | return fx; | |||
5315 | } | |||
5316 |
1 | // $Id: JEventLoop.h 1763 2006-05-10 14:29:25Z davidl $ | ||||||
2 | // | ||||||
3 | // File: JEventLoop.h | ||||||
4 | // Created: Wed Jun 8 12:30:51 EDT 2005 | ||||||
5 | // Creator: davidl (on Darwin wire129.jlab.org 7.8.0 powerpc) | ||||||
6 | // | ||||||
7 | |||||||
8 | #ifndef _JEventLoop_ | ||||||
9 | #define _JEventLoop_ | ||||||
10 | |||||||
11 | #include <sys/time.h> | ||||||
12 | |||||||
13 | #include <vector> | ||||||
14 | #include <list> | ||||||
15 | #include <string> | ||||||
16 | #include <utility> | ||||||
17 | #include <typeinfo> | ||||||
18 | #include <string.h> | ||||||
19 | #include <map> | ||||||
20 | #include <utility> | ||||||
21 | using std::vector; | ||||||
22 | using std::list; | ||||||
23 | using std::string; | ||||||
24 | using std::type_info; | ||||||
25 | |||||||
26 | #include <JANA/jerror.h> | ||||||
27 | #include <JANA/JObject.h> | ||||||
28 | #include <JANA/JException.h> | ||||||
29 | #include <JANA/JEvent.h> | ||||||
30 | #include <JANA/JThread.h> | ||||||
31 | #include <JANA/JFactory_base.h> | ||||||
32 | #include <JANA/JCalibration.h> | ||||||
33 | #include <JANA/JGeometry.h> | ||||||
34 | #include <JANA/JResourceManager.h> | ||||||
35 | #include <JANA/JStreamLog.h> | ||||||
36 | |||||||
37 | // The following is here just so we can use ROOT's THtml class to generate documentation. | ||||||
38 | #include "cint.h" | ||||||
39 | |||||||
40 | |||||||
41 | // Place everything in JANA namespace | ||||||
42 | namespace jana{ | ||||||
43 | |||||||
44 | |||||||
45 | template<class T> class JFactory; | ||||||
46 | class JApplication; | ||||||
47 | class JEventProcessor; | ||||||
48 | |||||||
49 | |||||||
50 | class JEventLoop{ | ||||||
51 | public: | ||||||
52 | |||||||
53 | friend class JApplication; | ||||||
54 | |||||||
55 | enum data_source_t{ | ||||||
56 | DATA_NOT_AVAILABLE = 1, | ||||||
57 | DATA_FROM_CACHE, | ||||||
58 | DATA_FROM_SOURCE, | ||||||
59 | DATA_FROM_FACTORY | ||||||
60 | }; | ||||||
61 | |||||||
62 | typedef struct{ | ||||||
63 | string caller_name; | ||||||
64 | string caller_tag; | ||||||
65 | string callee_name; | ||||||
66 | string callee_tag; | ||||||
67 | double start_time; | ||||||
68 | double end_time; | ||||||
69 | data_source_t data_source; | ||||||
70 | }call_stack_t; | ||||||
71 | |||||||
72 | typedef struct{ | ||||||
73 | const char* factory_name; | ||||||
74 | string tag; | ||||||
75 | const char* filename; | ||||||
76 | int line; | ||||||
77 | }error_call_stack_t; | ||||||
78 | |||||||
79 | JEventLoop(JApplication *app); ///< Constructor | ||||||
80 | virtual ~JEventLoop(); ////< Destructor | ||||||
81 | virtual const char* className(void){return static_className();} | ||||||
82 | static const char* static_className(void){return "JEventLoop";} | ||||||
83 | |||||||
84 | JApplication* GetJApplication(void) const {return app;} ///< Get pointer to the JApplication object | ||||||
85 | void RefreshProcessorListFromJApplication(void); ///< Re-copy the list of JEventProcessors from JApplication | ||||||
86 | virtual jerror_t AddFactory(JFactory_base* factory); ///< Add a factory | ||||||
87 | jerror_t RemoveFactory(JFactory_base* factory); ///< Remove a factory | ||||||
88 | JFactory_base* GetFactory(const string data_name, const char *tag="", bool allow_deftag=true); ///< Get a specific factory pointer | ||||||
89 | vector<JFactory_base*> GetFactories(void) const {return factories;} ///< Get all factory pointers | ||||||
90 | void GetFactoryNames(vector<string> &factorynames); ///< Get names of all factories in name:tag format | ||||||
91 | void GetFactoryNames(map<string,string> &factorynames); ///< Get names of all factories in map with key=name, value=tag | ||||||
92 | map<string,string> GetDefaultTags(void) const {return default_tags;} | ||||||
93 | jerror_t ClearFactories(void); ///< Reset all factories in preparation for next event. | ||||||
94 | jerror_t PrintFactories(int sparsify=0); ///< Print a list of all factories. | ||||||
95 | jerror_t Print(const string data_name, const char *tag=""); ///< Print the data of the given type | ||||||
96 | |||||||
97 | JCalibration* GetJCalibration(); | ||||||
98 | template<class T> bool GetCalib(string namepath, map<string,T> &vals); | ||||||
99 | template<class T> bool GetCalib(string namepath, vector<T> &vals); | ||||||
100 | template<class T> bool GetCalib(string namepath, T &val); | ||||||
101 | |||||||
102 | JGeometry* GetJGeometry(); | ||||||
103 | template<class T> bool GetGeom(string namepath, map<string,T> &vals); | ||||||
104 | template<class T> bool GetGeom(string namepath, T &val); | ||||||
105 | |||||||
106 | JResourceManager* GetJResourceManager(void); | ||||||
107 | string GetResource(string namepath); | ||||||
108 | template<class T> bool GetResource(string namepath, T vals, int event_number=0); | ||||||
109 | |||||||
110 | void Initialize(void); ///< Do initializations just before event processing starts | ||||||
111 | jerror_t Loop(void); ///< Loop over events | ||||||
112 | jerror_t OneEvent(uint64_t event_number); ///< Process a specific single event (if source supports it) | ||||||
113 | jerror_t OneEvent(void); ///< Process a single event | ||||||
114 | inline void Pause(void){pause = 1;} ///< Pause event processing | ||||||
115 | inline void Resume(void){pause = 0;} ///< Resume event processing | ||||||
116 | inline void Quit(void){quit = 1;} ///< Clean up and exit the event loop | ||||||
117 | inline bool GetQuit(void) const {return quit;} | ||||||
118 | void QuitProgram(void); | ||||||
119 | |||||||
120 | // Support for random access of events | ||||||
121 | bool HasRandomAccess(void); | ||||||
122 | void AddToEventQueue(uint64_t event_number){ next_events_to_process.push_back(event_number); } | ||||||
123 | void AddToEventQueue(list<uint64_t> &event_numbers) { next_events_to_process.insert(next_events_to_process.end(), event_numbers.begin(), event_numbers.end()); } | ||||||
124 | list<uint64_t> GetEventQueue(void){ return next_events_to_process; } | ||||||
125 | void ClearEventQueue(void){ next_events_to_process.clear(); } | ||||||
126 | |||||||
127 | template<class T> JFactory<T>* GetSingle(const T* &t, const char *tag="", bool exception_if_not_one=true); ///< Get pointer to first data object from (source or factory). | ||||||
128 | template<class T> JFactory<T>* Get(vector<const T*> &t, const char *tag="", bool allow_deftag=true); ///< Get data object pointers from (source or factory) | ||||||
129 | template<class T> JFactory<T>* GetFromFactory(vector<const T*> &t, const char *tag="", data_source_t &data_source=null_data_source, bool allow_deftag=true); ///< Get data object pointers from factory | ||||||
130 | template<class T> jerror_t GetFromSource(vector<const T*> &t, JFactory_base *factory=NULL__null); ///< Get data object pointers from source. | ||||||
131 | inline JEvent& GetJEvent(void){return event;} ///< Get pointer to the current JEvent object. | ||||||
132 | inline void SetJEvent(JEvent *event){this->event = *event;} ///< Set the JEvent pointer. | ||||||
133 | inline void SetAutoFree(int auto_free){this->auto_free = auto_free;} ///< Set the Auto-Free flag on/off | ||||||
134 | inline pthread_t GetPThreadID(void) const {return pthread_id;} ///< Get the pthread of the thread to which this JEventLoop belongs | ||||||
135 | double GetInstantaneousRate(void) const {return rate_instantaneous;} ///< Get the current event processing rate | ||||||
136 | double GetIntegratedRate(void) const {return rate_integrated;} ///< Get the current event processing rate | ||||||
137 | double GetLastEventProcessingTime(void) const {return delta_time_single;} | ||||||
138 | unsigned int GetNevents(void) const {return Nevents;} | ||||||
139 | |||||||
140 | inline bool CheckEventBoundary(uint64_t event_numberA, uint64_t event_numberB); | ||||||
141 | |||||||
142 | inline bool GetCallStackRecordingStatus(void){ return record_call_stack; } | ||||||
143 | inline void DisableCallStackRecording(void){ record_call_stack = false; } | ||||||
144 | inline void EnableCallStackRecording(void){ record_call_stack = true; } | ||||||
145 | inline void CallStackStart(JEventLoop::call_stack_t &cs, const string &caller_name, const string &caller_tag, const string callee_name, const string callee_tag); | ||||||
146 | inline void CallStackEnd(JEventLoop::call_stack_t &cs); | ||||||
147 | inline vector<call_stack_t> GetCallStack(void){return call_stack;} ///< Get the current factory call stack | ||||||
148 | inline void AddToCallStack(call_stack_t &cs){if(record_call_stack) call_stack.push_back(cs);} ///< Add specified item to call stack record but only if record_call_stack is true | ||||||
149 | inline void AddToErrorCallStack(error_call_stack_t &cs){error_call_stack.push_back(cs);} ///< Add layer to the factory call stack | ||||||
150 | inline vector<error_call_stack_t> GetErrorCallStack(void){return error_call_stack;} ///< Get the current factory error call stack | ||||||
151 | void PrintErrorCallStack(void); ///< Print the current factory call stack | ||||||
152 | |||||||
153 | const JObject* FindByID(JObject::oid_t id); ///< Find a data object by its identifier. | ||||||
154 | template<class T> const T* FindByID(JObject::oid_t id); ///< Find a data object by its type and identifier | ||||||
155 | JFactory_base* FindOwner(const JObject *t); ///< Find the factory that owns a data object by pointer | ||||||
156 | JFactory_base* FindOwner(JObject::oid_t id); ///< Find a factory that owns a data object by identifier | ||||||
157 | |||||||
158 | // User defined references | ||||||
159 | template<class T> void SetRef(T *t); ///< Add a user reference to this JEventLoop (must be a pointer) | ||||||
160 | template<class T> T* GetRef(void); ///< Get a user-defined reference of a specific type | ||||||
161 | template<class T> vector<T*> GetRefsT(void); ///< Get all user-defined refrences of a specicif type | ||||||
162 | vector<pair<const char*, void*> > GetRefs(void){ return user_refs; } ///< Get copy of full list of user-defined references | ||||||
163 | template<class T> void RemoveRef(T *t); ///< Remove user reference from list | ||||||
164 | |||||||
165 | // Convenience methods wrapping JEvent methods of same name | ||||||
166 | uint64_t GetStatus(void){return event.GetStatus();} | ||||||
167 | bool GetStatusBit(uint32_t bit){return event.GetStatusBit(bit);} | ||||||
168 | bool SetStatusBit(uint32_t bit, bool val=true){return event.SetStatusBit(bit, val);} | ||||||
169 | bool ClearStatusBit(uint32_t bit){return event.ClearStatusBit(bit);} | ||||||
170 | void ClearStatus(void){event.ClearStatus();} | ||||||
171 | void SetStatusBitDescription(uint32_t bit, string description){event.SetStatusBitDescription(bit, description);} | ||||||
172 | string GetStatusBitDescription(uint32_t bit){return event.GetStatusBitDescription(bit);} | ||||||
173 | void GetStatusBitDescriptions(map<uint32_t, string> &status_bit_descriptions){return event.GetStatusBitDescriptions(status_bit_descriptions);} | ||||||
174 | string StatusWordToString(void); | ||||||
175 | |||||||
176 | private: | ||||||
177 | JEvent event; | ||||||
178 | vector<JFactory_base*> factories; | ||||||
179 | vector<JEventProcessor*> processors; | ||||||
180 | vector<error_call_stack_t> error_call_stack; | ||||||
181 | vector<call_stack_t> call_stack; | ||||||
182 | JApplication *app; | ||||||
183 | JThread *jthread; | ||||||
184 | bool initialized; | ||||||
185 | bool print_parameters_called; | ||||||
186 | int pause; | ||||||
187 | int quit; | ||||||
188 | int auto_free; | ||||||
189 | pthread_t pthread_id; | ||||||
190 | map<string, string> default_tags; | ||||||
191 | vector<pair<string,string> > auto_activated_factories; | ||||||
192 | bool record_call_stack; | ||||||
193 | string caller_name; | ||||||
194 | string caller_tag; | ||||||
195 | vector<uint64_t> event_boundaries; | ||||||
196 | int32_t event_boundaries_run; ///< Run number boundaries were retrieved from (possbily 0) | ||||||
197 | list<uint64_t> next_events_to_process; | ||||||
198 | |||||||
199 | uint64_t Nevents; ///< Total events processed (this thread) | ||||||
200 | uint64_t Nevents_rate; ///< Num. events accumulated for "instantaneous" rate | ||||||
201 | double delta_time_single; ///< Time spent processing last event | ||||||
202 | double delta_time_rate; ///< Integrated time accumulated "instantaneous" rate (partial number of events) | ||||||
203 | double delta_time; ///< Total time spent processing events (this thread) | ||||||
204 | double rate_instantaneous; ///< Latest instantaneous rate | ||||||
205 | double rate_integrated; ///< Rate integrated over all events | ||||||
206 | |||||||
207 | static data_source_t null_data_source; | ||||||
208 | |||||||
209 | vector<pair<const char*, void*> > user_refs; | ||||||
210 | }; | ||||||
211 | |||||||
212 | |||||||
213 | // The following is here just so we can use ROOT's THtml class to generate documentation. | ||||||
214 | #ifdef G__DICTIONARY | ||||||
215 | typedef JEventLoop::call_stack_t call_stack_t; | ||||||
216 | typedef JEventLoop::error_call_stack_t error_call_stack_t; | ||||||
217 | #endif | ||||||
218 | |||||||
219 | #if !defined(__CINT__) && !defined(__CLING__) | ||||||
220 | |||||||
221 | //------------- | ||||||
222 | // GetSingle | ||||||
223 | //------------- | ||||||
224 | template<class T> | ||||||
225 | JFactory<T>* JEventLoop::GetSingle(const T* &t, const char *tag, bool exception_if_not_one) | ||||||
226 | { | ||||||
227 | /// This is a convenience method that can be used to get a pointer to the single | ||||||
228 | /// object of type T from the specified factory. It simply calls the Get(vector<...>) method | ||||||
229 | /// and copies the first pointer into "t" (or NULL if something other than 1 object is returned). | ||||||
230 | /// | ||||||
231 | /// This is intended to address the common situation in which there is an interest | ||||||
232 | /// in the event if and only if there is exactly 1 object of type T. If the event | ||||||
233 | /// has no objects of that type or more than 1 object of that type (for the specified | ||||||
234 | /// factory) then an exception of type "unsigned long" is thrown with the value | ||||||
235 | /// being the number of objects of type T. You can supress the exception by setting | ||||||
236 | /// exception_if_not_one to false. In that case, you will have to check if t==NULL to | ||||||
237 | /// know if the call succeeded. | ||||||
238 | vector<const T*> v; | ||||||
239 | JFactory<T> *fac = Get(v, tag); | ||||||
240 | |||||||
241 | if(v.size()!=1){ | ||||||
242 | t = NULL__null; | ||||||
243 | if(exception_if_not_one) throw v.size(); | ||||||
244 | } | ||||||
245 | |||||||
246 | t = v[0]; | ||||||
247 | |||||||
248 | return fac; | ||||||
249 | } | ||||||
250 | |||||||
251 | //------------- | ||||||
252 | // Get | ||||||
253 | //------------- | ||||||
254 | template<class T> | ||||||
255 | JFactory<T>* JEventLoop::Get(vector<const T*> &t, const char *tag, bool allow_deftag) | ||||||
256 | { | ||||||
257 | /// Retrieve or generate the array of objects of | ||||||
258 | /// type T for the curent event being processed | ||||||
259 | /// by this thread. | ||||||
260 | /// | ||||||
261 | /// By default, preference is given to reading the | ||||||
262 | /// objects from the data source(e.g. file) before generating | ||||||
263 | /// them in the factory. A flag exists in the factory | ||||||
264 | /// however to change this so that the factory is | ||||||
265 | /// given preference. | ||||||
266 | /// | ||||||
267 | /// Note that regardless of the setting of this flag, | ||||||
268 | /// the data are only either read in or generated once. | ||||||
269 | /// Ownership of the objects will always be with the | ||||||
270 | /// factory so subsequent calls will always return pointers to | ||||||
271 | /// the same data. | ||||||
272 | /// | ||||||
273 | /// If the factory is called on to generate the data, | ||||||
274 | /// it is done by calling the factory's Get() method | ||||||
275 | /// which, in turn, calls the evnt() method. | ||||||
276 | /// | ||||||
277 | /// First, we just call the GetFromFactory() method. | ||||||
278 | /// It will make the initial decision as to whether | ||||||
279 | /// it should look in the source first or not. If | ||||||
280 | /// it returns NULL, then the factory couldn't be | ||||||
281 | /// found so we automatically try the file. | ||||||
282 | /// | ||||||
283 | /// Note that if no factory exists to hold the objects | ||||||
284 | /// from the file, one can be created automatically | ||||||
285 | /// providing the <i>JANA:AUTOFACTORYCREATE</i> | ||||||
286 | /// configuration parameter is set. | ||||||
287 | |||||||
288 | // Check if a tag was specified for this data type to use for the | ||||||
289 | // default. | ||||||
290 | const char *mytag = tag
| ||||||
291 | if(strlen(mytag)==0 && allow_deftag
| ||||||
292 | map<string, string>::const_iterator iter = default_tags.find(T::static_className()); | ||||||
293 | if(iter!=default_tags.end())tag = iter->second.c_str(); | ||||||
294 | } | ||||||
295 | |||||||
296 | |||||||
297 | // If we are trying to keep track of the call stack then we | ||||||
298 | // need to add a new call_stack_t object to the the list | ||||||
299 | // and initialize it with the start time and caller/callee | ||||||
300 | // info. | ||||||
301 | call_stack_t cs; | ||||||
302 | |||||||
303 | // Optionally record starting info of call stack entry | ||||||
304 | if(record_call_stack) CallStackStart(cs, caller_name, caller_tag, T::static_className(), tag); | ||||||
305 | |||||||
306 | // Get the data (or at least try to) | ||||||
307 | JFactory<T>* factory=NULL__null; | ||||||
308 | try{ | ||||||
309 | factory = GetFromFactory(t, tag, cs.data_source, allow_deftag); | ||||||
310 | if(!factory){ | ||||||
311 | // No factory exists for this type and tag. It's possible | ||||||
312 | // that the source may be able to provide the objects | ||||||
313 | // but it will need a place to put them. We can create a | ||||||
314 | // dumb JFactory just to hold the data in case the source | ||||||
315 | // can provide the objects. Before we do though, make sure | ||||||
316 | // the user condones this via the presence of the | ||||||
317 | // "JANA:AUTOFACTORYCREATE" config parameter. | ||||||
318 | string p; | ||||||
319 | try{ | ||||||
320 | gPARMS->GetParameter("JANA:AUTOFACTORYCREATE", p); | ||||||
321 | }catch(...){} | ||||||
322 | if(p.size()==0){ | ||||||
323 | jout<<std::endl; | ||||||
324 | _DBG__std::cerr<<"/w/halld-scifs17exp/halld2/home/sdobbs/Software/jana/jana_0.8.2/Linux_CentOS7.7-x86_64-gcc4.8.5/include/JANA/JEventLoop.h" <<":"<<324<<std::endl; | ||||||
325 | jout<<"No factory of type \""<<T::static_className()<<"\" with tag \""<<tag<<"\" exists."<<std::endl; | ||||||
326 | jout<<"If you are reading objects from a file, I can auto-create a factory"<<std::endl; | ||||||
327 | jout<<"of the appropriate type to hold the objects, but this feature is turned"<<std::endl; | ||||||
328 | jout<<"off by default. To turn it on, set the \"JANA:AUTOFACTORYCREATE\""<<std::endl; | ||||||
329 | jout<<"configuration parameter. This can usually be done by passing the"<<std::endl; | ||||||
330 | jout<<"following argument to the program from the command line:"<<std::endl; | ||||||
331 | jout<<std::endl; | ||||||
332 | jout<<" -PJANA:AUTOFACTORYCREATE=1"<<std::endl; | ||||||
333 | jout<<std::endl; | ||||||
334 | jout<<"Note that since the most commonly expected occurance of this situation."<<std::endl; | ||||||
335 | jout<<"is an error, the program will now throw an exception so that the factory."<<std::endl; | ||||||
336 | jout<<"call stack can be printed."<<std::endl; | ||||||
337 | jout<<std::endl; | ||||||
338 | throw exception(); | ||||||
339 | }else{ | ||||||
340 | AddFactory(new JFactory<T>(tag)); | ||||||
341 | jout<<__FILE__"/w/halld-scifs17exp/halld2/home/sdobbs/Software/jana/jana_0.8.2/Linux_CentOS7.7-x86_64-gcc4.8.5/include/JANA/JEventLoop.h"<<":"<<__LINE__341<<" Auto-created "<<T::static_className()<<":"<<tag<<" factory"<<std::endl; | ||||||
342 | |||||||
343 | // Now try once more. The GetFromFactory method will call | ||||||
344 | // GetFromSource since it's empty. | ||||||
345 | factory = GetFromFactory(t, tag, cs.data_source, allow_deftag); | ||||||
346 | } | ||||||
347 | } | ||||||
348 | }catch(exception &e){ | ||||||
349 | // Uh-oh, an exception was thrown. Add us to the call stack | ||||||
350 | // and re-throw the exception | ||||||
351 | error_call_stack_t ecs; | ||||||
352 | ecs.factory_name = T::static_className(); | ||||||
353 | ecs.tag = tag; | ||||||
354 | ecs.filename = NULL__null; | ||||||
355 | error_call_stack.push_back(ecs); | ||||||
356 | throw e; | ||||||
357 | } | ||||||
358 | |||||||
359 | // If recording the call stack, update the end_time field and add to stack | ||||||
360 | if(record_call_stack) CallStackEnd(cs); | ||||||
361 | |||||||
362 | return factory; | ||||||
363 | } | ||||||
364 | |||||||
365 | //------------- | ||||||
366 | // GetFromFactory | ||||||
367 | //------------- | ||||||
368 | template<class T> | ||||||
369 | JFactory<T>* JEventLoop::GetFromFactory(vector<const T*> &t, const char *tag, data_source_t &data_source, bool allow_deftag) | ||||||
370 | { | ||||||
371 | // We need to find the factory providing data type T with | ||||||
372 | // tag given by "tag". | ||||||
373 | vector<JFactory_base*>::iterator iter=factories.begin(); | ||||||
374 | JFactory<T> *factory = NULL__null; | ||||||
375 | string className(T::static_className()); | ||||||
376 | |||||||
377 | // Check if a tag was specified for this data type to use for the | ||||||
378 | // default. | ||||||
379 | const char *mytag = tag==NULL__null ? "":tag; // protection against NULL tags | ||||||
380 | if(strlen(mytag)==0 && allow_deftag
| ||||||
381 | map<string, string>::const_iterator iter = default_tags.find(className); | ||||||
382 | if(iter!=default_tags.end())tag = iter->second.c_str(); | ||||||
383 | } | ||||||
384 | |||||||
385 | for(; iter!=factories.end(); iter++){ | ||||||
386 | // It turns out a long standing bug in g++ makes dynamic_cast return | ||||||
387 | // zero improperly when used on objects created on one side of | ||||||
388 | // a dynamically shared object (DSO) and the cast occurs on the | ||||||
389 | // other side. I saw bug reports ranging from 2001 to 2004. I saw | ||||||
390 | // saw it first-hand on LinuxEL4 using g++ 3.4.5. This is too bad | ||||||
391 | // since it is much more elegant (and safe) to use dynamic_cast. | ||||||
392 | // To avoid this problem which can occur with plugins, we check | ||||||
393 | // the name of the data classes are the same. (sigh) | ||||||
394 | //factory = dynamic_cast<JFactory<T> *>(*iter); | ||||||
395 | if(className == (*iter)->GetDataClassName())factory = (JFactory<T>*)(*iter); | ||||||
396 | if(factory == NULL__null)continue; | ||||||
397 | const char *factag = factory->Tag()==NULL__null ? "":factory->Tag(); | ||||||
398 | if(!strcmp(factag, tag)){ | ||||||
| |||||||
399 | break; | ||||||
400 | }else{ | ||||||
401 | factory=NULL__null; | ||||||
402 | } | ||||||
403 | } | ||||||
404 | |||||||
405 | // If factory not found, just return now | ||||||
406 | if(!factory){ | ||||||
407 | data_source = DATA_NOT_AVAILABLE; | ||||||
408 | return NULL__null; | ||||||
409 | } | ||||||
410 | |||||||
411 | // OK, we found the factory. If the evnt() routine has already | ||||||
412 | // been called, then just call the factory's Get() routine | ||||||
413 | // to return a copy of the existing data | ||||||
414 | if(factory->evnt_was_called()){ | ||||||
415 | factory->CopyFrom(t); | ||||||
416 | data_source = DATA_FROM_CACHE; | ||||||
417 | return factory; | ||||||
418 | } | ||||||
419 | |||||||
420 | // Next option is to get the objects from the data source | ||||||
421 | if(factory->GetCheckSourceFirst()){ | ||||||
422 | // If the object type/tag is found in the source, it | ||||||
423 | // will return NOERROR, even if there are zero instances | ||||||
424 | // of it. If it is not available in the source then it | ||||||
425 | // will return OBJECT_NOT_AVAILABLE. | ||||||
426 | |||||||
427 | jerror_t err = GetFromSource(t, factory); | ||||||
428 | if(err == NOERROR){ | ||||||
429 | // A return value of NOERROR means the source had the objects | ||||||
430 | // even if there were zero of them.(If the source had no | ||||||
431 | // information about the objects OBJECT_NOT_AVAILABLE would | ||||||
432 | // have been returned.) | ||||||
433 | // The GetFromSource() call will eventually lead to a call to | ||||||
434 | // the GetObjects() method of the concrete class derived | ||||||
435 | // from JEventSource. That routine should copy the object | ||||||
436 | // pointers into the factory using the factory's CopyTo() | ||||||
437 | // method which also sets the evnt_called flag for the factory. | ||||||
438 | // Note also that the "t" vector is then filled with a call | ||||||
439 | // to the factory's CopyFrom() method in JEvent::GetObjects(). | ||||||
440 | // All we need to do now is just set the factory pointers in | ||||||
441 | // the newly generated JObjects and return the factory pointer. | ||||||
442 | |||||||
443 | factory->SetFactoryPointers(); | ||||||
444 | data_source = DATA_FROM_SOURCE; | ||||||
445 | |||||||
446 | return factory; | ||||||
447 | } | ||||||
448 | } | ||||||
449 | |||||||
450 | // OK. It looks like we have to have the factory make this. | ||||||
451 | // Get pointers to data from the factory. | ||||||
452 | factory->Get(t); | ||||||
453 | factory->SetFactoryPointers(); | ||||||
454 | data_source = DATA_FROM_FACTORY; | ||||||
455 | |||||||
456 | return factory; | ||||||
457 | } | ||||||
458 | |||||||
459 | //------------- | ||||||
460 | // GetFromSource | ||||||
461 | //------------- | ||||||
462 | template<class T> | ||||||
463 | jerror_t JEventLoop::GetFromSource(vector<const T*> &t, JFactory_base *factory) | ||||||
464 | { | ||||||
465 | /// This tries to get objects from the event source. | ||||||
466 | /// "factory" must be a valid pointer to a JFactory | ||||||
467 | /// object since that will take ownership of the objects | ||||||
468 | /// created by the source. | ||||||
469 | /// This should usually be called from JEventLoop::GetFromFactory | ||||||
470 | /// which is called from JEventLoop::Get. The latter will | ||||||
471 | /// create a dummy JFactory of the proper flavor and tag if | ||||||
472 | /// one does not already exist so if objects exist in the | ||||||
473 | /// file without a corresponding factory to create them, they | ||||||
474 | /// can still be used. | ||||||
475 | if(!factory)throw OBJECT_NOT_AVAILABLE; | ||||||
476 | |||||||
477 | return event.GetObjects(t, factory); | ||||||
478 | } | ||||||
479 | |||||||
480 | //------------- | ||||||
481 | // CallStackStart | ||||||
482 | //------------- | ||||||
483 | inline void JEventLoop::CallStackStart(JEventLoop::call_stack_t &cs, const string &caller_name, const string &caller_tag, const string callee_name, const string callee_tag) | ||||||
484 | { | ||||||
485 | /// This is used to fill initial info into a call_stack_t stucture | ||||||
486 | /// for recording the call stack. It should be matched with a call | ||||||
487 | /// to CallStackEnd. It is normally called from the Get() method | ||||||
488 | /// above, but may also be used by external actors to manipulate | ||||||
489 | /// the call stack (presumably for good and not evil). | ||||||
490 | |||||||
491 | struct itimerval tmr; | ||||||
492 | getitimer(ITIMER_PROFITIMER_PROF, &tmr); | ||||||
493 | |||||||
494 | cs.caller_name = this->caller_name; | ||||||
495 | cs.caller_tag = this->caller_tag; | ||||||
496 | this->caller_name = cs.callee_name = callee_name; | ||||||
497 | this->caller_tag = cs.callee_tag = callee_tag; | ||||||
498 | cs.start_time = tmr.it_value.tv_sec + tmr.it_value.tv_usec/1.0E6; | ||||||
499 | } | ||||||
500 | |||||||
501 | //------------- | ||||||
502 | // CallStackEnd | ||||||
503 | //------------- | ||||||
504 | inline void JEventLoop::CallStackEnd(JEventLoop::call_stack_t &cs) | ||||||
505 | { | ||||||
506 | /// Complete a call stack entry. This should be matched | ||||||
507 | /// with a previous call to CallStackStart which was | ||||||
508 | /// used to fill the cs structure. | ||||||
509 | |||||||
510 | struct itimerval tmr; | ||||||
511 | getitimer(ITIMER_PROFITIMER_PROF, &tmr); | ||||||
512 | cs.end_time = tmr.it_value.tv_sec + tmr.it_value.tv_usec/1.0E6; | ||||||
513 | caller_name = cs.caller_name; | ||||||
514 | caller_tag = cs.caller_tag; | ||||||
515 | call_stack.push_back(cs); | ||||||
516 | } | ||||||
517 | |||||||
518 | //------------- | ||||||
519 | // CheckEventBoundary | ||||||
520 | //------------- | ||||||
521 | inline bool JEventLoop::CheckEventBoundary(uint64_t event_numberA, uint64_t event_numberB) | ||||||
522 | { | ||||||
523 | /// Check whether the two event numbers span one or more boundaries | ||||||
524 | /// in the calibration/conditions database for the current run number. | ||||||
525 | /// Return true if they do and false if they don't. The first parameter | ||||||
526 | /// "event_numberA" is also checked if it lands on a boundary in which | ||||||
527 | /// case true is also returned. If event_numberB lands on a boundary, | ||||||
528 | /// but event_numberA does not, then false is returned. | ||||||
529 | /// | ||||||
530 | /// This method is not expected to be called by a user. It is, however called, | ||||||
531 | /// everytime a JFactory's Get() method is called. | ||||||
532 | |||||||
533 | // Make sure our copy of the boundaries is up to date | ||||||
534 | if(event.GetRunNumber()!=event_boundaries_run){ | ||||||
535 | event_boundaries.clear(); // in case we can't get the JCalibration pointer | ||||||
536 | JCalibration *jcalib = GetJCalibration(); | ||||||
537 | if(jcalib)jcalib->GetEventBoundaries(event_boundaries); | ||||||
538 | event_boundaries_run = event.GetRunNumber(); | ||||||
539 | } | ||||||
540 | |||||||
541 | // Loop over boundaries | ||||||
542 | for(unsigned int i=0; i<event_boundaries.size(); i++){ | ||||||
543 | uint64_t eb = event_boundaries[i]; | ||||||
544 | if((eb - event_numberA)*(eb - event_numberB) < 0.0 || eb==event_numberA){ // think about it .... | ||||||
545 | // events span a boundary or is on a boundary. Return true | ||||||
546 | return true; | ||||||
547 | } | ||||||
548 | } | ||||||
549 | |||||||
550 | return false; | ||||||
551 | } | ||||||
552 | |||||||
553 | //------------- | ||||||
554 | // FindByID | ||||||
555 | //------------- | ||||||
556 | template<class T> | ||||||
557 | const T* JEventLoop::FindByID(JObject::oid_t id) | ||||||
558 | { | ||||||
559 | /// This is a templated method that can be used in place | ||||||
560 | /// of the non-templated FindByID(oid_t) method if one knows | ||||||
561 | /// the class of the object with the specified id. | ||||||
562 | /// This method is faster than calling the non-templated | ||||||
563 | /// FindByID and dynamic_cast-ing the JObject since | ||||||
564 | /// this will only search the objects of factories that | ||||||
565 | /// produce the desired data type. | ||||||
566 | /// This method will cast the JObject pointer to one | ||||||
567 | /// of the specified type. To use this method, | ||||||
568 | /// a type is specified in the call as follows: | ||||||
569 | /// | ||||||
570 | /// const DMyType *t = loop->FindByID<DMyType>(id); | ||||||
571 | |||||||
572 | // Loop over factories looking for ones that provide | ||||||
573 | // specified data type. | ||||||
574 | for(unsigned int i=0; i<factories.size(); i++){ | ||||||
575 | if(factories[i]->GetDataClassName() != T::static_className())continue; | ||||||
576 | |||||||
577 | // This factory provides data of type T. Search it for | ||||||
578 | // the object with the specified id. | ||||||
579 | const JObject *my_obj = factories[i]->GetByID(id); | ||||||
580 | if(my_obj)return dynamic_cast<const T*>(my_obj); | ||||||
581 | } | ||||||
582 | |||||||
583 | return NULL__null; | ||||||
584 | } | ||||||
585 | |||||||
586 | //------------- | ||||||
587 | // GetCalib (map) | ||||||
588 | //------------- | ||||||
589 | template<class T> | ||||||
590 | bool JEventLoop::GetCalib(string namepath, map<string,T> &vals) | ||||||
591 | { | ||||||
592 | /// Get the JCalibration object from JApplication for the run number of | ||||||
593 | /// the current event and call its Get() method to get the constants. | ||||||
594 | |||||||
595 | // Note that we could do this by making "vals" a generic type T thus, combining | ||||||
596 | // this with the vector version below. However, doing this explicitly will make | ||||||
597 | // it easier for the user to understand how to call us. | ||||||
598 | |||||||
599 | vals.clear(); | ||||||
600 | |||||||
601 | JCalibration *calib = GetJCalibration(); | ||||||
602 | if(!calib){ | ||||||
603 | _DBG_std::cerr<<"/w/halld-scifs17exp/halld2/home/sdobbs/Software/jana/jana_0.8.2/Linux_CentOS7.7-x86_64-gcc4.8.5/include/JANA/JEventLoop.h" <<":"<<603<<" "<<"Unable to get JCalibration object for run "<<event.GetRunNumber()<<std::endl; | ||||||
604 | return true; | ||||||
605 | } | ||||||
606 | |||||||
607 | return calib->Get(namepath, vals, event.GetEventNumber()); | ||||||
608 | } | ||||||
609 | |||||||
610 | //------------- | ||||||
611 | // GetCalib (vector) | ||||||
612 | //------------- | ||||||
613 | template<class T> bool JEventLoop::GetCalib(string namepath, vector<T> &vals) | ||||||
614 | { | ||||||
615 | /// Get the JCalibration object from JApplication for the run number of | ||||||
616 | /// the current event and call its Get() method to get the constants. | ||||||
617 | |||||||
618 | vals.clear(); | ||||||
619 | |||||||
620 | JCalibration *calib = GetJCalibration(); | ||||||
621 | if(!calib){ | ||||||
622 | _DBG_std::cerr<<"/w/halld-scifs17exp/halld2/home/sdobbs/Software/jana/jana_0.8.2/Linux_CentOS7.7-x86_64-gcc4.8.5/include/JANA/JEventLoop.h" <<":"<<622<<" "<<"Unable to get JCalibration object for run "<<event.GetRunNumber()<<std::endl; | ||||||
623 | return true; | ||||||
624 | } | ||||||
625 | |||||||
626 | return calib->Get(namepath, vals, event.GetEventNumber()); | ||||||
627 | } | ||||||
628 | |||||||
629 | //------------- | ||||||
630 | // GetCalib (single) | ||||||
631 | //------------- | ||||||
632 | template<class T> bool JEventLoop::GetCalib(string namepath, T &val) | ||||||
633 | { | ||||||
634 | /// This is a convenience method for getting a single entry. It | ||||||
635 | /// simply calls the vector version and returns the first entry. | ||||||
636 | /// It returns true if the vector version returns true AND there | ||||||
637 | /// is at least one entry in the vector. No check is made for there | ||||||
638 | /// there being more than one entry in the vector. | ||||||
639 | |||||||
640 | vector<T> vals; | ||||||
641 | bool ret = GetCalib(namepath, vals); | ||||||
642 | if(vals.empty()) return true; | ||||||
643 | val = vals[0]; | ||||||
644 | |||||||
645 | return ret; | ||||||
646 | } | ||||||
647 | |||||||
648 | //------------- | ||||||
649 | // GetGeom (map) | ||||||
650 | //------------- | ||||||
651 | template<class T> | ||||||
652 | bool JEventLoop::GetGeom(string namepath, map<string,T> &vals) | ||||||
653 | { | ||||||
654 | /// Get the JGeometry object from JApplication for the run number of | ||||||
655 | /// the current event and call its Get() method to get the constants. | ||||||
656 | |||||||
657 | // Note that we could do this by making "vals" a generic type T thus, combining | ||||||
658 | // this with the vector version below. However, doing this explicitly will make | ||||||
659 | // it easier for the user to understand how to call us. | ||||||
660 | |||||||
661 | vals.clear(); | ||||||
662 | |||||||
663 | JGeometry *geom = GetJGeometry(); | ||||||
664 | if(!geom){ | ||||||
665 | _DBG_std::cerr<<"/w/halld-scifs17exp/halld2/home/sdobbs/Software/jana/jana_0.8.2/Linux_CentOS7.7-x86_64-gcc4.8.5/include/JANA/JEventLoop.h" <<":"<<665<<" "<<"Unable to get JGeometry object for run "<<event.GetRunNumber()<<std::endl; | ||||||
666 | return true; | ||||||
667 | } | ||||||
668 | |||||||
669 | return geom->Get(namepath, vals); | ||||||
670 | } | ||||||
671 | |||||||
672 | //------------- | ||||||
673 | // GetGeom (atomic) | ||||||
674 | //------------- | ||||||
675 | template<class T> bool JEventLoop::GetGeom(string namepath, T &val) | ||||||
676 | { | ||||||
677 | /// Get the JCalibration object from JApplication for the run number of | ||||||
678 | /// the current event and call its Get() method to get the constants. | ||||||
679 | |||||||
680 | JGeometry *geom = GetJGeometry(); | ||||||
681 | if(!geom){ | ||||||
682 | _DBG_std::cerr<<"/w/halld-scifs17exp/halld2/home/sdobbs/Software/jana/jana_0.8.2/Linux_CentOS7.7-x86_64-gcc4.8.5/include/JANA/JEventLoop.h" <<":"<<682<<" "<<"Unable to get JGeometry object for run "<<event.GetRunNumber()<<std::endl; | ||||||
683 | return true; | ||||||
684 | } | ||||||
685 | |||||||
686 | return geom->Get(namepath, val); | ||||||
687 | } | ||||||
688 | |||||||
689 | //------------- | ||||||
690 | // SetRef | ||||||
691 | //------------- | ||||||
692 | template<class T> | ||||||
693 | void JEventLoop::SetRef(T *t) | ||||||
694 | { | ||||||
695 | pair<const char*, void*> p(typeid(T).name(), (void*)t); | ||||||
696 | user_refs.push_back(p); | ||||||
697 | } | ||||||
698 | |||||||
699 | //------------- | ||||||
700 | // GetResource | ||||||
701 | //------------- | ||||||
702 | template<class T> bool JEventLoop::GetResource(string namepath, T vals, int event_number) | ||||||
703 | { | ||||||
704 | JResourceManager *resource_manager = GetJResourceManager(); | ||||||
705 | if(!resource_manager){ | ||||||
706 | string mess = string("Unable to get the JResourceManager object (namepath=\"")+namepath+"\")"; | ||||||
707 | throw JException(mess); | ||||||
708 | } | ||||||
709 | |||||||
710 | return resource_manager->Get(namepath, vals, event_number); | ||||||
711 | } | ||||||
712 | |||||||
713 | //------------- | ||||||
714 | // GetRef | ||||||
715 | //------------- | ||||||
716 | template<class T> | ||||||
717 | T* JEventLoop::GetRef(void) | ||||||
718 | { | ||||||
719 | /// Get a user-defined reference (a pointer) | ||||||
720 | for(unsigned int i=0; i<user_refs.size(); i++){ | ||||||
721 | if(user_refs[i].first == typeid(T).name()) return (T*)user_refs[i].second; | ||||||
722 | } | ||||||
723 | |||||||
724 | return NULL__null; | ||||||
725 | } | ||||||
726 | |||||||
727 | //------------- | ||||||
728 | // GetRefsT | ||||||
729 | //------------- | ||||||
730 | template<class T> | ||||||
731 | vector<T*> JEventLoop::GetRefsT(void) | ||||||
732 | { | ||||||
733 | vector<T*> refs; | ||||||
734 | for(unsigned int i=0; i<user_refs.size(); i++){ | ||||||
735 | if(user_refs[i].first == typeid(T).name()){ | ||||||
736 | refs.push_back((T*)user_refs[i].second); | ||||||
737 | } | ||||||
738 | } | ||||||
739 | |||||||
740 | return refs; | ||||||
741 | } | ||||||
742 | |||||||
743 | //------------- | ||||||
744 | // RemoveRef | ||||||
745 | //------------- | ||||||
746 | template<class T> | ||||||
747 | void JEventLoop::RemoveRef(T *t) | ||||||
748 | { | ||||||
749 | vector<pair<const char*, void*> >::iterator iter; | ||||||
750 | for(iter=user_refs.begin(); iter!= user_refs.end(); iter++){ | ||||||
751 | if(iter->second == (void*)t){ | ||||||
752 | user_refs.erase(iter); | ||||||
753 | return; | ||||||
754 | } | ||||||
755 | } | ||||||
756 | _DBG_std::cerr<<"/w/halld-scifs17exp/halld2/home/sdobbs/Software/jana/jana_0.8.2/Linux_CentOS7.7-x86_64-gcc4.8.5/include/JANA/JEventLoop.h" <<":"<<756<<" "<<" Attempt to remove user reference not in event loop!" << std::endl; | ||||||
757 | } | ||||||
758 | |||||||
759 | |||||||
760 | #endif //__CINT__ __CLING__ | ||||||
761 | |||||||
762 | } // Close JANA namespace | ||||||
763 | |||||||
764 | |||||||
765 | |||||||
766 | #endif // _JEventLoop_ | ||||||
767 |
1 | // Iterators -*- C++ -*- |
2 | |
3 | // Copyright (C) 2001-2013 Free Software Foundation, Inc. |
4 | // |
5 | // This file is part of the GNU ISO C++ Library. This library is free |
6 | // software; you can redistribute it and/or modify it under the |
7 | // terms of the GNU General Public License as published by the |
8 | // Free Software Foundation; either version 3, or (at your option) |
9 | // any later version. |
10 | |
11 | // This library is distributed in the hope that it will be useful, |
12 | // but WITHOUT ANY WARRANTY; without even the implied warranty of |
13 | // MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
14 | // GNU General Public License for more details. |
15 | |
16 | // Under Section 7 of GPL version 3, you are granted additional |
17 | // permissions described in the GCC Runtime Library Exception, version |
18 | // 3.1, as published by the Free Software Foundation. |
19 | |
20 | // You should have received a copy of the GNU General Public License and |
21 | // a copy of the GCC Runtime Library Exception along with this program; |
22 | // see the files COPYING3 and COPYING.RUNTIME respectively. If not, see |
23 | // <http://www.gnu.org/licenses/>. |
24 | |
25 | /* |
26 | * |
27 | * Copyright (c) 1994 |
28 | * Hewlett-Packard Company |
29 | * |
30 | * Permission to use, copy, modify, distribute and sell this software |
31 | * and its documentation for any purpose is hereby granted without fee, |
32 | * provided that the above copyright notice appear in all copies and |
33 | * that both that copyright notice and this permission notice appear |
34 | * in supporting documentation. Hewlett-Packard Company makes no |
35 | * representations about the suitability of this software for any |
36 | * purpose. It is provided "as is" without express or implied warranty. |
37 | * |
38 | * |
39 | * Copyright (c) 1996-1998 |
40 | * Silicon Graphics Computer Systems, Inc. |
41 | * |
42 | * Permission to use, copy, modify, distribute and sell this software |
43 | * and its documentation for any purpose is hereby granted without fee, |
44 | * provided that the above copyright notice appear in all copies and |
45 | * that both that copyright notice and this permission notice appear |
46 | * in supporting documentation. Silicon Graphics makes no |
47 | * representations about the suitability of this software for any |
48 | * purpose. It is provided "as is" without express or implied warranty. |
49 | */ |
50 | |
51 | /** @file bits/stl_iterator.h |
52 | * This is an internal header file, included by other library headers. |
53 | * Do not attempt to use it directly. @headername{iterator} |
54 | * |
55 | * This file implements reverse_iterator, back_insert_iterator, |
56 | * front_insert_iterator, insert_iterator, __normal_iterator, and their |
57 | * supporting functions and overloaded operators. |
58 | */ |
59 | |
60 | #ifndef _STL_ITERATOR_H1 |
61 | #define _STL_ITERATOR_H1 1 |
62 | |
63 | #include <bits/cpp_type_traits.h> |
64 | #include <ext/type_traits.h> |
65 | #include <bits/move.h> |
66 | |
67 | namespace std _GLIBCXX_VISIBILITY(default)__attribute__ ((__visibility__ ("default"))) |
68 | { |
69 | _GLIBCXX_BEGIN_NAMESPACE_VERSION |
70 | |
71 | /** |
72 | * @addtogroup iterators |
73 | * @{ |
74 | */ |
75 | |
76 | // 24.4.1 Reverse iterators |
77 | /** |
78 | * Bidirectional and random access iterators have corresponding reverse |
79 | * %iterator adaptors that iterate through the data structure in the |
80 | * opposite direction. They have the same signatures as the corresponding |
81 | * iterators. The fundamental relation between a reverse %iterator and its |
82 | * corresponding %iterator @c i is established by the identity: |
83 | * @code |
84 | * &*(reverse_iterator(i)) == &*(i - 1) |
85 | * @endcode |
86 | * |
87 | * <em>This mapping is dictated by the fact that while there is always a |
88 | * pointer past the end of an array, there might not be a valid pointer |
89 | * before the beginning of an array.</em> [24.4.1]/1,2 |
90 | * |
91 | * Reverse iterators can be tricky and surprising at first. Their |
92 | * semantics make sense, however, and the trickiness is a side effect of |
93 | * the requirement that the iterators must be safe. |
94 | */ |
95 | template<typename _Iterator> |
96 | class reverse_iterator |
97 | : public iterator<typename iterator_traits<_Iterator>::iterator_category, |
98 | typename iterator_traits<_Iterator>::value_type, |
99 | typename iterator_traits<_Iterator>::difference_type, |
100 | typename iterator_traits<_Iterator>::pointer, |
101 | typename iterator_traits<_Iterator>::reference> |
102 | { |
103 | protected: |
104 | _Iterator current; |
105 | |
106 | typedef iterator_traits<_Iterator> __traits_type; |
107 | |
108 | public: |
109 | typedef _Iterator iterator_type; |
110 | typedef typename __traits_type::difference_type difference_type; |
111 | typedef typename __traits_type::pointer pointer; |
112 | typedef typename __traits_type::reference reference; |
113 | |
114 | /** |
115 | * The default constructor value-initializes member @p current. |
116 | * If it is a pointer, that means it is zero-initialized. |
117 | */ |
118 | // _GLIBCXX_RESOLVE_LIB_DEFECTS |
119 | // 235 No specification of default ctor for reverse_iterator |
120 | reverse_iterator() : current() { } |
121 | |
122 | /** |
123 | * This %iterator will move in the opposite direction that @p x does. |
124 | */ |
125 | explicit |
126 | reverse_iterator(iterator_type __x) : current(__x) { } |
127 | |
128 | /** |
129 | * The copy constructor is normal. |
130 | */ |
131 | reverse_iterator(const reverse_iterator& __x) |
132 | : current(__x.current) { } |
133 | |
134 | /** |
135 | * A %reverse_iterator across other types can be copied if the |
136 | * underlying %iterator can be converted to the type of @c current. |
137 | */ |
138 | template<typename _Iter> |
139 | reverse_iterator(const reverse_iterator<_Iter>& __x) |
140 | : current(__x.base()) { } |
141 | |
142 | /** |
143 | * @return @c current, the %iterator used for underlying work. |
144 | */ |
145 | iterator_type |
146 | base() const |
147 | { return current; } |
148 | |
149 | /** |
150 | * @return A reference to the value at @c --current |
151 | * |
152 | * This requires that @c --current is dereferenceable. |
153 | * |
154 | * @warning This implementation requires that for an iterator of the |
155 | * underlying iterator type, @c x, a reference obtained by |
156 | * @c *x remains valid after @c x has been modified or |
157 | * destroyed. This is a bug: http://gcc.gnu.org/PR51823 |
158 | */ |
159 | reference |
160 | operator*() const |
161 | { |
162 | _Iterator __tmp = current; |
163 | return *--__tmp; |
164 | } |
165 | |
166 | /** |
167 | * @return A pointer to the value at @c --current |
168 | * |
169 | * This requires that @c --current is dereferenceable. |
170 | */ |
171 | pointer |
172 | operator->() const |
173 | { return &(operator*()); } |
174 | |
175 | /** |
176 | * @return @c *this |
177 | * |
178 | * Decrements the underlying iterator. |
179 | */ |
180 | reverse_iterator& |
181 | operator++() |
182 | { |
183 | --current; |
184 | return *this; |
185 | } |
186 | |
187 | /** |
188 | * @return The original value of @c *this |
189 | * |
190 | * Decrements the underlying iterator. |
191 | */ |
192 | reverse_iterator |
193 | operator++(int) |
194 | { |
195 | reverse_iterator __tmp = *this; |
196 | --current; |
197 | return __tmp; |
198 | } |
199 | |
200 | /** |
201 | * @return @c *this |
202 | * |
203 | * Increments the underlying iterator. |
204 | */ |
205 | reverse_iterator& |
206 | operator--() |
207 | { |
208 | ++current; |
209 | return *this; |
210 | } |
211 | |
212 | /** |
213 | * @return A reverse_iterator with the previous value of @c *this |
214 | * |
215 | * Increments the underlying iterator. |
216 | */ |
217 | reverse_iterator |
218 | operator--(int) |
219 | { |
220 | reverse_iterator __tmp = *this; |
221 | ++current; |
222 | return __tmp; |
223 | } |
224 | |
225 | /** |
226 | * @return A reverse_iterator that refers to @c current - @a __n |
227 | * |
228 | * The underlying iterator must be a Random Access Iterator. |
229 | */ |
230 | reverse_iterator |
231 | operator+(difference_type __n) const |
232 | { return reverse_iterator(current - __n); } |
233 | |
234 | /** |
235 | * @return *this |
236 | * |
237 | * Moves the underlying iterator backwards @a __n steps. |
238 | * The underlying iterator must be a Random Access Iterator. |
239 | */ |
240 | reverse_iterator& |
241 | operator+=(difference_type __n) |
242 | { |
243 | current -= __n; |
244 | return *this; |
245 | } |
246 | |
247 | /** |
248 | * @return A reverse_iterator that refers to @c current - @a __n |
249 | * |
250 | * The underlying iterator must be a Random Access Iterator. |
251 | */ |
252 | reverse_iterator |
253 | operator-(difference_type __n) const |
254 | { return reverse_iterator(current + __n); } |
255 | |
256 | /** |
257 | * @return *this |
258 | * |
259 | * Moves the underlying iterator forwards @a __n steps. |
260 | * The underlying iterator must be a Random Access Iterator. |
261 | */ |
262 | reverse_iterator& |
263 | operator-=(difference_type __n) |
264 | { |
265 | current += __n; |
266 | return *this; |
267 | } |
268 | |
269 | /** |
270 | * @return The value at @c current - @a __n - 1 |
271 | * |
272 | * The underlying iterator must be a Random Access Iterator. |
273 | */ |
274 | reference |
275 | operator[](difference_type __n) const |
276 | { return *(*this + __n); } |
277 | }; |
278 | |
279 | //@{ |
280 | /** |
281 | * @param __x A %reverse_iterator. |
282 | * @param __y A %reverse_iterator. |
283 | * @return A simple bool. |
284 | * |
285 | * Reverse iterators forward many operations to their underlying base() |
286 | * iterators. Others are implemented in terms of one another. |
287 | * |
288 | */ |
289 | template<typename _Iterator> |
290 | inline bool |
291 | operator==(const reverse_iterator<_Iterator>& __x, |
292 | const reverse_iterator<_Iterator>& __y) |
293 | { return __x.base() == __y.base(); } |
294 | |
295 | template<typename _Iterator> |
296 | inline bool |
297 | operator<(const reverse_iterator<_Iterator>& __x, |
298 | const reverse_iterator<_Iterator>& __y) |
299 | { return __y.base() < __x.base(); } |
300 | |
301 | template<typename _Iterator> |
302 | inline bool |
303 | operator!=(const reverse_iterator<_Iterator>& __x, |
304 | const reverse_iterator<_Iterator>& __y) |
305 | { return !(__x == __y); } |
306 | |
307 | template<typename _Iterator> |
308 | inline bool |
309 | operator>(const reverse_iterator<_Iterator>& __x, |
310 | const reverse_iterator<_Iterator>& __y) |
311 | { return __y < __x; } |
312 | |
313 | template<typename _Iterator> |
314 | inline bool |
315 | operator<=(const reverse_iterator<_Iterator>& __x, |
316 | const reverse_iterator<_Iterator>& __y) |
317 | { return !(__y < __x); } |
318 | |
319 | template<typename _Iterator> |
320 | inline bool |
321 | operator>=(const reverse_iterator<_Iterator>& __x, |
322 | const reverse_iterator<_Iterator>& __y) |
323 | { return !(__x < __y); } |
324 | |
325 | template<typename _Iterator> |
326 | inline typename reverse_iterator<_Iterator>::difference_type |
327 | operator-(const reverse_iterator<_Iterator>& __x, |
328 | const reverse_iterator<_Iterator>& __y) |
329 | { return __y.base() - __x.base(); } |
330 | |
331 | template<typename _Iterator> |
332 | inline reverse_iterator<_Iterator> |
333 | operator+(typename reverse_iterator<_Iterator>::difference_type __n, |
334 | const reverse_iterator<_Iterator>& __x) |
335 | { return reverse_iterator<_Iterator>(__x.base() - __n); } |
336 | |
337 | // _GLIBCXX_RESOLVE_LIB_DEFECTS |
338 | // DR 280. Comparison of reverse_iterator to const reverse_iterator. |
339 | template<typename _IteratorL, typename _IteratorR> |
340 | inline bool |
341 | operator==(const reverse_iterator<_IteratorL>& __x, |
342 | const reverse_iterator<_IteratorR>& __y) |
343 | { return __x.base() == __y.base(); } |
344 | |
345 | template<typename _IteratorL, typename _IteratorR> |
346 | inline bool |
347 | operator<(const reverse_iterator<_IteratorL>& __x, |
348 | const reverse_iterator<_IteratorR>& __y) |
349 | { return __y.base() < __x.base(); } |
350 | |
351 | template<typename _IteratorL, typename _IteratorR> |
352 | inline bool |
353 | operator!=(const reverse_iterator<_IteratorL>& __x, |
354 | const reverse_iterator<_IteratorR>& __y) |
355 | { return !(__x == __y); } |
356 | |
357 | template<typename _IteratorL, typename _IteratorR> |
358 | inline bool |
359 | operator>(const reverse_iterator<_IteratorL>& __x, |
360 | const reverse_iterator<_IteratorR>& __y) |
361 | { return __y < __x; } |
362 | |
363 | template<typename _IteratorL, typename _IteratorR> |
364 | inline bool |
365 | operator<=(const reverse_iterator<_IteratorL>& __x, |
366 | const reverse_iterator<_IteratorR>& __y) |
367 | { return !(__y < __x); } |
368 | |
369 | template<typename _IteratorL, typename _IteratorR> |
370 | inline bool |
371 | operator>=(const reverse_iterator<_IteratorL>& __x, |
372 | const reverse_iterator<_IteratorR>& __y) |
373 | { return !(__x < __y); } |
374 | |
375 | template<typename _IteratorL, typename _IteratorR> |
376 | #if __cplusplus201103L >= 201103L |
377 | // DR 685. |
378 | inline auto |
379 | operator-(const reverse_iterator<_IteratorL>& __x, |
380 | const reverse_iterator<_IteratorR>& __y) |
381 | -> decltype(__y.base() - __x.base()) |
382 | #else |
383 | inline typename reverse_iterator<_IteratorL>::difference_type |
384 | operator-(const reverse_iterator<_IteratorL>& __x, |
385 | const reverse_iterator<_IteratorR>& __y) |
386 | #endif |
387 | { return __y.base() - __x.base(); } |
388 | //@} |
389 | |
390 | // 24.4.2.2.1 back_insert_iterator |
391 | /** |
392 | * @brief Turns assignment into insertion. |
393 | * |
394 | * These are output iterators, constructed from a container-of-T. |
395 | * Assigning a T to the iterator appends it to the container using |
396 | * push_back. |
397 | * |
398 | * Tip: Using the back_inserter function to create these iterators can |
399 | * save typing. |
400 | */ |
401 | template<typename _Container> |
402 | class back_insert_iterator |
403 | : public iterator<output_iterator_tag, void, void, void, void> |
404 | { |
405 | protected: |
406 | _Container* container; |
407 | |
408 | public: |
409 | /// A nested typedef for the type of whatever container you used. |
410 | typedef _Container container_type; |
411 | |
412 | /// The only way to create this %iterator is with a container. |
413 | explicit |
414 | back_insert_iterator(_Container& __x) : container(&__x) { } |
415 | |
416 | /** |
417 | * @param __value An instance of whatever type |
418 | * container_type::const_reference is; presumably a |
419 | * reference-to-const T for container<T>. |
420 | * @return This %iterator, for chained operations. |
421 | * |
422 | * This kind of %iterator doesn't really have a @a position in the |
423 | * container (you can think of the position as being permanently at |
424 | * the end, if you like). Assigning a value to the %iterator will |
425 | * always append the value to the end of the container. |
426 | */ |
427 | #if __cplusplus201103L < 201103L |
428 | back_insert_iterator& |
429 | operator=(typename _Container::const_reference __value) |
430 | { |
431 | container->push_back(__value); |
432 | return *this; |
433 | } |
434 | #else |
435 | back_insert_iterator& |
436 | operator=(const typename _Container::value_type& __value) |
437 | { |
438 | container->push_back(__value); |
439 | return *this; |
440 | } |
441 | |
442 | back_insert_iterator& |
443 | operator=(typename _Container::value_type&& __value) |
444 | { |
445 | container->push_back(std::move(__value)); |
446 | return *this; |
447 | } |
448 | #endif |
449 | |
450 | /// Simply returns *this. |
451 | back_insert_iterator& |
452 | operator*() |
453 | { return *this; } |
454 | |
455 | /// Simply returns *this. (This %iterator does not @a move.) |
456 | back_insert_iterator& |
457 | operator++() |
458 | { return *this; } |
459 | |
460 | /// Simply returns *this. (This %iterator does not @a move.) |
461 | back_insert_iterator |
462 | operator++(int) |
463 | { return *this; } |
464 | }; |
465 | |
466 | /** |
467 | * @param __x A container of arbitrary type. |
468 | * @return An instance of back_insert_iterator working on @p __x. |
469 | * |
470 | * This wrapper function helps in creating back_insert_iterator instances. |
471 | * Typing the name of the %iterator requires knowing the precise full |
472 | * type of the container, which can be tedious and impedes generic |
473 | * programming. Using this function lets you take advantage of automatic |
474 | * template parameter deduction, making the compiler match the correct |
475 | * types for you. |
476 | */ |
477 | template<typename _Container> |
478 | inline back_insert_iterator<_Container> |
479 | back_inserter(_Container& __x) |
480 | { return back_insert_iterator<_Container>(__x); } |
481 | |
482 | /** |
483 | * @brief Turns assignment into insertion. |
484 | * |
485 | * These are output iterators, constructed from a container-of-T. |
486 | * Assigning a T to the iterator prepends it to the container using |
487 | * push_front. |
488 | * |
489 | * Tip: Using the front_inserter function to create these iterators can |
490 | * save typing. |
491 | */ |
492 | template<typename _Container> |
493 | class front_insert_iterator |
494 | : public iterator<output_iterator_tag, void, void, void, void> |
495 | { |
496 | protected: |
497 | _Container* container; |
498 | |
499 | public: |
500 | /// A nested typedef for the type of whatever container you used. |
501 | typedef _Container container_type; |
502 | |
503 | /// The only way to create this %iterator is with a container. |
504 | explicit front_insert_iterator(_Container& __x) : container(&__x) { } |
505 | |
506 | /** |
507 | * @param __value An instance of whatever type |
508 | * container_type::const_reference is; presumably a |
509 | * reference-to-const T for container<T>. |
510 | * @return This %iterator, for chained operations. |
511 | * |
512 | * This kind of %iterator doesn't really have a @a position in the |
513 | * container (you can think of the position as being permanently at |
514 | * the front, if you like). Assigning a value to the %iterator will |
515 | * always prepend the value to the front of the container. |
516 | */ |
517 | #if __cplusplus201103L < 201103L |
518 | front_insert_iterator& |
519 | operator=(typename _Container::const_reference __value) |
520 | { |
521 | container->push_front(__value); |
522 | return *this; |
523 | } |
524 | #else |
525 | front_insert_iterator& |
526 | operator=(const typename _Container::value_type& __value) |
527 | { |
528 | container->push_front(__value); |
529 | return *this; |
530 | } |
531 | |
532 | front_insert_iterator& |
533 | operator=(typename _Container::value_type&& __value) |
534 | { |
535 | container->push_front(std::move(__value)); |
536 | return *this; |
537 | } |
538 | #endif |
539 | |
540 | /// Simply returns *this. |
541 | front_insert_iterator& |
542 | operator*() |
543 | { return *this; } |
544 | |
545 | /// Simply returns *this. (This %iterator does not @a move.) |
546 | front_insert_iterator& |
547 | operator++() |
548 | { return *this; } |
549 | |
550 | /// Simply returns *this. (This %iterator does not @a move.) |
551 | front_insert_iterator |
552 | operator++(int) |
553 | { return *this; } |
554 | }; |
555 | |
556 | /** |
557 | * @param __x A container of arbitrary type. |
558 | * @return An instance of front_insert_iterator working on @p x. |
559 | * |
560 | * This wrapper function helps in creating front_insert_iterator instances. |
561 | * Typing the name of the %iterator requires knowing the precise full |
562 | * type of the container, which can be tedious and impedes generic |
563 | * programming. Using this function lets you take advantage of automatic |
564 | * template parameter deduction, making the compiler match the correct |
565 | * types for you. |
566 | */ |
567 | template<typename _Container> |
568 | inline front_insert_iterator<_Container> |
569 | front_inserter(_Container& __x) |
570 | { return front_insert_iterator<_Container>(__x); } |
571 | |
572 | /** |
573 | * @brief Turns assignment into insertion. |
574 | * |
575 | * These are output iterators, constructed from a container-of-T. |
576 | * Assigning a T to the iterator inserts it in the container at the |
577 | * %iterator's position, rather than overwriting the value at that |
578 | * position. |
579 | * |
580 | * (Sequences will actually insert a @e copy of the value before the |
581 | * %iterator's position.) |
582 | * |
583 | * Tip: Using the inserter function to create these iterators can |
584 | * save typing. |
585 | */ |
586 | template<typename _Container> |
587 | class insert_iterator |
588 | : public iterator<output_iterator_tag, void, void, void, void> |
589 | { |
590 | protected: |
591 | _Container* container; |
592 | typename _Container::iterator iter; |
593 | |
594 | public: |
595 | /// A nested typedef for the type of whatever container you used. |
596 | typedef _Container container_type; |
597 | |
598 | /** |
599 | * The only way to create this %iterator is with a container and an |
600 | * initial position (a normal %iterator into the container). |
601 | */ |
602 | insert_iterator(_Container& __x, typename _Container::iterator __i) |
603 | : container(&__x), iter(__i) {} |
604 | |
605 | /** |
606 | * @param __value An instance of whatever type |
607 | * container_type::const_reference is; presumably a |
608 | * reference-to-const T for container<T>. |
609 | * @return This %iterator, for chained operations. |
610 | * |
611 | * This kind of %iterator maintains its own position in the |
612 | * container. Assigning a value to the %iterator will insert the |
613 | * value into the container at the place before the %iterator. |
614 | * |
615 | * The position is maintained such that subsequent assignments will |
616 | * insert values immediately after one another. For example, |
617 | * @code |
618 | * // vector v contains A and Z |
619 | * |
620 | * insert_iterator i (v, ++v.begin()); |
621 | * i = 1; |
622 | * i = 2; |
623 | * i = 3; |
624 | * |
625 | * // vector v contains A, 1, 2, 3, and Z |
626 | * @endcode |
627 | */ |
628 | #if __cplusplus201103L < 201103L |
629 | insert_iterator& |
630 | operator=(typename _Container::const_reference __value) |
631 | { |
632 | iter = container->insert(iter, __value); |
633 | ++iter; |
634 | return *this; |
635 | } |
636 | #else |
637 | insert_iterator& |
638 | operator=(const typename _Container::value_type& __value) |
639 | { |
640 | iter = container->insert(iter, __value); |
641 | ++iter; |
642 | return *this; |
643 | } |
644 | |
645 | insert_iterator& |
646 | operator=(typename _Container::value_type&& __value) |
647 | { |
648 | iter = container->insert(iter, std::move(__value)); |
649 | ++iter; |
650 | return *this; |
651 | } |
652 | #endif |
653 | |
654 | /// Simply returns *this. |
655 | insert_iterator& |
656 | operator*() |
657 | { return *this; } |
658 | |
659 | /// Simply returns *this. (This %iterator does not @a move.) |
660 | insert_iterator& |
661 | operator++() |
662 | { return *this; } |
663 | |
664 | /// Simply returns *this. (This %iterator does not @a move.) |
665 | insert_iterator& |
666 | operator++(int) |
667 | { return *this; } |
668 | }; |
669 | |
670 | /** |
671 | * @param __x A container of arbitrary type. |
672 | * @return An instance of insert_iterator working on @p __x. |
673 | * |
674 | * This wrapper function helps in creating insert_iterator instances. |
675 | * Typing the name of the %iterator requires knowing the precise full |
676 | * type of the container, which can be tedious and impedes generic |
677 | * programming. Using this function lets you take advantage of automatic |
678 | * template parameter deduction, making the compiler match the correct |
679 | * types for you. |
680 | */ |
681 | template<typename _Container, typename _Iterator> |
682 | inline insert_iterator<_Container> |
683 | inserter(_Container& __x, _Iterator __i) |
684 | { |
685 | return insert_iterator<_Container>(__x, |
686 | typename _Container::iterator(__i)); |
687 | } |
688 | |
689 | // @} group iterators |
690 | |
691 | _GLIBCXX_END_NAMESPACE_VERSION |
692 | } // namespace |
693 | |
694 | namespace __gnu_cxx _GLIBCXX_VISIBILITY(default)__attribute__ ((__visibility__ ("default"))) |
695 | { |
696 | _GLIBCXX_BEGIN_NAMESPACE_VERSION |
697 | |
698 | // This iterator adapter is @a normal in the sense that it does not |
699 | // change the semantics of any of the operators of its iterator |
700 | // parameter. Its primary purpose is to convert an iterator that is |
701 | // not a class, e.g. a pointer, into an iterator that is a class. |
702 | // The _Container parameter exists solely so that different containers |
703 | // using this template can instantiate different types, even if the |
704 | // _Iterator parameter is the same. |
705 | using std::iterator_traits; |
706 | using std::iterator; |
707 | template<typename _Iterator, typename _Container> |
708 | class __normal_iterator |
709 | { |
710 | protected: |
711 | _Iterator _M_current; |
712 | |
713 | typedef iterator_traits<_Iterator> __traits_type; |
714 | |
715 | public: |
716 | typedef _Iterator iterator_type; |
717 | typedef typename __traits_type::iterator_category iterator_category; |
718 | typedef typename __traits_type::value_type value_type; |
719 | typedef typename __traits_type::difference_type difference_type; |
720 | typedef typename __traits_type::reference reference; |
721 | typedef typename __traits_type::pointer pointer; |
722 | |
723 | _GLIBCXX_CONSTEXPRconstexpr __normal_iterator() : _M_current(_Iterator()) { } |
724 | |
725 | explicit |
726 | __normal_iterator(const _Iterator& __i) : _M_current(__i) { } |
727 | |
728 | // Allow iterator to const_iterator conversion |
729 | template<typename _Iter> |
730 | __normal_iterator(const __normal_iterator<_Iter, |
731 | typename __enable_if< |
732 | (std::__are_same<_Iter, typename _Container::pointer>::__value), |
733 | _Container>::__type>& __i) |
734 | : _M_current(__i.base()) { } |
735 | |
736 | // Forward iterator requirements |
737 | reference |
738 | operator*() const |
739 | { return *_M_current; } |
740 | |
741 | pointer |
742 | operator->() const |
743 | { return _M_current; } |
744 | |
745 | __normal_iterator& |
746 | operator++() |
747 | { |
748 | ++_M_current; |
749 | return *this; |
750 | } |
751 | |
752 | __normal_iterator |
753 | operator++(int) |
754 | { return __normal_iterator(_M_current++); } |
755 | |
756 | // Bidirectional iterator requirements |
757 | __normal_iterator& |
758 | operator--() |
759 | { |
760 | --_M_current; |
761 | return *this; |
762 | } |
763 | |
764 | __normal_iterator |
765 | operator--(int) |
766 | { return __normal_iterator(_M_current--); } |
767 | |
768 | // Random access iterator requirements |
769 | reference |
770 | operator[](const difference_type& __n) const |
771 | { return _M_current[__n]; } |
772 | |
773 | __normal_iterator& |
774 | operator+=(const difference_type& __n) |
775 | { _M_current += __n; return *this; } |
776 | |
777 | __normal_iterator |
778 | operator+(const difference_type& __n) const |
779 | { return __normal_iterator(_M_current + __n); } |
780 | |
781 | __normal_iterator& |
782 | operator-=(const difference_type& __n) |
783 | { _M_current -= __n; return *this; } |
784 | |
785 | __normal_iterator |
786 | operator-(const difference_type& __n) const |
787 | { return __normal_iterator(_M_current - __n); } |
788 | |
789 | const _Iterator& |
790 | base() const |
791 | { return _M_current; } |
792 | }; |
793 | |
794 | // Note: In what follows, the left- and right-hand-side iterators are |
795 | // allowed to vary in types (conceptually in cv-qualification) so that |
796 | // comparison between cv-qualified and non-cv-qualified iterators be |
797 | // valid. However, the greedy and unfriendly operators in std::rel_ops |
798 | // will make overload resolution ambiguous (when in scope) if we don't |
799 | // provide overloads whose operands are of the same type. Can someone |
800 | // remind me what generic programming is about? -- Gaby |
801 | |
802 | // Forward iterator requirements |
803 | template<typename _IteratorL, typename _IteratorR, typename _Container> |
804 | inline bool |
805 | operator==(const __normal_iterator<_IteratorL, _Container>& __lhs, |
806 | const __normal_iterator<_IteratorR, _Container>& __rhs) |
807 | { return __lhs.base() == __rhs.base(); } |
808 | |
809 | template<typename _Iterator, typename _Container> |
810 | inline bool |
811 | operator==(const __normal_iterator<_Iterator, _Container>& __lhs, |
812 | const __normal_iterator<_Iterator, _Container>& __rhs) |
813 | { return __lhs.base() == __rhs.base(); } |
814 | |
815 | template<typename _IteratorL, typename _IteratorR, typename _Container> |
816 | inline bool |
817 | operator!=(const __normal_iterator<_IteratorL, _Container>& __lhs, |
818 | const __normal_iterator<_IteratorR, _Container>& __rhs) |
819 | { return __lhs.base() != __rhs.base(); } |
820 | |
821 | template<typename _Iterator, typename _Container> |
822 | inline bool |
823 | operator!=(const __normal_iterator<_Iterator, _Container>& __lhs, |
824 | const __normal_iterator<_Iterator, _Container>& __rhs) |
825 | { return __lhs.base() != __rhs.base(); } |
826 | |
827 | // Random access iterator requirements |
828 | template<typename _IteratorL, typename _IteratorR, typename _Container> |
829 | inline bool |
830 | operator<(const __normal_iterator<_IteratorL, _Container>& __lhs, |
831 | const __normal_iterator<_IteratorR, _Container>& __rhs) |
832 | { return __lhs.base() < __rhs.base(); } |
833 | |
834 | template<typename _Iterator, typename _Container> |
835 | inline bool |
836 | operator<(const __normal_iterator<_Iterator, _Container>& __lhs, |
837 | const __normal_iterator<_Iterator, _Container>& __rhs) |
838 | { return __lhs.base() < __rhs.base(); } |
839 | |
840 | template<typename _IteratorL, typename _IteratorR, typename _Container> |
841 | inline bool |
842 | operator>(const __normal_iterator<_IteratorL, _Container>& __lhs, |
843 | const __normal_iterator<_IteratorR, _Container>& __rhs) |
844 | { return __lhs.base() > __rhs.base(); } |
845 | |
846 | template<typename _Iterator, typename _Container> |
847 | inline bool |
848 | operator>(const __normal_iterator<_Iterator, _Container>& __lhs, |
849 | const __normal_iterator<_Iterator, _Container>& __rhs) |
850 | { return __lhs.base() > __rhs.base(); } |
851 | |
852 | template<typename _IteratorL, typename _IteratorR, typename _Container> |
853 | inline bool |
854 | operator<=(const __normal_iterator<_IteratorL, _Container>& __lhs, |
855 | const __normal_iterator<_IteratorR, _Container>& __rhs) |
856 | { return __lhs.base() <= __rhs.base(); } |
857 | |
858 | template<typename _Iterator, typename _Container> |
859 | inline bool |
860 | operator<=(const __normal_iterator<_Iterator, _Container>& __lhs, |
861 | const __normal_iterator<_Iterator, _Container>& __rhs) |
862 | { return __lhs.base() <= __rhs.base(); } |
863 | |
864 | template<typename _IteratorL, typename _IteratorR, typename _Container> |
865 | inline bool |
866 | operator>=(const __normal_iterator<_IteratorL, _Container>& __lhs, |
867 | const __normal_iterator<_IteratorR, _Container>& __rhs) |
868 | { return __lhs.base() >= __rhs.base(); } |
869 | |
870 | template<typename _Iterator, typename _Container> |
871 | inline bool |
872 | operator>=(const __normal_iterator<_Iterator, _Container>& __lhs, |
873 | const __normal_iterator<_Iterator, _Container>& __rhs) |
874 | { return __lhs.base() >= __rhs.base(); } |
875 | |
876 | // _GLIBCXX_RESOLVE_LIB_DEFECTS |
877 | // According to the resolution of DR179 not only the various comparison |
878 | // operators but also operator- must accept mixed iterator/const_iterator |
879 | // parameters. |
880 | template<typename _IteratorL, typename _IteratorR, typename _Container> |
881 | #if __cplusplus201103L >= 201103L |
882 | // DR 685. |
883 | inline auto |
884 | operator-(const __normal_iterator<_IteratorL, _Container>& __lhs, |
885 | const __normal_iterator<_IteratorR, _Container>& __rhs) |
886 | -> decltype(__lhs.base() - __rhs.base()) |
887 | #else |
888 | inline typename __normal_iterator<_IteratorL, _Container>::difference_type |
889 | operator-(const __normal_iterator<_IteratorL, _Container>& __lhs, |
890 | const __normal_iterator<_IteratorR, _Container>& __rhs) |
891 | #endif |
892 | { return __lhs.base() - __rhs.base(); } |
893 | |
894 | template<typename _Iterator, typename _Container> |
895 | inline typename __normal_iterator<_Iterator, _Container>::difference_type |
896 | operator-(const __normal_iterator<_Iterator, _Container>& __lhs, |
897 | const __normal_iterator<_Iterator, _Container>& __rhs) |
898 | { return __lhs.base() - __rhs.base(); } |
899 | |
900 | template<typename _Iterator, typename _Container> |
901 | inline __normal_iterator<_Iterator, _Container> |
902 | operator+(typename __normal_iterator<_Iterator, _Container>::difference_type |
903 | __n, const __normal_iterator<_Iterator, _Container>& __i) |
904 | { return __normal_iterator<_Iterator, _Container>(__i.base() + __n); } |
905 | |
906 | _GLIBCXX_END_NAMESPACE_VERSION |
907 | } // namespace |
908 | |
909 | #if __cplusplus201103L >= 201103L |
910 | |
911 | namespace std _GLIBCXX_VISIBILITY(default)__attribute__ ((__visibility__ ("default"))) |
912 | { |
913 | _GLIBCXX_BEGIN_NAMESPACE_VERSION |
914 | |
915 | /** |
916 | * @addtogroup iterators |
917 | * @{ |
918 | */ |
919 | |
920 | // 24.4.3 Move iterators |
921 | /** |
922 | * Class template move_iterator is an iterator adapter with the same |
923 | * behavior as the underlying iterator except that its dereference |
924 | * operator implicitly converts the value returned by the underlying |
925 | * iterator's dereference operator to an rvalue reference. Some |
926 | * generic algorithms can be called with move iterators to replace |
927 | * copying with moving. |
928 | */ |
929 | template<typename _Iterator> |
930 | class move_iterator |
931 | { |
932 | protected: |
933 | _Iterator _M_current; |
934 | |
935 | typedef iterator_traits<_Iterator> __traits_type; |
936 | |
937 | public: |
938 | typedef _Iterator iterator_type; |
939 | typedef typename __traits_type::iterator_category iterator_category; |
940 | typedef typename __traits_type::value_type value_type; |
941 | typedef typename __traits_type::difference_type difference_type; |
942 | // NB: DR 680. |
943 | typedef _Iterator pointer; |
944 | typedef value_type&& reference; |
945 | |
946 | move_iterator() |
947 | : _M_current() { } |
948 | |
949 | explicit |
950 | move_iterator(iterator_type __i) |
951 | : _M_current(__i) { } |
952 | |
953 | template<typename _Iter> |
954 | move_iterator(const move_iterator<_Iter>& __i) |
955 | : _M_current(__i.base()) { } |
956 | |
957 | iterator_type |
958 | base() const |
959 | { return _M_current; } |
960 | |
961 | reference |
962 | operator*() const |
963 | { return std::move(*_M_current); } |
964 | |
965 | pointer |
966 | operator->() const |
967 | { return _M_current; } |
968 | |
969 | move_iterator& |
970 | operator++() |
971 | { |
972 | ++_M_current; |
973 | return *this; |
974 | } |
975 | |
976 | move_iterator |
977 | operator++(int) |
978 | { |
979 | move_iterator __tmp = *this; |
980 | ++_M_current; |
981 | return __tmp; |
982 | } |
983 | |
984 | move_iterator& |
985 | operator--() |
986 | { |
987 | --_M_current; |
988 | return *this; |
989 | } |
990 | |
991 | move_iterator |
992 | operator--(int) |
993 | { |
994 | move_iterator __tmp = *this; |
995 | --_M_current; |
996 | return __tmp; |
997 | } |
998 | |
999 | move_iterator |
1000 | operator+(difference_type __n) const |
1001 | { return move_iterator(_M_current + __n); } |
1002 | |
1003 | move_iterator& |
1004 | operator+=(difference_type __n) |
1005 | { |
1006 | _M_current += __n; |
1007 | return *this; |
1008 | } |
1009 | |
1010 | move_iterator |
1011 | operator-(difference_type __n) const |
1012 | { return move_iterator(_M_current - __n); } |
1013 | |
1014 | move_iterator& |
1015 | operator-=(difference_type __n) |
1016 | { |
1017 | _M_current -= __n; |
1018 | return *this; |
1019 | } |
1020 | |
1021 | reference |
1022 | operator[](difference_type __n) const |
1023 | { return std::move(_M_current[__n]); } |
1024 | }; |
1025 | |
1026 | // Note: See __normal_iterator operators note from Gaby to understand |
1027 | // why there are always 2 versions for most of the move_iterator |
1028 | // operators. |
1029 | template<typename _IteratorL, typename _IteratorR> |
1030 | inline bool |
1031 | operator==(const move_iterator<_IteratorL>& __x, |
1032 | const move_iterator<_IteratorR>& __y) |
1033 | { return __x.base() == __y.base(); } |
1034 | |
1035 | template<typename _Iterator> |
1036 | inline bool |
1037 | operator==(const move_iterator<_Iterator>& __x, |
1038 | const move_iterator<_Iterator>& __y) |
1039 | { return __x.base() == __y.base(); } |
1040 | |
1041 | template<typename _IteratorL, typename _IteratorR> |
1042 | inline bool |
1043 | operator!=(const move_iterator<_IteratorL>& __x, |
1044 | const move_iterator<_IteratorR>& __y) |
1045 | { return !(__x == __y); } |
1046 | |
1047 | template<typename _Iterator> |
1048 | inline bool |
1049 | operator!=(const move_iterator<_Iterator>& __x, |
1050 | const move_iterator<_Iterator>& __y) |
1051 | { return !(__x == __y); } |
1052 | |
1053 | template<typename _IteratorL, typename _IteratorR> |
1054 | inline bool |
1055 | operator<(const move_iterator<_IteratorL>& __x, |
1056 | const move_iterator<_IteratorR>& __y) |
1057 | { return __x.base() < __y.base(); } |
1058 | |
1059 | template<typename _Iterator> |
1060 | inline bool |
1061 | operator<(const move_iterator<_Iterator>& __x, |
1062 | const move_iterator<_Iterator>& __y) |
1063 | { return __x.base() < __y.base(); } |
1064 | |
1065 | template<typename _IteratorL, typename _IteratorR> |
1066 | inline bool |
1067 | operator<=(const move_iterator<_IteratorL>& __x, |
1068 | const move_iterator<_IteratorR>& __y) |
1069 | { return !(__y < __x); } |
1070 | |
1071 | template<typename _Iterator> |
1072 | inline bool |
1073 | operator<=(const move_iterator<_Iterator>& __x, |
1074 | const move_iterator<_Iterator>& __y) |
1075 | { return !(__y < __x); } |
1076 | |
1077 | template<typename _IteratorL, typename _IteratorR> |
1078 | inline bool |
1079 | operator>(const move_iterator<_IteratorL>& __x, |
1080 | const move_iterator<_IteratorR>& __y) |
1081 | { return __y < __x; } |
1082 | |
1083 | template<typename _Iterator> |
1084 | inline bool |
1085 | operator>(const move_iterator<_Iterator>& __x, |
1086 | const move_iterator<_Iterator>& __y) |
1087 | { return __y < __x; } |
1088 | |
1089 | template<typename _IteratorL, typename _IteratorR> |
1090 | inline bool |
1091 | operator>=(const move_iterator<_IteratorL>& __x, |
1092 | const move_iterator<_IteratorR>& __y) |
1093 | { return !(__x < __y); } |
1094 | |
1095 | template<typename _Iterator> |
1096 | inline bool |
1097 | operator>=(const move_iterator<_Iterator>& __x, |
1098 | const move_iterator<_Iterator>& __y) |
1099 | { return !(__x < __y); } |
1100 | |
1101 | // DR 685. |
1102 | template<typename _IteratorL, typename _IteratorR> |
1103 | inline auto |
1104 | operator-(const move_iterator<_IteratorL>& __x, |
1105 | const move_iterator<_IteratorR>& __y) |
1106 | -> decltype(__x.base() - __y.base()) |
1107 | { return __x.base() - __y.base(); } |
1108 | |
1109 | template<typename _Iterator> |
1110 | inline auto |
1111 | operator-(const move_iterator<_Iterator>& __x, |
1112 | const move_iterator<_Iterator>& __y) |
1113 | -> decltype(__x.base() - __y.base()) |
1114 | { return __x.base() - __y.base(); } |
1115 | |
1116 | template<typename _Iterator> |
1117 | inline move_iterator<_Iterator> |
1118 | operator+(typename move_iterator<_Iterator>::difference_type __n, |
1119 | const move_iterator<_Iterator>& __x) |
1120 | { return __x + __n; } |
1121 | |
1122 | template<typename _Iterator> |
1123 | inline move_iterator<_Iterator> |
1124 | make_move_iterator(_Iterator __i) |
1125 | { return move_iterator<_Iterator>(__i); } |
1126 | |
1127 | template<typename _Iterator, typename _ReturnType |
1128 | = typename conditional<__move_if_noexcept_cond |
1129 | <typename iterator_traits<_Iterator>::value_type>::value, |
1130 | _Iterator, move_iterator<_Iterator>>::type> |
1131 | inline _ReturnType |
1132 | __make_move_if_noexcept_iterator(_Iterator __i) |
1133 | { return _ReturnType(__i); } |
1134 | |
1135 | // @} group iterators |
1136 | |
1137 | _GLIBCXX_END_NAMESPACE_VERSION |
1138 | } // namespace |
1139 | |
1140 | #define _GLIBCXX_MAKE_MOVE_ITERATOR(_Iter)std::make_move_iterator(_Iter) std::make_move_iterator(_Iter) |
1141 | #define _GLIBCXX_MAKE_MOVE_IF_NOEXCEPT_ITERATOR(_Iter)std::__make_move_if_noexcept_iterator(_Iter) \ |
1142 | std::__make_move_if_noexcept_iterator(_Iter) |
1143 | #else |
1144 | #define _GLIBCXX_MAKE_MOVE_ITERATOR(_Iter)std::make_move_iterator(_Iter) (_Iter) |
1145 | #define _GLIBCXX_MAKE_MOVE_IF_NOEXCEPT_ITERATOR(_Iter)std::__make_move_if_noexcept_iterator(_Iter) (_Iter) |
1146 | #endif // C++11 |
1147 | |
1148 | #endif |